USD816283S1 - Pedestal washing machine - Google Patents
Pedestal washing machine Download PDFInfo
- Publication number
- USD816283S1 USD816283S1 US35/355,014 US35501427F USD816283S US D816283 S1 USD816283 S1 US D816283S1 US 35501427 F US35501427 F US 35501427F US D816283 S USD816283 S US D816283S
- Authority
- US
- United States
- Prior art keywords
- washing machine
- pedestal washing
- pedestal
- view
- elevation view
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000005406 washing Methods 0.000 title claims description 9
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title claims description 7
- 230000007613 environmental effect Effects 0.000 description 1
Images
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR30-2015-0044477 | 2015-09-03 | ||
| KR20150044477 | 2015-09-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD816283S1 true USD816283S1 (en) | 2018-04-24 |
Family
ID=57226610
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US35/355,014 Active USD816283S1 (en) | 2015-09-03 | 2016-02-23 | Pedestal washing machine |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | USD816283S1 (enrdf_load_stackoverflow) |
| JP (1) | JP1584689S (enrdf_load_stackoverflow) |
| AU (1) | AU367798S (enrdf_load_stackoverflow) |
| CA (1) | CA167253S (enrdf_load_stackoverflow) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD857765S1 (en) * | 2017-03-24 | 2019-08-27 | Lg Electronics Inc. | Drawer-type clothes dryer |
| USD917811S1 (en) * | 2018-02-22 | 2021-04-27 | Samsung Electronics Co., Ltd. | Water pail for drying machine |
| USD933314S1 (en) * | 2019-01-21 | 2021-10-12 | Samsung Electronics Co., Ltd. | Dishwasher |
| USD933909S1 (en) * | 2019-01-21 | 2021-10-19 | Samsung Electronics Co., Ltd. | Dishwasher |
| USD992035S1 (en) * | 2021-08-03 | 2023-07-11 | Eddie Hayes | Game box extension |
| USD996751S1 (en) * | 2021-03-08 | 2023-08-22 | Lg Electronics Inc. | Electric washing machine |
Citations (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD474566S1 (en) * | 2001-06-20 | 2003-05-13 | Whirlpool Corporation | Front panel of a laundry pedestal |
| USD483206S1 (en) * | 2003-01-13 | 2003-12-09 | Kimball International Inc. | Drawer front |
| USD504259S1 (en) * | 2004-02-23 | 2005-04-26 | Rubbermaid Commercial Products Llc | Drawer face |
| USD521702S1 (en) * | 2004-11-10 | 2006-05-23 | Lg Electronics Inc. | Cabinet for drum type washing machine |
| US20070151120A1 (en) * | 2005-12-30 | 2007-07-05 | Tomasi Donald M | Non-tumble clothes dryer |
| USD549408S1 (en) * | 2006-06-28 | 2007-08-21 | Samsung Electronics Co., Ltd. | Cabinet for drum washer |
| USD587048S1 (en) * | 2008-03-31 | 2009-02-24 | Waterloo Industries, Inc. | Tool cabinet |
| USD589718S1 (en) * | 2006-12-13 | 2009-04-07 | Waterloo Industries, Inc. | Tool chest and cabinet |
| US20090145175A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145174A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145177A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| USD606267S1 (en) * | 2009-05-20 | 2009-12-15 | Lg Electronics Inc. | Washing machine |
| USD613972S1 (en) * | 2006-12-13 | 2010-04-20 | Waterloo Industries, Inc. | Tool cabinet |
| USD617965S1 (en) * | 2007-05-04 | 2010-06-15 | Bsh Home Appliances Corporation | Laundry appliance pedestal |
| USD620211S1 (en) * | 2009-11-06 | 2010-07-20 | Whirlpool Corporation | Appliance pedestal |
| USD629168S1 (en) * | 2008-12-03 | 2010-12-14 | Lg Electronics Inc. | Drawer for washing machine |
| US7921679B2 (en) * | 2007-09-03 | 2011-04-12 | Lg Electronics Inc. | Washing/drying machine |
| USD645623S1 (en) * | 2009-07-30 | 2011-09-20 | Bsh Home Appliances Corporation | Laundry appliance |
| US8215136B2 (en) * | 2007-06-13 | 2012-07-10 | Lg Electronics Inc. | Laundry machine having multiple laundry treatment devices |
| USD665544S1 (en) * | 2011-07-28 | 2012-08-14 | Lg Electronics Inc. | Drawer-shaped washing machine |
| USD667179S1 (en) * | 2011-07-28 | 2012-09-11 | Lg Electronics Inc. | Drawer-shaped washing machine |
| US8341981B2 (en) * | 2007-11-21 | 2013-01-01 | Lg Electronics Inc. | Washing machine |
| US8561438B2 (en) * | 2006-12-08 | 2013-10-22 | Lg Electronics Inc. | Complex washing machine and controlling method for the same |
| USD701657S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD701658S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD704909S1 (en) * | 2011-08-03 | 2014-05-13 | Lg Electronics Inc. | Storage drawer for washing machines |
| USD728870S1 (en) * | 2012-04-11 | 2015-05-05 | Electrolux Home Products Corporation N.V. | Dishwasher panel |
| USD732777S1 (en) * | 2013-05-09 | 2015-06-23 | Lg Electronics Inc. | Detergent box for washing machine |
| USD759911S1 (en) * | 2014-12-09 | 2016-06-21 | Lg Electronics Inc. | Washing machine |
| US9447841B2 (en) * | 2014-07-08 | 2016-09-20 | Samsung Electronics Co., Ltd. | Pedestal and laundry processing apparatus having the same |
| USD767837S1 (en) * | 2015-03-04 | 2016-09-27 | Lg Electronics Inc. | Washing machine |
| USD784637S1 (en) * | 2015-08-28 | 2017-04-18 | Samsung Electronics Co., Ltd. | Drawer of washing machine |
| USD792035S1 (en) * | 2014-12-09 | 2017-07-11 | Lg Electronics Inc. | Washing machine |
-
2016
- 2016-02-23 US US35/355,014 patent/USD816283S1/en active Active
- 2016-03-01 CA CA167253F patent/CA167253S/en active Active
- 2016-03-02 AU AU201611136F patent/AU367798S/en active Active
- 2016-03-03 JP JPD2016-4724F patent/JP1584689S/ja active Active
Patent Citations (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD474566S1 (en) * | 2001-06-20 | 2003-05-13 | Whirlpool Corporation | Front panel of a laundry pedestal |
| USD483206S1 (en) * | 2003-01-13 | 2003-12-09 | Kimball International Inc. | Drawer front |
| USD504259S1 (en) * | 2004-02-23 | 2005-04-26 | Rubbermaid Commercial Products Llc | Drawer face |
| USD521702S1 (en) * | 2004-11-10 | 2006-05-23 | Lg Electronics Inc. | Cabinet for drum type washing machine |
| US20070151120A1 (en) * | 2005-12-30 | 2007-07-05 | Tomasi Donald M | Non-tumble clothes dryer |
| USD549408S1 (en) * | 2006-06-28 | 2007-08-21 | Samsung Electronics Co., Ltd. | Cabinet for drum washer |
| US8561438B2 (en) * | 2006-12-08 | 2013-10-22 | Lg Electronics Inc. | Complex washing machine and controlling method for the same |
| USD589718S1 (en) * | 2006-12-13 | 2009-04-07 | Waterloo Industries, Inc. | Tool chest and cabinet |
| USD613972S1 (en) * | 2006-12-13 | 2010-04-20 | Waterloo Industries, Inc. | Tool cabinet |
| USD617965S1 (en) * | 2007-05-04 | 2010-06-15 | Bsh Home Appliances Corporation | Laundry appliance pedestal |
| USD633670S1 (en) * | 2007-05-04 | 2011-03-01 | Bsh Home Appliances Corporation | Laundry appliance pedestal |
| US8215136B2 (en) * | 2007-06-13 | 2012-07-10 | Lg Electronics Inc. | Laundry machine having multiple laundry treatment devices |
| US7921679B2 (en) * | 2007-09-03 | 2011-04-12 | Lg Electronics Inc. | Washing/drying machine |
| US20090145175A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145177A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145174A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US8341981B2 (en) * | 2007-11-21 | 2013-01-01 | Lg Electronics Inc. | Washing machine |
| USD587048S1 (en) * | 2008-03-31 | 2009-02-24 | Waterloo Industries, Inc. | Tool cabinet |
| USD629168S1 (en) * | 2008-12-03 | 2010-12-14 | Lg Electronics Inc. | Drawer for washing machine |
| USD606267S1 (en) * | 2009-05-20 | 2009-12-15 | Lg Electronics Inc. | Washing machine |
| USD645623S1 (en) * | 2009-07-30 | 2011-09-20 | Bsh Home Appliances Corporation | Laundry appliance |
| USD620211S1 (en) * | 2009-11-06 | 2010-07-20 | Whirlpool Corporation | Appliance pedestal |
| USD665544S1 (en) * | 2011-07-28 | 2012-08-14 | Lg Electronics Inc. | Drawer-shaped washing machine |
| USD667179S1 (en) * | 2011-07-28 | 2012-09-11 | Lg Electronics Inc. | Drawer-shaped washing machine |
| USD704909S1 (en) * | 2011-08-03 | 2014-05-13 | Lg Electronics Inc. | Storage drawer for washing machines |
| USD728870S1 (en) * | 2012-04-11 | 2015-05-05 | Electrolux Home Products Corporation N.V. | Dishwasher panel |
| USD701657S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD701658S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD732777S1 (en) * | 2013-05-09 | 2015-06-23 | Lg Electronics Inc. | Detergent box for washing machine |
| US9447841B2 (en) * | 2014-07-08 | 2016-09-20 | Samsung Electronics Co., Ltd. | Pedestal and laundry processing apparatus having the same |
| USD759911S1 (en) * | 2014-12-09 | 2016-06-21 | Lg Electronics Inc. | Washing machine |
| USD792035S1 (en) * | 2014-12-09 | 2017-07-11 | Lg Electronics Inc. | Washing machine |
| USD794265S1 (en) * | 2014-12-09 | 2017-08-08 | Lg Electronics Inc. | Washing machine |
| USD767837S1 (en) * | 2015-03-04 | 2016-09-27 | Lg Electronics Inc. | Washing machine |
| USD784637S1 (en) * | 2015-08-28 | 2017-04-18 | Samsung Electronics Co., Ltd. | Drawer of washing machine |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD857765S1 (en) * | 2017-03-24 | 2019-08-27 | Lg Electronics Inc. | Drawer-type clothes dryer |
| USD917811S1 (en) * | 2018-02-22 | 2021-04-27 | Samsung Electronics Co., Ltd. | Water pail for drying machine |
| USD933314S1 (en) * | 2019-01-21 | 2021-10-12 | Samsung Electronics Co., Ltd. | Dishwasher |
| USD933909S1 (en) * | 2019-01-21 | 2021-10-19 | Samsung Electronics Co., Ltd. | Dishwasher |
| USD996751S1 (en) * | 2021-03-08 | 2023-08-22 | Lg Electronics Inc. | Electric washing machine |
| USD992035S1 (en) * | 2021-08-03 | 2023-07-11 | Eddie Hayes | Game box extension |
Also Published As
| Publication number | Publication date |
|---|---|
| JP1584689S (enrdf_load_stackoverflow) | 2017-08-28 |
| CA167253S (en) | 2016-10-31 |
| AU367798S (en) | 2016-03-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD811028S1 (en) | Pedestal washing machine | |
| USD794265S1 (en) | Washing machine | |
| USD760454S1 (en) | Washing machine | |
| USD770707S1 (en) | Washing machine | |
| USD819281S1 (en) | Washing machine | |
| USD761618S1 (en) | Lid | |
| USD771330S1 (en) | Washing machine | |
| USD767835S1 (en) | Door for washing machine | |
| USD729994S1 (en) | Washing machine | |
| USD770103S1 (en) | Washing machine | |
| USD808093S1 (en) | Washing machine | |
| USD808094S1 (en) | Washing machine | |
| USD854765S1 (en) | Door for drum washing machine | |
| USD816283S1 (en) | Pedestal washing machine | |
| USD796130S1 (en) | Door for washing machine | |
| USD843670S1 (en) | Washing machine | |
| USD827226S1 (en) | Washing machine | |
| USD809221S1 (en) | Washing machine | |
| USD764123S1 (en) | Washing machine | |
| USD788385S1 (en) | Washing machine | |
| USD831917S1 (en) | Door for washing machine | |
| USD827958S1 (en) | Door for washing machine | |
| USD831916S1 (en) | Door for washing machine | |
| USD831913S1 (en) | Door for washing machine | |
| USD831912S1 (en) | Door for washing machine |