USD738866S1 - Antenna with dome form factor - Google Patents
Antenna with dome form factor Download PDFInfo
- Publication number
- USD738866S1 USD738866S1 US29/467,973 US201329467973F USD738866S US D738866 S1 USD738866 S1 US D738866S1 US 201329467973 F US201329467973 F US 201329467973F US D738866 S USD738866 S US D738866S
- Authority
- US
- United States
- Prior art keywords
- antenna
- form factor
- dome form
- dome
- factor
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- QCDFBFJGMNKBDO-UHFFFAOYSA-N Clioquinol Chemical compound C1=CN=C2C(O)=C(I)C=C(Cl)C2=C1 QCDFBFJGMNKBDO-UHFFFAOYSA-N 0.000 title claims description 9
Images
Description
The broken lines illustrate portions of the antenna which form no part of the claimed invention.
Claims (1)
- I claim the ornamental design for an antenna with dome form factor, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/467,973 USD738866S1 (en) | 2013-09-25 | 2013-09-25 | Antenna with dome form factor |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/467,973 USD738866S1 (en) | 2013-09-25 | 2013-09-25 | Antenna with dome form factor |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD738866S1 true USD738866S1 (en) | 2015-09-15 |
Family
ID=54063910
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/467,973 Active USD738866S1 (en) | 2013-09-25 | 2013-09-25 | Antenna with dome form factor |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD738866S1 (en) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD802569S1 (en) * | 2016-02-24 | 2017-11-14 | Airgain Incorporated | Antenna |
Citations (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2926349A (en) * | 1957-03-29 | 1960-02-23 | Jack H Jensen | Corner reflector antenna |
| US3922682A (en) * | 1974-05-31 | 1975-11-25 | Communications Satellite Corp | Aberration correcting subreflectors for toroidal reflector antennas |
| USD254520S (en) * | 1977-11-03 | 1980-03-25 | Amirault Gerald A | Vision shield for a student typist or the like |
| USD387773S (en) * | 1996-10-28 | 1997-12-16 | Weller Roger G | Satellite dish protective visor |
| USD400888S (en) * | 1997-07-14 | 1998-11-10 | SGard Inc. | Satellite dish signal protector |
| US5877730A (en) * | 1997-02-18 | 1999-03-02 | Foster; Elmer D. | Satellite dish with shield |
| US5926139A (en) | 1997-07-02 | 1999-07-20 | Lucent Technologies Inc. | Planar dual frequency band antenna |
| USD426234S (en) * | 1999-09-28 | 2000-06-06 | Cunningham Jr Jerome J | Rain fade shield for satellite dish |
| US20020036897A1 (en) * | 2000-09-25 | 2002-03-28 | Kabushiki Kaisha Toshiba | Electronic apparatus having insulator for fixing wiring substrate |
| US6667718B2 (en) | 2002-05-15 | 2003-12-23 | Kosan I & T Co., Ltd. | Microstrip dual band antenna |
| US20040090377A1 (en) | 2002-11-08 | 2004-05-13 | Dai Hsin Kuo | Multi-band antenna |
| US20040239574A1 (en) * | 2001-11-02 | 2004-12-02 | Juergen Zeiher | Positioning device for adjustable housing |
| US7215294B2 (en) * | 2003-05-23 | 2007-05-08 | Lucent Technologies Inc. | Antenna with reflector |
| US20080074330A1 (en) * | 2006-09-22 | 2008-03-27 | Yung-Sen Lin | Electronic Apparatus with an Antenna |
| US20080246683A1 (en) * | 2005-10-14 | 2008-10-09 | Jochen Christ | Cladding For a Microwave Antenna |
| US20080266202A1 (en) | 2007-04-27 | 2008-10-30 | Ching-Chi Lin | Antenna unit |
| US20090128262A1 (en) * | 2007-11-15 | 2009-05-21 | Samsung Electronics Co., Ltd. | Apparatus and system for transmitting power wirelessly |
| USD617319S1 (en) * | 2009-09-02 | 2010-06-08 | Audiovox Specialized Applications, Llc | Antenna housing |
| USD623632S1 (en) | 2009-11-10 | 2010-09-14 | Skycross, Inc. | Antenna structure |
| US7804450B2 (en) | 2007-07-20 | 2010-09-28 | Laird Technologies, Inc. | Hybrid antenna structure |
| USD630194S1 (en) | 2010-07-13 | 2011-01-04 | Cheng Uei Precision Industry Co., Ltd. | Multi-band antenna |
| USD635965S1 (en) | 2010-11-15 | 2011-04-12 | Cheng Uei Precision Industry Co., Ltd. | Antenna |
| CN301605367S (en) * | 2011-03-09 | 2011-07-06 | 沈雪兰 | Indoor antenna base (006 type) |
| USD649962S1 (en) | 2011-06-29 | 2011-12-06 | Cheng Uei Precision Industry Co., Ltd. | Multi-band antenna |
| USD670276S1 (en) | 2011-12-21 | 2012-11-06 | Cheng Uei Precision Industry Co., Ltd. | Multi-band antenna |
| USD683720S1 (en) | 2011-02-14 | 2013-06-04 | Taoglas Group Holdings | Antenna |
| USD684564S1 (en) | 2012-10-12 | 2013-06-18 | Avery Dennison Corporation | RFID antenna |
| USD684565S1 (en) | 2013-03-06 | 2013-06-18 | Airgain, Inc. | Antenna |
| USD690289S1 (en) | 2013-02-06 | 2013-09-24 | Taoglas Group Holdings Limited | Antenna |
| US8704717B2 (en) * | 2011-04-17 | 2014-04-22 | Richard Gordon Kosnik | Satellite dish snow shield |
| US20150023517A1 (en) * | 2013-07-22 | 2015-01-22 | Mizco International Inc. | Apparatus for providing wireless functionality to an audio playback device |
-
2013
- 2013-09-25 US US29/467,973 patent/USD738866S1/en active Active
Patent Citations (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2926349A (en) * | 1957-03-29 | 1960-02-23 | Jack H Jensen | Corner reflector antenna |
| US3922682A (en) * | 1974-05-31 | 1975-11-25 | Communications Satellite Corp | Aberration correcting subreflectors for toroidal reflector antennas |
| USD254520S (en) * | 1977-11-03 | 1980-03-25 | Amirault Gerald A | Vision shield for a student typist or the like |
| USD387773S (en) * | 1996-10-28 | 1997-12-16 | Weller Roger G | Satellite dish protective visor |
| US5877730A (en) * | 1997-02-18 | 1999-03-02 | Foster; Elmer D. | Satellite dish with shield |
| US5926139A (en) | 1997-07-02 | 1999-07-20 | Lucent Technologies Inc. | Planar dual frequency band antenna |
| USD400888S (en) * | 1997-07-14 | 1998-11-10 | SGard Inc. | Satellite dish signal protector |
| USD426234S (en) * | 1999-09-28 | 2000-06-06 | Cunningham Jr Jerome J | Rain fade shield for satellite dish |
| US20020036897A1 (en) * | 2000-09-25 | 2002-03-28 | Kabushiki Kaisha Toshiba | Electronic apparatus having insulator for fixing wiring substrate |
| US20040239574A1 (en) * | 2001-11-02 | 2004-12-02 | Juergen Zeiher | Positioning device for adjustable housing |
| US6667718B2 (en) | 2002-05-15 | 2003-12-23 | Kosan I & T Co., Ltd. | Microstrip dual band antenna |
| US20040090377A1 (en) | 2002-11-08 | 2004-05-13 | Dai Hsin Kuo | Multi-band antenna |
| US7215294B2 (en) * | 2003-05-23 | 2007-05-08 | Lucent Technologies Inc. | Antenna with reflector |
| US20080246683A1 (en) * | 2005-10-14 | 2008-10-09 | Jochen Christ | Cladding For a Microwave Antenna |
| US20080074330A1 (en) * | 2006-09-22 | 2008-03-27 | Yung-Sen Lin | Electronic Apparatus with an Antenna |
| US20080266202A1 (en) | 2007-04-27 | 2008-10-30 | Ching-Chi Lin | Antenna unit |
| US7804450B2 (en) | 2007-07-20 | 2010-09-28 | Laird Technologies, Inc. | Hybrid antenna structure |
| US20090128262A1 (en) * | 2007-11-15 | 2009-05-21 | Samsung Electronics Co., Ltd. | Apparatus and system for transmitting power wirelessly |
| USD617319S1 (en) * | 2009-09-02 | 2010-06-08 | Audiovox Specialized Applications, Llc | Antenna housing |
| USD623632S1 (en) | 2009-11-10 | 2010-09-14 | Skycross, Inc. | Antenna structure |
| USD630194S1 (en) | 2010-07-13 | 2011-01-04 | Cheng Uei Precision Industry Co., Ltd. | Multi-band antenna |
| USD635965S1 (en) | 2010-11-15 | 2011-04-12 | Cheng Uei Precision Industry Co., Ltd. | Antenna |
| USD683720S1 (en) | 2011-02-14 | 2013-06-04 | Taoglas Group Holdings | Antenna |
| CN301605367S (en) * | 2011-03-09 | 2011-07-06 | 沈雪兰 | Indoor antenna base (006 type) |
| US8704717B2 (en) * | 2011-04-17 | 2014-04-22 | Richard Gordon Kosnik | Satellite dish snow shield |
| USD649962S1 (en) | 2011-06-29 | 2011-12-06 | Cheng Uei Precision Industry Co., Ltd. | Multi-band antenna |
| USD670276S1 (en) | 2011-12-21 | 2012-11-06 | Cheng Uei Precision Industry Co., Ltd. | Multi-band antenna |
| USD684564S1 (en) | 2012-10-12 | 2013-06-18 | Avery Dennison Corporation | RFID antenna |
| USD690289S1 (en) | 2013-02-06 | 2013-09-24 | Taoglas Group Holdings Limited | Antenna |
| USD684565S1 (en) | 2013-03-06 | 2013-06-18 | Airgain, Inc. | Antenna |
| US20150023517A1 (en) * | 2013-07-22 | 2015-01-22 | Mizco International Inc. | Apparatus for providing wireless functionality to an audio playback device |
Non-Patent Citations (4)
| Title |
|---|
| Satellite Radio Antenna XM-50 (DA-233-XM-50)-Navigate The Sea, google publish date Nov. 10, 2008, online, site visited Apr. 29, 2015, https://www.google.com/...ch?q=DA-233-XM-50+Satellite+Radio+Antenna&sourceid=ie7&rls=com.microsoft:en-us:IE-Address&ie=&oe=&gws-rd=ssl&as-qdr=y15. * |
| Signalized™ In-Building International Wireless Cellular Booster Repeater System, online, site visited Apr. 29, 2015, http://bestcelldist.com/index.php?main-page=product-info&cPath=102&products-id=54946&zenid=8b27058b8c5414880ebc1b6a6500ef67. * |
| worldproducts.com directional antenna, create date Jun. 20, 2013, online site visited Apr. 29, 2015, http://www.worldproducts.com/pdfs/Wireless/WPANT30058-RA.pdf. * |
| worldproducts.com directional antenna, create date May 27, 2014, online, site visited Apr. 29, 2015, http://www.worldproducts.com/pdfs/Wireless/WPANTDP081-S2C.pdf. * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD802569S1 (en) * | 2016-02-24 | 2017-11-14 | Airgain Incorporated | Antenna |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD706751S1 (en) | Antenna | |
| USD837188S1 (en) | Antenna | |
| USD826216S1 (en) | Soundbar | |
| USD748078S1 (en) | Remote control | |
| USD746263S1 (en) | Satellite speaker | |
| USD731300S1 (en) | Lug nut | |
| USD741536S1 (en) | Lamp | |
| USD723306S1 (en) | Desk | |
| USD760382S1 (en) | Drencher | |
| USD735046S1 (en) | Bottle | |
| USD730328S1 (en) | Antenna | |
| USD755043S1 (en) | Wire retainer | |
| USD709053S1 (en) | Antenna | |
| USD719013S1 (en) | Line management device | |
| USD730858S1 (en) | Television receiver | |
| USD779904S1 (en) | Chisel | |
| USD781863S1 (en) | Case | |
| USD724386S1 (en) | Cup | |
| USD773443S1 (en) | Antenna | |
| USD742132S1 (en) | Chair | |
| USD698881S1 (en) | Skateboard | |
| USD766882S1 (en) | Antenna | |
| USD741615S1 (en) | Chair | |
| USD770770S1 (en) | Travel case | |
| USD731789S1 (en) | Compact tactical case |