USD815376S1 - Pedestal washing machine - Google Patents
Pedestal washing machine Download PDFInfo
- Publication number
- USD815376S1 USD815376S1 US35/355,014 US35501429F USD815376S US D815376 S1 USD815376 S1 US D815376S1 US 35501429 F US35501429 F US 35501429F US D815376 S USD815376 S US D815376S
- Authority
- US
- United States
- Prior art keywords
- washing machine
- pedestal washing
- pedestal
- view
- elevation view
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000005406 washing Methods 0.000 title claims description 7
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title claims description 6
Images
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR30-2015-0044481 | 2015-09-03 | ||
| KR20150044481 | 2015-09-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD815376S1 true USD815376S1 (en) | 2018-04-10 |
Family
ID=57226612
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US35/355,014 Active USD815376S1 (en) | 2015-09-03 | 2016-02-23 | Pedestal washing machine |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | USD815376S1 (enrdf_load_stackoverflow) |
| JP (1) | JP1584885S (enrdf_load_stackoverflow) |
| AU (1) | AU367803S (enrdf_load_stackoverflow) |
| CA (1) | CA167255S (enrdf_load_stackoverflow) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD917811S1 (en) * | 2018-02-22 | 2021-04-27 | Samsung Electronics Co., Ltd. | Water pail for drying machine |
| USD927806S1 (en) * | 2019-04-30 | 2021-08-10 | Yuanlin Qiu | Laundry machine add-on box for detergent dispensing |
| USD996751S1 (en) * | 2021-03-08 | 2023-08-22 | Lg Electronics Inc. | Electric washing machine |
Citations (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD474566S1 (en) * | 2001-06-20 | 2003-05-13 | Whirlpool Corporation | Front panel of a laundry pedestal |
| USD483206S1 (en) * | 2003-01-13 | 2003-12-09 | Kimball International Inc. | Drawer front |
| USD504259S1 (en) * | 2004-02-23 | 2005-04-26 | Rubbermaid Commercial Products Llc | Drawer face |
| USD521702S1 (en) * | 2004-11-10 | 2006-05-23 | Lg Electronics Inc. | Cabinet for drum type washing machine |
| US20070151120A1 (en) * | 2005-12-30 | 2007-07-05 | Tomasi Donald M | Non-tumble clothes dryer |
| USD549408S1 (en) * | 2006-06-28 | 2007-08-21 | Samsung Electronics Co., Ltd. | Cabinet for drum washer |
| USD587048S1 (en) * | 2008-03-31 | 2009-02-24 | Waterloo Industries, Inc. | Tool cabinet |
| USD589718S1 (en) * | 2006-12-13 | 2009-04-07 | Waterloo Industries, Inc. | Tool chest and cabinet |
| US20090145175A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145174A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145177A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| USD606267S1 (en) * | 2009-05-20 | 2009-12-15 | Lg Electronics Inc. | Washing machine |
| USD613972S1 (en) * | 2006-12-13 | 2010-04-20 | Waterloo Industries, Inc. | Tool cabinet |
| USD617965S1 (en) * | 2007-05-04 | 2010-06-15 | Bsh Home Appliances Corporation | Laundry appliance pedestal |
| USD620211S1 (en) * | 2009-11-06 | 2010-07-20 | Whirlpool Corporation | Appliance pedestal |
| USD629168S1 (en) * | 2008-12-03 | 2010-12-14 | Lg Electronics Inc. | Drawer for washing machine |
| US7921679B2 (en) * | 2007-09-03 | 2011-04-12 | Lg Electronics Inc. | Washing/drying machine |
| USD645623S1 (en) * | 2009-07-30 | 2011-09-20 | Bsh Home Appliances Corporation | Laundry appliance |
| US8215136B2 (en) * | 2007-06-13 | 2012-07-10 | Lg Electronics Inc. | Laundry machine having multiple laundry treatment devices |
| USD665544S1 (en) * | 2011-07-28 | 2012-08-14 | Lg Electronics Inc. | Drawer-shaped washing machine |
| USD667179S1 (en) * | 2011-07-28 | 2012-09-11 | Lg Electronics Inc. | Drawer-shaped washing machine |
| US8341981B2 (en) * | 2007-11-21 | 2013-01-01 | Lg Electronics Inc. | Washing machine |
| US8561438B2 (en) * | 2006-12-08 | 2013-10-22 | Lg Electronics Inc. | Complex washing machine and controlling method for the same |
| USD701657S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD701658S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD704909S1 (en) * | 2011-08-03 | 2014-05-13 | Lg Electronics Inc. | Storage drawer for washing machines |
| USD728870S1 (en) * | 2012-04-11 | 2015-05-05 | Electrolux Home Products Corporation N.V. | Dishwasher panel |
| USD732777S1 (en) * | 2013-05-09 | 2015-06-23 | Lg Electronics Inc. | Detergent box for washing machine |
| USD759911S1 (en) * | 2014-12-09 | 2016-06-21 | Lg Electronics Inc. | Washing machine |
| US9447841B2 (en) * | 2014-07-08 | 2016-09-20 | Samsung Electronics Co., Ltd. | Pedestal and laundry processing apparatus having the same |
| USD767837S1 (en) * | 2015-03-04 | 2016-09-27 | Lg Electronics Inc. | Washing machine |
| USD784637S1 (en) * | 2015-08-28 | 2017-04-18 | Samsung Electronics Co., Ltd. | Drawer of washing machine |
| USD792035S1 (en) * | 2014-12-09 | 2017-07-11 | Lg Electronics Inc. | Washing machine |
-
2016
- 2016-02-23 US US35/355,014 patent/USD815376S1/en active Active
- 2016-03-01 CA CA167255F patent/CA167255S/en active Active
- 2016-03-02 AU AU201611139F patent/AU367803S/en active Active
- 2016-03-03 JP JPD2016-4723F patent/JP1584885S/ja active Active
Patent Citations (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD474566S1 (en) * | 2001-06-20 | 2003-05-13 | Whirlpool Corporation | Front panel of a laundry pedestal |
| USD483206S1 (en) * | 2003-01-13 | 2003-12-09 | Kimball International Inc. | Drawer front |
| USD504259S1 (en) * | 2004-02-23 | 2005-04-26 | Rubbermaid Commercial Products Llc | Drawer face |
| USD521702S1 (en) * | 2004-11-10 | 2006-05-23 | Lg Electronics Inc. | Cabinet for drum type washing machine |
| US20070151120A1 (en) * | 2005-12-30 | 2007-07-05 | Tomasi Donald M | Non-tumble clothes dryer |
| USD549408S1 (en) * | 2006-06-28 | 2007-08-21 | Samsung Electronics Co., Ltd. | Cabinet for drum washer |
| US8561438B2 (en) * | 2006-12-08 | 2013-10-22 | Lg Electronics Inc. | Complex washing machine and controlling method for the same |
| USD589718S1 (en) * | 2006-12-13 | 2009-04-07 | Waterloo Industries, Inc. | Tool chest and cabinet |
| USD613972S1 (en) * | 2006-12-13 | 2010-04-20 | Waterloo Industries, Inc. | Tool cabinet |
| USD617965S1 (en) * | 2007-05-04 | 2010-06-15 | Bsh Home Appliances Corporation | Laundry appliance pedestal |
| USD633670S1 (en) * | 2007-05-04 | 2011-03-01 | Bsh Home Appliances Corporation | Laundry appliance pedestal |
| US8215136B2 (en) * | 2007-06-13 | 2012-07-10 | Lg Electronics Inc. | Laundry machine having multiple laundry treatment devices |
| US7921679B2 (en) * | 2007-09-03 | 2011-04-12 | Lg Electronics Inc. | Washing/drying machine |
| US20090145175A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145177A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US20090145174A1 (en) * | 2007-11-21 | 2009-06-11 | Lg Electronics Inc. | Washing machine |
| US8341981B2 (en) * | 2007-11-21 | 2013-01-01 | Lg Electronics Inc. | Washing machine |
| USD587048S1 (en) * | 2008-03-31 | 2009-02-24 | Waterloo Industries, Inc. | Tool cabinet |
| USD629168S1 (en) * | 2008-12-03 | 2010-12-14 | Lg Electronics Inc. | Drawer for washing machine |
| USD606267S1 (en) * | 2009-05-20 | 2009-12-15 | Lg Electronics Inc. | Washing machine |
| USD645623S1 (en) * | 2009-07-30 | 2011-09-20 | Bsh Home Appliances Corporation | Laundry appliance |
| USD620211S1 (en) * | 2009-11-06 | 2010-07-20 | Whirlpool Corporation | Appliance pedestal |
| USD665544S1 (en) * | 2011-07-28 | 2012-08-14 | Lg Electronics Inc. | Drawer-shaped washing machine |
| USD667179S1 (en) * | 2011-07-28 | 2012-09-11 | Lg Electronics Inc. | Drawer-shaped washing machine |
| USD704909S1 (en) * | 2011-08-03 | 2014-05-13 | Lg Electronics Inc. | Storage drawer for washing machines |
| USD728870S1 (en) * | 2012-04-11 | 2015-05-05 | Electrolux Home Products Corporation N.V. | Dishwasher panel |
| USD701657S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD701658S1 (en) * | 2013-04-04 | 2014-03-25 | Lg Electronics Inc. | Electric washing machine |
| USD732777S1 (en) * | 2013-05-09 | 2015-06-23 | Lg Electronics Inc. | Detergent box for washing machine |
| US9447841B2 (en) * | 2014-07-08 | 2016-09-20 | Samsung Electronics Co., Ltd. | Pedestal and laundry processing apparatus having the same |
| USD759911S1 (en) * | 2014-12-09 | 2016-06-21 | Lg Electronics Inc. | Washing machine |
| USD792035S1 (en) * | 2014-12-09 | 2017-07-11 | Lg Electronics Inc. | Washing machine |
| USD794265S1 (en) * | 2014-12-09 | 2017-08-08 | Lg Electronics Inc. | Washing machine |
| USD767837S1 (en) * | 2015-03-04 | 2016-09-27 | Lg Electronics Inc. | Washing machine |
| USD784637S1 (en) * | 2015-08-28 | 2017-04-18 | Samsung Electronics Co., Ltd. | Drawer of washing machine |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD917811S1 (en) * | 2018-02-22 | 2021-04-27 | Samsung Electronics Co., Ltd. | Water pail for drying machine |
| USD927806S1 (en) * | 2019-04-30 | 2021-08-10 | Yuanlin Qiu | Laundry machine add-on box for detergent dispensing |
| USD996751S1 (en) * | 2021-03-08 | 2023-08-22 | Lg Electronics Inc. | Electric washing machine |
Also Published As
| Publication number | Publication date |
|---|---|
| JP1584885S (enrdf_load_stackoverflow) | 2017-08-28 |
| AU367803S (en) | 2016-03-22 |
| CA167255S (en) | 2016-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD811028S1 (en) | Pedestal washing machine | |
| USD810501S1 (en) | Cookware lid | |
| USD858013S1 (en) | Washing machine | |
| USD794265S1 (en) | Washing machine | |
| USD729998S1 (en) | Washing machine | |
| USD764121S1 (en) | Washing machine | |
| USD773753S1 (en) | Washing machine | |
| USD765455S1 (en) | Coffee machine | |
| USD808093S1 (en) | Washing machine | |
| USD773754S1 (en) | Washing machine | |
| USD808094S1 (en) | Washing machine | |
| USD794266S1 (en) | Washing machine | |
| USD730603S1 (en) | Pulsator for washing machine | |
| USD843670S1 (en) | Washing machine | |
| USD827226S1 (en) | Washing machine | |
| USD772500S1 (en) | Washing machine | |
| USD788389S1 (en) | Detergent container for washing machine | |
| USD773128S1 (en) | Washing machine | |
| USD816283S1 (en) | Pedestal washing machine | |
| USD827958S1 (en) | Door for washing machine | |
| USD831917S1 (en) | Door for washing machine | |
| USD831912S1 (en) | Door for washing machine | |
| USD831914S1 (en) | Door for washing machine | |
| USD831913S1 (en) | Door for washing machine | |
| USD831916S1 (en) | Door for washing machine |