USD690486S1 - Blanket poncho - Google Patents
Blanket poncho Download PDFInfo
- Publication number
- USD690486S1 USD690486S1 US29/377,922 US37792210F USD690486S US D690486 S1 USD690486 S1 US D690486S1 US 37792210 F US37792210 F US 37792210F US D690486 S USD690486 S US D690486S
- Authority
- US
- United States
- Prior art keywords
- blanket
- poncho
- view
- ornamental design
- worn
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- PGOOBECODWQEAB-UHFFFAOYSA-N (E)-clothianidin Chemical compound [O-][N+](=O)\N=C(/NC)NCC1=CN=C(Cl)S1 PGOOBECODWQEAB-UHFFFAOYSA-N 0.000 title claims description 6
Images
Description
The broken line portions of the disclosure are for illustrative purposes only and form no part of the claimed design.
Claims (1)
- The ornamental design for a blanket poncho, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/377,922 USD690486S1 (en) | 2010-10-27 | 2010-10-27 | Blanket poncho |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/377,922 USD690486S1 (en) | 2010-10-27 | 2010-10-27 | Blanket poncho |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD690486S1 true USD690486S1 (en) | 2013-10-01 |
Family
ID=49230062
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/377,922 Active USD690486S1 (en) | 2010-10-27 | 2010-10-27 | Blanket poncho |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD690486S1 (en) |
Cited By (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20110259280A1 (en) * | 2010-04-23 | 2011-10-27 | Catherine Partridge | Multi-purpose bag |
| USD721873S1 (en) * | 2014-06-10 | 2015-02-03 | Scott R. Lesstino | Combined apron and hooded cape |
| USD722421S1 (en) * | 2014-03-27 | 2015-02-17 | Lorraine LaVette Jackson | Hair protector bib |
| USD792678S1 (en) * | 2015-10-01 | 2017-07-25 | Wallrest North America | Portable shelter |
| USD801005S1 (en) * | 2016-02-22 | 2017-10-31 | Franco Manufacturing Co. Inc. | Hooded cape wrap |
| USD801004S1 (en) * | 2016-02-20 | 2017-10-31 | Franco Manufacturing Co. Inc. | Hooded cape wrap |
| USD833109S1 (en) * | 2017-02-07 | 2018-11-13 | Melbourne Nights LLC | Travel blanket |
| USD839539S1 (en) * | 2017-09-19 | 2019-02-05 | Marilyn F. Jones | Pocket blanket |
| USD854787S1 (en) * | 2019-04-04 | 2019-07-30 | Shun On John Ngan | Hooded garment |
| USD877461S1 (en) * | 2018-03-09 | 2020-03-10 | Grzegorz Mieszczak | Ponchos |
| USD894537S1 (en) | 2020-01-31 | 2020-09-01 | Shun On John Ngan | Hoodie with pocket |
| USD894532S1 (en) | 2020-03-26 | 2020-09-01 | Shun On John Ngan | Wearable blanket |
| USD894536S1 (en) | 2019-12-24 | 2020-09-01 | Shun On John Ngan | Poncho hoodie |
| US10772366B1 (en) | 2020-03-16 | 2020-09-15 | Shun On John Ngan | Convertible garment |
| USD901838S1 (en) * | 2018-07-10 | 2020-11-17 | Nomi Lewin | Nursing cover |
| USD903239S1 (en) * | 2018-03-08 | 2020-12-01 | Steven Crosse | Coat with apron |
| USD912370S1 (en) | 2019-09-06 | 2021-03-09 | Shun On John Ngan | Hooded garment |
| USD912931S1 (en) | 2020-02-26 | 2021-03-16 | Nelson Yan | Blanket with sleeves, inside foot pockets and open back |
| USD912941S1 (en) * | 2020-02-26 | 2021-03-16 | Nelson Yan | Woman's poncho with front pockets and hood |
| USD914331S1 (en) | 2020-02-25 | 2021-03-30 | Nelson Yan | Wearable poncho with neck warmer |
| USD914330S1 (en) | 2020-02-24 | 2021-03-30 | Nelson Yan | Blanket sweatshirt with neck warmer |
| USD922033S1 (en) * | 2020-12-04 | 2021-06-15 | Yunjie Zhu | Fireproof outfit |
| USD927832S1 (en) * | 2018-07-18 | 2021-08-17 | Tara Lynn Weston | Poncho |
| USD948248S1 (en) * | 2020-02-03 | 2022-04-12 | AGN Properties | Hooded towel |
| USD958492S1 (en) * | 2020-09-09 | 2022-07-26 | Moore Llc | Blanket with an integrated cap |
| USD992240S1 (en) * | 2021-02-18 | 2023-07-18 | Hoodie Flags, LLC | Wearable flag having a hood and a pouch for storing the hood |
| USD1007818S1 (en) * | 2023-03-15 | 2023-12-19 | Cabo Poncho LLC | Poncho wrap |
| USD1021331S1 (en) | 2023-04-19 | 2024-04-09 | Cabo Poncho LLC | Poncho wrap |
| USD1045332S1 (en) * | 2024-03-11 | 2024-10-08 | Starpony (Hk) Limited | Wearable blanket |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD410382S (en) * | 1998-03-24 | 1999-06-01 | Dawn Therriault | Hooded towel |
| USD430721S (en) * | 1998-11-17 | 2000-09-12 | Keith Beauchan | Poncho |
| USD453607S1 (en) * | 2000-05-22 | 2002-02-19 | Debra Tracy | Rain blanket |
| USD456661S1 (en) * | 2001-07-11 | 2002-05-07 | Kym Henegan | Hooded baby drying towel |
| USD507693S1 (en) * | 2002-05-15 | 2005-07-26 | Pauline Ann Walton | Drying poncho |
| USD600884S1 (en) * | 2009-02-19 | 2009-09-29 | Patton Earl E | Poncho |
| USD601327S1 (en) * | 2008-01-31 | 2009-10-06 | Lori Anderson | Blanket wrap |
| USD617533S1 (en) * | 2008-07-30 | 2010-06-15 | Regina Michelle Douglas | Hooded towel |
-
2010
- 2010-10-27 US US29/377,922 patent/USD690486S1/en active Active
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD410382S (en) * | 1998-03-24 | 1999-06-01 | Dawn Therriault | Hooded towel |
| USD430721S (en) * | 1998-11-17 | 2000-09-12 | Keith Beauchan | Poncho |
| USD453607S1 (en) * | 2000-05-22 | 2002-02-19 | Debra Tracy | Rain blanket |
| USD456661S1 (en) * | 2001-07-11 | 2002-05-07 | Kym Henegan | Hooded baby drying towel |
| USD507693S1 (en) * | 2002-05-15 | 2005-07-26 | Pauline Ann Walton | Drying poncho |
| USD601327S1 (en) * | 2008-01-31 | 2009-10-06 | Lori Anderson | Blanket wrap |
| USD617533S1 (en) * | 2008-07-30 | 2010-06-15 | Regina Michelle Douglas | Hooded towel |
| USD600884S1 (en) * | 2009-02-19 | 2009-09-29 | Patton Earl E | Poncho |
Cited By (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20110259280A1 (en) * | 2010-04-23 | 2011-10-27 | Catherine Partridge | Multi-purpose bag |
| USD722421S1 (en) * | 2014-03-27 | 2015-02-17 | Lorraine LaVette Jackson | Hair protector bib |
| USD721873S1 (en) * | 2014-06-10 | 2015-02-03 | Scott R. Lesstino | Combined apron and hooded cape |
| USD792678S1 (en) * | 2015-10-01 | 2017-07-25 | Wallrest North America | Portable shelter |
| USD801004S1 (en) * | 2016-02-20 | 2017-10-31 | Franco Manufacturing Co. Inc. | Hooded cape wrap |
| USD801005S1 (en) * | 2016-02-22 | 2017-10-31 | Franco Manufacturing Co. Inc. | Hooded cape wrap |
| USD833109S1 (en) * | 2017-02-07 | 2018-11-13 | Melbourne Nights LLC | Travel blanket |
| USD839539S1 (en) * | 2017-09-19 | 2019-02-05 | Marilyn F. Jones | Pocket blanket |
| USD903239S1 (en) * | 2018-03-08 | 2020-12-01 | Steven Crosse | Coat with apron |
| USD877461S1 (en) * | 2018-03-09 | 2020-03-10 | Grzegorz Mieszczak | Ponchos |
| USD901838S1 (en) * | 2018-07-10 | 2020-11-17 | Nomi Lewin | Nursing cover |
| USD927832S1 (en) * | 2018-07-18 | 2021-08-17 | Tara Lynn Weston | Poncho |
| USD854787S1 (en) * | 2019-04-04 | 2019-07-30 | Shun On John Ngan | Hooded garment |
| USD912370S1 (en) | 2019-09-06 | 2021-03-09 | Shun On John Ngan | Hooded garment |
| USD960526S1 (en) | 2019-09-06 | 2022-08-16 | Shun On John Ngan | Hooded garment |
| USD960525S1 (en) | 2019-09-06 | 2022-08-16 | Shun On John Ngan | Hooded garment |
| USD960528S1 (en) | 2019-09-06 | 2022-08-16 | Shun On John Ngan | Hooded garment |
| USD960527S1 (en) | 2019-09-06 | 2022-08-16 | Shun On John Ngan | Hooded garment |
| USD894536S1 (en) | 2019-12-24 | 2020-09-01 | Shun On John Ngan | Poncho hoodie |
| USD894537S1 (en) | 2020-01-31 | 2020-09-01 | Shun On John Ngan | Hoodie with pocket |
| USD948248S1 (en) * | 2020-02-03 | 2022-04-12 | AGN Properties | Hooded towel |
| USD914330S1 (en) | 2020-02-24 | 2021-03-30 | Nelson Yan | Blanket sweatshirt with neck warmer |
| USD914331S1 (en) | 2020-02-25 | 2021-03-30 | Nelson Yan | Wearable poncho with neck warmer |
| USD912931S1 (en) | 2020-02-26 | 2021-03-16 | Nelson Yan | Blanket with sleeves, inside foot pockets and open back |
| USD912941S1 (en) * | 2020-02-26 | 2021-03-16 | Nelson Yan | Woman's poncho with front pockets and hood |
| US10772366B1 (en) | 2020-03-16 | 2020-09-15 | Shun On John Ngan | Convertible garment |
| USD932135S1 (en) | 2020-03-26 | 2021-10-05 | Shun On John Ngan | Wearable blanket |
| USD894532S1 (en) | 2020-03-26 | 2020-09-01 | Shun On John Ngan | Wearable blanket |
| USD958492S1 (en) * | 2020-09-09 | 2022-07-26 | Moore Llc | Blanket with an integrated cap |
| USD922033S1 (en) * | 2020-12-04 | 2021-06-15 | Yunjie Zhu | Fireproof outfit |
| USD992240S1 (en) * | 2021-02-18 | 2023-07-18 | Hoodie Flags, LLC | Wearable flag having a hood and a pouch for storing the hood |
| USD1007818S1 (en) * | 2023-03-15 | 2023-12-19 | Cabo Poncho LLC | Poncho wrap |
| USD1021331S1 (en) | 2023-04-19 | 2024-04-09 | Cabo Poncho LLC | Poncho wrap |
| USD1045332S1 (en) * | 2024-03-11 | 2024-10-08 | Starpony (Hk) Limited | Wearable blanket |
| USD1045333S1 (en) * | 2024-03-11 | 2024-10-08 | Starpony (Hk) Limited | Wearable blanket |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD690486S1 (en) | Blanket poncho | |
| USD696487S1 (en) | Trousers | |
| USD627586S1 (en) | Child's blanket | |
| USD663923S1 (en) | Pants | |
| USD663922S1 (en) | Pants | |
| USD630002S1 (en) | Hooded shirt | |
| USD630003S1 (en) | Hooded shirt | |
| USD653276S1 (en) | Camera | |
| USD673868S1 (en) | Watch | |
| USD673991S1 (en) | Camera | |
| USD641140S1 (en) | Hair cover | |
| USD645791S1 (en) | Motorbike | |
| USD657697S1 (en) | Watch device | |
| USD634651S1 (en) | Watch | |
| USD608981S1 (en) | Sports suit | |
| USD645645S1 (en) | Nursing shawl | |
| USD602677S1 (en) | Sports suit | |
| USD684409S1 (en) | Extremity warming blanket | |
| USD632192S1 (en) | Watch | |
| USD627252S1 (en) | Earring | |
| USD680303S1 (en) | Sleeved garment | |
| USD703871S1 (en) | Sports helmet | |
| USD619910S1 (en) | Adjustable timer housing | |
| USD682137S1 (en) | Watch dial | |
| USD652675S1 (en) | Pan protector |