USD806842S1 - Toilet - Google Patents
Toilet Download PDFInfo
- Publication number
- USD806842S1 USD806842S1 US29/570,489 US201629570489F USD806842S US D806842 S1 USD806842 S1 US D806842S1 US 201629570489 F US201629570489 F US 201629570489F US D806842 S USD806842 S US D806842S
- Authority
- US
- United States
- Prior art keywords
- view
- toilet
- design
- design shown
- pedestal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 1
Images
Description
The ornamental design that is claimed is shown in the drawings as solid lines and surfaces having surface shading. In the drawings, the broken lines depict environmental subject matter only and form no part of the claimed design. The dash/dot/dash lines indicate a boundary between the claimed and unclaimed portion of the design.
Claims (1)
- I claim the ornamental design for a toilet, as shown and described.
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/570,489 USD806842S1 (en) | 2016-07-08 | 2016-07-08 | Toilet |
| US29/628,590 USD824006S1 (en) | 2016-07-08 | 2017-12-06 | Toilet |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/570,489 USD806842S1 (en) | 2016-07-08 | 2016-07-08 | Toilet |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/628,590 Division USD824006S1 (en) | 2016-07-08 | 2017-12-06 | Toilet |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD806842S1 true USD806842S1 (en) | 2018-01-02 |
Family
ID=60805160
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/570,489 Active USD806842S1 (en) | 2016-07-08 | 2016-07-08 | Toilet |
| US29/628,590 Active USD824006S1 (en) | 2016-07-08 | 2017-12-06 | Toilet |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/628,590 Active USD824006S1 (en) | 2016-07-08 | 2017-12-06 | Toilet |
Country Status (1)
| Country | Link |
|---|---|
| US (2) | USD806842S1 (en) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD824006S1 (en) * | 2016-07-08 | 2018-07-24 | Kohler Co. | Toilet |
| USD863517S1 (en) * | 2016-06-09 | 2019-10-15 | Kohler Co. | Toilet |
| USD883454S1 (en) * | 2016-06-09 | 2020-05-05 | Kohler Co. | Toilet |
| USD892285S1 (en) | 2018-09-10 | 2020-08-04 | Kohler Co. | Toilet |
| USD897506S1 (en) | 2018-06-21 | 2020-09-29 | Kohler Co. | Toilet |
| USD935581S1 (en) | 2019-12-18 | 2021-11-09 | Kohler Co. | Toilet |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU201614066S (en) * | 2016-07-26 | 2016-08-01 | Caroma Industries Ltd | A rimless toilet pan |
Citations (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD430927S (en) * | 1996-11-15 | 2000-09-12 | Toto Ltd. | Water closet |
| USD437634S1 (en) | 1998-12-02 | 2001-02-13 | Kohler Co. | Water closet |
| USD437920S1 (en) * | 2000-04-04 | 2001-02-20 | Acorn Engineering Co. | Stainless steel toilet |
| USD465272S1 (en) | 2002-02-13 | 2002-11-05 | Kohler Co. | Water closet |
| USD483448S1 (en) * | 2002-05-17 | 2003-12-09 | American Standard International Inc. | Bowl |
| USD496443S1 (en) | 2003-04-10 | 2004-09-21 | Kohler Co. | Water closet |
| USD496442S1 (en) | 2003-04-10 | 2004-09-21 | Kohler Co. | Bowl for water closet |
| USD507335S1 (en) | 2003-12-12 | 2005-07-12 | Kohler Co. | Base for a water closet |
| USD578621S1 (en) * | 2007-12-20 | 2008-10-14 | Globe Union Industrial Corp. | Toilet |
| USD606179S1 (en) * | 2008-06-03 | 2009-12-15 | Caroma Industries Limited | Toilet pan |
| USD621011S1 (en) * | 2009-09-18 | 2010-08-03 | As Ip Holdco, L.L.C. | One-piece toilet |
| USD672854S1 (en) * | 2011-08-31 | 2012-12-18 | Toto Ltd. | Toilet bowl |
| USD697599S1 (en) | 2012-10-04 | 2014-01-14 | Kohler Co. | Toilet |
| USD702819S1 (en) * | 2013-06-07 | 2014-04-15 | Masco Corporation Of Indiana | Toilet |
| USD743516S1 (en) * | 2014-01-31 | 2015-11-17 | Kohler Co. | Toilet |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD355711S (en) * | 1993-01-29 | 1995-02-21 | Toto, Ltd. | Toilet bowl |
| USD476402S1 (en) * | 2001-08-01 | 2003-06-24 | Roca Sanitario, S.A. | Toilet tank and lid |
| USD520613S1 (en) * | 2005-01-07 | 2006-05-09 | Kohler France Sas | Bidet |
| USD652493S1 (en) * | 2011-01-12 | 2012-01-17 | As Ip Holdco, L.L.C. | Toilet |
| USD702331S1 (en) * | 2013-06-10 | 2014-04-08 | Masco Corporation Of Indiana | Toilet bowl |
| US9976591B2 (en) * | 2014-01-31 | 2018-05-22 | Kohler Co. | Bolt and cap assembly for plumbing fixture |
| USD797910S1 (en) * | 2015-12-11 | 2017-09-19 | Delta Faucet Company | Toilet |
| USD806842S1 (en) * | 2016-07-08 | 2018-01-02 | Kohler Co. | Toilet |
-
2016
- 2016-07-08 US US29/570,489 patent/USD806842S1/en active Active
-
2017
- 2017-12-06 US US29/628,590 patent/USD824006S1/en active Active
Patent Citations (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD430927S (en) * | 1996-11-15 | 2000-09-12 | Toto Ltd. | Water closet |
| USD437634S1 (en) | 1998-12-02 | 2001-02-13 | Kohler Co. | Water closet |
| USD437920S1 (en) * | 2000-04-04 | 2001-02-20 | Acorn Engineering Co. | Stainless steel toilet |
| USD465272S1 (en) | 2002-02-13 | 2002-11-05 | Kohler Co. | Water closet |
| USD483448S1 (en) * | 2002-05-17 | 2003-12-09 | American Standard International Inc. | Bowl |
| USD496443S1 (en) | 2003-04-10 | 2004-09-21 | Kohler Co. | Water closet |
| USD496442S1 (en) | 2003-04-10 | 2004-09-21 | Kohler Co. | Bowl for water closet |
| USD507335S1 (en) | 2003-12-12 | 2005-07-12 | Kohler Co. | Base for a water closet |
| USD514208S1 (en) | 2003-12-12 | 2006-01-31 | Kohler Co. | Water closet |
| USD578621S1 (en) * | 2007-12-20 | 2008-10-14 | Globe Union Industrial Corp. | Toilet |
| USD606179S1 (en) * | 2008-06-03 | 2009-12-15 | Caroma Industries Limited | Toilet pan |
| USD621011S1 (en) * | 2009-09-18 | 2010-08-03 | As Ip Holdco, L.L.C. | One-piece toilet |
| USD672854S1 (en) * | 2011-08-31 | 2012-12-18 | Toto Ltd. | Toilet bowl |
| USD697599S1 (en) | 2012-10-04 | 2014-01-14 | Kohler Co. | Toilet |
| USD697601S1 (en) | 2012-10-04 | 2014-01-14 | Kohler Co. | Toilet |
| USD702819S1 (en) * | 2013-06-07 | 2014-04-15 | Masco Corporation Of Indiana | Toilet |
| USD743516S1 (en) * | 2014-01-31 | 2015-11-17 | Kohler Co. | Toilet |
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD863517S1 (en) * | 2016-06-09 | 2019-10-15 | Kohler Co. | Toilet |
| USD883454S1 (en) * | 2016-06-09 | 2020-05-05 | Kohler Co. | Toilet |
| USD884849S1 (en) * | 2016-06-09 | 2020-05-19 | Kohler Co. | Toilet |
| USD892998S1 (en) * | 2016-06-09 | 2020-08-11 | Kohler Co. | Toilet |
| USD824006S1 (en) * | 2016-07-08 | 2018-07-24 | Kohler Co. | Toilet |
| USD897506S1 (en) | 2018-06-21 | 2020-09-29 | Kohler Co. | Toilet |
| USD892285S1 (en) | 2018-09-10 | 2020-08-04 | Kohler Co. | Toilet |
| USD912231S1 (en) | 2018-09-10 | 2021-03-02 | Kohler Co. | Toilet |
| USD931427S1 (en) | 2018-09-10 | 2021-09-21 | Kohler Co. | Toilet |
| USD935581S1 (en) | 2019-12-18 | 2021-11-09 | Kohler Co. | Toilet |
| USD961742S1 (en) | 2019-12-18 | 2022-08-23 | Kohler Co | Toilet |
| USD987789S1 (en) | 2019-12-18 | 2023-05-30 | Kohler Co. | Toilet |
Also Published As
| Publication number | Publication date |
|---|---|
| USD824006S1 (en) | 2018-07-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD824007S1 (en) | Toilet seat cover | |
| USD820415S1 (en) | Faucet | |
| USD865923S1 (en) | Basin | |
| USD825041S1 (en) | Toilet | |
| USD822183S1 (en) | Toilet | |
| USD806842S1 (en) | Toilet | |
| USD855779S1 (en) | Faucet | |
| USD837292S1 (en) | Multi-function printer | |
| USD827113S1 (en) | Toilet | |
| USD1032804S1 (en) | Lavatory basin | |
| USD804208S1 (en) | Inflatable seat | |
| USD825043S1 (en) | Toilet | |
| USD876155S1 (en) | Griddle | |
| USD829311S1 (en) | Toilet | |
| USD829310S1 (en) | Toilet | |
| USD825042S1 (en) | Toilet | |
| USD808453S1 (en) | Three dimensional printer | |
| USD859062S1 (en) | Griddle | |
| USD876154S1 (en) | Griddle | |
| USD822760S1 (en) | Printer | |
| USD946721S1 (en) | Lavatory basin | |
| USD837954S1 (en) | Toilet | |
| USD885521S1 (en) | Handshower | |
| USD960295S1 (en) | Shower components | |
| USD827989S1 (en) | Balaclava |