USD746557S1 - Footwear - Google Patents
Footwear Download PDFInfo
- Publication number
- USD746557S1 USD746557S1 US29/478,973 US201429478973F USD746557S US D746557 S1 USD746557 S1 US D746557S1 US 201429478973 F US201429478973 F US 201429478973F US D746557 S USD746557 S US D746557S
- Authority
- US
- United States
- Prior art keywords
- footwear
- view
- holes
- sole
- intermediate strap
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 241000270722 Crocodylidae Species 0.000 description 1
- LNNWVNGFPYWNQE-GMIGKAJZSA-N desomorphine Chemical compound C1C2=CC=C(O)C3=C2[C@]24CCN(C)[C@H]1[C@@H]2CCC[C@@H]4O3 LNNWVNGFPYWNQE-GMIGKAJZSA-N 0.000 description 1
Images
Description
The CROCS® word mark and circular crocodile logo, the tread pattern of the sole, the textual material on the sole, the raised bump pattern of the footbed, the holes at both ends of the intermediate strap, the holes at each side of the upper that are surrounded by the holes at each end of the intermediate strap, and the entire inside surface of the shoe upper are shown in broken lines for illustrative purposes only and form no part of the claimed design.
Claims (1)
- The ornamental design for footwear, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/478,973 USD746557S1 (en) | 2014-01-10 | 2014-01-10 | Footwear |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/478,973 USD746557S1 (en) | 2014-01-10 | 2014-01-10 | Footwear |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD746557S1 true USD746557S1 (en) | 2016-01-05 |
Family
ID=54939425
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/478,973 Active USD746557S1 (en) | 2014-01-10 | 2014-01-10 | Footwear |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD746557S1 (en) |
Cited By (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD827991S1 (en) * | 2016-02-08 | 2018-09-11 | Crocs, Inc. | Footwear |
| USD833125S1 (en) | 2016-02-08 | 2018-11-13 | Crocs, Inc. | Footwear |
| USD833720S1 (en) | 2016-02-08 | 2018-11-20 | Crocs, Inc. | Footwear |
| USD895943S1 (en) | 2018-07-12 | 2020-09-15 | Crocs, Inc. | Footwear |
| USD910286S1 (en) | 2019-02-08 | 2021-02-16 | Crocs, Inc. | Footwear |
| USD919256S1 (en) | 2019-07-30 | 2021-05-18 | Crocs, Inc. | Footwear |
| USD932751S1 (en) * | 2020-02-07 | 2021-10-12 | Crocs, Inc. | Footwear outsole |
| USRE49279E1 (en) | 2017-01-06 | 2022-11-08 | Crocs, Inc. | Footwear |
| USD993601S1 (en) * | 2023-04-06 | 2023-08-01 | Skechers U.S.A., Inc. Ii | Shoe upper component |
| USD995054S1 (en) * | 2021-06-30 | 2023-08-15 | Shenzhen Starlink Network Technology Co., Ltd | Shoe |
| USD995996S1 (en) * | 2020-08-30 | 2023-08-22 | Sinmisa Co., Ltd | Shoe |
| USD1011704S1 (en) | 2021-02-22 | 2024-01-23 | Crocs, Inc. | Footwear |
| USD1014912S1 (en) * | 2021-02-19 | 2024-02-20 | Crocs, Inc. | Footwear |
| USD1025552S1 (en) | 2021-03-15 | 2024-05-07 | Crocs, Inc. | Footwear |
| USD1029463S1 (en) | 2021-01-14 | 2024-06-04 | Crocs, Inc. | Footwear |
| USD1040490S1 (en) * | 2023-01-26 | 2024-09-03 | Azzedine Alaia Sas | Shoe |
| USD1046391S1 (en) | 2021-02-22 | 2024-10-15 | Crocs, Inc. | Footwear |
| USD1073268S1 (en) | 2021-02-22 | 2025-05-06 | Crocs, Inc. | Footwear |
| USD1076357S1 (en) * | 2024-12-04 | 2025-05-27 | Xiamen Bilefu Dianzishangwu Co., Ltd | Shoe |
| USD1080152S1 (en) | 2023-05-05 | 2025-06-24 | Crocs, Inc. | Footwear |
| USD1110693S1 (en) * | 2025-02-21 | 2026-02-03 | Crocs, Inc. | Footwear |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD622045S1 (en) * | 2009-02-25 | 2010-08-24 | Columbia Insurance Company | Upper for a shoe |
| USD698531S1 (en) * | 2012-04-13 | 2014-02-04 | Crocs, Inc. | Footwear |
| USD709677S1 (en) * | 2011-03-24 | 2014-07-29 | Crocs, Inc. | Footwear |
-
2014
- 2014-01-10 US US29/478,973 patent/USD746557S1/en active Active
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD622045S1 (en) * | 2009-02-25 | 2010-08-24 | Columbia Insurance Company | Upper for a shoe |
| USD709677S1 (en) * | 2011-03-24 | 2014-07-29 | Crocs, Inc. | Footwear |
| USD698531S1 (en) * | 2012-04-13 | 2014-02-04 | Crocs, Inc. | Footwear |
Non-Patent Citations (2)
| Title |
|---|
| Design U.S. Appl. No. 29/477,444 entitled Footwear, filed Dec. 21, 2013. |
| Design U.S. Appl. No. 29/485,549 entitled Footwear, filed Mar. 19, 2013. |
Cited By (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD827991S1 (en) * | 2016-02-08 | 2018-09-11 | Crocs, Inc. | Footwear |
| USD833125S1 (en) | 2016-02-08 | 2018-11-13 | Crocs, Inc. | Footwear |
| USD833720S1 (en) | 2016-02-08 | 2018-11-20 | Crocs, Inc. | Footwear |
| USRE49279E1 (en) | 2017-01-06 | 2022-11-08 | Crocs, Inc. | Footwear |
| USRE49309E1 (en) | 2017-01-06 | 2022-11-29 | Crocs, Inc. | Footwear |
| USRE49310E1 (en) | 2017-01-06 | 2022-11-29 | Crocs, Inc. | Footwear |
| USD895943S1 (en) | 2018-07-12 | 2020-09-15 | Crocs, Inc. | Footwear |
| USD910286S1 (en) | 2019-02-08 | 2021-02-16 | Crocs, Inc. | Footwear |
| USD919256S1 (en) | 2019-07-30 | 2021-05-18 | Crocs, Inc. | Footwear |
| USD932751S1 (en) * | 2020-02-07 | 2021-10-12 | Crocs, Inc. | Footwear outsole |
| USD995996S1 (en) * | 2020-08-30 | 2023-08-22 | Sinmisa Co., Ltd | Shoe |
| USD1029463S1 (en) | 2021-01-14 | 2024-06-04 | Crocs, Inc. | Footwear |
| USD1014912S1 (en) * | 2021-02-19 | 2024-02-20 | Crocs, Inc. | Footwear |
| USD1011704S1 (en) | 2021-02-22 | 2024-01-23 | Crocs, Inc. | Footwear |
| USD1046391S1 (en) | 2021-02-22 | 2024-10-15 | Crocs, Inc. | Footwear |
| USD1073268S1 (en) | 2021-02-22 | 2025-05-06 | Crocs, Inc. | Footwear |
| USD1025552S1 (en) | 2021-03-15 | 2024-05-07 | Crocs, Inc. | Footwear |
| USD995054S1 (en) * | 2021-06-30 | 2023-08-15 | Shenzhen Starlink Network Technology Co., Ltd | Shoe |
| USD1010292S1 (en) * | 2021-06-30 | 2024-01-09 | Shenzhen Starlink Network Technology Co, Ltd | Shoe |
| USD1040490S1 (en) * | 2023-01-26 | 2024-09-03 | Azzedine Alaia Sas | Shoe |
| USD993601S1 (en) * | 2023-04-06 | 2023-08-01 | Skechers U.S.A., Inc. Ii | Shoe upper component |
| USD1080152S1 (en) | 2023-05-05 | 2025-06-24 | Crocs, Inc. | Footwear |
| USD1076357S1 (en) * | 2024-12-04 | 2025-05-27 | Xiamen Bilefu Dianzishangwu Co., Ltd | Shoe |
| USD1110693S1 (en) * | 2025-02-21 | 2026-02-03 | Crocs, Inc. | Footwear |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD746557S1 (en) | Footwear | |
| USD739126S1 (en) | Footwear | |
| USD739125S1 (en) | Footwear | |
| USD752848S1 (en) | Footwear | |
| USD739648S1 (en) | Footwear | |
| USD741581S1 (en) | Footwear | |
| USD710577S1 (en) | Footwear | |
| USD740001S1 (en) | Footwear | |
| USD747080S1 (en) | Footwear | |
| USD698131S1 (en) | Footwear | |
| USD720920S1 (en) | Footwear | |
| USD756621S1 (en) | Golf shoe upper | |
| USD738084S1 (en) | Golf shoe upper | |
| USD756617S1 (en) | Golf shoe outsole | |
| USD671720S1 (en) | Footwear | |
| USD766558S1 (en) | Golf shoe outsole | |
| USD756620S1 (en) | Shoe sole | |
| USD757413S1 (en) | Golf shoe upper | |
| USD731767S1 (en) | Shoe sole | |
| USD698531S1 (en) | Footwear | |
| USD694994S1 (en) | Footwear | |
| USD825900S1 (en) | Shoe | |
| USD758059S1 (en) | Golf shoe upper | |
| USD793044S1 (en) | Shoe | |
| USD796813S1 (en) | Shoe upper |