USD782466S1 - Terminal - Google Patents
Terminal Download PDFInfo
- Publication number
- USD782466S1 USD782466S1 US29/558,705 US201629558705F USD782466S US D782466 S1 USD782466 S1 US D782466S1 US 201629558705 F US201629558705 F US 201629558705F US D782466 S USD782466 S US D782466S
- Authority
- US
- United States
- Prior art keywords
- terminal
- view
- ornamental design
- front perspective
- pedestal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
Images
Description
Claims (1)
- The ornamental design for a terminal, as shown and described.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US29/558,705 USD782466S1 (en) | 2016-03-21 | 2016-03-21 | Terminal |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US29/558,705 USD782466S1 (en) | 2016-03-21 | 2016-03-21 | Terminal |
Publications (1)
Publication Number | Publication Date |
---|---|
USD782466S1 true USD782466S1 (en) | 2017-03-28 |
Family
ID=58359416
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US29/558,705 Active USD782466S1 (en) | 2016-03-21 | 2016-03-21 | Terminal |
Country Status (1)
Country | Link |
---|---|
US (1) | USD782466S1 (en) |
Cited By (49)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
USD806698S1 (en) * | 2016-12-29 | 2018-01-02 | Scientific Games International, Inc. | Lottery ticket checker terminal |
USD827008S1 (en) * | 2016-09-12 | 2018-08-28 | Sysmex Corporation | Microscope |
USD828831S1 (en) * | 2017-08-01 | 2018-09-18 | Genuine Parts Company | Digital kiosk |
USD829705S1 (en) * | 2015-10-21 | 2018-10-02 | Verifone, Inc. | Electronic payment device |
USD831639S1 (en) * | 2017-08-21 | 2018-10-23 | Otis Elevator Company | Operating/display panel |
USD849833S1 (en) * | 2017-04-11 | 2019-05-28 | Posbank Co., Ltd. | Cradle for terminal for managing selling information |
USD850525S1 (en) * | 2017-06-12 | 2019-06-04 | Posbank Co., Ltd. | Point-of-sales register |
USD856410S1 (en) * | 2017-07-19 | 2019-08-13 | Ncr Corporation | Terminal |
USD857007S1 (en) * | 2017-08-22 | 2019-08-20 | Intel Corporation | Audio-visual display device |
USD857689S1 (en) * | 2012-03-01 | 2019-08-27 | Zivelo LLC | Kiosk system |
USD857791S1 (en) * | 2017-04-06 | 2019-08-27 | Pax Computer Technology (Shenzhen) Co., Ltd. | Electronic cash register |
USD861778S1 (en) * | 2018-05-04 | 2019-10-01 | Ncr Corporation | Terminal |
USD862552S1 (en) * | 2018-02-26 | 2019-10-08 | Caliber Imaging & Diagnostics, Inc. | Housing for microscopic and macroscopic imagers with hinged cover |
USD864193S1 (en) * | 2017-09-08 | 2019-10-22 | Panasonic Intellectual Property Management Co., Ltd. | Interactive kiosk |
USD872188S1 (en) * | 2018-07-24 | 2020-01-07 | Bally Gaming, Inc. | Gaming machine |
USD872189S1 (en) * | 2018-07-24 | 2020-01-07 | Bally Gaming, Inc. | Gaming machine |
USD873262S1 (en) * | 2017-08-17 | 2020-01-21 | Llavanya Fernando | Customer facing kiosk |
USD873921S1 (en) * | 2018-07-24 | 2020-01-28 | Bally Gaming, Inc. | Gaming machine |
USD880609S1 (en) * | 2018-07-24 | 2020-04-07 | Bally Gaming, Inc. | Gaming machine with graphical user interface |
USD880326S1 (en) | 2017-11-02 | 2020-04-07 | Otis Elevator Company | Operating/display panel |
USD880327S1 (en) | 2017-11-02 | 2020-04-07 | Otis Elevator Company | Operating/display panel |
USD881995S1 (en) * | 2018-07-24 | 2020-04-21 | Sg Gaming, Inc. | Gaming machine |
USD883391S1 (en) * | 2017-09-08 | 2020-05-05 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD886905S1 (en) * | 2018-07-24 | 2020-06-09 | Sg Gaming, Inc. | Gaming machine |
USD887495S1 (en) * | 2018-07-24 | 2020-06-16 | Sg Gaming, Inc. | Gaming machine |
USD887496S1 (en) * | 2017-09-29 | 2020-06-16 | Aristocrat Technologies Australia Pty Limited | Gaming machine display |
USD888705S1 (en) * | 2018-07-04 | 2020-06-30 | Sakai Display Products Corporation | Housing for aerial imaging apparatus |
USD889455S1 (en) | 2017-08-21 | 2020-07-07 | Zivelo, Inc. | Kiosk |
USD896815S1 (en) * | 2019-05-21 | 2020-09-22 | Shenzhen Xfanic Technology Co., Ltd. | Docking station video sharer |
USD902296S1 (en) * | 2019-04-08 | 2020-11-17 | Aures Technologies | Point-of-sale (POS) terminal |
USD905048S1 (en) * | 2018-03-08 | 2020-12-15 | Koenig & Bauer Ag | Multimedia communication terminal |
USD912043S1 (en) * | 2018-12-20 | 2021-03-02 | Transact Technologies Incorporated | Terminal with integral printers |
USD916954S1 (en) * | 2019-07-15 | 2021-04-20 | Five Stars Loyalty, Inc. | Point-of-sale terminal |
USD919925S1 (en) * | 2018-08-27 | 2021-05-18 | Crane Payment Innovations, Inc. | Bezel |
USD922369S1 (en) * | 2019-04-10 | 2021-06-15 | Cleveron As | Automated parcel terminal |
USD922479S1 (en) * | 2019-02-20 | 2021-06-15 | CINAMON Holding OÜ | Cash register |
USD934244S1 (en) * | 2018-09-18 | 2021-10-26 | Google Llc | Display device |
USD935456S1 (en) * | 2018-09-18 | 2021-11-09 | Google Llc | Display device |
USD945626S1 (en) * | 2019-12-18 | 2022-03-08 | Aceage Inc. | Medication delivery cartridge |
USD952035S1 (en) * | 2019-08-19 | 2022-05-17 | Elo Touch Solutions, Inc. | Printing kiosk |
USD958733S1 (en) * | 2017-01-30 | 2022-07-26 | Tabletop Media Llc | Battery for tabletop point-of-sale terminal |
USD962219S1 (en) * | 2020-10-07 | 2022-08-30 | Samsung Electronics Co., Ltd. | Kiosk |
USD964982S1 (en) * | 2022-04-06 | 2022-09-27 | Capital One Services, Llc | Kiosk |
USD971209S1 (en) | 2018-09-18 | 2022-11-29 | Google Llc | Display device |
USD977415S1 (en) * | 2019-03-27 | 2023-02-07 | Bosch Automotive Products (Suzhou) Co. Ltd | Battery |
US11874707B2 (en) | 2018-09-18 | 2024-01-16 | Google Llc | Display assistant device |
USD1014615S1 (en) * | 2021-03-31 | 2024-02-13 | Shenzhen Zolon Technology Co., Ltd. | Self-service payment terminal |
USD1034821S1 (en) | 2018-07-24 | 2024-07-09 | Lnw Gaming, Inc. | Gaming machine |
USD1034820S1 (en) | 2018-07-24 | 2024-07-09 | Lnw Gaming, Inc. | Gaming machine |
Citations (16)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
USD425875S (en) * | 1999-05-05 | 2000-05-30 | King Products Inc. | Interactive display system |
US7546957B2 (en) * | 2007-05-29 | 2009-06-16 | Ncr Corporation | Travel kiosk |
US8113429B2 (en) * | 2008-12-18 | 2012-02-14 | Ncr Corporation | Barcode reading station |
USD661293S1 (en) * | 2011-03-15 | 2012-06-05 | Pfu Limited | Computer terminal |
USD676038S1 (en) * | 2011-10-11 | 2013-02-12 | Toshiba Tec Kabushiki Kaisha | Informational terminal unit |
USD681030S1 (en) * | 2012-07-11 | 2013-04-30 | Ncr Corporation | Kiosk |
USD690293S1 (en) * | 2010-03-03 | 2013-09-24 | GB Electronics (UK) Limited | Interactive or multiservice digital terminal |
USD691141S1 (en) * | 2011-08-17 | 2013-10-08 | Spartadata LLC. | Electronic tablet housing with card reader |
USD693803S1 (en) * | 2012-02-08 | 2013-11-19 | Ncr Corporation | Terminal |
USD695285S1 (en) * | 2013-04-21 | 2013-12-10 | Cubic Corporation | Interactive terminal |
USD707674S1 (en) * | 2013-09-20 | 2014-06-24 | Isaac S. Daniel | Electronic kiosk |
USD730890S1 (en) * | 2014-12-08 | 2015-06-02 | Diebold Self-Service Systems Division Of Diebold, Incorporated | Self-service terminal |
USD732522S1 (en) * | 2013-06-27 | 2015-06-23 | Bibliotheca Limited | Kiosk |
USD734314S1 (en) * | 2013-04-16 | 2015-07-14 | Ncr Corporation | Terminal |
USD751061S1 (en) * | 2014-04-11 | 2016-03-08 | Nextgenid, Inc. | Kiosk |
USD763247S1 (en) * | 2015-02-04 | 2016-08-09 | Ncr Corporation | Kiosk |
-
2016
- 2016-03-21 US US29/558,705 patent/USD782466S1/en active Active
Patent Citations (16)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
USD425875S (en) * | 1999-05-05 | 2000-05-30 | King Products Inc. | Interactive display system |
US7546957B2 (en) * | 2007-05-29 | 2009-06-16 | Ncr Corporation | Travel kiosk |
US8113429B2 (en) * | 2008-12-18 | 2012-02-14 | Ncr Corporation | Barcode reading station |
USD690293S1 (en) * | 2010-03-03 | 2013-09-24 | GB Electronics (UK) Limited | Interactive or multiservice digital terminal |
USD661293S1 (en) * | 2011-03-15 | 2012-06-05 | Pfu Limited | Computer terminal |
USD691141S1 (en) * | 2011-08-17 | 2013-10-08 | Spartadata LLC. | Electronic tablet housing with card reader |
USD676038S1 (en) * | 2011-10-11 | 2013-02-12 | Toshiba Tec Kabushiki Kaisha | Informational terminal unit |
USD693803S1 (en) * | 2012-02-08 | 2013-11-19 | Ncr Corporation | Terminal |
USD681030S1 (en) * | 2012-07-11 | 2013-04-30 | Ncr Corporation | Kiosk |
USD734314S1 (en) * | 2013-04-16 | 2015-07-14 | Ncr Corporation | Terminal |
USD695285S1 (en) * | 2013-04-21 | 2013-12-10 | Cubic Corporation | Interactive terminal |
USD732522S1 (en) * | 2013-06-27 | 2015-06-23 | Bibliotheca Limited | Kiosk |
USD707674S1 (en) * | 2013-09-20 | 2014-06-24 | Isaac S. Daniel | Electronic kiosk |
USD751061S1 (en) * | 2014-04-11 | 2016-03-08 | Nextgenid, Inc. | Kiosk |
USD730890S1 (en) * | 2014-12-08 | 2015-06-02 | Diebold Self-Service Systems Division Of Diebold, Incorporated | Self-service terminal |
USD763247S1 (en) * | 2015-02-04 | 2016-08-09 | Ncr Corporation | Kiosk |
Cited By (100)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
USD857689S1 (en) * | 2012-03-01 | 2019-08-27 | Zivelo LLC | Kiosk system |
USD892110S1 (en) * | 2012-03-01 | 2020-08-04 | Zivelo, Inc. | Kiosk system |
USD829705S1 (en) * | 2015-10-21 | 2018-10-02 | Verifone, Inc. | Electronic payment device |
USD829704S1 (en) * | 2015-10-21 | 2018-10-02 | Verifone, Inc. | Electronic payment device |
USD842296S1 (en) * | 2015-10-21 | 2019-03-05 | Verifone, Inc. | Electronic payment device |
USD827008S1 (en) * | 2016-09-12 | 2018-08-28 | Sysmex Corporation | Microscope |
USD806698S1 (en) * | 2016-12-29 | 2018-01-02 | Scientific Games International, Inc. | Lottery ticket checker terminal |
USD958733S1 (en) * | 2017-01-30 | 2022-07-26 | Tabletop Media Llc | Battery for tabletop point-of-sale terminal |
USD857791S1 (en) * | 2017-04-06 | 2019-08-27 | Pax Computer Technology (Shenzhen) Co., Ltd. | Electronic cash register |
USD849833S1 (en) * | 2017-04-11 | 2019-05-28 | Posbank Co., Ltd. | Cradle for terminal for managing selling information |
USD850525S1 (en) * | 2017-06-12 | 2019-06-04 | Posbank Co., Ltd. | Point-of-sales register |
USD856410S1 (en) * | 2017-07-19 | 2019-08-13 | Ncr Corporation | Terminal |
USD828831S1 (en) * | 2017-08-01 | 2018-09-18 | Genuine Parts Company | Digital kiosk |
USD873262S1 (en) * | 2017-08-17 | 2020-01-21 | Llavanya Fernando | Customer facing kiosk |
USD831639S1 (en) * | 2017-08-21 | 2018-10-23 | Otis Elevator Company | Operating/display panel |
USD889455S1 (en) | 2017-08-21 | 2020-07-07 | Zivelo, Inc. | Kiosk |
USD857007S1 (en) * | 2017-08-22 | 2019-08-20 | Intel Corporation | Audio-visual display device |
USD883391S1 (en) * | 2017-09-08 | 2020-05-05 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1037359S1 (en) | 2017-09-08 | 2024-07-30 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1038251S1 (en) | 2017-09-08 | 2024-08-06 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1038248S1 (en) | 2017-09-08 | 2024-08-06 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1038245S1 (en) | 2017-09-08 | 2024-08-06 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1038246S1 (en) | 2017-09-08 | 2024-08-06 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1038254S1 (en) | 2017-09-08 | 2024-08-06 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1038255S1 (en) | 2017-09-08 | 2024-08-06 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1038247S1 (en) | 2017-09-08 | 2024-08-06 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1038244S1 (en) | 2017-09-08 | 2024-08-06 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1039619S1 (en) | 2017-09-08 | 2024-08-20 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1038256S1 (en) | 2017-09-08 | 2024-08-06 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD864193S1 (en) * | 2017-09-08 | 2019-10-22 | Panasonic Intellectual Property Management Co., Ltd. | Interactive kiosk |
USD1038249S1 (en) | 2017-09-08 | 2024-08-06 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1037360S1 (en) | 2017-09-08 | 2024-07-30 | Aristocrat Technologies Australia Pty Limited | Bank of combined gaming machines and displays |
USD1038250S1 (en) | 2017-09-08 | 2024-08-06 | Aristocrat Technologies Australia Pty Limited | Bank of combined gaming machines and displays |
USD1026102S1 (en) | 2017-09-08 | 2024-05-07 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1026101S1 (en) | 2017-09-08 | 2024-05-07 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1025220S1 (en) | 2017-09-08 | 2024-04-30 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1024202S1 (en) | 2017-09-08 | 2024-04-23 | Aristocrat Technologies Australia Pty Limited | Bank of combined gaming machines and displays |
USD1024205S1 (en) | 2017-09-08 | 2024-04-23 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1024204S1 (en) | 2017-09-08 | 2024-04-23 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1024203S1 (en) | 2017-09-08 | 2024-04-23 | Aristocrat Technologies Australia Pty Limited | Combined gaming machine and display |
USD1024207S1 (en) | 2017-09-29 | 2024-04-23 | Aristocrat Technologies Australia Pty Limited | Gaming machine display |
USD1024206S1 (en) | 2017-09-29 | 2024-04-23 | Aristocrat Technologies Australia Pty Limited | Gaming machine display |
USD1024208S1 (en) | 2017-09-29 | 2024-04-23 | Aristocrat Technologies Australia Pty Limited | Gaming machine display |
USD1023160S1 (en) | 2017-09-29 | 2024-04-16 | Aristocrat Technologies Australia Pty Limited | Gaming machine display |
USD887496S1 (en) * | 2017-09-29 | 2020-06-16 | Aristocrat Technologies Australia Pty Limited | Gaming machine display |
USD1023159S1 (en) | 2017-09-29 | 2024-04-16 | Aristocrat Technologies Australia Pty Limited | Gaming machine display |
USD1022048S1 (en) | 2017-09-29 | 2024-04-09 | Aristocrat Technologies Australia Pty Limited | Gaming machine display |
USD1014633S1 (en) | 2017-09-29 | 2024-02-13 | Aristocrat Technologies Australia Pty Limited | Gaming machine and display |
USD978004S1 (en) | 2017-11-02 | 2023-02-14 | Otis Elevator Company | Operating/display panel |
USD880326S1 (en) | 2017-11-02 | 2020-04-07 | Otis Elevator Company | Operating/display panel |
USD974934S1 (en) | 2017-11-02 | 2023-01-10 | Otis Elevator Company | Operating/display panel |
USD941694S1 (en) | 2017-11-02 | 2022-01-25 | Otis Elevator Company | Operating/display panel |
USD880327S1 (en) | 2017-11-02 | 2020-04-07 | Otis Elevator Company | Operating/display panel |
USD862552S1 (en) * | 2018-02-26 | 2019-10-08 | Caliber Imaging & Diagnostics, Inc. | Housing for microscopic and macroscopic imagers with hinged cover |
USD905048S1 (en) * | 2018-03-08 | 2020-12-15 | Koenig & Bauer Ag | Multimedia communication terminal |
USD861778S1 (en) * | 2018-05-04 | 2019-10-01 | Ncr Corporation | Terminal |
USD888705S1 (en) * | 2018-07-04 | 2020-06-30 | Sakai Display Products Corporation | Housing for aerial imaging apparatus |
USD1011430S1 (en) | 2018-07-24 | 2024-01-16 | Lnw Gaming, Inc. | Gaming machine |
USD886905S1 (en) * | 2018-07-24 | 2020-06-09 | Sg Gaming, Inc. | Gaming machine |
USD1012185S1 (en) | 2018-07-24 | 2024-01-23 | Lnw Gaming, Inc. | Gaming machine |
USD1012183S1 (en) | 2018-07-24 | 2024-01-23 | Lnw Gaming, Inc. | Gaming machine |
USD1012186S1 (en) | 2018-07-24 | 2024-01-23 | Lnw Gaming, Inc. | Gaming machine with graphical user interface |
USD1012184S1 (en) | 2018-07-24 | 2024-01-23 | Lnw Gaming, Inc. | Gaming machine with graphical user interface |
USD1013044S1 (en) | 2018-07-24 | 2024-01-30 | Lnw Gaming, Inc. | Gaming machine |
USD880609S1 (en) * | 2018-07-24 | 2020-04-07 | Bally Gaming, Inc. | Gaming machine with graphical user interface |
USD881995S1 (en) * | 2018-07-24 | 2020-04-21 | Sg Gaming, Inc. | Gaming machine |
USD1018677S1 (en) | 2018-07-24 | 2024-03-19 | Lnw Gaming, Inc. | Gaming machine |
USD1018678S1 (en) | 2018-07-24 | 2024-03-19 | Lnw Gaming, Inc. | Gaming machine |
USD1011431S1 (en) | 2018-07-24 | 2024-01-16 | Lnw Gaming, Inc. | Gaming machine |
USD887495S1 (en) * | 2018-07-24 | 2020-06-16 | Sg Gaming, Inc. | Gaming machine |
USD873921S1 (en) * | 2018-07-24 | 2020-01-28 | Bally Gaming, Inc. | Gaming machine |
USD1034820S1 (en) | 2018-07-24 | 2024-07-09 | Lnw Gaming, Inc. | Gaming machine |
USD872189S1 (en) * | 2018-07-24 | 2020-01-07 | Bally Gaming, Inc. | Gaming machine |
USD872188S1 (en) * | 2018-07-24 | 2020-01-07 | Bally Gaming, Inc. | Gaming machine |
USD1034821S1 (en) | 2018-07-24 | 2024-07-09 | Lnw Gaming, Inc. | Gaming machine |
USD1033542S1 (en) | 2018-07-24 | 2024-07-02 | Lnw Gaming, Inc. | Gaming machine |
USD1032721S1 (en) | 2018-07-24 | 2024-06-25 | Lnw Gaming, Inc. | Gaming machine with graphical user interface |
USD919925S1 (en) * | 2018-08-27 | 2021-05-18 | Crane Payment Innovations, Inc. | Bezel |
USD935456S1 (en) * | 2018-09-18 | 2021-11-09 | Google Llc | Display device |
USD970501S1 (en) | 2018-09-18 | 2022-11-22 | Google Llc | Display device |
US11874707B2 (en) | 2018-09-18 | 2024-01-16 | Google Llc | Display assistant device |
USD1038122S1 (en) | 2018-09-18 | 2024-08-06 | Google Llc | Display device |
USD980211S1 (en) | 2018-09-18 | 2023-03-07 | Google Llc | Display device |
USD934244S1 (en) * | 2018-09-18 | 2021-10-26 | Google Llc | Display device |
USD971209S1 (en) | 2018-09-18 | 2022-11-29 | Google Llc | Display device |
USD912043S1 (en) * | 2018-12-20 | 2021-03-02 | Transact Technologies Incorporated | Terminal with integral printers |
USD922479S1 (en) * | 2019-02-20 | 2021-06-15 | CINAMON Holding OÜ | Cash register |
USD977415S1 (en) * | 2019-03-27 | 2023-02-07 | Bosch Automotive Products (Suzhou) Co. Ltd | Battery |
USD902296S1 (en) * | 2019-04-08 | 2020-11-17 | Aures Technologies | Point-of-sale (POS) terminal |
USD922369S1 (en) * | 2019-04-10 | 2021-06-15 | Cleveron As | Automated parcel terminal |
USD896815S1 (en) * | 2019-05-21 | 2020-09-22 | Shenzhen Xfanic Technology Co., Ltd. | Docking station video sharer |
USD916954S1 (en) * | 2019-07-15 | 2021-04-20 | Five Stars Loyalty, Inc. | Point-of-sale terminal |
USD952035S1 (en) * | 2019-08-19 | 2022-05-17 | Elo Touch Solutions, Inc. | Printing kiosk |
USD1007575S1 (en) | 2019-08-19 | 2023-12-12 | Elo Touch Solutions, Inc. | Printing kiosk |
USD994767S1 (en) | 2019-08-19 | 2023-08-08 | Elo Touch Solutions, Inc. | Printing kiosk |
USD945626S1 (en) * | 2019-12-18 | 2022-03-08 | Aceage Inc. | Medication delivery cartridge |
USD991927S1 (en) | 2020-10-07 | 2023-07-11 | Samsung Electronics Co., Ltd. | Kiosk |
USD962219S1 (en) * | 2020-10-07 | 2022-08-30 | Samsung Electronics Co., Ltd. | Kiosk |
USD1014615S1 (en) * | 2021-03-31 | 2024-02-13 | Shenzhen Zolon Technology Co., Ltd. | Self-service payment terminal |
USD964982S1 (en) * | 2022-04-06 | 2022-09-27 | Capital One Services, Llc | Kiosk |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
USD782466S1 (en) | Terminal | |
USD924190S1 (en) | Phone | |
USD841627S1 (en) | Earphone | |
USD861472S1 (en) | Bio-clamp | |
USD849734S1 (en) | Phone case | |
USD873587S1 (en) | Cabinet | |
USD813806S1 (en) | Charger | |
USD824360S1 (en) | Headphone | |
USD825134S1 (en) | Self-service terminal | |
USD798068S1 (en) | Chair | |
USD808856S1 (en) | Hoverboard | |
USD808857S1 (en) | Hoverboard | |
USD798069S1 (en) | Chair | |
USD782998S1 (en) | Earphone | |
USD782997S1 (en) | Earphone | |
USD770436S1 (en) | Telephone stand | |
USD798617S1 (en) | Chair | |
USD828348S1 (en) | Self-service terminal | |
USD844613S1 (en) | Keypad | |
USD776635S1 (en) | Earphone | |
USD832011S1 (en) | Table | |
USD839237S1 (en) | Earphone | |
USD798070S1 (en) | Chair | |
USD853036S1 (en) | Compact | |
USD821061S1 (en) | Shorts |