USD810520S1 - Melon slicer set - Google Patents
Melon slicer set Download PDFInfo
- Publication number
- USD810520S1 USD810520S1 US29/562,321 US201629562321F USD810520S US D810520 S1 USD810520 S1 US D810520S1 US 201629562321 F US201629562321 F US 201629562321F US D810520 S USD810520 S US D810520S
- Authority
- US
- United States
- Prior art keywords
- melon
- slicer set
- melon slicer
- view
- slicer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 241000219112 Cucumis Species 0.000 title claims description 8
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 title claims description 8
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 title claims description 8
Images
Description
The broken lines depict portions of the slicer set that form no part of the claim.
Claims (1)
- The ornamental design for a melon slicer set, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/562,321 USD810520S1 (en) | 2016-04-25 | 2016-04-25 | Melon slicer set |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/562,321 USD810520S1 (en) | 2016-04-25 | 2016-04-25 | Melon slicer set |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD810520S1 true USD810520S1 (en) | 2018-02-20 |
Family
ID=61188027
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/562,321 Active USD810520S1 (en) | 2016-04-25 | 2016-04-25 | Melon slicer set |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD810520S1 (en) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD884414S1 (en) * | 2018-06-22 | 2020-05-19 | Prince Castle LLC | Produce pusher |
| USD907958S1 (en) * | 2015-02-17 | 2021-01-19 | Prince Castle LLC | Blade set |
| USD919382S1 (en) * | 2019-02-15 | 2021-05-18 | Hutzler Manufacturing Co., Inc. | Cake layer slicer |
| USD968178S1 (en) * | 2022-02-14 | 2022-11-01 | Longzhao Chen | Sausage cutter |
| USD1040622S1 (en) * | 2024-02-20 | 2024-09-03 | Shenzhen Tuanxin Intelligent Technology Co., Ltd. | Bread slicer |
| USD1102840S1 (en) * | 2024-10-23 | 2025-11-25 | Pingyang Yili Crafts Co., Ltd | Fruit slicer |
Citations (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1764235A (en) | 1928-04-01 | 1930-06-17 | Wilmking Friedrich | Holder for cutting fruit |
| US2018806A (en) | 1931-11-07 | 1935-10-29 | Johnson Automatic Sealer Co Lt | Packaging machine |
| US2108992A (en) | 1936-08-13 | 1938-02-22 | Obenshain Noel | Device for cutting fruit into sectors |
| US2613714A (en) | 1949-07-20 | 1952-10-14 | Paul H Miller | Slicing device for culinary purposes |
| US5499578A (en) * | 1995-02-23 | 1996-03-19 | Payne; Patricia K. | Sausage cutter |
| USD375661S (en) * | 1995-12-08 | 1996-11-19 | Ross Gregory J | Watermelon slicer |
| USD389380S (en) | 1995-09-14 | 1998-01-20 | West Bend Company | Bread slicing rack |
| USD410366S (en) * | 1998-10-26 | 1999-06-01 | Chiasson Ernest T | Pumpkin slicer |
| USD510507S1 (en) * | 2004-04-06 | 2005-10-11 | Good Time Industries Co., Ltd. | Egg slicer |
| US7065880B2 (en) * | 2001-10-31 | 2006-06-27 | Katie Lane Corp. | Hot dog slicer |
| US20070022611A1 (en) * | 2005-07-28 | 2007-02-01 | Stacy Verbiest | Portable slicer for food products |
| USD536224S1 (en) * | 2004-10-14 | 2007-02-06 | Berger Andrew L | Expandable bread slicer/server |
| US7249550B1 (en) * | 2006-04-10 | 2007-07-31 | Thune Jr Daniel | Culinary cutting tool |
| US7340835B2 (en) * | 2001-10-31 | 2008-03-11 | Katie Lane Corp. | Hot dog slicer |
| USD573418S1 (en) * | 2007-07-30 | 2008-07-22 | Robinson Home Products Inc. | Egg slicer |
| US7455005B2 (en) | 2004-06-14 | 2008-11-25 | National Presto Industries, Inc. | Adjustable slicing device |
| USD635409S1 (en) * | 2010-09-01 | 2011-04-05 | Yellow Brick Enterprises, LLC | Hand operated slicer |
| USD642873S1 (en) * | 2011-02-10 | 2011-08-09 | Sylmark Holdings Limited | Knife |
| USD662790S1 (en) * | 2011-01-20 | 2012-07-03 | Christina Rugprayoon | Jellied cranberry slicer |
| US8241688B2 (en) | 2010-03-24 | 2012-08-14 | Aguirre Daniel M | Tripe cutting board and method for making menudo |
| US20120297991A1 (en) * | 2011-05-24 | 2012-11-29 | Holly Hueser | Hot dog and sausage preparer |
| USD756174S1 (en) * | 2011-05-24 | 2016-05-17 | Holly Hueser | Combined bite-sized hot dog and sausage preparer |
| USD779289S1 (en) * | 2015-11-05 | 2017-02-21 | Easyblade Llc | Melon carving knife |
-
2016
- 2016-04-25 US US29/562,321 patent/USD810520S1/en active Active
Patent Citations (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1764235A (en) | 1928-04-01 | 1930-06-17 | Wilmking Friedrich | Holder for cutting fruit |
| US2018806A (en) | 1931-11-07 | 1935-10-29 | Johnson Automatic Sealer Co Lt | Packaging machine |
| US2108992A (en) | 1936-08-13 | 1938-02-22 | Obenshain Noel | Device for cutting fruit into sectors |
| US2613714A (en) | 1949-07-20 | 1952-10-14 | Paul H Miller | Slicing device for culinary purposes |
| US5499578A (en) * | 1995-02-23 | 1996-03-19 | Payne; Patricia K. | Sausage cutter |
| USD389380S (en) | 1995-09-14 | 1998-01-20 | West Bend Company | Bread slicing rack |
| USD375661S (en) * | 1995-12-08 | 1996-11-19 | Ross Gregory J | Watermelon slicer |
| USD410366S (en) * | 1998-10-26 | 1999-06-01 | Chiasson Ernest T | Pumpkin slicer |
| US7340835B2 (en) * | 2001-10-31 | 2008-03-11 | Katie Lane Corp. | Hot dog slicer |
| US7065880B2 (en) * | 2001-10-31 | 2006-06-27 | Katie Lane Corp. | Hot dog slicer |
| USD510507S1 (en) * | 2004-04-06 | 2005-10-11 | Good Time Industries Co., Ltd. | Egg slicer |
| US7455005B2 (en) | 2004-06-14 | 2008-11-25 | National Presto Industries, Inc. | Adjustable slicing device |
| USD536224S1 (en) * | 2004-10-14 | 2007-02-06 | Berger Andrew L | Expandable bread slicer/server |
| US20070022611A1 (en) * | 2005-07-28 | 2007-02-01 | Stacy Verbiest | Portable slicer for food products |
| US7249550B1 (en) * | 2006-04-10 | 2007-07-31 | Thune Jr Daniel | Culinary cutting tool |
| USD573418S1 (en) * | 2007-07-30 | 2008-07-22 | Robinson Home Products Inc. | Egg slicer |
| US8241688B2 (en) | 2010-03-24 | 2012-08-14 | Aguirre Daniel M | Tripe cutting board and method for making menudo |
| USD635409S1 (en) * | 2010-09-01 | 2011-04-05 | Yellow Brick Enterprises, LLC | Hand operated slicer |
| USD662790S1 (en) * | 2011-01-20 | 2012-07-03 | Christina Rugprayoon | Jellied cranberry slicer |
| USD642873S1 (en) * | 2011-02-10 | 2011-08-09 | Sylmark Holdings Limited | Knife |
| US20120297991A1 (en) * | 2011-05-24 | 2012-11-29 | Holly Hueser | Hot dog and sausage preparer |
| USD756174S1 (en) * | 2011-05-24 | 2016-05-17 | Holly Hueser | Combined bite-sized hot dog and sausage preparer |
| USD779289S1 (en) * | 2015-11-05 | 2017-02-21 | Easyblade Llc | Melon carving knife |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD907958S1 (en) * | 2015-02-17 | 2021-01-19 | Prince Castle LLC | Blade set |
| USD884414S1 (en) * | 2018-06-22 | 2020-05-19 | Prince Castle LLC | Produce pusher |
| USD919382S1 (en) * | 2019-02-15 | 2021-05-18 | Hutzler Manufacturing Co., Inc. | Cake layer slicer |
| USD968178S1 (en) * | 2022-02-14 | 2022-11-01 | Longzhao Chen | Sausage cutter |
| USD1040622S1 (en) * | 2024-02-20 | 2024-09-03 | Shenzhen Tuanxin Intelligent Technology Co., Ltd. | Bread slicer |
| USD1102840S1 (en) * | 2024-10-23 | 2025-11-25 | Pingyang Yili Crafts Co., Ltd | Fruit slicer |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD823624S1 (en) | Stool | |
| USD851438S1 (en) | Beverage extractor | |
| USD831905S1 (en) | Grooming tool | |
| USD807273S1 (en) | Glider | |
| USD814291S1 (en) | Earring box | |
| USD813369S1 (en) | Fan | |
| USD820894S1 (en) | Camera | |
| USD874321S1 (en) | Gemstone | |
| USD917203S1 (en) | Tray | |
| USD826548S1 (en) | Drinking flask | |
| USD823596S1 (en) | Holster | |
| USD784698S1 (en) | Basket | |
| USD796984S1 (en) | Necklace | |
| USD762421S1 (en) | Holder | |
| USD800513S1 (en) | Knife block | |
| USD818781S1 (en) | Zester | |
| USD786597S1 (en) | Armrest | |
| USD816374S1 (en) | Pillow | |
| USD812997S1 (en) | Mandoline | |
| USD810520S1 (en) | Melon slicer set | |
| USD785888S1 (en) | Paint pan and insert | |
| USD821361S1 (en) | Actuator | |
| USD788889S1 (en) | Circular grate | |
| USD789497S1 (en) | Circular grate | |
| USD801953S1 (en) | Microphone |