USD788212S1 - Antivibration pedestal for a musical instrument - Google Patents
Antivibration pedestal for a musical instrument Download PDFInfo
- Publication number
- USD788212S1 USD788212S1 US29/553,168 US201629553168F USD788212S US D788212 S1 USD788212 S1 US D788212S1 US 201629553168 F US201629553168 F US 201629553168F US D788212 S USD788212 S US D788212S
- Authority
- US
- United States
- Prior art keywords
- musical instrument
- antivibration pedestal
- antivibration
- pedestal
- view
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title claims description 4
Images
Description
The broken line subject matters in FIGS. 6-7 are included for the purpose of illustrating unclaimed environment and form no part of the claimed design. The broken line portions of the antivibration pedestal for a musical instrument represent unclaimed portions of the design and form no part thereof. The dot-dash-dot broken lines in FIGS. 1-2 define the bounds of the claim. The entire areas located within the dot-dash-dot broken lines form no part thereof.
Claims (1)
- The ornamental design for an antivibration pedestal for a musical instrument, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/553,168 USD788212S1 (en) | 2013-10-28 | 2016-01-29 | Antivibration pedestal for a musical instrument |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/471,010 USD757846S1 (en) | 2013-10-28 | 2013-10-28 | Antivibration pedestal for a musical instrument |
| US29/553,168 USD788212S1 (en) | 2013-10-28 | 2016-01-29 | Antivibration pedestal for a musical instrument |
Related Parent Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/471,010 Division USD757846S1 (en) | 2013-10-28 | 2013-10-28 | Antivibration pedestal for a musical instrument |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD788212S1 true USD788212S1 (en) | 2017-05-30 |
Family
ID=56028390
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/471,010 Active USD757846S1 (en) | 2013-10-28 | 2013-10-28 | Antivibration pedestal for a musical instrument |
| US29/553,168 Active USD788212S1 (en) | 2013-10-28 | 2016-01-29 | Antivibration pedestal for a musical instrument |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/471,010 Active USD757846S1 (en) | 2013-10-28 | 2013-10-28 | Antivibration pedestal for a musical instrument |
Country Status (1)
| Country | Link |
|---|---|
| US (2) | USD757846S1 (en) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD863701S1 (en) | 2019-05-21 | 2019-10-15 | Allan Wendling | Vibration dampening support |
| USD871696S1 (en) | 2019-05-21 | 2019-12-31 | Allan Wendling | Vibration dampening support |
| USD904504S1 (en) * | 2016-02-17 | 2020-12-08 | Roger William Graham | Electronic device cover |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD757846S1 (en) * | 2013-10-28 | 2016-05-31 | Roland Corporation | Antivibration pedestal for a musical instrument |
| USD888151S1 (en) | 2017-11-09 | 2020-06-23 | Melanie Almiron McGinnis | Piano key overlay tile |
| USD989128S1 (en) * | 2020-07-07 | 2023-06-13 | Ironhawk Industrial Distribution LLC | Curb guard |
Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3213963A (en) * | 1962-04-05 | 1965-10-26 | Vogt Ansgar | Antiskid device for ladders |
| US3612301A (en) * | 1969-07-07 | 1971-10-12 | Bobbie D Peacock | Cushion pad insertable between heavy panels |
| USD310953S (en) * | 1987-04-22 | 1990-10-02 | Ilukowicz Robert J | Panel spacer pad |
| USD383377S (en) * | 1996-05-03 | 1997-09-09 | Sellers Kathleen R | Cushioned furniture protector |
| US5883315A (en) * | 1997-05-16 | 1999-03-16 | Burton Kaplan | Stringed instrument shoulder rest |
| USD416741S (en) * | 1998-10-16 | 1999-11-23 | Foamex L.P. | Mattress overlay |
| USD467590S1 (en) * | 2001-09-10 | 2002-12-24 | Craig A. Walker | Rotating wrist support |
| US6754934B1 (en) * | 2003-01-17 | 2004-06-29 | Shiffler Equipment Sales, Inc. | Lower surface structure for furniture cap and glide |
| US7743882B2 (en) * | 2003-08-18 | 2010-06-29 | Vinh Thanh Vu | Vibration-control platform |
| USD722107S1 (en) * | 2010-10-15 | 2015-02-03 | Ari Magnusson | Musical instrument cushion |
| US20150115127A1 (en) * | 2013-10-31 | 2015-04-30 | Roland Corporation | Vibration isolating table |
| USD728673S1 (en) * | 2010-10-15 | 2015-05-05 | Ari Magnusson | Musical instrument cushion |
| USD757846S1 (en) * | 2013-10-28 | 2016-05-31 | Roland Corporation | Antivibration pedestal for a musical instrument |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1534440A (en) * | 1921-12-21 | 1925-04-21 | Aubrey B Shapard | Glider for furniture legs and the like |
| US3679159A (en) * | 1971-02-09 | 1972-07-25 | Bert Bach | Vibration isolation structure |
| EP0078649A1 (en) * | 1981-10-27 | 1983-05-11 | Avon Industrial Polymers Limited | Isolation pads |
| USD278155S (en) * | 1982-10-18 | 1985-03-26 | Peavey Electronics Corp. | Combined mounting ring and thumbrest for a musical instrument |
| USD418375S (en) * | 1999-02-11 | 2000-01-04 | Sheldon H. Goodman | Coaster |
| US6812390B2 (en) * | 2003-02-05 | 2004-11-02 | John E. Kalbas | Violin stand |
| US20050061138A1 (en) * | 2003-09-24 | 2005-03-24 | Lance Justis | Anchoring apparatus for musical instrument stands |
| US20050156090A1 (en) * | 2003-11-20 | 2005-07-21 | Drayton Clarence R.Jr. | Musical instrument harness and anchoring system |
| NZ544446A (en) * | 2004-04-27 | 2009-02-28 | Zoltan A Kemeny | Dynamic kinematic mount where at least six points of translation are constrained and translation and rotation are decoupled from each other |
| USD505564S1 (en) * | 2004-06-17 | 2005-05-31 | Curtis D. Wagner | Plant stand |
| USD504249S1 (en) * | 2004-06-17 | 2005-04-26 | Curtis D. Wagner | Plant stand |
| JP4455950B2 (en) * | 2004-07-28 | 2010-04-21 | 三菱電線工業株式会社 | Cleat |
| US20070235605A1 (en) * | 2006-04-06 | 2007-10-11 | Jacob Voelz | Instrument stand securement device |
| US20070290104A1 (en) * | 2006-06-14 | 2007-12-20 | Tri-Ped Corporation | Apparatus for stabilizing a tripod |
| US9188276B2 (en) * | 2010-06-10 | 2015-11-17 | Metal & Cable Corp., Inc. | Magnetic mounting system |
| JP2012092873A (en) * | 2010-10-26 | 2012-05-17 | Ryozo Yoneda | Earthquake-resisting support device for object |
| USD685255S1 (en) * | 2011-01-28 | 2013-07-02 | Installations Magasins Gerard Rocquet | Device for moving loads |
| USD680564S1 (en) * | 2011-09-21 | 2013-04-23 | Snyder National Corporation | Equipment support pad |
| US9123313B2 (en) * | 2011-10-06 | 2015-09-01 | Robert Norman Hyams | Apparatus for preventing a foot pedal assembly from moving away from a seat and method of use |
| US20130133504A1 (en) * | 2011-11-28 | 2013-05-30 | Akito Takegawa | Isolation rings for use with musical instruments and equipment |
| WO2014165828A1 (en) * | 2013-04-04 | 2014-10-09 | Ben Shelef | Improved kinematic mount |
| USD735510S1 (en) * | 2014-04-23 | 2015-08-04 | Innerworkings, Inc. | Base with wheels for a temporary display rack |
-
2013
- 2013-10-28 US US29/471,010 patent/USD757846S1/en active Active
-
2016
- 2016-01-29 US US29/553,168 patent/USD788212S1/en active Active
Patent Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3213963A (en) * | 1962-04-05 | 1965-10-26 | Vogt Ansgar | Antiskid device for ladders |
| US3612301A (en) * | 1969-07-07 | 1971-10-12 | Bobbie D Peacock | Cushion pad insertable between heavy panels |
| USD310953S (en) * | 1987-04-22 | 1990-10-02 | Ilukowicz Robert J | Panel spacer pad |
| USD383377S (en) * | 1996-05-03 | 1997-09-09 | Sellers Kathleen R | Cushioned furniture protector |
| US5883315A (en) * | 1997-05-16 | 1999-03-16 | Burton Kaplan | Stringed instrument shoulder rest |
| USD416741S (en) * | 1998-10-16 | 1999-11-23 | Foamex L.P. | Mattress overlay |
| USD467590S1 (en) * | 2001-09-10 | 2002-12-24 | Craig A. Walker | Rotating wrist support |
| US6754934B1 (en) * | 2003-01-17 | 2004-06-29 | Shiffler Equipment Sales, Inc. | Lower surface structure for furniture cap and glide |
| US7743882B2 (en) * | 2003-08-18 | 2010-06-29 | Vinh Thanh Vu | Vibration-control platform |
| USD722107S1 (en) * | 2010-10-15 | 2015-02-03 | Ari Magnusson | Musical instrument cushion |
| USD728673S1 (en) * | 2010-10-15 | 2015-05-05 | Ari Magnusson | Musical instrument cushion |
| USD757846S1 (en) * | 2013-10-28 | 2016-05-31 | Roland Corporation | Antivibration pedestal for a musical instrument |
| US20150115127A1 (en) * | 2013-10-31 | 2015-04-30 | Roland Corporation | Vibration isolating table |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD904504S1 (en) * | 2016-02-17 | 2020-12-08 | Roger William Graham | Electronic device cover |
| USD863701S1 (en) | 2019-05-21 | 2019-10-15 | Allan Wendling | Vibration dampening support |
| USD871696S1 (en) | 2019-05-21 | 2019-12-31 | Allan Wendling | Vibration dampening support |
Also Published As
| Publication number | Publication date |
|---|---|
| USD757846S1 (en) | 2016-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD726052S1 (en) | Module for a measuring instrument | |
| USD712399S1 (en) | All-in-one computer | |
| USD741287S1 (en) | Earphone | |
| USD656130S1 (en) | Microphone | |
| USD855394S1 (en) | Oven handle | |
| USD803410S1 (en) | Instrument for measuring electrocardiogram | |
| USD705711S1 (en) | Instrument panel for an automobile | |
| USD716764S1 (en) | Speaker | |
| USD727898S1 (en) | All-in-one computer | |
| USD728218S1 (en) | First aid kit | |
| USD766356S1 (en) | Percussion musical instrument | |
| USD736746S1 (en) | Jacket for a portable speaker | |
| USD735168S1 (en) | Jacket for portable speaker | |
| USD710941S1 (en) | Writing instrument | |
| USD731058S1 (en) | Opthalmologic instrument | |
| USD788212S1 (en) | Antivibration pedestal for a musical instrument | |
| USD736747S1 (en) | Jacket for a portable speaker | |
| USD780161S1 (en) | Electronic musical instrument | |
| USD718374S1 (en) | Digital piano | |
| USD782566S1 (en) | Pedal for a musical instrument | |
| USD727899S1 (en) | All-in-one computer | |
| USD721520S1 (en) | Pillow | |
| USD682951S1 (en) | Dollhouse unit | |
| USD727320S1 (en) | All-in-one computer | |
| USD718312S1 (en) | Writing instrument or stylus |