USD680697S1 - Bareback rodeo rigging - Google Patents
Bareback rodeo rigging Download PDFInfo
- Publication number
- USD680697S1 USD680697S1 US29/415,833 US201229415833F USD680697S US D680697 S1 USD680697 S1 US D680697S1 US 201229415833 F US201229415833 F US 201229415833F US D680697 S USD680697 S US D680697S
- Authority
- US
- United States
- Prior art keywords
- bareback
- rodeo
- rigging
- view
- design illustrated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- ZEKANFGSDXODPD-UHFFFAOYSA-N glyphosate-isopropylammonium Chemical compound CC(C)N.OC(=O)CNCP(O)(O)=O ZEKANFGSDXODPD-UHFFFAOYSA-N 0.000 title claims description 3
Images
Description
Claims (1)
- The ornamental design for a bareback rodeo rigging, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/415,833 USD680697S1 (en) | 2012-03-14 | 2012-03-14 | Bareback rodeo rigging |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/415,833 USD680697S1 (en) | 2012-03-14 | 2012-03-14 | Bareback rodeo rigging |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD680697S1 true USD680697S1 (en) | 2013-04-23 |
Family
ID=48095424
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/415,833 Active USD680697S1 (en) | 2012-03-14 | 2012-03-14 | Bareback rodeo rigging |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD680697S1 (en) |
Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3312040A (en) * | 1965-03-25 | 1967-04-04 | Nuzzo Charles | Lightweight versatile saddle |
| US3438177A (en) * | 1967-04-11 | 1969-04-15 | Championship Rodeo Equipment | Handgrip attachment for a surcingle |
| US3835621A (en) * | 1972-08-14 | 1974-09-17 | M Gorenschek | Saddle construction, seat member for use therein, and method |
| USD250549S (en) * | 1976-10-04 | 1978-12-12 | Stoddard Charles W | Saddle |
| USD251623S (en) * | 1977-10-27 | 1979-04-17 | Abercrombie Jr Mac C | Combined saddle and pad |
| USD280668S (en) * | 1982-06-16 | 1985-09-17 | Sarnelli Judith A | Saddle |
| US5187924A (en) * | 1991-01-29 | 1993-02-23 | Marshall Robert L | Saddle |
| US6298640B1 (en) * | 1999-08-17 | 2001-10-09 | John R. Schneider | Grab saddle system |
| US6588185B1 (en) * | 1999-04-14 | 2003-07-08 | Hermes Sellier | Saddletree allowing exchangeability of parts of a saddle, and a saddle comprising such a saddletree |
| US6688087B2 (en) * | 2000-07-13 | 2004-02-10 | Decosemo Peter A. | Treeless jumping saddle and method of making the same |
| US7080496B2 (en) * | 2004-01-09 | 2006-07-25 | Pershing Roland Van Scoyk | Handgrip and stirrup support for bareback horse riding |
| US7121068B2 (en) * | 2004-01-09 | 2006-10-17 | Pershing Roland Van Scoyk | Handgrip and stirrup support for bareback horse riding |
| US7574848B2 (en) * | 2002-04-16 | 2009-08-18 | David Kempsell | Saddles |
-
2012
- 2012-03-14 US US29/415,833 patent/USD680697S1/en active Active
Patent Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3312040A (en) * | 1965-03-25 | 1967-04-04 | Nuzzo Charles | Lightweight versatile saddle |
| US3438177A (en) * | 1967-04-11 | 1969-04-15 | Championship Rodeo Equipment | Handgrip attachment for a surcingle |
| US3835621A (en) * | 1972-08-14 | 1974-09-17 | M Gorenschek | Saddle construction, seat member for use therein, and method |
| USD250549S (en) * | 1976-10-04 | 1978-12-12 | Stoddard Charles W | Saddle |
| USD251623S (en) * | 1977-10-27 | 1979-04-17 | Abercrombie Jr Mac C | Combined saddle and pad |
| USD280668S (en) * | 1982-06-16 | 1985-09-17 | Sarnelli Judith A | Saddle |
| US5187924A (en) * | 1991-01-29 | 1993-02-23 | Marshall Robert L | Saddle |
| US6588185B1 (en) * | 1999-04-14 | 2003-07-08 | Hermes Sellier | Saddletree allowing exchangeability of parts of a saddle, and a saddle comprising such a saddletree |
| US6298640B1 (en) * | 1999-08-17 | 2001-10-09 | John R. Schneider | Grab saddle system |
| US6688087B2 (en) * | 2000-07-13 | 2004-02-10 | Decosemo Peter A. | Treeless jumping saddle and method of making the same |
| US7574848B2 (en) * | 2002-04-16 | 2009-08-18 | David Kempsell | Saddles |
| US7080496B2 (en) * | 2004-01-09 | 2006-07-25 | Pershing Roland Van Scoyk | Handgrip and stirrup support for bareback horse riding |
| US7121068B2 (en) * | 2004-01-09 | 2006-10-17 | Pershing Roland Van Scoyk | Handgrip and stirrup support for bareback horse riding |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD686538S1 (en) | Motorcycle | |
| USD765166S1 (en) | Barcode printer | |
| USD692860S1 (en) | Speaker | |
| USD698491S1 (en) | Three head shaver | |
| USD671227S1 (en) | Diagnostic analyzer | |
| USD753926S1 (en) | Saddle | |
| USD745404S1 (en) | Bottle | |
| USD687072S1 (en) | Snorkel | |
| USD674367S1 (en) | Set top box | |
| USD720548S1 (en) | Saddle | |
| USD685531S1 (en) | Pet bed | |
| USD727417S1 (en) | Printer | |
| USD693314S1 (en) | Control module | |
| USD706514S1 (en) | Hoist | |
| USD714275S1 (en) | Case | |
| USD689290S1 (en) | Seat | |
| USD717625S1 (en) | Pneumatic nailer | |
| USD682991S1 (en) | Faucet | |
| USD741074S1 (en) | Bicycle saddle | |
| USD751637S1 (en) | Printer | |
| USD698561S1 (en) | Bench | |
| USD750006S1 (en) | Water scooter | |
| USD677712S1 (en) | Guitar head | |
| USD687071S1 (en) | Snorkel | |
| USD711466S1 (en) | Clipboard |