USD657285S1 - Trophy pedestal - Google Patents
Trophy pedestal Download PDFInfo
- Publication number
- USD657285S1 USD657285S1 US29/367,104 US36710410F USD657285S US D657285 S1 USD657285 S1 US D657285S1 US 36710410 F US36710410 F US 36710410F US D657285 S USD657285 S US D657285S
- Authority
- US
- United States
- Prior art keywords
- trophy
- pedestal
- trophy pedestal
- view
- broken lines
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title description 3
Images
Description
The broken lines immediately adjacent the shaded areas represent the bounds of the claim and all other broken lines showing the bottom of the trophy pedestal are for the purposes of illustrating environment. None of the broken lines form a part of the claimed design.
Claims (1)
- I claim the ornamental designs for trophy pedestals, as shown and described.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA134534 | 2010-03-16 | ||
| CA 134534 CA134534S (en) | 2010-03-16 | 2010-03-16 | Trophy pedestal |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD657285S1 true USD657285S1 (en) | 2012-04-10 |
Family
ID=45922401
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/367,104 Active USD657285S1 (en) | 2010-03-16 | 2010-08-03 | Trophy pedestal |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | USD657285S1 (en) |
| CA (1) | CA134534S (en) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD943207S1 (en) * | 2020-06-16 | 2022-02-08 | Xiuyun Liu | Hair rollers |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4323630A (en) * | 1980-09-02 | 1982-04-06 | Mackey William H | Trophy support column |
| US5322739A (en) * | 1992-06-03 | 1994-06-21 | Avnet, Inc. | Trophy construction |
| USD356282S (en) * | 1993-09-01 | 1995-03-14 | Multitrade International Co. | Base |
| USD398260S (en) * | 1996-09-12 | 1998-09-15 | Trophyland Ltd | Mount for a trophy |
| USD527682S1 (en) * | 2005-05-25 | 2006-09-05 | Yi Choi Tam | Trophy pedestal |
-
2010
- 2010-03-16 CA CA 134534 patent/CA134534S/en not_active Expired - Lifetime
- 2010-08-03 US US29/367,104 patent/USD657285S1/en active Active
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4323630A (en) * | 1980-09-02 | 1982-04-06 | Mackey William H | Trophy support column |
| US5322739A (en) * | 1992-06-03 | 1994-06-21 | Avnet, Inc. | Trophy construction |
| USD356282S (en) * | 1993-09-01 | 1995-03-14 | Multitrade International Co. | Base |
| USD398260S (en) * | 1996-09-12 | 1998-09-15 | Trophyland Ltd | Mount for a trophy |
| USD527682S1 (en) * | 2005-05-25 | 2006-09-05 | Yi Choi Tam | Trophy pedestal |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD943207S1 (en) * | 2020-06-16 | 2022-02-08 | Xiuyun Liu | Hair rollers |
Also Published As
| Publication number | Publication date |
|---|---|
| CA134534S (en) | 2011-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD633888S1 (en) | Handset | |
| USD634294S1 (en) | Handset | |
| USD832779S1 (en) | Panel skirt | |
| USD625700S1 (en) | Handset | |
| USD591599S1 (en) | Container | |
| USD645342S1 (en) | Food container | |
| USD639770S1 (en) | Handset | |
| USD645343S1 (en) | Food container | |
| USD672741S1 (en) | Handset | |
| USD618655S1 (en) | Handset | |
| USD605623S1 (en) | Handset | |
| USD672329S1 (en) | Handset | |
| USD665761S1 (en) | Handset | |
| USD631903S1 (en) | Video magnifier | |
| USD657765S1 (en) | Handset | |
| USD654475S1 (en) | Speaker | |
| USD631265S1 (en) | TV stand | |
| USD674784S1 (en) | Speakerphone | |
| USD641119S1 (en) | Console for a container, receptacle, or the like | |
| USD604539S1 (en) | Shelf and corbel | |
| USD617638S1 (en) | Bottle | |
| USD619893S1 (en) | Bottle | |
| USD660346S1 (en) | Shredder | |
| USD630883S1 (en) | Grill | |
| USD707668S1 (en) | Modem |