USD659227S1 - Pedestal sink - Google Patents
Pedestal sink Download PDFInfo
- Publication number
- USD659227S1 USD659227S1 US29/358,672 US35867210F USD659227S US D659227 S1 USD659227 S1 US D659227S1 US 35867210 F US35867210 F US 35867210F US D659227 S USD659227 S US D659227S
- Authority
- US
- United States
- Prior art keywords
- pedestal sink
- pedestal
- sink
- view
- detail
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title claims description 11
Images
Description
The broken lines shown in the Figures form no part of the claimed design.
Claims (1)
- The ornamental design for a pedestal sink, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/358,672 USD659227S1 (en) | 2010-03-30 | 2010-03-30 | Pedestal sink |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/358,672 USD659227S1 (en) | 2010-03-30 | 2010-03-30 | Pedestal sink |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD659227S1 true USD659227S1 (en) | 2012-05-08 |
Family
ID=46002556
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/358,672 Active USD659227S1 (en) | 2010-03-30 | 2010-03-30 | Pedestal sink |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD659227S1 (en) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD797907S1 (en) * | 2016-05-04 | 2017-09-19 | Ronbow Corporation | Sink top |
| USD875903S1 (en) * | 2015-03-09 | 2020-02-18 | Grohe Ag | Ceramic sink |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD428476S (en) * | 1999-09-14 | 2000-07-18 | Mark Abolafia | Sink |
| USD455200S1 (en) * | 2000-07-31 | 2002-04-02 | Acorn Engineering Co., Inc. | Sink |
| USD495792S1 (en) * | 2003-04-10 | 2004-09-07 | Kohler Co. | Lavatory |
| USD542388S1 (en) * | 2006-01-05 | 2007-05-08 | Toto Ltd. | Pedestal sink |
| USD543262S1 (en) * | 2006-08-08 | 2007-05-22 | Dolan Patrick S | Pedestal lavatory |
| USD601676S1 (en) * | 2008-01-04 | 2009-10-06 | Kohler France Sas | Plumbing fixture support |
-
2010
- 2010-03-30 US US29/358,672 patent/USD659227S1/en active Active
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD428476S (en) * | 1999-09-14 | 2000-07-18 | Mark Abolafia | Sink |
| USD455200S1 (en) * | 2000-07-31 | 2002-04-02 | Acorn Engineering Co., Inc. | Sink |
| USD495792S1 (en) * | 2003-04-10 | 2004-09-07 | Kohler Co. | Lavatory |
| USD542388S1 (en) * | 2006-01-05 | 2007-05-08 | Toto Ltd. | Pedestal sink |
| USD543262S1 (en) * | 2006-08-08 | 2007-05-22 | Dolan Patrick S | Pedestal lavatory |
| USD601676S1 (en) * | 2008-01-04 | 2009-10-06 | Kohler France Sas | Plumbing fixture support |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD875903S1 (en) * | 2015-03-09 | 2020-02-18 | Grohe Ag | Ceramic sink |
| USD896931S1 (en) * | 2015-03-09 | 2020-09-22 | Grohe Ag | Ceramic sink |
| USD926946S1 (en) | 2015-03-09 | 2021-08-03 | Grohe Ag | Bathtub |
| USD969279S1 (en) | 2015-03-09 | 2022-11-08 | Grohe Ag | Bathtub |
| USD1052056S1 (en) | 2015-03-09 | 2024-11-19 | Grohe Ag | Ceramic sink |
| USD1066612S1 (en) | 2015-03-09 | 2025-03-11 | Grohe Ag | Ceramic sink |
| USD797907S1 (en) * | 2016-05-04 | 2017-09-19 | Ronbow Corporation | Sink top |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD637184S1 (en) | Earphone | |
| USD637183S1 (en) | Earphone | |
| USD690488S1 (en) | Shoe | |
| USD623627S1 (en) | Optic-shaped headphones | |
| USD812457S1 (en) | Coupling | |
| USD663726S1 (en) | Mount | |
| USD636062S1 (en) | Faucet | |
| USD642661S1 (en) | Faucet | |
| USD649144S1 (en) | Case | |
| USD628031S1 (en) | Hand pruner | |
| USD637181S1 (en) | Headphone | |
| USD628032S1 (en) | Hand pruner | |
| USD724207S1 (en) | Surgical retractor | |
| USD657697S1 (en) | Watch device | |
| USD629131S1 (en) | Lighting device | |
| USD653276S1 (en) | Camera | |
| USD673991S1 (en) | Camera | |
| USD630067S1 (en) | Hand pruner | |
| USD737591S1 (en) | Furniture | |
| USD661281S1 (en) | Headphone | |
| USD657276S1 (en) | Manometer | |
| USD651093S1 (en) | Bottle | |
| USD646496S1 (en) | Armchair | |
| USD673623S1 (en) | Cycle | |
| USD655323S1 (en) | Coater |