USD717658S1 - Perfume bottle - Google Patents
Perfume bottle Download PDFInfo
- Publication number
- USD717658S1 USD717658S1 US29/427,921 US201229427921F USD717658S US D717658 S1 USD717658 S1 US D717658S1 US 201229427921 F US201229427921 F US 201229427921F US D717658 S USD717658 S US D717658S
- Authority
- US
- United States
- Prior art keywords
- perfume bottle
- perfume
- bottle
- view
- ornamental design
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000002304 perfume Substances 0.000 title claims description 5
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
Images
Description
The perfume bottle is transparent, except for an opaque shaped body, having a discoid shape with a convex central portion, which extends upwardly from the bottom wall of the perfume bottle.
Claims (1)
- The ornamental design for a perfume bottle, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/427,921 USD717658S1 (en) | 2012-07-24 | 2012-07-24 | Perfume bottle |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/427,921 USD717658S1 (en) | 2012-07-24 | 2012-07-24 | Perfume bottle |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD717658S1 true USD717658S1 (en) | 2014-11-18 |
Family
ID=51870466
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/427,921 Active USD717658S1 (en) | 2012-07-24 | 2012-07-24 | Perfume bottle |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD717658S1 (en) |
Cited By (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD776544S1 (en) * | 2015-08-26 | 2017-01-17 | Mary Kay Inc. | Cosmetic bottle |
| USD777038S1 (en) | 2016-05-27 | 2017-01-24 | Suntory Holdings Limited | Bottle |
| USD792231S1 (en) * | 2014-10-31 | 2017-07-18 | Piramal Glass-Usa, Inc. | Bottle |
| USD795076S1 (en) * | 2014-09-29 | 2017-08-22 | Diageo Brands B.V. | Bottle |
| USD803066S1 (en) * | 2016-06-06 | 2017-11-21 | Cheil Germany Gmbh | Beverage bottle |
| USD815528S1 (en) | 2016-11-04 | 2018-04-17 | Owens-Brockway Glass Container Inc. | Container |
| USD815529S1 (en) | 2016-11-04 | 2018-04-17 | Owens-Brockway Glass Container Inc. | Container |
| USD818365S1 (en) | 2016-11-04 | 2018-05-22 | Owens-Brockway Glass Container Inc. | Container |
| USD820101S1 (en) | 2016-11-04 | 2018-06-12 | Owens-Brockway Glass Container Inc. | Container |
| USD820100S1 (en) | 2016-11-04 | 2018-06-12 | Owens-Brockway Glass Container Inc. | Container |
| USD820102S1 (en) | 2016-11-04 | 2018-06-12 | Owens-Brockway Glass Container Inc. | Container |
| USD822495S1 (en) * | 2017-03-30 | 2018-07-10 | Prestige Et Collections International | Bottle for perfume |
| USD860802S1 (en) | 2016-11-04 | 2019-09-24 | Owens-Brockway Glass Container Inc. | Container |
| USD867144S1 (en) | 2017-12-13 | 2019-11-19 | Piramal Glass - Usa, Inc. | Bottle |
| USD907506S1 (en) * | 2018-12-21 | 2021-01-12 | Colgate-Palmolive Company | Container |
| USD908010S1 (en) * | 2018-12-21 | 2021-01-19 | Colgate-Palmolive Company | Container |
| USD917296S1 (en) * | 2018-10-29 | 2021-04-27 | Saverglass | Bottle |
| USD962775S1 (en) | 2020-10-29 | 2022-09-06 | Suntory Holdings Limited | Bottle |
| USD1007317S1 (en) * | 2022-02-07 | 2023-12-12 | Off-White, Llc | Fragrance bottle |
| USD1040658S1 (en) * | 2022-04-21 | 2024-09-03 | L'Oréal (U.K.) Limited | Fragrance bottle |
| USD1051651S1 (en) * | 2023-11-10 | 2024-11-19 | 10123577 Manitoba LTD | Decanter |
| USD1083614S1 (en) * | 2022-10-31 | 2025-07-15 | Atlas Beverages Limited | Bottle |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD522872S1 (en) * | 2003-12-09 | 2006-06-13 | Saint-Gobain Desjonqueres | Bottle |
| USD559697S1 (en) * | 2005-09-30 | 2008-01-15 | Saverglass Inc. | Bottle |
| USD562143S1 (en) * | 2005-09-30 | 2008-02-19 | Saverglass Inc. | Bottle |
| CN300812181S (en) * | 2007-08-23 | 2008-08-06 | 朱学明 | Perfume bottle(050) |
| USD589356S1 (en) * | 2007-10-02 | 2009-03-31 | Saverglass, Inc. | Flask |
| USD595142S1 (en) * | 2006-10-18 | 2009-06-30 | Saverglass Inc. | Flask |
-
2012
- 2012-07-24 US US29/427,921 patent/USD717658S1/en active Active
Patent Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD522872S1 (en) * | 2003-12-09 | 2006-06-13 | Saint-Gobain Desjonqueres | Bottle |
| USD559697S1 (en) * | 2005-09-30 | 2008-01-15 | Saverglass Inc. | Bottle |
| USD562143S1 (en) * | 2005-09-30 | 2008-02-19 | Saverglass Inc. | Bottle |
| USD595142S1 (en) * | 2006-10-18 | 2009-06-30 | Saverglass Inc. | Flask |
| CN300812181S (en) * | 2007-08-23 | 2008-08-06 | 朱学明 | Perfume bottle(050) |
| CN300812177S (en) * | 2007-08-23 | 2008-08-06 | 朱学明 | Perfume bottle(026) |
| USD589356S1 (en) * | 2007-10-02 | 2009-03-31 | Saverglass, Inc. | Flask |
| USD596491S1 (en) * | 2007-10-02 | 2009-07-21 | Saverglass Inc. | Flask |
| USD601428S1 (en) * | 2007-10-02 | 2009-10-06 | Saverglass Inc. | Bottle |
Cited By (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD795076S1 (en) * | 2014-09-29 | 2017-08-22 | Diageo Brands B.V. | Bottle |
| USD792231S1 (en) * | 2014-10-31 | 2017-07-18 | Piramal Glass-Usa, Inc. | Bottle |
| USD796964S1 (en) | 2015-08-26 | 2017-09-12 | Mary Kay Inc. | Cosmetic bottle |
| USD863972S1 (en) | 2015-08-26 | 2019-10-22 | Mary Kay Inc. | Cosmetic bottle |
| USD776544S1 (en) * | 2015-08-26 | 2017-01-17 | Mary Kay Inc. | Cosmetic bottle |
| USD833291S1 (en) | 2015-08-26 | 2018-11-13 | Mary Kay Inc. | Cosmetic bottle |
| USD830189S1 (en) | 2016-05-27 | 2018-10-09 | Suntory Holdings Limited | Bottle |
| USD777038S1 (en) | 2016-05-27 | 2017-01-24 | Suntory Holdings Limited | Bottle |
| USD830831S1 (en) | 2016-05-27 | 2018-10-16 | Suntory Holdings Limited | Bottle |
| USD803066S1 (en) * | 2016-06-06 | 2017-11-21 | Cheil Germany Gmbh | Beverage bottle |
| USD815529S1 (en) | 2016-11-04 | 2018-04-17 | Owens-Brockway Glass Container Inc. | Container |
| USD820100S1 (en) | 2016-11-04 | 2018-06-12 | Owens-Brockway Glass Container Inc. | Container |
| USD820101S1 (en) | 2016-11-04 | 2018-06-12 | Owens-Brockway Glass Container Inc. | Container |
| USD818365S1 (en) | 2016-11-04 | 2018-05-22 | Owens-Brockway Glass Container Inc. | Container |
| USD860802S1 (en) | 2016-11-04 | 2019-09-24 | Owens-Brockway Glass Container Inc. | Container |
| USD815528S1 (en) | 2016-11-04 | 2018-04-17 | Owens-Brockway Glass Container Inc. | Container |
| USD820102S1 (en) | 2016-11-04 | 2018-06-12 | Owens-Brockway Glass Container Inc. | Container |
| USD822495S1 (en) * | 2017-03-30 | 2018-07-10 | Prestige Et Collections International | Bottle for perfume |
| USD867144S1 (en) | 2017-12-13 | 2019-11-19 | Piramal Glass - Usa, Inc. | Bottle |
| USD917296S1 (en) * | 2018-10-29 | 2021-04-27 | Saverglass | Bottle |
| USD907506S1 (en) * | 2018-12-21 | 2021-01-12 | Colgate-Palmolive Company | Container |
| USD908010S1 (en) * | 2018-12-21 | 2021-01-19 | Colgate-Palmolive Company | Container |
| USD923480S1 (en) | 2018-12-21 | 2021-06-29 | Colgate-Palmolive Company | Container |
| USD923481S1 (en) | 2018-12-21 | 2021-06-29 | Colgate-Palmolive Company | Container |
| USD962775S1 (en) | 2020-10-29 | 2022-09-06 | Suntory Holdings Limited | Bottle |
| USD1007317S1 (en) * | 2022-02-07 | 2023-12-12 | Off-White, Llc | Fragrance bottle |
| USD1040658S1 (en) * | 2022-04-21 | 2024-09-03 | L'Oréal (U.K.) Limited | Fragrance bottle |
| USD1083614S1 (en) * | 2022-10-31 | 2025-07-15 | Atlas Beverages Limited | Bottle |
| USD1051651S1 (en) * | 2023-11-10 | 2024-11-19 | 10123577 Manitoba LTD | Decanter |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD717658S1 (en) | Perfume bottle | |
| USD675100S1 (en) | Capsule shaped container | |
| USD668913S1 (en) | Square shaped water bottle | |
| USD646574S1 (en) | Cosmetic bottle | |
| USD788593S1 (en) | Bottle for perfume | |
| USD705074S1 (en) | Bottle | |
| USD695616S1 (en) | Bottle | |
| USD706135S1 (en) | Container cap | |
| USD725472S1 (en) | Beverage container | |
| USD744290S1 (en) | Vacuum bottle | |
| USD709330S1 (en) | Beverage container | |
| USD705059S1 (en) | Container cap | |
| USD705663S1 (en) | Perfume bottle | |
| USD709734S1 (en) | Vacuum bottle | |
| USD718139S1 (en) | Bottle | |
| USD739749S1 (en) | Bottle | |
| USD681448S1 (en) | Container | |
| USD696410S1 (en) | Baby bottle | |
| USD730735S1 (en) | Beverage container | |
| USD690561S1 (en) | Ring bottle holder | |
| USD727686S1 (en) | Drinking glass | |
| USD721966S1 (en) | Cosmetic container | |
| USD695118S1 (en) | Bottle | |
| USD703048S1 (en) | Container | |
| USD697418S1 (en) | Perfume bottle |