USD600522S1 - Clamp - Google Patents
Clamp Download PDFInfo
- Publication number
- USD600522S1 USD600522S1 US29/306,820 US30682008F USD600522S US D600522 S1 USD600522 S1 US D600522S1 US 30682008 F US30682008 F US 30682008F US D600522 S USD600522 S US D600522S
- Authority
- US
- United States
- Prior art keywords
- clamp
- view
- breadboard
- elevation view
- pedestal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 1
Images
Description
Claims (1)
- The ornamental design for a clamp, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/306,820 USD600522S1 (en) | 2008-04-16 | 2008-04-16 | Clamp |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/306,820 USD600522S1 (en) | 2008-04-16 | 2008-04-16 | Clamp |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD600522S1 true USD600522S1 (en) | 2009-09-22 |
Family
ID=41077232
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/306,820 Expired - Lifetime USD600522S1 (en) | 2008-04-16 | 2008-04-16 | Clamp |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD600522S1 (en) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20090267278A1 (en) * | 2008-04-28 | 2009-10-29 | Joseph Christman | Clamping fork with repeatable reference and two step clamping fork |
| USD638698S1 (en) * | 2008-04-17 | 2011-05-31 | Steven Andrew Sprinkmann | Clamping device |
| USD645716S1 (en) | 2009-08-13 | 2011-09-27 | Lee Valley Tools, Ltd. | Surface vise |
| USD824233S1 (en) | 2016-11-02 | 2018-07-31 | Lee Valley Tools Ltd. | Adjustable bench stop clamp |
| USD888523S1 (en) * | 2018-03-09 | 2020-06-30 | Kreg Enterprises, Inc. | Inline clamp |
Citations (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4647027A (en) * | 1983-02-15 | 1987-03-03 | Keith Shafto | Clamping and holding tool |
| USD341127S (en) * | 1992-02-20 | 1993-11-09 | Isaac Sachs | Electrical ground lug |
| USD354810S (en) * | 1993-08-17 | 1995-01-24 | Zimmer, Inc. | Surgical parallel drill guide |
| US5586754A (en) * | 1995-08-11 | 1996-12-24 | Williams; Willis R. | Grid block workpiece clamping apparatus |
| USD385484S (en) * | 1996-01-18 | 1997-10-28 | Zito Richard R | Safety clamp |
| USD387971S (en) * | 1995-02-13 | 1997-12-23 | Dexter Automatic Products Company | Combined housing and securing device |
| USD390091S (en) * | 1996-10-08 | 1998-02-03 | Reginald Munger | Adjustable transducer mounting bracket |
| US5713118A (en) * | 1992-10-01 | 1998-02-03 | Chick Machine Tool, Inc. | Apparatus for positioning an element on a surface |
| USD406748S (en) * | 1997-06-05 | 1999-03-16 | Byrne Norman R | Grommet housing for lift-up devices |
| US6158728A (en) * | 1999-12-01 | 2000-12-12 | Smith; Gregory C. | Workpiece holding device |
| USD554976S1 (en) * | 2006-01-17 | 2007-11-13 | Physical Systems, Inc. | Single line clamp support bracket |
| USD562124S1 (en) * | 2007-03-08 | 2008-02-19 | Focal Point Products, Inc. | Clip unit for installing medallions |
-
2008
- 2008-04-16 US US29/306,820 patent/USD600522S1/en not_active Expired - Lifetime
Patent Citations (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4647027A (en) * | 1983-02-15 | 1987-03-03 | Keith Shafto | Clamping and holding tool |
| USD341127S (en) * | 1992-02-20 | 1993-11-09 | Isaac Sachs | Electrical ground lug |
| US5713118A (en) * | 1992-10-01 | 1998-02-03 | Chick Machine Tool, Inc. | Apparatus for positioning an element on a surface |
| USD354810S (en) * | 1993-08-17 | 1995-01-24 | Zimmer, Inc. | Surgical parallel drill guide |
| USD387971S (en) * | 1995-02-13 | 1997-12-23 | Dexter Automatic Products Company | Combined housing and securing device |
| US5586754A (en) * | 1995-08-11 | 1996-12-24 | Williams; Willis R. | Grid block workpiece clamping apparatus |
| USD385484S (en) * | 1996-01-18 | 1997-10-28 | Zito Richard R | Safety clamp |
| USD390091S (en) * | 1996-10-08 | 1998-02-03 | Reginald Munger | Adjustable transducer mounting bracket |
| USD406748S (en) * | 1997-06-05 | 1999-03-16 | Byrne Norman R | Grommet housing for lift-up devices |
| US6158728A (en) * | 1999-12-01 | 2000-12-12 | Smith; Gregory C. | Workpiece holding device |
| USD554976S1 (en) * | 2006-01-17 | 2007-11-13 | Physical Systems, Inc. | Single line clamp support bracket |
| USD562124S1 (en) * | 2007-03-08 | 2008-02-19 | Focal Point Products, Inc. | Clip unit for installing medallions |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD638698S1 (en) * | 2008-04-17 | 2011-05-31 | Steven Andrew Sprinkmann | Clamping device |
| US20090267278A1 (en) * | 2008-04-28 | 2009-10-29 | Joseph Christman | Clamping fork with repeatable reference and two step clamping fork |
| USD645716S1 (en) | 2009-08-13 | 2011-09-27 | Lee Valley Tools, Ltd. | Surface vise |
| USD824233S1 (en) | 2016-11-02 | 2018-07-31 | Lee Valley Tools Ltd. | Adjustable bench stop clamp |
| USD888523S1 (en) * | 2018-03-09 | 2020-06-30 | Kreg Enterprises, Inc. | Inline clamp |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD615514S1 (en) | Single monitor and stand | |
| USD657977S1 (en) | Tripod stand | |
| USD615367S1 (en) | Fork | |
| USD631974S1 (en) | Massage device | |
| USD631973S1 (en) | Massage device | |
| USD616950S1 (en) | Thick grip | |
| USD630312S1 (en) | Screw in fan | |
| USD615054S1 (en) | Double monitor and stand | |
| USD630359S1 (en) | Lighting device | |
| USD631972S1 (en) | Massage device | |
| USD592012S1 (en) | Bottle | |
| USD630062S1 (en) | Bottle | |
| USD608640S1 (en) | Lid for a bottle | |
| USD573875S1 (en) | Apparatus for securing an object to a support surface | |
| USD617022S1 (en) | Flashlight component | |
| USD628866S1 (en) | Threaded bolt tool | |
| USD607095S1 (en) | Desktop diffuser | |
| USD623214S1 (en) | Portable video magnifier | |
| USD649497S1 (en) | Motorcycle fairing cover | |
| USD628517S1 (en) | Zipper | |
| USD606700S1 (en) | Light fixture | |
| USD675096S1 (en) | Screw cap | |
| USD625990S1 (en) | Spike nut cover | |
| USD714922S1 (en) | Vaporizer | |
| USD595996S1 (en) | Utensil storage stand |