USD816283S1 - Pedestal washing machine - Google Patents
Pedestal washing machine Download PDFInfo
- Publication number
- USD816283S1 USD816283S1 US35/355,014 US35501427F USD816283S US D816283 S1 USD816283 S1 US D816283S1 US 35501427 F US35501427 F US 35501427F US D816283 S USD816283 S US D816283S
- Authority
- US
- United States
- Prior art keywords
- washing machine
- pedestal washing
- pedestal
- view
- elevation view
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000005406 washing Methods 0.000 title claims description 9
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title claims description 7
- 230000007613 environmental effect Effects 0.000 description 1
Images
Description
1. Pedestal washing machine
The broken lines shown in 1.8 and 1.11 are included for the purpose of illustrating unclaimed portions of the pedestal washing machine and form no part of the claimed design.
The broken lines showing a second washing machine appliance in 1.12 are provided for the purpose of illustrating environmental structure and form no part of the claimed design.
The broken lines shown in 1.8 and 1.11 illustrate portions of the pedestal washing machine that form no part of the claimed design.
Claims (1)
- The ornamental design for a pedestal washing machine, as shown and described.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR30-2015-0044477 | 2015-09-03 | ||
| KR20150044477 | 2015-09-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD816283S1 true USD816283S1 (en) | 2018-04-24 |
Family
ID=57226610
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US35/355,014 Active USD816283S1 (en) | 2015-09-03 | 2016-02-23 | Pedestal washing machine |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | USD816283S1 (en) |
| JP (1) | JP1584689S (en) |
| AU (1) | AU367798S (en) |
| CA (1) | CA167253S (en) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD857765S1 (en) * | 2017-03-24 | 2019-08-27 | Lg Electronics Inc. | Drawer-type clothes dryer |
| USD917811S1 (en) * | 2018-02-22 | 2021-04-27 | Samsung Electronics Co., Ltd. | Water pail for drying machine |
| USD933314S1 (en) * | 2019-01-21 | 2021-10-12 | Samsung Electronics Co., Ltd. | Dishwasher |
| USD933909S1 (en) * | 2019-01-21 | 2021-10-19 | Samsung Electronics Co., Ltd. | Dishwasher |
| USD992035S1 (en) * | 2021-08-03 | 2023-07-11 | Eddie Hayes | Game box extension |
| USD996751S1 (en) * | 2021-03-08 | 2023-08-22 | Lg Electronics Inc. | Electric washing machine |
Citations (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD474566S1 (en) * | 2001-06-20 | 2003-05-13 | Whirlpool Corporation | Front panel of a laundry pedestal |
| USD483206S1 (en) * | 2003-01-13 | 2003-12-09 | Kimball International Inc. | Drawer front |
| USD504259S1 (en) * | 2004-02-23 | 2005-04-26 | Rubbermaid Commercial Products Llc | Drawer face |
| USD521702S1 (en) * | 2004-11-10 | 2006-05-23 | Lg Electronics Inc. | Cabinet for drum type washing machine |
| US20070151120A1 (en) * | 2005-12-30 | 2007-07-05 | Tomasi Donald M | Non-tumble clothes dryer |
| USD549408S1 (en) * | 2006-06-28 | 2007-08-21 | Samsung Electronics Co., Ltd. | Cabinet for drum washer |
| USD587048S1 (en) * | 2008-03-31 | 2009-02-24 | Waterloo Industries, Inc. | Tool cabinet |
| USD589718S1 (en) * | 2006-12-13 | 2009-04-07 | Waterloo Industries, Inc. | Tool chest and cabinet |
| US20090145177A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145174A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145175A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| USD606267S1 (en) * | 2009-05-20 | 2009-12-15 | Lg Electronics Inc. | Washing machine |
| USD613972S1 (en) * | 2006-12-13 | 2010-04-20 | Waterloo Industries, Inc. | Tool cabinet |
| USD617965S1 (en) * | 2007-05-04 | 2010-06-15 | Bsh Home Appliances Corporation | Laundry appliance pedestal |
| USD620211S1 (en) * | 2009-11-06 | 2010-07-20 | Whirlpool Corporation | Appliance pedestal |
| USD629168S1 (en) * | 2008-12-03 | 2010-12-14 | Lg Electronics Inc. | Drawer for washing machine |
| US7921679B2 (en) * | 2007-09-03 | 2011-04-12 | Lg Electronics Inc. | Washing/drying machine |
| USD645623S1 (en) * | 2009-07-30 | 2011-09-20 | Bsh Home Appliances Corporation | Laundry appliance |
| US8215136B2 (en) * | 2007-06-13 | 2012-07-10 | Lg Electronics Inc. | Laundry machine having multiple laundry treatment devices |
| USD665544S1 (en) * | 2011-07-28 | 2012-08-14 | Lg Electronics Inc. | Drawer-shaped washing machine |
| USD667179S1 (en) * | 2011-07-28 | 2012-09-11 | Lg Electronics Inc. | Drawer-shaped washing machine |
| US8341981B2 (en) * | 2007-11-21 | 2013-01-01 | Lg Electronics Inc. | Washing machine |
| US8561438B2 (en) * | 2006-12-08 | 2013-10-22 | Lg Electronics Inc. | Complex washing machine and controlling method for the same |
| USD701657S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD701658S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD704909S1 (en) * | 2011-08-03 | 2014-05-13 | Lg Electronics Inc. | Storage drawer for washing machines |
| USD728870S1 (en) * | 2012-04-11 | 2015-05-05 | Electrolux Home Products Corporation N.V. | Dishwasher panel |
| USD732777S1 (en) * | 2013-05-09 | 2015-06-23 | Lg Electronics Inc. | Detergent box for washing machine |
| USD759911S1 (en) * | 2014-12-09 | 2016-06-21 | Lg Electronics Inc. | Washing machine |
| US9447841B2 (en) * | 2014-07-08 | 2016-09-20 | Samsung Electronics Co., Ltd. | Pedestal and laundry processing apparatus having the same |
| USD767837S1 (en) * | 2015-03-04 | 2016-09-27 | Lg Electronics Inc. | Washing machine |
| USD784637S1 (en) * | 2015-08-28 | 2017-04-18 | Samsung Electronics Co., Ltd. | Drawer of washing machine |
| USD792035S1 (en) * | 2014-12-09 | 2017-07-11 | Lg Electronics Inc. | Washing machine |
-
2016
- 2016-02-23 US US35/355,014 patent/USD816283S1/en active Active
- 2016-03-01 CA CA167253F patent/CA167253S/en active Active
- 2016-03-02 AU AU201611136F patent/AU367798S/en not_active Expired - Lifetime
- 2016-03-03 JP JPD2016-4724F patent/JP1584689S/ja active Active
Patent Citations (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD474566S1 (en) * | 2001-06-20 | 2003-05-13 | Whirlpool Corporation | Front panel of a laundry pedestal |
| USD483206S1 (en) * | 2003-01-13 | 2003-12-09 | Kimball International Inc. | Drawer front |
| USD504259S1 (en) * | 2004-02-23 | 2005-04-26 | Rubbermaid Commercial Products Llc | Drawer face |
| USD521702S1 (en) * | 2004-11-10 | 2006-05-23 | Lg Electronics Inc. | Cabinet for drum type washing machine |
| US20070151120A1 (en) * | 2005-12-30 | 2007-07-05 | Tomasi Donald M | Non-tumble clothes dryer |
| USD549408S1 (en) * | 2006-06-28 | 2007-08-21 | Samsung Electronics Co., Ltd. | Cabinet for drum washer |
| US8561438B2 (en) * | 2006-12-08 | 2013-10-22 | Lg Electronics Inc. | Complex washing machine and controlling method for the same |
| USD589718S1 (en) * | 2006-12-13 | 2009-04-07 | Waterloo Industries, Inc. | Tool chest and cabinet |
| USD613972S1 (en) * | 2006-12-13 | 2010-04-20 | Waterloo Industries, Inc. | Tool cabinet |
| USD617965S1 (en) * | 2007-05-04 | 2010-06-15 | Bsh Home Appliances Corporation | Laundry appliance pedestal |
| USD633670S1 (en) * | 2007-05-04 | 2011-03-01 | Bsh Home Appliances Corporation | Laundry appliance pedestal |
| US8215136B2 (en) * | 2007-06-13 | 2012-07-10 | Lg Electronics Inc. | Laundry machine having multiple laundry treatment devices |
| US7921679B2 (en) * | 2007-09-03 | 2011-04-12 | Lg Electronics Inc. | Washing/drying machine |
| US20090145177A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145175A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145174A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US8341981B2 (en) * | 2007-11-21 | 2013-01-01 | Lg Electronics Inc. | Washing machine |
| USD587048S1 (en) * | 2008-03-31 | 2009-02-24 | Waterloo Industries, Inc. | Tool cabinet |
| USD629168S1 (en) * | 2008-12-03 | 2010-12-14 | Lg Electronics Inc. | Drawer for washing machine |
| USD606267S1 (en) * | 2009-05-20 | 2009-12-15 | Lg Electronics Inc. | Washing machine |
| USD645623S1 (en) * | 2009-07-30 | 2011-09-20 | Bsh Home Appliances Corporation | Laundry appliance |
| USD620211S1 (en) * | 2009-11-06 | 2010-07-20 | Whirlpool Corporation | Appliance pedestal |
| USD665544S1 (en) * | 2011-07-28 | 2012-08-14 | Lg Electronics Inc. | Drawer-shaped washing machine |
| USD667179S1 (en) * | 2011-07-28 | 2012-09-11 | Lg Electronics Inc. | Drawer-shaped washing machine |
| USD704909S1 (en) * | 2011-08-03 | 2014-05-13 | Lg Electronics Inc. | Storage drawer for washing machines |
| USD728870S1 (en) * | 2012-04-11 | 2015-05-05 | Electrolux Home Products Corporation N.V. | Dishwasher panel |
| USD701657S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD701658S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD732777S1 (en) * | 2013-05-09 | 2015-06-23 | Lg Electronics Inc. | Detergent box for washing machine |
| US9447841B2 (en) * | 2014-07-08 | 2016-09-20 | Samsung Electronics Co., Ltd. | Pedestal and laundry processing apparatus having the same |
| USD759911S1 (en) * | 2014-12-09 | 2016-06-21 | Lg Electronics Inc. | Washing machine |
| USD792035S1 (en) * | 2014-12-09 | 2017-07-11 | Lg Electronics Inc. | Washing machine |
| USD794265S1 (en) * | 2014-12-09 | 2017-08-08 | Lg Electronics Inc. | Washing machine |
| USD767837S1 (en) * | 2015-03-04 | 2016-09-27 | Lg Electronics Inc. | Washing machine |
| USD784637S1 (en) * | 2015-08-28 | 2017-04-18 | Samsung Electronics Co., Ltd. | Drawer of washing machine |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD857765S1 (en) * | 2017-03-24 | 2019-08-27 | Lg Electronics Inc. | Drawer-type clothes dryer |
| USD917811S1 (en) * | 2018-02-22 | 2021-04-27 | Samsung Electronics Co., Ltd. | Water pail for drying machine |
| USD933314S1 (en) * | 2019-01-21 | 2021-10-12 | Samsung Electronics Co., Ltd. | Dishwasher |
| USD933909S1 (en) * | 2019-01-21 | 2021-10-19 | Samsung Electronics Co., Ltd. | Dishwasher |
| USD996751S1 (en) * | 2021-03-08 | 2023-08-22 | Lg Electronics Inc. | Electric washing machine |
| USD992035S1 (en) * | 2021-08-03 | 2023-07-11 | Eddie Hayes | Game box extension |
Also Published As
| Publication number | Publication date |
|---|---|
| AU367798S (en) | 2016-03-18 |
| CA167253S (en) | 2016-10-31 |
| JP1584689S (en) | 2017-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD811028S1 (en) | Pedestal washing machine | |
| USD794265S1 (en) | Washing machine | |
| USD760454S1 (en) | Washing machine | |
| USD770707S1 (en) | Washing machine | |
| USD824123S1 (en) | Washing machine | |
| USD761618S1 (en) | Lid | |
| USD729994S1 (en) | Washing machine | |
| USD771330S1 (en) | Washing machine | |
| USD767835S1 (en) | Door for washing machine | |
| USD770103S1 (en) | Washing machine | |
| USD808093S1 (en) | Washing machine | |
| USD808094S1 (en) | Washing machine | |
| USD854765S1 (en) | Door for drum washing machine | |
| USD816283S1 (en) | Pedestal washing machine | |
| USD796130S1 (en) | Door for washing machine | |
| USD843670S1 (en) | Washing machine | |
| USD827226S1 (en) | Washing machine | |
| USD764123S1 (en) | Washing machine | |
| USD788385S1 (en) | Washing machine | |
| USD809221S1 (en) | Washing machine | |
| USD831917S1 (en) | Door for washing machine | |
| USD827958S1 (en) | Door for washing machine | |
| USD831912S1 (en) | Door for washing machine | |
| USD831913S1 (en) | Door for washing machine | |
| USD831916S1 (en) | Door for washing machine |