USD767852S1 - Weighted bolero - Google Patents
Weighted bolero Download PDFInfo
- Publication number
- USD767852S1 USD767852S1 US29/528,095 US201529528095F USD767852S US D767852 S1 USD767852 S1 US D767852S1 US 201529528095 F US201529528095 F US 201529528095F US D767852 S USD767852 S US D767852S
- Authority
- US
- United States
- Prior art keywords
- bolero
- weighted
- elevation view
- view
- ornamental design
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- QHTQREMOGMZHJV-UHFFFAOYSA-N Thiobencarb Chemical compound CCN(CC)C(=O)SCC1=CC=C(Cl)C=C1 QHTQREMOGMZHJV-UHFFFAOYSA-N 0.000 title claims description 4
Images
Description
The broken lines in the drawings illustrate portion of the weighted bolero that do not form part of the claimed design.
Claims (1)
- The ornamental design for a weighted bolero, as shown and described.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA161184 | 2015-03-04 | ||
| CA161184F CA161184S (en) | 2015-03-04 | 2015-03-04 | LONG SLEEVE BOLERO |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD767852S1 true USD767852S1 (en) | 2016-10-04 |
Family
ID=55444163
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/528,095 Active USD767852S1 (en) | 2015-03-04 | 2015-05-26 | Weighted bolero |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | USD767852S1 (en) |
| CA (1) | CA161184S (en) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD801636S1 (en) * | 2016-08-31 | 2017-11-07 | Nike, Inc. | Upper body garment |
| USD805731S1 (en) * | 2015-11-24 | 2017-12-26 | Zojock Sports Apparel, Llc | Padded apparel |
| USD824143S1 (en) * | 2016-12-21 | 2018-07-31 | Superflex, Inc. | Exosuit |
Citations (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD298474S (en) * | 1986-05-12 | 1988-11-08 | Twede Evan L | Protective shirt |
| USD333903S (en) * | 1989-03-01 | 1993-03-16 | Meredith Jerry R | Flotation swimsuit |
| US5667466A (en) | 1995-07-25 | 1997-09-16 | Riley, Jr.; John L. | Wrist or ankle exercise weight |
| US5768706A (en) * | 1996-05-06 | 1998-06-23 | Griffith; Charles L. | Midi weighted jacket |
| US5943700A (en) * | 1997-05-09 | 1999-08-31 | Hammer; Coach | Weighted garment |
| US6005041A (en) | 1995-11-09 | 1999-12-21 | Cook; Arnold J. | Reinforced thermoplastic elastomeric gel (RTEG) |
| USD420467S (en) * | 1997-10-10 | 2000-02-08 | Breitbach Karen E | Hockey vest |
| USD457708S1 (en) * | 2000-08-22 | 2002-05-28 | Jack Holland | Shoulder-padded T-shirt |
| US6665879B2 (en) | 2002-05-08 | 2003-12-23 | Vandenberg Nancy Lynn | Weighted insert |
| US20040016041A1 (en) * | 2002-05-23 | 2004-01-29 | Mizuno Corporation | Undershirt |
| US6748601B2 (en) * | 2002-03-11 | 2004-06-15 | Lashoto Henry G. | Articulating body protective device |
| US20040221355A1 (en) | 2003-05-08 | 2004-11-11 | Garcia Fernando L. | Two piece full body weighted swimsuit |
| US20050081277A1 (en) * | 2003-10-15 | 2005-04-21 | Matechen John M. | Garment with energy dissipating conformable padding |
| USD531389S1 (en) * | 2005-01-07 | 2006-11-07 | Med-Eng Systems, Inc. | Garment with shoulder protector |
| USD535808S1 (en) * | 2004-09-16 | 2007-01-30 | Bauer Nike Hockey Inc. | Sporting shirt |
| USD545028S1 (en) * | 2004-09-13 | 2007-06-26 | Ronald Myrick | Weighted training garment |
| US20100285936A1 (en) | 2009-05-08 | 2010-11-11 | Ryne Tacker | Muscle strengthening system and method |
| USD629999S1 (en) * | 2009-12-18 | 2011-01-04 | Nike, Inc. | Portion of compression shorts |
| USD630819S1 (en) * | 2010-04-27 | 2011-01-18 | Axler Dorothy S | Padded undershirt |
| USD633688S1 (en) * | 2009-12-18 | 2011-03-08 | Nike, Inc. | Compression shorts |
| US8156572B2 (en) | 2007-11-29 | 2012-04-17 | Patrick Gerald Whaley | Weighted exercise clothing |
| USD663101S1 (en) * | 2011-06-21 | 2012-07-10 | Shock Doctor, Inc. | Compression undergarment |
| USD674576S1 (en) * | 2011-05-18 | 2013-01-22 | L.H. Holdings, Inc. | Padded sports garment |
| US8375465B2 (en) | 2008-07-23 | 2013-02-19 | Patrick Gerald Whaley | Drag inducing swimwear |
| GB2496638A (en) | 2011-11-17 | 2013-05-22 | Richard Walker | Impact resistant material |
| USD683934S1 (en) | 2008-11-26 | 2013-06-11 | Patrick Gerald Whaley | Shirt |
| US20130291268A1 (en) | 2012-05-07 | 2013-11-07 | Patrick Gerald Whaley | Protective clothing |
| USD703919S1 (en) | 2008-11-26 | 2014-05-06 | Titin Inc | Pants |
| USD728111S1 (en) * | 2013-09-30 | 2015-04-28 | Wanetah Walmsley | Rehabilitation garment |
| USD734922S1 (en) * | 2013-05-08 | 2015-07-28 | Brent L. Docker | Weighted exercise vest |
-
2015
- 2015-03-04 CA CA161184F patent/CA161184S/en not_active Expired - Lifetime
- 2015-05-26 US US29/528,095 patent/USD767852S1/en active Active
Patent Citations (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD298474S (en) * | 1986-05-12 | 1988-11-08 | Twede Evan L | Protective shirt |
| USD333903S (en) * | 1989-03-01 | 1993-03-16 | Meredith Jerry R | Flotation swimsuit |
| US5667466A (en) | 1995-07-25 | 1997-09-16 | Riley, Jr.; John L. | Wrist or ankle exercise weight |
| US6005041A (en) | 1995-11-09 | 1999-12-21 | Cook; Arnold J. | Reinforced thermoplastic elastomeric gel (RTEG) |
| US5768706A (en) * | 1996-05-06 | 1998-06-23 | Griffith; Charles L. | Midi weighted jacket |
| US5943700A (en) * | 1997-05-09 | 1999-08-31 | Hammer; Coach | Weighted garment |
| USD420467S (en) * | 1997-10-10 | 2000-02-08 | Breitbach Karen E | Hockey vest |
| USD457708S1 (en) * | 2000-08-22 | 2002-05-28 | Jack Holland | Shoulder-padded T-shirt |
| US6748601B2 (en) * | 2002-03-11 | 2004-06-15 | Lashoto Henry G. | Articulating body protective device |
| US6665879B2 (en) | 2002-05-08 | 2003-12-23 | Vandenberg Nancy Lynn | Weighted insert |
| US20040016041A1 (en) * | 2002-05-23 | 2004-01-29 | Mizuno Corporation | Undershirt |
| US20040221355A1 (en) | 2003-05-08 | 2004-11-11 | Garcia Fernando L. | Two piece full body weighted swimsuit |
| US20050081277A1 (en) * | 2003-10-15 | 2005-04-21 | Matechen John M. | Garment with energy dissipating conformable padding |
| USD545028S1 (en) * | 2004-09-13 | 2007-06-26 | Ronald Myrick | Weighted training garment |
| USD535808S1 (en) * | 2004-09-16 | 2007-01-30 | Bauer Nike Hockey Inc. | Sporting shirt |
| USD531389S1 (en) * | 2005-01-07 | 2006-11-07 | Med-Eng Systems, Inc. | Garment with shoulder protector |
| US8156572B2 (en) | 2007-11-29 | 2012-04-17 | Patrick Gerald Whaley | Weighted exercise clothing |
| US8375465B2 (en) | 2008-07-23 | 2013-02-19 | Patrick Gerald Whaley | Drag inducing swimwear |
| USD683934S1 (en) | 2008-11-26 | 2013-06-11 | Patrick Gerald Whaley | Shirt |
| USD703919S1 (en) | 2008-11-26 | 2014-05-06 | Titin Inc | Pants |
| US20100285936A1 (en) | 2009-05-08 | 2010-11-11 | Ryne Tacker | Muscle strengthening system and method |
| USD629999S1 (en) * | 2009-12-18 | 2011-01-04 | Nike, Inc. | Portion of compression shorts |
| USD633688S1 (en) * | 2009-12-18 | 2011-03-08 | Nike, Inc. | Compression shorts |
| USD630819S1 (en) * | 2010-04-27 | 2011-01-18 | Axler Dorothy S | Padded undershirt |
| USD674576S1 (en) * | 2011-05-18 | 2013-01-22 | L.H. Holdings, Inc. | Padded sports garment |
| USD663101S1 (en) * | 2011-06-21 | 2012-07-10 | Shock Doctor, Inc. | Compression undergarment |
| GB2496638A (en) | 2011-11-17 | 2013-05-22 | Richard Walker | Impact resistant material |
| US20130291268A1 (en) | 2012-05-07 | 2013-11-07 | Patrick Gerald Whaley | Protective clothing |
| USD734922S1 (en) * | 2013-05-08 | 2015-07-28 | Brent L. Docker | Weighted exercise vest |
| USD728111S1 (en) * | 2013-09-30 | 2015-04-28 | Wanetah Walmsley | Rehabilitation garment |
Non-Patent Citations (4)
| Title |
|---|
| Louis Garneau-Mens Speed Cycling Bolero, posted at amazon.com, reviewed on Apr. 9, 2013, [online], [site visited Mar. 2, 2016]. Available from Internet, <URL:http://www.amazon.com/Louis-Garneau-Speed-Cycling-Bolero/dp/B00793MGCG/ref=cm-cr-arp-d-product-top?ie=UTF8>. * |
| Reebok KFS Hybrid Core Sr. Long Sleeve Padded Shirt, posted at hockeymonkey.com, reviewed on Mar. 21, 2015, [online], [site visited Feb. 12, 2016]. Available from Internet, <URL: http://www.hockeymonkey.com/reebok-hockey-undergarment-kfs-padded-shirt-ls.html>. * |
| Titin Force Weighted Shirt System Black posted at amazon.com, reviewed on Jan. 6, 2014, [online], [site visited Feb. 12, 2016]. Available from Internet, <URL: http://www.amazon.com/Titin-Force-Weighted-Shirt-System/product-reviews/B00E65FV8G/ref=cm-cr-arp-d-paging-btm-8?ie=UTF8&showViewpoints=1&sortBy=recent&pageNumber=8>. * |
| Titin® Weighted Shirt Sets, posted at rogueapo.com, reviewed on Feb. 21, 2013, [online], [site visited Feb. 12, 2016]. Available from Internet, <URL: http://www.rogueapo.com/titin-weighted-shirt-sets>. * |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD805731S1 (en) * | 2015-11-24 | 2017-12-26 | Zojock Sports Apparel, Llc | Padded apparel |
| USD801636S1 (en) * | 2016-08-31 | 2017-11-07 | Nike, Inc. | Upper body garment |
| USD824143S1 (en) * | 2016-12-21 | 2018-07-31 | Superflex, Inc. | Exosuit |
Also Published As
| Publication number | Publication date |
|---|---|
| CA161184S (en) | 2016-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD829400S1 (en) | Trash can | |
| USD839578S1 (en) | Boot | |
| USD782166S1 (en) | Boot | |
| USD723665S1 (en) | Faucet | |
| USD763213S1 (en) | Television | |
| USD780022S1 (en) | Ring | |
| USD715298S1 (en) | Stylus | |
| USD732330S1 (en) | Beverage dispenser | |
| USD776173S1 (en) | Refrigerator | |
| USD767097S1 (en) | Faucet | |
| USD731839S1 (en) | Beverage dispenser | |
| USD770789S1 (en) | Chair | |
| USD743728S1 (en) | Beverage dispenser | |
| USD798869S1 (en) | Computer | |
| USD759131S1 (en) | Dispenser for refrigerator | |
| USD770198S1 (en) | Shelving system | |
| USD727742S1 (en) | Perfume bottle | |
| USD788084S1 (en) | Television antenna | |
| USD821910S1 (en) | Ring | |
| USD826078S1 (en) | Ring | |
| USD762334S1 (en) | Dishwasher | |
| USD784152S1 (en) | Fragrance bottle | |
| USD755189S1 (en) | Stand for television | |
| USD780450S1 (en) | Carrying case | |
| USD794423S1 (en) | Bracket |