USD734100S1 - Server with pedestal - Google Patents
Server with pedestal Download PDFInfo
- Publication number
- USD734100S1 USD734100S1 US29/489,157 US201429489157F USD734100S US D734100 S1 USD734100 S1 US D734100S1 US 201429489157 F US201429489157 F US 201429489157F US D734100 S USD734100 S US D734100S
- Authority
- US
- United States
- Prior art keywords
- server
- pedestal
- view
- mirror image
- perspective
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title claims description 4
- 230000007613 environmental effect Effects 0.000 description 1
Images
Description
The broken lines in the drawings are included for the purpose of illustration and form no part of the claimed design.
Claims (1)
- The ornamental design for a server with pedestal, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/489,157 USD734100S1 (en) | 2014-04-28 | 2014-04-28 | Server with pedestal |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/489,157 USD734100S1 (en) | 2014-04-28 | 2014-04-28 | Server with pedestal |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD734100S1 true USD734100S1 (en) | 2015-07-14 |
Family
ID=53507024
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/489,157 Active USD734100S1 (en) | 2014-04-28 | 2014-04-28 | Server with pedestal |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD734100S1 (en) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD825965S1 (en) * | 2016-03-16 | 2018-08-21 | Apparatus Llc | Dining table |
| USD853788S1 (en) * | 2018-02-09 | 2019-07-16 | Changfeng Zeng | Cake turntable |
| USD936421S1 (en) * | 2021-03-22 | 2021-11-23 | Jianhua Yang | Cake turntable |
| USD974164S1 (en) * | 2020-09-24 | 2023-01-03 | Matthew Horan | Packaging stand for footwear |
| USD1101497S1 (en) * | 2024-01-29 | 2025-11-11 | Blink Oneusa Inc | Cake turntable |
| USD1102830S1 (en) * | 2023-07-04 | 2025-11-25 | Jinfu Zhu | Cake stand |
Citations (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US145145A (en) | 1873-12-02 | Improvement in salvers | ||
| US1055740A (en) | 1912-03-26 | 1913-03-11 | Laurel Cut Glass Co | Bowl. |
| USD80971S (en) * | 1929-11-15 | 1930-04-15 | George Sakier | Design for a bowl or similar article |
| US2932293A (en) * | 1959-01-07 | 1960-04-12 | Central Mine Equipment Company | Food steamer |
| US3565281A (en) | 1968-12-11 | 1971-02-23 | Phillips Petroleum Co | Container |
| US3912249A (en) * | 1975-01-06 | 1975-10-14 | Humberto Vaca | Cake frosting device |
| USD281049S (en) * | 1983-01-24 | 1985-10-22 | Violet J. Towns | Cake stand |
| USD288767S (en) * | 1983-06-28 | 1987-03-17 | Fratelli Guzzini S.P.A. | Covered cake tray or similar article |
| USD347142S (en) * | 1991-07-18 | 1994-05-24 | Falvo Joseph S | Pan lid |
| USD378724S (en) * | 1996-01-17 | 1997-04-08 | Young Michelle D | Watermelon container with strainer |
| US5736659A (en) * | 1996-10-10 | 1998-04-07 | Kyle, Jr.; Richard | Musical rotating cake plate |
| USD431132S (en) * | 1999-09-10 | 2000-09-26 | Sally Sirkin Lewis | Table |
| USD441258S1 (en) * | 1999-11-16 | 2001-05-01 | Charlene Spiegelman | Table top serving tray |
| US20040211406A1 (en) * | 2003-04-24 | 2004-10-28 | Randall Cornfield | Multi-purpose stovetop grilling and cooking device |
| USD507933S1 (en) | 2004-07-06 | 2005-08-02 | Fred A. Carmichael | Cup, serving tray and removable handle combination |
| USD556516S1 (en) * | 2006-01-20 | 2007-12-04 | Dart Industries Inc. | Cake server with pedestal |
| USD569172S1 (en) * | 2007-10-26 | 2008-05-20 | Bledsoe Monalie E | Food cover for microwave oven |
| USD578414S1 (en) * | 2007-08-10 | 2008-10-14 | Kikkerland Design, Inc. | Cube jigger |
| USD584543S1 (en) * | 2006-08-10 | 2009-01-13 | Foroogh Taherirastgar | Table pedestal |
| USD590659S1 (en) * | 2008-05-16 | 2009-04-21 | Old Nassau Imports, Llc | Cocktail glass |
| USD636637S1 (en) * | 2009-12-23 | 2011-04-26 | Columbia Insurance Company | Cake stand |
| USD671368S1 (en) | 2010-03-14 | 2012-11-27 | Stewart Anna M | Attachable pedestal |
| USD701731S1 (en) * | 2012-08-03 | 2014-04-01 | Whirley Industries, Inc. | Goblet |
-
2014
- 2014-04-28 US US29/489,157 patent/USD734100S1/en active Active
Patent Citations (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US145145A (en) | 1873-12-02 | Improvement in salvers | ||
| US1055740A (en) | 1912-03-26 | 1913-03-11 | Laurel Cut Glass Co | Bowl. |
| USD80971S (en) * | 1929-11-15 | 1930-04-15 | George Sakier | Design for a bowl or similar article |
| US2932293A (en) * | 1959-01-07 | 1960-04-12 | Central Mine Equipment Company | Food steamer |
| US3565281A (en) | 1968-12-11 | 1971-02-23 | Phillips Petroleum Co | Container |
| US3912249A (en) * | 1975-01-06 | 1975-10-14 | Humberto Vaca | Cake frosting device |
| USD281049S (en) * | 1983-01-24 | 1985-10-22 | Violet J. Towns | Cake stand |
| USD288767S (en) * | 1983-06-28 | 1987-03-17 | Fratelli Guzzini S.P.A. | Covered cake tray or similar article |
| USD347142S (en) * | 1991-07-18 | 1994-05-24 | Falvo Joseph S | Pan lid |
| USD378724S (en) * | 1996-01-17 | 1997-04-08 | Young Michelle D | Watermelon container with strainer |
| US5736659A (en) * | 1996-10-10 | 1998-04-07 | Kyle, Jr.; Richard | Musical rotating cake plate |
| USD431132S (en) * | 1999-09-10 | 2000-09-26 | Sally Sirkin Lewis | Table |
| USD441258S1 (en) * | 1999-11-16 | 2001-05-01 | Charlene Spiegelman | Table top serving tray |
| US20040211406A1 (en) * | 2003-04-24 | 2004-10-28 | Randall Cornfield | Multi-purpose stovetop grilling and cooking device |
| USD507933S1 (en) | 2004-07-06 | 2005-08-02 | Fred A. Carmichael | Cup, serving tray and removable handle combination |
| USD556516S1 (en) * | 2006-01-20 | 2007-12-04 | Dart Industries Inc. | Cake server with pedestal |
| USD584543S1 (en) * | 2006-08-10 | 2009-01-13 | Foroogh Taherirastgar | Table pedestal |
| USD578414S1 (en) * | 2007-08-10 | 2008-10-14 | Kikkerland Design, Inc. | Cube jigger |
| USD569172S1 (en) * | 2007-10-26 | 2008-05-20 | Bledsoe Monalie E | Food cover for microwave oven |
| USD590659S1 (en) * | 2008-05-16 | 2009-04-21 | Old Nassau Imports, Llc | Cocktail glass |
| USD636637S1 (en) * | 2009-12-23 | 2011-04-26 | Columbia Insurance Company | Cake stand |
| USD671368S1 (en) | 2010-03-14 | 2012-11-27 | Stewart Anna M | Attachable pedestal |
| USD701731S1 (en) * | 2012-08-03 | 2014-04-01 | Whirley Industries, Inc. | Goblet |
Non-Patent Citations (6)
| Title |
|---|
| "Arthur Court Designs Grape 13 Footed Cake Plate", printed from www.bonanza.com/listings/Arthur-Court-Designs-Grape-13-F...41917244341&gpkwd=&goog-pla=1&gclid=CJjZkPOYy7cCFQmf4AodWRsA2g, publicly available at least as early as Jun. 4, 2014 (2 pages). |
| "Beehive Cake Stand", printed from www.westelm.com/products/beehive-cake-stand-e687/, publicly available at least as early as Mar. 12, 2013, per http://web.archive.org (2 pages). |
| "Cake Stand Makeover", printed from www.thediyplaybook.com/2013/03/cake-stand-makeover.html, Mar. 28, 2013 (6 pages). |
| "Cake Stands Are White With A Clear 1⅜″ Diameter×7⅞″h Acrylic Dome", printed from www.displays2go.com/Product.aspx?ID=18225, publicly available at least as early as Jan. 27, 2013, per http://web.archive.org (2 pages). |
| "Fondant Marble Cake Stand", printed from www.anthropologie.com/anthro/catalog/productdetail.jsp?nav...---Pla--- PLAs---PLAs&utm-medium=ppc&device=c&network=g&matchtype=, publicly available at least as early as Jun. 4, 2013 (2 pages). |
| Office Action from Canadian Patent Application No. 156,915, mailed Dec. 9, 2014 (3 pages). |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD825965S1 (en) * | 2016-03-16 | 2018-08-21 | Apparatus Llc | Dining table |
| USD853788S1 (en) * | 2018-02-09 | 2019-07-16 | Changfeng Zeng | Cake turntable |
| USD974164S1 (en) * | 2020-09-24 | 2023-01-03 | Matthew Horan | Packaging stand for footwear |
| USD936421S1 (en) * | 2021-03-22 | 2021-11-23 | Jianhua Yang | Cake turntable |
| USD1102830S1 (en) * | 2023-07-04 | 2025-11-25 | Jinfu Zhu | Cake stand |
| USD1101497S1 (en) * | 2024-01-29 | 2025-11-11 | Blink Oneusa Inc | Cake turntable |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD759997S1 (en) | 3-tier shelving unit | |
| USD750041S1 (en) | Headphones | |
| USD784586S1 (en) | Searchlight | |
| USD730668S1 (en) | Desk top | |
| USD729525S1 (en) | Stand portion of a foldable mirror | |
| USD752905S1 (en) | Table | |
| USD818237S1 (en) | Cart | |
| USD795648S1 (en) | Beverageware | |
| USD755129S1 (en) | Desktop receptacle | |
| USD755128S1 (en) | Desktop receptacle | |
| USD732864S1 (en) | Display apparatus | |
| USD739759S1 (en) | Bottle | |
| USD795619S1 (en) | Desk with legs | |
| USD783060S1 (en) | Merger | |
| USD754455S1 (en) | Table | |
| USD743188S1 (en) | Desk | |
| USD763016S1 (en) | Display unit | |
| USD712185S1 (en) | Trampoline chair | |
| USD746074S1 (en) | Bar stool | |
| USD788501S1 (en) | Display unit | |
| USD729554S1 (en) | Display fixture | |
| USD751264S1 (en) | Cart | |
| USD742088S1 (en) | Cart | |
| USD785271S1 (en) | Cart | |
| USD727645S1 (en) | Seat |