USD682003S1 - Container of a liquid filtration device - Google Patents
Container of a liquid filtration device Download PDFInfo
- Publication number
- USD682003S1 USD682003S1 US29/396,068 US201129396068F USD682003S US D682003 S1 USD682003 S1 US D682003S1 US 201129396068 F US201129396068 F US 201129396068F US D682003 S USD682003 S US D682003S
- Authority
- US
- United States
- Prior art keywords
- container
- filtration device
- liquid filtration
- view
- liquid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000001914 filtration Methods 0.000 title claims description 5
- 239000007788 liquid Substances 0.000 title claims description 5
- 229940003587 aquaphor Drugs 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- MTZBBNMLMNBNJL-UHFFFAOYSA-N xipamide Chemical compound CC1=CC=CC(C)=C1NC(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1O MTZBBNMLMNBNJL-UHFFFAOYSA-N 0.000 description 1
Images
Description
The claimed container for a liquid filtration device is a pitcher for use in constructing portable, table-top devices for liquid filtration, including water, with a removable cartridge. The broken lines showing environmental structure is for illustrative purposes only and form no part of the claimed design. “Aquaphor” forming a part of the claimed design is a registered trademark (US Reg. No. 2565363) of Electrophor Inc., a New York corporation.
Claims (1)
- The ornamental design for a container of a liquid filtration device, as shown and described.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| RU2011500884 | 2011-03-25 | ||
| RU2011500884 | 2011-03-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD682003S1 true USD682003S1 (en) | 2013-05-14 |
Family
ID=48225706
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/396,068 Active USD682003S1 (en) | 2011-03-25 | 2011-06-24 | Container of a liquid filtration device |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD682003S1 (en) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD708888S1 (en) * | 2013-02-06 | 2014-07-15 | Camelbak Products, Llc | Pitcher |
| USD708887S1 (en) * | 2013-02-06 | 2014-07-15 | Camelbak Products, Llc | Pitcher body |
| USD789727S1 (en) * | 2016-03-18 | 2017-06-20 | Brita Gmbh | Water container with lid and funnel |
| USD796245S1 (en) * | 2015-07-17 | 2017-09-05 | Brita Gmbh | Water container with filter |
| USD798643S1 (en) * | 2015-09-21 | 2017-10-03 | Brita Gmbh | Water container with lid and funnel |
| USD800489S1 (en) * | 2016-03-18 | 2017-10-24 | Brita Gmbh | Water container |
| USD802851S1 (en) * | 2016-01-07 | 2017-11-14 | Classic Brands, LLC | Birdseed tote |
| USD1011829S1 (en) * | 2022-03-18 | 2024-01-23 | Palm Mass Customization, Llc | Container |
Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD299607S (en) * | 1985-12-12 | 1989-01-31 | Ryan Rupert T | Measuring jug |
| US5054661A (en) * | 1990-03-15 | 1991-10-08 | Hollje Anthony K | Paint bucket construction |
| USD328492S (en) * | 1989-07-17 | 1992-08-04 | Anita Mathis | Measured dosage medicine container |
| US5637214A (en) * | 1995-11-09 | 1997-06-10 | Kahana; Dov | Filter assembly for water treatment apparatus |
| USD388654S (en) * | 1996-07-01 | 1998-01-06 | U.S. Philips Corporation | Electric water kettle |
| USD406003S (en) * | 1997-11-10 | 1999-02-23 | Recovery Engineering, Inc. | Water purification pitcher |
| USD418714S (en) * | 1998-06-03 | 2000-01-11 | The Clorox Company | Pitcher |
| US6103114A (en) * | 1998-01-09 | 2000-08-15 | Recovery Engineering, Inc. | Pour-through water treatment carafe |
| RU50975U1 (en) | 2005-09-12 | 2006-01-27 | Государственный научно-исследовательский испытательный институт военной медицины МО РФ | AIR TREATMENT AND EVACUATION COMPLEX |
| USD552916S1 (en) * | 2006-01-27 | 2007-10-16 | Pi-Design Ag | Pitcher |
| USD573394S1 (en) * | 2007-04-05 | 2008-07-22 | Brita Gmbh | Water filtration system with a handle |
-
2011
- 2011-06-24 US US29/396,068 patent/USD682003S1/en active Active
Patent Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD299607S (en) * | 1985-12-12 | 1989-01-31 | Ryan Rupert T | Measuring jug |
| USD328492S (en) * | 1989-07-17 | 1992-08-04 | Anita Mathis | Measured dosage medicine container |
| US5054661A (en) * | 1990-03-15 | 1991-10-08 | Hollje Anthony K | Paint bucket construction |
| US5637214A (en) * | 1995-11-09 | 1997-06-10 | Kahana; Dov | Filter assembly for water treatment apparatus |
| USD388654S (en) * | 1996-07-01 | 1998-01-06 | U.S. Philips Corporation | Electric water kettle |
| USD406003S (en) * | 1997-11-10 | 1999-02-23 | Recovery Engineering, Inc. | Water purification pitcher |
| US6103114A (en) * | 1998-01-09 | 2000-08-15 | Recovery Engineering, Inc. | Pour-through water treatment carafe |
| USD418714S (en) * | 1998-06-03 | 2000-01-11 | The Clorox Company | Pitcher |
| RU50975U1 (en) | 2005-09-12 | 2006-01-27 | Государственный научно-исследовательский испытательный институт военной медицины МО РФ | AIR TREATMENT AND EVACUATION COMPLEX |
| USD552916S1 (en) * | 2006-01-27 | 2007-10-16 | Pi-Design Ag | Pitcher |
| USD573394S1 (en) * | 2007-04-05 | 2008-07-22 | Brita Gmbh | Water filtration system with a handle |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD708888S1 (en) * | 2013-02-06 | 2014-07-15 | Camelbak Products, Llc | Pitcher |
| USD708887S1 (en) * | 2013-02-06 | 2014-07-15 | Camelbak Products, Llc | Pitcher body |
| USD796245S1 (en) * | 2015-07-17 | 2017-09-05 | Brita Gmbh | Water container with filter |
| USD798643S1 (en) * | 2015-09-21 | 2017-10-03 | Brita Gmbh | Water container with lid and funnel |
| USD800488S1 (en) * | 2015-09-21 | 2017-10-24 | Brita Gmbh | Water container |
| USD801100S1 (en) * | 2015-09-21 | 2017-10-31 | Brita Gmbh | Water container with lid and funnel |
| USD802851S1 (en) * | 2016-01-07 | 2017-11-14 | Classic Brands, LLC | Birdseed tote |
| USD789727S1 (en) * | 2016-03-18 | 2017-06-20 | Brita Gmbh | Water container with lid and funnel |
| USD800489S1 (en) * | 2016-03-18 | 2017-10-24 | Brita Gmbh | Water container |
| USD1011829S1 (en) * | 2022-03-18 | 2024-01-23 | Palm Mass Customization, Llc | Container |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD683176S1 (en) | Container of a liquid filtration device | |
| USD682003S1 (en) | Container of a liquid filtration device | |
| USD980416S1 (en) | Holder for a medicament container | |
| USD653074S1 (en) | Combined oblong cooking device | |
| USD691418S1 (en) | Infuser | |
| USD642421S1 (en) | Combined cooking device | |
| USD720451S1 (en) | Liquid drug transfer assembly | |
| USD662320S1 (en) | Portable utensil holder | |
| USD737436S1 (en) | Liquid drug reconstitution assembly | |
| USD667674S1 (en) | Liquid dispenser and filter | |
| USD694620S1 (en) | Beverage cartridge | |
| USD669310S1 (en) | Portable beverage container | |
| USD698649S1 (en) | Container | |
| USD645764S1 (en) | Container | |
| USD666460S1 (en) | Food container | |
| USD652237S1 (en) | Corner shower caddy | |
| USD668094S1 (en) | Water filtration pitcher | |
| USD693628S1 (en) | Top for liquid storage container | |
| USD650531S1 (en) | Hand holder for a tablet | |
| USD689664S1 (en) | Liquid dispenser | |
| USD657195S1 (en) | Reusable beverage container | |
| USD669778S1 (en) | Container | |
| USD765837S1 (en) | Liquid transfer device with integral vial adapter | |
| USD666865S1 (en) | Pitcher | |
| USD767124S1 (en) | Liquid transfer device with integral vial adapter |