USD665686S1 - Elevator passenger interface - Google Patents
Elevator passenger interface Download PDFInfo
- Publication number
- USD665686S1 USD665686S1 US29/402,467 US201129402467F USD665686S US D665686 S1 USD665686 S1 US D665686S1 US 201129402467 F US201129402467 F US 201129402467F US D665686 S USD665686 S US D665686S
- Authority
- US
- United States
- Prior art keywords
- elevator passenger
- passenger interface
- view
- interface
- elevator
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 4
- 230000007613 environmental effect Effects 0.000 description 1
Images
Description
In the drawings, the broken line showing of a pedestal depicts environmental subject matter and forms no part of the claim.
Claims (1)
- We claim the ornamental design of an elevator passenger interface, as shown and described.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR20110019712 | 2011-05-16 | ||
| KR30-2011-0019712 | 2011-05-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD665686S1 true USD665686S1 (en) | 2012-08-21 |
Family
ID=46641852
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/402,467 Active USD665686S1 (en) | 2011-05-16 | 2011-09-23 | Elevator passenger interface |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD665686S1 (en) |
Cited By (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD705108S1 (en) * | 2012-02-17 | 2014-05-20 | Otis Elevator Company | Touch pad for destination selection controller |
| USD708084S1 (en) * | 2012-02-17 | 2014-07-01 | Otis Elevator Company | Key pad for destination selection controller |
| USD747991S1 (en) * | 2012-08-17 | 2016-01-26 | Otis Elevator Company | Touch pad for destination selection controller |
| USD747990S1 (en) * | 2012-08-17 | 2016-01-26 | Otis Elevator Company | Key pad for destination selection controller |
| USD748515S1 (en) * | 2014-03-24 | 2016-02-02 | Mitsubishi Electric Corporation | Landing operation panel for elevator |
| USD769145S1 (en) * | 2015-07-24 | 2016-10-18 | Fujitec Co., Ltd. | Elevator control panel |
| USD774938S1 (en) * | 2015-07-24 | 2016-12-27 | Fujitec Co., Ltd. | Elevator control panel with graphical user interface |
| USD774937S1 (en) * | 2015-07-24 | 2016-12-27 | Fujitec Co., Ltd. | Elevator control panel with graphical user interface |
| USD881269S1 (en) * | 2018-03-05 | 2020-04-14 | Ingenico Group | Payment terminal |
| USD911334S1 (en) * | 2019-04-12 | 2021-02-23 | Kone Corporation | Electronic touch board |
| USD922232S1 (en) * | 2019-06-28 | 2021-06-15 | Ademco Inc. | Security system keypad |
| USD956599S1 (en) | 2019-07-23 | 2022-07-05 | Ademco Inc. | Security system keypad |
| USD956594S1 (en) | 2019-07-19 | 2022-07-05 | Ademco Inc. | Enclosure for a security system control unit |
| USD960743S1 (en) * | 2021-01-04 | 2022-08-16 | Ebs Sp. Zo.O. | Keypad for an alarm system |
| USD967725S1 (en) * | 2019-11-01 | 2022-10-25 | Honeywell International Inc. | Fall indicator for a fall arrester or rail shuttle |
| USD1009671S1 (en) | 2019-09-10 | 2024-01-02 | Ademco Inc. | Security system control panel with touchscreen interface |
Citations (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD268026S (en) * | 1981-02-02 | 1983-02-22 | Otis Elevator Company | Control panel for elevator systems |
| USD268668S (en) * | 1981-02-02 | 1983-04-19 | Otis Elevator Company | Control panel for elevator systems |
| USD289291S (en) * | 1984-04-06 | 1987-04-14 | International Business Machines Corp. | Interactive graphics data terminal |
| USD308364S (en) * | 1987-11-10 | 1990-06-05 | Data Entry Systems, Inc. | Data entry digitizing tablet |
| USD370355S (en) * | 1993-04-04 | 1996-06-04 | Kenney Richard E H | Print holder |
| USD435270S (en) * | 2000-05-31 | 2000-12-19 | Visual Graphic Systems Inc. | Sign |
| USD439244S1 (en) * | 1999-12-14 | 2001-03-20 | Bellsouth Intellectual Property Management Corporation | Push-button matrix |
| USD451603S1 (en) * | 2000-06-15 | 2001-12-04 | Dj Orthopedics, Llc | Electronic display device |
| USD452234S1 (en) * | 1996-11-20 | 2001-12-18 | Bellsouth Intellectual Property Corporation | Push-button matrix |
| USD479659S1 (en) * | 2001-09-27 | 2003-09-16 | Wall Aktiengesellschaft | Show case |
| USD518480S1 (en) * | 2003-10-27 | 2006-04-04 | Nanyang Brothers Tobacco Company Limited | Wireless shopfloor data terminal |
| USD589829S1 (en) * | 2008-04-17 | 2009-04-07 | Inventio Ag | Operating/display panel |
| USD589831S1 (en) * | 2008-04-17 | 2009-04-07 | Inventio Ag | Operating/display panel |
| USD589832S1 (en) * | 2007-12-05 | 2009-04-07 | Mitsubishi Electric Corporation | Control panel for elevator |
| USD601052S1 (en) * | 2008-04-17 | 2009-09-29 | Inventio Ag | Operating/display panel |
-
2011
- 2011-09-23 US US29/402,467 patent/USD665686S1/en active Active
Patent Citations (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD268026S (en) * | 1981-02-02 | 1983-02-22 | Otis Elevator Company | Control panel for elevator systems |
| USD268668S (en) * | 1981-02-02 | 1983-04-19 | Otis Elevator Company | Control panel for elevator systems |
| USD289291S (en) * | 1984-04-06 | 1987-04-14 | International Business Machines Corp. | Interactive graphics data terminal |
| USD308364S (en) * | 1987-11-10 | 1990-06-05 | Data Entry Systems, Inc. | Data entry digitizing tablet |
| USD370355S (en) * | 1993-04-04 | 1996-06-04 | Kenney Richard E H | Print holder |
| USD452234S1 (en) * | 1996-11-20 | 2001-12-18 | Bellsouth Intellectual Property Corporation | Push-button matrix |
| USD439244S1 (en) * | 1999-12-14 | 2001-03-20 | Bellsouth Intellectual Property Management Corporation | Push-button matrix |
| USD435270S (en) * | 2000-05-31 | 2000-12-19 | Visual Graphic Systems Inc. | Sign |
| USD451603S1 (en) * | 2000-06-15 | 2001-12-04 | Dj Orthopedics, Llc | Electronic display device |
| USD479659S1 (en) * | 2001-09-27 | 2003-09-16 | Wall Aktiengesellschaft | Show case |
| USD518480S1 (en) * | 2003-10-27 | 2006-04-04 | Nanyang Brothers Tobacco Company Limited | Wireless shopfloor data terminal |
| USD589832S1 (en) * | 2007-12-05 | 2009-04-07 | Mitsubishi Electric Corporation | Control panel for elevator |
| USD589829S1 (en) * | 2008-04-17 | 2009-04-07 | Inventio Ag | Operating/display panel |
| USD589831S1 (en) * | 2008-04-17 | 2009-04-07 | Inventio Ag | Operating/display panel |
| USD601052S1 (en) * | 2008-04-17 | 2009-09-29 | Inventio Ag | Operating/display panel |
Cited By (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD705108S1 (en) * | 2012-02-17 | 2014-05-20 | Otis Elevator Company | Touch pad for destination selection controller |
| USD708084S1 (en) * | 2012-02-17 | 2014-07-01 | Otis Elevator Company | Key pad for destination selection controller |
| USD747991S1 (en) * | 2012-08-17 | 2016-01-26 | Otis Elevator Company | Touch pad for destination selection controller |
| USD747990S1 (en) * | 2012-08-17 | 2016-01-26 | Otis Elevator Company | Key pad for destination selection controller |
| USD748515S1 (en) * | 2014-03-24 | 2016-02-02 | Mitsubishi Electric Corporation | Landing operation panel for elevator |
| USD769145S1 (en) * | 2015-07-24 | 2016-10-18 | Fujitec Co., Ltd. | Elevator control panel |
| USD774938S1 (en) * | 2015-07-24 | 2016-12-27 | Fujitec Co., Ltd. | Elevator control panel with graphical user interface |
| USD774937S1 (en) * | 2015-07-24 | 2016-12-27 | Fujitec Co., Ltd. | Elevator control panel with graphical user interface |
| USD881269S1 (en) * | 2018-03-05 | 2020-04-14 | Ingenico Group | Payment terminal |
| USD911334S1 (en) * | 2019-04-12 | 2021-02-23 | Kone Corporation | Electronic touch board |
| USD922232S1 (en) * | 2019-06-28 | 2021-06-15 | Ademco Inc. | Security system keypad |
| USD1000990S1 (en) | 2019-06-28 | 2023-10-10 | Ademco Inc. | Security system keypad |
| USD956594S1 (en) | 2019-07-19 | 2022-07-05 | Ademco Inc. | Enclosure for a security system control unit |
| USD956599S1 (en) | 2019-07-23 | 2022-07-05 | Ademco Inc. | Security system keypad |
| USD1104811S1 (en) | 2019-07-23 | 2025-12-09 | Resideo Llc | Security system keypad |
| USD1009671S1 (en) | 2019-09-10 | 2024-01-02 | Ademco Inc. | Security system control panel with touchscreen interface |
| USD967725S1 (en) * | 2019-11-01 | 2022-10-25 | Honeywell International Inc. | Fall indicator for a fall arrester or rail shuttle |
| USD960743S1 (en) * | 2021-01-04 | 2022-08-16 | Ebs Sp. Zo.O. | Keypad for an alarm system |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD665686S1 (en) | Elevator passenger interface | |
| USD663638S1 (en) | Elevator passenger interface | |
| USD710640S1 (en) | Chair | |
| USD660055S1 (en) | Seating unit | |
| USD660054S1 (en) | Seating unit | |
| USD699784S1 (en) | Office printer | |
| USD658532S1 (en) | Pendant | |
| USD686422S1 (en) | Seat | |
| USD650816S1 (en) | Cabin | |
| USD659047S1 (en) | Pendant | |
| USD660027S1 (en) | Aircraft seat | |
| USD678941S1 (en) | Office printer | |
| USD686277S1 (en) | Office printer | |
| USD662002S1 (en) | Elevator passenger interface | |
| USD696053S1 (en) | Shade for child car seat | |
| USD690121S1 (en) | Chaise | |
| USD636296S1 (en) | Automobile | |
| USD673784S1 (en) | Shade for child car seat | |
| USD712960S1 (en) | Printer | |
| USD666527S1 (en) | Vehicle | |
| USD659416S1 (en) | Vehicle seat | |
| USD667903S1 (en) | Air cushion protection structure | |
| USD648166S1 (en) | Floor mat | |
| USD672160S1 (en) | Vehicle seat | |
| USD693455S1 (en) | Microinfuser |