USD816229S1 - Transmitter unit for a glucose monitoring skin patch - Google Patents
Transmitter unit for a glucose monitoring skin patch Download PDFInfo
- Publication number
- USD816229S1 USD816229S1 US29/615,071 US201729615071F USD816229S US D816229 S1 USD816229 S1 US D816229S1 US 201729615071 F US201729615071 F US 201729615071F US D816229 S USD816229 S US D816229S
- Authority
- US
- United States
- Prior art keywords
- transmitter unit
- glucose monitoring
- skin patch
- monitoring skin
- view
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 title claims description 3
- 239000007933 dermal patch Substances 0.000 title claims description 3
- 239000008103 glucose Substances 0.000 title claims description 3
- 238000012544 monitoring process Methods 0.000 title claims description 3
Images
Description
The broken lines immediately adjacent the shaded areas represent the bounds of the claim, while all other broken lines are directed to environment; the broken lines form no part of the claimed design.
Claims (1)
- We claim the ornamental design for a transmitter unit for a glucose monitoring skin patch, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/615,071 USD816229S1 (en) | 2017-08-25 | 2017-08-25 | Transmitter unit for a glucose monitoring skin patch |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/615,071 USD816229S1 (en) | 2017-08-25 | 2017-08-25 | Transmitter unit for a glucose monitoring skin patch |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD816229S1 true USD816229S1 (en) | 2018-04-24 |
Family
ID=61952258
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/615,071 Active USD816229S1 (en) | 2017-08-25 | 2017-08-25 | Transmitter unit for a glucose monitoring skin patch |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD816229S1 (en) |
Cited By (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD875254S1 (en) * | 2018-06-08 | 2020-02-11 | Biolinq, Inc. | Intradermal biosensor |
| USD902408S1 (en) * | 2003-11-05 | 2020-11-17 | Abbott Diabetes Care Inc. | Analyte sensor control unit |
| US10973443B2 (en) | 2002-11-05 | 2021-04-13 | Abbott Diabetes Care Inc. | Sensor inserter assembly |
| USD926325S1 (en) * | 2018-06-22 | 2021-07-27 | Dexcom, Inc. | Wearable medical monitoring device |
| US11134896B2 (en) | 2017-06-23 | 2021-10-05 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| USD939699S1 (en) * | 2019-11-29 | 2021-12-28 | Quanta Computer Inc. | Wireless stethoscope |
| USD944979S1 (en) * | 2020-08-19 | 2022-03-01 | Winston T. Richards | Electronic stethoscope |
| US11331022B2 (en) | 2017-10-24 | 2022-05-17 | Dexcom, Inc. | Pre-connected analyte sensors |
| US11350862B2 (en) | 2017-10-24 | 2022-06-07 | Dexcom, Inc. | Pre-connected analyte sensors |
| USD961770S1 (en) * | 2020-07-22 | 2022-08-23 | Chukwuemeka Anderson Obi | Stethoscope |
| USD980621S1 (en) * | 2021-09-08 | 2023-03-14 | Wan Rong Ronald He | Armband |
| USD985776S1 (en) * | 2021-07-26 | 2023-05-09 | SiriuXense Co., Ltd. | Fetal monitoring device |
| USD988160S1 (en) | 2021-03-16 | 2023-06-06 | Biolinq Incorporated | Wearable dermal sensor |
| USD996999S1 (en) | 2021-11-16 | 2023-08-29 | Biolinq Incorporated | Wearable sensor |
| USD1012744S1 (en) | 2022-05-16 | 2024-01-30 | Biolinq Incorporated | Wearable sensor with illuminated display |
| USD1013544S1 (en) | 2022-04-29 | 2024-02-06 | Biolinq Incorporated | Wearable sensor |
| USD1035004S1 (en) | 2023-02-28 | 2024-07-09 | Biolinq Incorporated | Wearable sensor |
| USD1039158S1 (en) | 2015-07-09 | 2024-08-13 | Dexcom, Inc. | Base for medical device electronic module |
| USD1039159S1 (en) | 2015-07-09 | 2024-08-13 | Dexcom, Inc. | Medical device electronic module |
| USD1057956S1 (en) | 2015-07-09 | 2025-01-14 | Dexcom, Inc. | Medical device inserter |
| USD1068516S1 (en) | 2023-02-28 | 2025-04-01 | Biolinq Incorporated | Wearable sensor |
| USD1083977S1 (en) | 2023-02-28 | 2025-07-15 | Biolinq Incorporated | Display with graphical user interface for a wearable sensor |
| USD1083640S1 (en) | 2023-05-16 | 2025-07-15 | Biolinq Incorporated | Wearable sensor |
Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20130267811A1 (en) * | 2012-04-04 | 2013-10-10 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US20140276576A1 (en) * | 2013-03-15 | 2014-09-18 | Becton, Dickinson And Company | Automatic Angled Infusion Set Assembly |
| US20150209508A1 (en) * | 2011-02-09 | 2015-07-30 | Becton, Dickinson And Company | Self-contained spring inserter for drug delivery infusion set |
| US20160058380A1 (en) * | 2014-08-26 | 2016-03-03 | Dexcom, Inc. | Systems and methods for securing a continuous analyte sensor to a host |
| US20160157759A1 (en) * | 2014-03-07 | 2016-06-09 | Medtrum Technologies Inc. | Analyte sensing system |
| US20160287150A1 (en) * | 2014-10-27 | 2016-10-06 | Shenzhen Waveguider Optical Telecom Technology Inc. | Dynamic blood glucose data acquiring device and host |
| US9610031B2 (en) * | 2004-07-13 | 2017-04-04 | Dexcom, Inc. | Transcutaneous analyte sensor |
| US20170112534A1 (en) * | 2015-10-21 | 2017-04-27 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US20170188912A1 (en) * | 2015-12-30 | 2017-07-06 | Dexcom, Inc. | Transcutaneous analyte sensor systems and methods |
| USD794201S1 (en) * | 2015-07-09 | 2017-08-08 | Dexcom, Inc. | Medical device electronic module |
-
2017
- 2017-08-25 US US29/615,071 patent/USD816229S1/en active Active
Patent Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9610031B2 (en) * | 2004-07-13 | 2017-04-04 | Dexcom, Inc. | Transcutaneous analyte sensor |
| US20150209508A1 (en) * | 2011-02-09 | 2015-07-30 | Becton, Dickinson And Company | Self-contained spring inserter for drug delivery infusion set |
| US20130267811A1 (en) * | 2012-04-04 | 2013-10-10 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US20140276576A1 (en) * | 2013-03-15 | 2014-09-18 | Becton, Dickinson And Company | Automatic Angled Infusion Set Assembly |
| US20160157759A1 (en) * | 2014-03-07 | 2016-06-09 | Medtrum Technologies Inc. | Analyte sensing system |
| US20160058380A1 (en) * | 2014-08-26 | 2016-03-03 | Dexcom, Inc. | Systems and methods for securing a continuous analyte sensor to a host |
| US20160287150A1 (en) * | 2014-10-27 | 2016-10-06 | Shenzhen Waveguider Optical Telecom Technology Inc. | Dynamic blood glucose data acquiring device and host |
| USD794201S1 (en) * | 2015-07-09 | 2017-08-08 | Dexcom, Inc. | Medical device electronic module |
| US20170112534A1 (en) * | 2015-10-21 | 2017-04-27 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US20170188912A1 (en) * | 2015-12-30 | 2017-07-06 | Dexcom, Inc. | Transcutaneous analyte sensor systems and methods |
Non-Patent Citations (1)
| Title |
|---|
| Bergan, Mark et al., "Dexcom Has a Big Ally if Apple Gets Into Its Corner of the Diabetes Market", Bloomberg News, Apr. 19, 2017, Retrieved from the internet: https://www.bloomberg.com/news/articles/2017-04-19/dexcom-has-a-big-ally-if-apple-gets-into-its-corner-of-the-diabetes-market, 5 pages. |
Cited By (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US10973443B2 (en) | 2002-11-05 | 2021-04-13 | Abbott Diabetes Care Inc. | Sensor inserter assembly |
| USD902408S1 (en) * | 2003-11-05 | 2020-11-17 | Abbott Diabetes Care Inc. | Analyte sensor control unit |
| USD914881S1 (en) * | 2003-11-05 | 2021-03-30 | Abbott Diabetes Care Inc. | Analyte sensor electronic mount |
| USD1039158S1 (en) | 2015-07-09 | 2024-08-13 | Dexcom, Inc. | Base for medical device electronic module |
| USD1057956S1 (en) | 2015-07-09 | 2025-01-14 | Dexcom, Inc. | Medical device inserter |
| USD1039159S1 (en) | 2015-07-09 | 2024-08-13 | Dexcom, Inc. | Medical device electronic module |
| US11510625B2 (en) | 2017-06-23 | 2022-11-29 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US11395631B2 (en) | 2017-06-23 | 2022-07-26 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US12502132B2 (en) | 2017-06-23 | 2025-12-23 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US11311241B2 (en) | 2017-06-23 | 2022-04-26 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US11311240B2 (en) | 2017-06-23 | 2022-04-26 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US11207026B2 (en) | 2017-06-23 | 2021-12-28 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US11134896B2 (en) | 2017-06-23 | 2021-10-05 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US11504063B2 (en) | 2017-06-23 | 2022-11-22 | Dexcom, Inc. | Transcutaneous analyte sensors, applicators therefor, and associated methods |
| US12150250B2 (en) | 2017-10-24 | 2024-11-19 | Dexcom, Inc. | Pre-connected analyte sensors |
| US11382540B2 (en) | 2017-10-24 | 2022-07-12 | Dexcom, Inc. | Pre-connected analyte sensors |
| US11943876B2 (en) | 2017-10-24 | 2024-03-26 | Dexcom, Inc. | Pre-connected analyte sensors |
| US11350862B2 (en) | 2017-10-24 | 2022-06-07 | Dexcom, Inc. | Pre-connected analyte sensors |
| US11331022B2 (en) | 2017-10-24 | 2022-05-17 | Dexcom, Inc. | Pre-connected analyte sensors |
| US11706876B2 (en) | 2017-10-24 | 2023-07-18 | Dexcom, Inc. | Pre-connected analyte sensors |
| USD875254S1 (en) * | 2018-06-08 | 2020-02-11 | Biolinq, Inc. | Intradermal biosensor |
| USD926325S1 (en) * | 2018-06-22 | 2021-07-27 | Dexcom, Inc. | Wearable medical monitoring device |
| USD1036676S1 (en) | 2018-06-22 | 2024-07-23 | Dexcom, Inc. | Wearable medical monitoring device |
| USD939699S1 (en) * | 2019-11-29 | 2021-12-28 | Quanta Computer Inc. | Wireless stethoscope |
| USD961770S1 (en) * | 2020-07-22 | 2022-08-23 | Chukwuemeka Anderson Obi | Stethoscope |
| USD944979S1 (en) * | 2020-08-19 | 2022-03-01 | Winston T. Richards | Electronic stethoscope |
| USD962429S1 (en) * | 2020-08-19 | 2022-08-30 | Winston T. Richards | Electronic stethoscope |
| USD988160S1 (en) | 2021-03-16 | 2023-06-06 | Biolinq Incorporated | Wearable dermal sensor |
| USD985776S1 (en) * | 2021-07-26 | 2023-05-09 | SiriuXense Co., Ltd. | Fetal monitoring device |
| USD980621S1 (en) * | 2021-09-08 | 2023-03-14 | Wan Rong Ronald He | Armband |
| USD996999S1 (en) | 2021-11-16 | 2023-08-29 | Biolinq Incorporated | Wearable sensor |
| USD1013544S1 (en) | 2022-04-29 | 2024-02-06 | Biolinq Incorporated | Wearable sensor |
| USD1051745S1 (en) | 2022-04-29 | 2024-11-19 | Biolinq Incorporated | Wearable sensor |
| USD1038794S1 (en) | 2022-05-16 | 2024-08-13 | Biolinq Incorporated | Wearable sensor with illuminated display |
| USD1012744S1 (en) | 2022-05-16 | 2024-01-30 | Biolinq Incorporated | Wearable sensor with illuminated display |
| USD1035004S1 (en) | 2023-02-28 | 2024-07-09 | Biolinq Incorporated | Wearable sensor |
| USD1068516S1 (en) | 2023-02-28 | 2025-04-01 | Biolinq Incorporated | Wearable sensor |
| USD1083977S1 (en) | 2023-02-28 | 2025-07-15 | Biolinq Incorporated | Display with graphical user interface for a wearable sensor |
| USD1083640S1 (en) | 2023-05-16 | 2025-07-15 | Biolinq Incorporated | Wearable sensor |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD816229S1 (en) | Transmitter unit for a glucose monitoring skin patch | |
| USD842996S1 (en) | Glucose monitoring skin patch | |
| USD912048S1 (en) | Display device | |
| USD851762S1 (en) | Anvil | |
| USD843354S1 (en) | Earphone | |
| USD832859S1 (en) | Display mount | |
| USD832276S1 (en) | Display mount for case | |
| USD850113S1 (en) | Toothbrush | |
| USD827831S1 (en) | Health monitoring wrist wearable | |
| USD848396S1 (en) | Noise monitoring headset | |
| USD752229S1 (en) | Blood pressure unit | |
| USD862891S1 (en) | Skin cleanser | |
| USD815743S1 (en) | Smart blood pressure monitor | |
| USD833029S1 (en) | Gum massager | |
| USD861913S1 (en) | Fluid testing device | |
| USD737110S1 (en) | Knife | |
| USD842300S1 (en) | Display device | |
| USD745167S1 (en) | Telemetry monitor | |
| USD810979S1 (en) | Lantern device | |
| USD700675S1 (en) | Knife | |
| USD759254S1 (en) | Diagnostic device | |
| USD825618S1 (en) | Agricultural baler | |
| USD838190S1 (en) | Sensor module | |
| USD899588S1 (en) | Remote controller for glucose monitoring system | |
| USD857679S1 (en) | Smartphone |