USD793463S1 - Camera - Google Patents
Camera Download PDFInfo
- Publication number
- USD793463S1 USD793463S1 US29/571,866 US201629571866F USD793463S US D793463 S1 USD793463 S1 US D793463S1 US 201629571866 F US201629571866 F US 201629571866F US D793463 S USD793463 S US D793463S
- Authority
- US
- United States
- Prior art keywords
- camera
- view
- design
- garmin
- trademark
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- BXNJHAXVSOCGBA-UHFFFAOYSA-N Harmine Chemical compound N1=CC=C2C3=CC=C(OC)C=C3NC2=C1C BXNJHAXVSOCGBA-UHFFFAOYSA-N 0.000 description 2
Images
Description
The structural features depicted by broken lines have been shown for the purpose of illustrating portions of the camera that form no part of the claimed design. The “GARMIN” trademark depicted in the drawing figures is a trademark of Garmin Ltd. or its subsidiaries and it forms no part of the claimed design.
Claims (1)
- The ornamental design for a camera, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/571,866 USD793463S1 (en) | 2016-07-22 | 2016-07-22 | Camera |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/571,866 USD793463S1 (en) | 2016-07-22 | 2016-07-22 | Camera |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD793463S1 true USD793463S1 (en) | 2017-08-01 |
Family
ID=59381778
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/571,866 Active USD793463S1 (en) | 2016-07-22 | 2016-07-22 | Camera |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD793463S1 (en) |
Cited By (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD805117S1 (en) * | 2015-11-17 | 2017-12-12 | Gopro, Inc. | Camera |
| USD806775S1 (en) * | 2016-09-07 | 2018-01-02 | Gopro, Inc. | Camera |
| USD810175S1 (en) * | 2016-05-02 | 2018-02-13 | Hanwha Techwin Co., Ltd. | Camera |
| USD833505S1 (en) * | 2016-09-13 | 2018-11-13 | Shenzhen Baker Av Digital Technology Co., Ltd. | Sports camera |
| USD837865S1 (en) * | 2014-07-21 | 2019-01-08 | Gopro, Inc. | Camera |
| USD843035S1 (en) * | 2016-01-03 | 2019-03-12 | Industrial Revolutions, Inc. | Headlamp |
| USD849087S1 (en) | 2018-01-03 | 2019-05-21 | Jingwu Li | Children's camera |
| USD849084S1 (en) * | 2017-09-19 | 2019-05-21 | Shenzhen Baker Av Digital Technology Co., Ltd. | Sports camera |
| USD851155S1 (en) * | 2017-07-14 | 2019-06-11 | Shenzhen Baker Av Digital Technology Co., Ltd. | Sports camera |
| USD855675S1 (en) * | 2017-07-18 | 2019-08-06 | Apeman International Co., Ltd. | Camera |
| USD856392S1 (en) * | 2017-07-22 | 2019-08-13 | Apeman International Co., Ltd. | Camera |
| USD857076S1 (en) * | 2017-08-24 | 2019-08-20 | Shenzhen Tat Electronics Co., Ltd. | Action camera |
| USD860291S1 (en) | 2017-09-27 | 2019-09-17 | Garmin Switzerland Gmbh | Camera device with display |
| USD860287S1 (en) * | 2013-10-08 | 2019-09-17 | Ive Jonathan P | Camera |
| USD865843S1 (en) * | 2017-11-29 | 2019-11-05 | Shenzhen Baker Av Digital Technology Co., Ltd. | Sports camera |
| USD867420S1 (en) * | 2018-01-12 | 2019-11-19 | Shenzhen Hongfeng Century Technology CO., LTD. | Motion camera |
| USD868867S1 (en) | 2018-03-06 | 2019-12-03 | Garmin Switzerland Gmbh | Camera |
| USD871480S1 (en) * | 2018-04-17 | 2019-12-31 | Shenzhen Baker Av Digital Technology Co., Ltd. | Sports camera |
| USD872162S1 (en) * | 2018-01-02 | 2020-01-07 | Shenzhen Cencom Technology Co., Ltd. | Sports camera |
| USD873163S1 (en) * | 2017-09-13 | 2020-01-21 | Csc Group Llc | Conspicuity tag |
| USD877228S1 (en) * | 2018-06-13 | 2020-03-03 | Shenzhen HDKing Electronics Co., Ltd | Sports camera |
| USD893578S1 (en) * | 2019-06-14 | 2020-08-18 | Rylo, Inc. | Camera |
| USD902287S1 (en) | 2013-10-08 | 2020-11-17 | Ive Jonathan P | Camera |
| USD903740S1 (en) | 2018-09-14 | 2020-12-01 | Gopro, Inc. | Camera |
| USD907680S1 (en) | 2018-08-31 | 2021-01-12 | Gopro, Inc. | Camera |
| USD921740S1 (en) | 2019-06-11 | 2021-06-08 | Gopro, Inc. | Camera |
| USD925638S1 (en) * | 2018-12-21 | 2021-07-20 | Fluke Corporation | Thermal imager |
| USD941382S1 (en) * | 2018-07-20 | 2022-01-18 | Ashok Babu Kunjukkannan | Camera enclosure |
| USD946074S1 (en) | 2020-08-14 | 2022-03-15 | Gopro, Inc. | Camera |
| USD950629S1 (en) | 2019-09-17 | 2022-05-03 | Gopro, Inc. | Camera |
| USD977547S1 (en) * | 2018-11-15 | 2023-02-07 | Fujifilm Corporation | Camera |
| US11675251B2 (en) | 2019-09-18 | 2023-06-13 | Gopro, Inc. | Door assemblies for image capture devices |
| USD998017S1 (en) | 2017-12-28 | 2023-09-05 | Gopro, Inc. | Camera |
| US11782327B2 (en) | 2020-07-02 | 2023-10-10 | Gopro, Inc. | Removable battery door assemblies for image capture devices |
| USD1029745S1 (en) | 2019-09-13 | 2024-06-04 | Gopro, Inc. | Camera battery |
| USD1029746S1 (en) | 2020-07-31 | 2024-06-04 | Gopro, Inc. | Battery |
| USD1031809S1 (en) * | 2022-01-20 | 2024-06-18 | Garmin International, Inc. | Camera |
| USD1038209S1 (en) | 2015-12-15 | 2024-08-06 | Gopro, Inc. | Camera |
| US12066748B2 (en) | 2019-09-18 | 2024-08-20 | Gopro, Inc. | Door assemblies for image capture devices |
| USD1050227S1 (en) | 2020-08-14 | 2024-11-05 | Gopro, Inc. | Camera door |
| USD1061682S1 (en) | 2022-08-04 | 2025-02-11 | Gopro, Inc. | Camera door |
| USD1063818S1 (en) | 2017-09-28 | 2025-02-25 | Gopro, Inc. | Battery |
| USD1066462S1 (en) | 2021-02-12 | 2025-03-11 | Gopro, Inc. | Camera door |
| US12321084B2 (en) | 2022-08-12 | 2025-06-03 | Gopro, Inc. | Interconnect mechanism for image capture device |
| USD1096894S1 (en) | 2023-11-16 | 2025-10-07 | Garmin International, Inc. | Camera |
| USD1101016S1 (en) | 2024-04-03 | 2025-11-04 | Gopro, Inc. | Camera |
| USD1107775S1 (en) | 2022-08-04 | 2025-12-30 | Gopro, Inc. | Camera |
| USD1110393S1 (en) | 2024-04-26 | 2026-01-27 | Gopro, Inc. | Camera door |
| USD1111083S1 (en) | 2024-04-03 | 2026-02-03 | Gopro, Inc. | Camera door |
| USD1118735S1 (en) | 2024-05-22 | 2026-03-17 | Gopro, Inc. | Camera |
Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD392659S (en) * | 1996-11-12 | 1998-03-24 | Matsushita Electric Industrial Co., Ltd. | Digital still camera |
| US20070019948A1 (en) * | 2005-07-19 | 2007-01-25 | Canon Kabushiki Kaisha | Lens barrel, driving method thereof, and image pickup device |
| USD560237S1 (en) * | 2006-01-20 | 2008-01-22 | Fujifilm Corporation | Electronic camera |
| USD750686S1 (en) * | 2014-10-27 | 2016-03-01 | ShenZhen Dazzne Technical Limited | Camera |
| USD751131S1 (en) * | 2012-09-13 | 2016-03-08 | Gopro, Inc. | Camera |
| USD753749S1 (en) * | 2014-08-29 | 2016-04-12 | Hangzhou Hikvision Digital Technology Co., Ltd | Sport video camera |
| USD755270S1 (en) * | 2014-12-29 | 2016-05-03 | Garmin Switzerland Gmbh | Camera |
| USD758467S1 (en) * | 2013-12-02 | 2016-06-07 | Shenzhen AEE Technology Co., Ltd | Camera device |
| USD760309S1 (en) * | 2014-05-30 | 2016-06-28 | Gopro, Inc. | Camera |
| US20160209731A1 (en) * | 2015-01-15 | 2016-07-21 | Xiaoyi Technology Co., Ltd. | Light structure for an electronic device |
| USD766351S1 (en) * | 2014-12-31 | 2016-09-13 | Autel Aerotech Co., Ltd. | Camera |
| USD772966S1 (en) * | 2016-01-13 | 2016-11-29 | Xiaoyi Technology Co., Ltd. | Camera |
| USD777232S1 (en) * | 2015-08-25 | 2017-01-24 | Garmin Switzerland Gmbh | Camera device |
-
2016
- 2016-07-22 US US29/571,866 patent/USD793463S1/en active Active
Patent Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD392659S (en) * | 1996-11-12 | 1998-03-24 | Matsushita Electric Industrial Co., Ltd. | Digital still camera |
| US20070019948A1 (en) * | 2005-07-19 | 2007-01-25 | Canon Kabushiki Kaisha | Lens barrel, driving method thereof, and image pickup device |
| USD560237S1 (en) * | 2006-01-20 | 2008-01-22 | Fujifilm Corporation | Electronic camera |
| USD751131S1 (en) * | 2012-09-13 | 2016-03-08 | Gopro, Inc. | Camera |
| USD758467S1 (en) * | 2013-12-02 | 2016-06-07 | Shenzhen AEE Technology Co., Ltd | Camera device |
| USD760309S1 (en) * | 2014-05-30 | 2016-06-28 | Gopro, Inc. | Camera |
| USD753749S1 (en) * | 2014-08-29 | 2016-04-12 | Hangzhou Hikvision Digital Technology Co., Ltd | Sport video camera |
| USD750686S1 (en) * | 2014-10-27 | 2016-03-01 | ShenZhen Dazzne Technical Limited | Camera |
| USD755270S1 (en) * | 2014-12-29 | 2016-05-03 | Garmin Switzerland Gmbh | Camera |
| USD766351S1 (en) * | 2014-12-31 | 2016-09-13 | Autel Aerotech Co., Ltd. | Camera |
| US20160209731A1 (en) * | 2015-01-15 | 2016-07-21 | Xiaoyi Technology Co., Ltd. | Light structure for an electronic device |
| USD777232S1 (en) * | 2015-08-25 | 2017-01-24 | Garmin Switzerland Gmbh | Camera device |
| USD772966S1 (en) * | 2016-01-13 | 2016-11-29 | Xiaoyi Technology Co., Ltd. | Camera |
Non-Patent Citations (10)
| Title |
|---|
| CannonPowershot A620/PowerShot A610 Camera User Guide; cover page; published 2005. |
| Garmin Dash Cam™ 30/35 Owner's manual, published Oct. 2015. |
| GoPro Hero3+ Owner's Manual. |
| Printout from http://www.bestbuy.com/site/activeon-cx-hd-action-camera-onyx-black/4533500.p?skuId=4533500 ; published prior to Jul. 22, 2016. |
| Printout from http://www.dorainmaker.com/2014/11gopros-review-indepth.html published prior to Dec. 29, 2014. |
| Printout from http://www.kdlinks.com/index.php/popular-products/kdlinks-x1-full-hd-165-wide-angle-car-dashboard-camcorder-with-gps-g-sensor-wdr-2-7-screen-and-8gb-micro-sd-included.html; published prior to Jul. 22, 2016. |
| Printout from https://buy.garmin.com/en-US/US/p/164723 published prior to Jul. 22, 2016. |
| Printout from https://www.cnet.com/produets/xiaomi-yi/ ; published prior to Jul. 22, 2016. |
| SJCAM SJ5000 Owner's Manual. |
| U.S. Appl. No. 29/571,859, filed Jul. 22, 2016. |
Cited By (78)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD902287S1 (en) | 2013-10-08 | 2020-11-17 | Ive Jonathan P | Camera |
| USD860287S1 (en) * | 2013-10-08 | 2019-09-17 | Ive Jonathan P | Camera |
| USD897407S1 (en) | 2013-10-08 | 2020-09-29 | Jonathan P. Ive | Camera |
| USD837865S1 (en) * | 2014-07-21 | 2019-01-08 | Gopro, Inc. | Camera |
| USD805117S1 (en) * | 2015-11-17 | 2017-12-12 | Gopro, Inc. | Camera |
| USD881974S1 (en) | 2015-11-17 | 2020-04-21 | Gopro, Inc. | Camera |
| USD1038209S1 (en) | 2015-12-15 | 2024-08-06 | Gopro, Inc. | Camera |
| USD1077027S1 (en) | 2015-12-15 | 2025-05-27 | Gopro, Inc. | Camera |
| USD843035S1 (en) * | 2016-01-03 | 2019-03-12 | Industrial Revolutions, Inc. | Headlamp |
| USD810175S1 (en) * | 2016-05-02 | 2018-02-13 | Hanwha Techwin Co., Ltd. | Camera |
| USD868871S1 (en) * | 2016-09-07 | 2019-12-03 | Gopro, Inc. | Camera |
| USD840463S1 (en) | 2016-09-07 | 2019-02-12 | Gopro, Inc. | Camera |
| USD892194S1 (en) | 2016-09-07 | 2020-08-04 | Gopro, Inc. | Camera |
| USD806775S1 (en) * | 2016-09-07 | 2018-01-02 | Gopro, Inc. | Camera |
| USD833505S1 (en) * | 2016-09-13 | 2018-11-13 | Shenzhen Baker Av Digital Technology Co., Ltd. | Sports camera |
| USD851155S1 (en) * | 2017-07-14 | 2019-06-11 | Shenzhen Baker Av Digital Technology Co., Ltd. | Sports camera |
| USD855675S1 (en) * | 2017-07-18 | 2019-08-06 | Apeman International Co., Ltd. | Camera |
| USD856392S1 (en) * | 2017-07-22 | 2019-08-13 | Apeman International Co., Ltd. | Camera |
| USD857076S1 (en) * | 2017-08-24 | 2019-08-20 | Shenzhen Tat Electronics Co., Ltd. | Action camera |
| USD873163S1 (en) * | 2017-09-13 | 2020-01-21 | Csc Group Llc | Conspicuity tag |
| USD849084S1 (en) * | 2017-09-19 | 2019-05-21 | Shenzhen Baker Av Digital Technology Co., Ltd. | Sports camera |
| USD860291S1 (en) | 2017-09-27 | 2019-09-17 | Garmin Switzerland Gmbh | Camera device with display |
| USD1063818S1 (en) | 2017-09-28 | 2025-02-25 | Gopro, Inc. | Battery |
| USD865843S1 (en) * | 2017-11-29 | 2019-11-05 | Shenzhen Baker Av Digital Technology Co., Ltd. | Sports camera |
| USD1079788S1 (en) | 2017-12-28 | 2025-06-17 | Gopro, Inc. | Camera |
| USD998017S1 (en) | 2017-12-28 | 2023-09-05 | Gopro, Inc. | Camera |
| USD1036536S1 (en) | 2017-12-28 | 2024-07-23 | Gopro, Inc. | Camera |
| USD872162S1 (en) * | 2018-01-02 | 2020-01-07 | Shenzhen Cencom Technology Co., Ltd. | Sports camera |
| USD849087S1 (en) | 2018-01-03 | 2019-05-21 | Jingwu Li | Children's camera |
| USD867420S1 (en) * | 2018-01-12 | 2019-11-19 | Shenzhen Hongfeng Century Technology CO., LTD. | Motion camera |
| USD868867S1 (en) | 2018-03-06 | 2019-12-03 | Garmin Switzerland Gmbh | Camera |
| USD871480S1 (en) * | 2018-04-17 | 2019-12-31 | Shenzhen Baker Av Digital Technology Co., Ltd. | Sports camera |
| USD877228S1 (en) * | 2018-06-13 | 2020-03-03 | Shenzhen HDKing Electronics Co., Ltd | Sports camera |
| USD941382S1 (en) * | 2018-07-20 | 2022-01-18 | Ashok Babu Kunjukkannan | Camera enclosure |
| USD1058641S1 (en) | 2018-08-31 | 2025-01-21 | Gopro, Inc. | Camera |
| USD907680S1 (en) | 2018-08-31 | 2021-01-12 | Gopro, Inc. | Camera |
| USD990540S1 (en) | 2018-08-31 | 2023-06-27 | Gopro, Inc. | Camera |
| USD950628S1 (en) | 2018-09-14 | 2022-05-03 | Gopro, Inc. | Camera |
| USD903740S1 (en) | 2018-09-14 | 2020-12-01 | Gopro, Inc. | Camera |
| USD963020S1 (en) | 2018-09-14 | 2022-09-06 | Gopro, Inc. | Camera |
| USD977547S1 (en) * | 2018-11-15 | 2023-02-07 | Fujifilm Corporation | Camera |
| USD925638S1 (en) * | 2018-12-21 | 2021-07-20 | Fluke Corporation | Thermal imager |
| USD954128S1 (en) | 2019-06-11 | 2022-06-07 | Gopro, Inc. | Camera |
| USD921740S1 (en) | 2019-06-11 | 2021-06-08 | Gopro, Inc. | Camera |
| USD1009124S1 (en) | 2019-06-11 | 2023-12-26 | Gopro, Inc. | Camera |
| USD941904S1 (en) | 2019-06-11 | 2022-01-25 | Gopro, Inc. | Camera |
| USD995600S1 (en) | 2019-06-11 | 2023-08-15 | Gopro, Inc. | Camera |
| USD893578S1 (en) * | 2019-06-14 | 2020-08-18 | Rylo, Inc. | Camera |
| USD1029745S1 (en) | 2019-09-13 | 2024-06-04 | Gopro, Inc. | Camera battery |
| USD950629S1 (en) | 2019-09-17 | 2022-05-03 | Gopro, Inc. | Camera |
| USD997232S1 (en) | 2019-09-17 | 2023-08-29 | Gopro, Inc. | Camera |
| USD956123S1 (en) | 2019-09-17 | 2022-06-28 | Gopro, Inc. | Camera |
| USD988390S1 (en) | 2019-09-17 | 2023-06-06 | Gopro, Inc. | Camera |
| USD1090676S1 (en) | 2019-09-17 | 2025-08-26 | Gopro, Inc. | Camera |
| USD1024165S1 (en) | 2019-09-17 | 2024-04-23 | Gopro, Inc. | Camera |
| US11675251B2 (en) | 2019-09-18 | 2023-06-13 | Gopro, Inc. | Door assemblies for image capture devices |
| US12066748B2 (en) | 2019-09-18 | 2024-08-20 | Gopro, Inc. | Door assemblies for image capture devices |
| US12066749B2 (en) | 2019-09-18 | 2024-08-20 | Gopro, Inc. | Door assemblies for image capture devices |
| US11782327B2 (en) | 2020-07-02 | 2023-10-10 | Gopro, Inc. | Removable battery door assemblies for image capture devices |
| US12253793B2 (en) | 2020-07-02 | 2025-03-18 | Gopro, Inc. | Removable battery door assemblies for image capture devices |
| USD1029746S1 (en) | 2020-07-31 | 2024-06-04 | Gopro, Inc. | Battery |
| USD946074S1 (en) | 2020-08-14 | 2022-03-15 | Gopro, Inc. | Camera |
| USD991318S1 (en) | 2020-08-14 | 2023-07-04 | Gopro, Inc. | Camera |
| USD950624S1 (en) | 2020-08-14 | 2022-05-03 | Gopro, Inc. | Camera |
| USD989841S1 (en) | 2020-08-14 | 2023-06-20 | Gopro, Inc. | Camera |
| USD1004676S1 (en) | 2020-08-14 | 2023-11-14 | Gopro, Inc. | Camera |
| USD1050227S1 (en) | 2020-08-14 | 2024-11-05 | Gopro, Inc. | Camera door |
| USD963022S1 (en) | 2020-08-14 | 2022-09-06 | Gopro, Inc. | Camera |
| USD1066462S1 (en) | 2021-02-12 | 2025-03-11 | Gopro, Inc. | Camera door |
| USD1031809S1 (en) * | 2022-01-20 | 2024-06-18 | Garmin International, Inc. | Camera |
| USD1061682S1 (en) | 2022-08-04 | 2025-02-11 | Gopro, Inc. | Camera door |
| USD1107775S1 (en) | 2022-08-04 | 2025-12-30 | Gopro, Inc. | Camera |
| US12321084B2 (en) | 2022-08-12 | 2025-06-03 | Gopro, Inc. | Interconnect mechanism for image capture device |
| USD1096894S1 (en) | 2023-11-16 | 2025-10-07 | Garmin International, Inc. | Camera |
| USD1101016S1 (en) | 2024-04-03 | 2025-11-04 | Gopro, Inc. | Camera |
| USD1111083S1 (en) | 2024-04-03 | 2026-02-03 | Gopro, Inc. | Camera door |
| USD1110393S1 (en) | 2024-04-26 | 2026-01-27 | Gopro, Inc. | Camera door |
| USD1118735S1 (en) | 2024-05-22 | 2026-03-17 | Gopro, Inc. | Camera |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD793463S1 (en) | Camera | |
| USD820335S1 (en) | Camera | |
| USD955924S1 (en) | Travel trailer | |
| USD879884S1 (en) | Scooter | |
| USD755270S1 (en) | Camera | |
| USD941397S1 (en) | Kart | |
| USD836699S1 (en) | Camera with handle | |
| USD793468S1 (en) | Display device | |
| USD835364S1 (en) | Electronic device | |
| USD788608S1 (en) | Fitness device | |
| USD810169S1 (en) | Camera | |
| USD839753S1 (en) | Watch with display | |
| USD814545S1 (en) | Handle for camera or the like | |
| USD814643S1 (en) | Fitness device | |
| USD815228S1 (en) | Foot-deck based vehicle | |
| USD795940S1 (en) | Camera | |
| USD789542S1 (en) | Fitness watch | |
| USD772442S1 (en) | Night light | |
| USD775021S1 (en) | Hood | |
| USD788609S1 (en) | Fitness device | |
| USD816150S1 (en) | Gimbal with camera | |
| USD792927S1 (en) | Kart | |
| USD764600S1 (en) | Kart | |
| USD850509S1 (en) | Camera | |
| USD785066S1 (en) | Camera device |