USD739644S1 - Combination car seat blanket and poncho - Google Patents
Combination car seat blanket and poncho Download PDFInfo
- Publication number
- USD739644S1 USD739644S1 US29/490,040 US201429490040F USD739644S US D739644 S1 USD739644 S1 US D739644S1 US 201429490040 F US201429490040 F US 201429490040F US D739644 S USD739644 S US D739644S
- Authority
- US
- United States
- Prior art keywords
- poncho
- car seat
- combination car
- seat blanket
- blanket
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- PGOOBECODWQEAB-UHFFFAOYSA-N (E)-clothianidin Chemical compound [O-][N+](=O)\N=C(/NC)NCC1=CN=C(Cl)S1 PGOOBECODWQEAB-UHFFFAOYSA-N 0.000 title claims description 12
Images
Description
The broken lines showing portions of the human form illustrate the design being worn as a poncho, and form no part of the claimed design.
Claims (1)
- The ornamental design for a combination car seat blanket and poncho, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/490,040 USD739644S1 (en) | 2014-05-06 | 2014-05-06 | Combination car seat blanket and poncho |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/490,040 USD739644S1 (en) | 2014-05-06 | 2014-05-06 | Combination car seat blanket and poncho |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD739644S1 true USD739644S1 (en) | 2015-09-29 |
Family
ID=54149802
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/490,040 Active USD739644S1 (en) | 2014-05-06 | 2014-05-06 | Combination car seat blanket and poncho |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD739644S1 (en) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD957789S1 (en) * | 2020-10-26 | 2022-07-19 | Ashley Brown | Shawl with hook and loop closure |
| USD1007818S1 (en) * | 2023-03-15 | 2023-12-19 | Cabo Poncho LLC | Poncho wrap |
| USD1021331S1 (en) | 2023-04-19 | 2024-04-09 | Cabo Poncho LLC | Poncho wrap |
| USD1027390S1 (en) * | 2022-04-18 | 2024-05-21 | Melissa Smith | Towel capelet |
| USD1027380S1 (en) * | 2022-11-22 | 2024-05-21 | Buckle Me Baby Coats, Llc | Wearable car seat blanket |
| USD1063297S1 (en) * | 2024-09-26 | 2025-02-25 | Joshua Lefkovitz | Wearable blanket |
| USD1069330S1 (en) * | 2022-10-12 | 2025-04-08 | Wilko Pet Care Pty Ltd | Hairdressing cape |
Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD270498S (en) * | 1981-06-10 | 1983-09-13 | Fine Art Pillow & Specialties Corp. | Cover for infant car seat |
| USD283475S (en) * | 1983-10-31 | 1986-04-22 | Rebecca Reece | Combined seat and armrest cover unit for a child's car seat |
| USD415603S (en) * | 1998-07-24 | 1999-10-26 | Wampler Billy L | Mom and tot haircutting cape |
| USD542509S1 (en) * | 2004-10-21 | 2007-05-15 | Blackwood Industries, Inc. | Breathable covering nursing blanket |
| USD601327S1 (en) * | 2008-01-31 | 2009-10-06 | Lori Anderson | Blanket wrap |
| USD613035S1 (en) * | 2008-10-14 | 2010-04-06 | Lunt Edward J | Poncho-style hospital gown |
| USD632121S1 (en) * | 2010-11-02 | 2011-02-08 | Sally Ramirez | Place saver for stadium seating |
| USD652198S1 (en) * | 2010-04-14 | 2012-01-17 | Triboro Quilt Manufacturing Corporation | Bath swaddler |
| USD676220S1 (en) * | 2011-06-03 | 2013-02-19 | Lucy Bestajian | Combination baby poncho jacket, car seat cover, and shopping cart liner |
| USD683932S1 (en) * | 2012-05-24 | 2013-06-11 | Darlene Zitscher | Cape |
| USD715519S1 (en) * | 2013-06-13 | 2014-10-21 | Ami Dodd | Multi-functional infant blanket |
-
2014
- 2014-05-06 US US29/490,040 patent/USD739644S1/en active Active
Patent Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD270498S (en) * | 1981-06-10 | 1983-09-13 | Fine Art Pillow & Specialties Corp. | Cover for infant car seat |
| USD283475S (en) * | 1983-10-31 | 1986-04-22 | Rebecca Reece | Combined seat and armrest cover unit for a child's car seat |
| USD415603S (en) * | 1998-07-24 | 1999-10-26 | Wampler Billy L | Mom and tot haircutting cape |
| USD542509S1 (en) * | 2004-10-21 | 2007-05-15 | Blackwood Industries, Inc. | Breathable covering nursing blanket |
| USD601327S1 (en) * | 2008-01-31 | 2009-10-06 | Lori Anderson | Blanket wrap |
| USD613035S1 (en) * | 2008-10-14 | 2010-04-06 | Lunt Edward J | Poncho-style hospital gown |
| USD652198S1 (en) * | 2010-04-14 | 2012-01-17 | Triboro Quilt Manufacturing Corporation | Bath swaddler |
| USD632121S1 (en) * | 2010-11-02 | 2011-02-08 | Sally Ramirez | Place saver for stadium seating |
| USD676220S1 (en) * | 2011-06-03 | 2013-02-19 | Lucy Bestajian | Combination baby poncho jacket, car seat cover, and shopping cart liner |
| USD683932S1 (en) * | 2012-05-24 | 2013-06-11 | Darlene Zitscher | Cape |
| USD715519S1 (en) * | 2013-06-13 | 2014-10-21 | Ami Dodd | Multi-functional infant blanket |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD957789S1 (en) * | 2020-10-26 | 2022-07-19 | Ashley Brown | Shawl with hook and loop closure |
| USD1027390S1 (en) * | 2022-04-18 | 2024-05-21 | Melissa Smith | Towel capelet |
| USD1069330S1 (en) * | 2022-10-12 | 2025-04-08 | Wilko Pet Care Pty Ltd | Hairdressing cape |
| USD1027380S1 (en) * | 2022-11-22 | 2024-05-21 | Buckle Me Baby Coats, Llc | Wearable car seat blanket |
| USD1007818S1 (en) * | 2023-03-15 | 2023-12-19 | Cabo Poncho LLC | Poncho wrap |
| USD1021331S1 (en) | 2023-04-19 | 2024-04-09 | Cabo Poncho LLC | Poncho wrap |
| USD1063297S1 (en) * | 2024-09-26 | 2025-02-25 | Joshua Lefkovitz | Wearable blanket |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD769648S1 (en) | Pillow | |
| USD767772S1 (en) | Sleeve | |
| USD737689S1 (en) | Bottle | |
| USD773307S1 (en) | Bottle | |
| USD814931S1 (en) | Bottle | |
| USD737456S1 (en) | Rolling massager | |
| USD773199S1 (en) | Chair | |
| USD754855S1 (en) | Curved tissue fastening device | |
| USD752766S1 (en) | Non-invasive neurostimulation device | |
| USD767773S1 (en) | Sleeve | |
| USD750794S1 (en) | Non-invasive neurostimulation device | |
| USD751214S1 (en) | Non-invasive neurostimulation device | |
| USD754867S1 (en) | Hot or cold pack for shoulder and neck | |
| USD751722S1 (en) | Non-invasive neurostimulation device | |
| USD739644S1 (en) | Combination car seat blanket and poncho | |
| USD759404S1 (en) | Pillow | |
| USD761578S1 (en) | Chair | |
| USD752236S1 (en) | Non-invasive neurostimulation device | |
| USD789707S1 (en) | Jewelry holder | |
| USD711946S1 (en) | Torch | |
| USD745261S1 (en) | Needle | |
| USD739500S1 (en) | Valve cover | |
| USD741067S1 (en) | Ring connector | |
| USD787328S1 (en) | Cap | |
| USD753316S1 (en) | Non-invasive neurostimulation device |