USD598539S1 - Medical injector - Google Patents
Medical injector Download PDFInfo
- Publication number
- USD598539S1 USD598539S1 US29/274,156 US27415607F USD598539S US D598539 S1 USD598539 S1 US D598539S1 US 27415607 F US27415607 F US 27415607F US D598539 S USD598539 S US D598539S
- Authority
- US
- United States
- Prior art keywords
- medical injector
- view
- pantone
- corresponds
- injector
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- VAYOSLLFUXYJDT-RDTXWAMCSA-N Lysergic acid diethylamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N(CC)CC)C2)=C3C2=CNC3=C1 VAYOSLLFUXYJDT-RDTXWAMCSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
Images
Description
The file of this patent contains at least one photograph executed in color. Copies of this patent with color photographs will be provided by the Office upon request and payment of the necessary fee.
The colors of the design are as follows:
Body: Pantone: 17-3923 TPX (corresponds to dark blue);
Dose dial grip: Pantone 651 (corresponds to light blue); and
Dose button: Pantone 072 (corresponds to royal blue).
Claims (1)
- The ornamental design for the medical injector, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/311,657 USD608442S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EM06208510000 | 2006-10-30 | ||
| EM000620851 | 2006-10-30 |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/311,657 Division USD608442S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD598539S1 true USD598539S1 (en) | 2009-08-18 |
Family
ID=40943140
Family Applications (15)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/274,152 Expired - Lifetime USD599010S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,155 Expired - Lifetime USD600795S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,154 Expired - Lifetime USD626216S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,153 Expired - Lifetime USD599011S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,156 Expired - Lifetime USD598539S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,149 Expired - Lifetime USD599008S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,151 Expired - Lifetime USD599009S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,150 Expired - Lifetime USD600794S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/311,659 Expired - Lifetime USD610251S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,660 Expired - Lifetime USD610676S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,657 Expired - Lifetime USD608442S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,670 Expired - Lifetime USD610252S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,661 Expired - Lifetime USD610677S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,662 Expired - Lifetime USD606650S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,658 Expired - Lifetime USD606649S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
Family Applications Before (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/274,152 Expired - Lifetime USD599010S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,155 Expired - Lifetime USD600795S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,154 Expired - Lifetime USD626216S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,153 Expired - Lifetime USD599011S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
Family Applications After (10)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/274,149 Expired - Lifetime USD599008S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,151 Expired - Lifetime USD599009S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/274,150 Expired - Lifetime USD600794S1 (en) | 2006-10-30 | 2007-03-30 | Medical injector |
| US29/311,659 Expired - Lifetime USD610251S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,660 Expired - Lifetime USD610676S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,657 Expired - Lifetime USD608442S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,670 Expired - Lifetime USD610252S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,661 Expired - Lifetime USD610677S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,662 Expired - Lifetime USD606650S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
| US29/311,658 Expired - Lifetime USD606649S1 (en) | 2006-10-30 | 2009-05-20 | Medical injector |
Country Status (2)
| Country | Link |
|---|---|
| US (15) | USD599010S1 (en) |
| CA (7) | CA120175S (en) |
Cited By (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD652136S1 (en) * | 2008-10-11 | 2012-01-10 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD676957S1 (en) | 2012-04-13 | 2013-02-26 | Becton, Dickinson And Company | Self injection device |
| USD680643S1 (en) | 2012-04-13 | 2013-04-23 | Becton, Dickinson And Company | Self injection device window |
| USD688793S1 (en) | 2012-10-05 | 2013-08-27 | Becton, Dickinson And Company | Self-injection device |
| USD688790S1 (en) | 2012-10-05 | 2013-08-27 | Becton, Dickinson And Company | Self-injection device |
| USD688792S1 (en) | 2012-10-05 | 2013-08-27 | Becton, Dickinson And Company | Self-injection device |
| USD688791S1 (en) | 2012-10-05 | 2013-08-27 | Becton, Dickinson And Company | Self-injection device |
| USD696397S1 (en) | 2012-04-13 | 2013-12-24 | Becton, Dickinson And Company | Autoinjector |
| USD696772S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Autoinjector |
| USD696773S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Self injection device |
| USD696770S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Autoinjector |
| USD696775S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Autoinjector |
| USD696774S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Autoinjector |
| USD696771S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Self injection device |
| USD697205S1 (en) | 2012-04-13 | 2014-01-07 | Becton, Dickinson And Company | Autoinjector |
| USD703314S1 (en) | 2012-04-13 | 2014-04-22 | Becton, Dickinson And Company | Self injection device |
| USD708317S1 (en) | 2012-04-13 | 2014-07-01 | Becton, Dickinson And Company | Autoinjector |
| USD716442S1 (en) | 2010-12-06 | 2014-10-28 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD717428S1 (en) | 2010-11-19 | 2014-11-11 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD717940S1 (en) | 2010-11-19 | 2014-11-18 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD719257S1 (en) | 2010-12-06 | 2014-12-09 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD722158S1 (en) | 2010-11-19 | 2015-02-03 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD725771S1 (en) | 2010-11-19 | 2015-03-31 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD740937S1 (en) | 2012-04-13 | 2015-10-13 | Becton Dickinson And Company | Self injection device window |
| USD752210S1 (en) | 2014-08-27 | 2016-03-22 | Merck Sharp & Dohme Corp. | Medical injector pen |
| USD752211S1 (en) * | 2012-08-01 | 2016-03-22 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD752738S1 (en) * | 2013-09-20 | 2016-03-29 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD770038S1 (en) | 2014-06-26 | 2016-10-25 | Eli Lilly And Company | Medication injection device |
| USD773039S1 (en) * | 2014-01-17 | 2016-11-29 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD773647S1 (en) | 2014-08-27 | 2016-12-06 | Merck Sharp & Dohme Corp. | Medical injector pen |
| USD773646S1 (en) | 2014-08-27 | 2016-12-06 | Merck Sharp & Dohme Corp | Medical injector pen |
| USD777907S1 (en) | 2014-08-27 | 2017-01-31 | Merck Sharp & Dohme Corp. | Medical injector pen |
| USD777908S1 (en) | 2014-08-27 | 2017-01-31 | Merck Sharp & Dohme Corp. | Medical injector pen |
| USD878561S1 (en) * | 2017-11-06 | 2020-03-17 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD888938S1 (en) * | 2017-07-03 | 2020-06-30 | Sanofi-Aventis Deutschland Gmbh | Pen-shaped injector |
| USD892311S1 (en) | 2017-10-25 | 2020-08-04 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD903856S1 (en) | 2018-06-29 | 2020-12-01 | Regeneron Pharmaceuticals, Inc. | Auto-injector |
| USD932006S1 (en) | 2018-11-21 | 2021-09-28 | Regeneron Pharmaceuticals, Inc. | Auto-injector cap |
| US11484654B2 (en) | 2017-06-30 | 2022-11-01 | Regeneron Pharmaceuticals, Inc. | Auto-injector with anti-roll features |
| USD1054018S1 (en) * | 2022-11-04 | 2024-12-10 | Sanofi-Aventis Deutschland Gmbh | Medical injection device |
| USD1079937S1 (en) | 2020-09-11 | 2025-06-17 | Sanofi | Medical injector |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD599010S1 (en) * | 2006-10-30 | 2009-08-25 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| CA121972S (en) * | 2007-02-23 | 2008-11-25 | Sanofi Aventis Deutschland | Medical injector |
| USD641077S1 (en) | 2008-09-15 | 2011-07-05 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD651305S1 (en) | 2008-10-11 | 2011-12-27 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD612486S1 (en) * | 2008-11-28 | 2010-03-23 | F. Hoffmann-La Roche Ag | Auto-injector |
| USD619244S1 (en) * | 2009-05-28 | 2010-07-06 | F. Hoffmann-La Roche Ag | Auto-injector |
| USD620106S1 (en) * | 2009-05-28 | 2010-07-20 | F. Hoffman-La Roche Ag | Auto-injector |
| USD627061S1 (en) * | 2009-05-28 | 2010-11-09 | F. Hoffmann-La Roche Ag | Auto-injector |
| USD685464S1 (en) | 2010-01-11 | 2013-07-02 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD641783S1 (en) | 2010-04-09 | 2011-07-19 | Sanford, L.P. | Writing instrument |
| USD650069S1 (en) | 2010-09-16 | 2011-12-06 | Panasonic Corporation | Injector |
| USD650070S1 (en) | 2010-09-16 | 2011-12-06 | Panasonic Corporation | Injector |
| USD729930S1 (en) * | 2011-03-08 | 2015-05-19 | Novo Nordisk A/S | Injection device |
| USD724721S1 (en) * | 2011-11-01 | 2015-03-17 | Novo Nordisk A/S | Injection device |
| USD734450S1 (en) | 2011-11-01 | 2015-07-14 | Novo Nordisk A/S | Injection device |
| USD676548S1 (en) | 2011-11-08 | 2013-02-19 | Becton, Dickinson And Company | Medical injector pen |
| USD710992S1 (en) * | 2011-11-08 | 2014-08-12 | Becton Dickinson France | Medical injector pen |
| USD755369S1 (en) * | 2012-08-01 | 2016-05-03 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD690417S1 (en) | 2012-10-19 | 2013-09-24 | Sid Solomon | Disposable syringe with unit markings for the dosage and administration of refined forms of botulinum toxin A |
| USD739011S1 (en) | 2013-03-15 | 2015-09-15 | Eli Lilly And Company | Automatic injection device |
| EP3229872B1 (en) * | 2014-12-12 | 2019-01-30 | SHL Medical AG | Dose setting mechanism and medicament delivery device comprising the dose setting mechanism |
| USD866757S1 (en) | 2016-03-11 | 2019-11-12 | Millennium Pharmaceuticals, Inc. | Autoinjector |
| USD832925S1 (en) * | 2016-05-23 | 2018-11-06 | Societe Bic | Writing instrument |
| USD820439S1 (en) | 2016-06-13 | 2018-06-12 | Carebay Europe Ltd. | Medicament delivery device |
| USD820438S1 (en) | 2016-06-13 | 2018-06-12 | Carebay Europe Ltd. | Medicament delivery device |
| USD876628S1 (en) | 2016-07-20 | 2020-02-25 | Nyxoah S.A. | Medical implant |
| USD988519S1 (en) | 2016-09-12 | 2023-06-06 | Nyxoah S.A. | Patch |
| USD858753S1 (en) * | 2017-01-17 | 2019-09-03 | Nyxoah S.A. | Medical device |
| USD882764S1 (en) * | 2017-02-23 | 2020-04-28 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| WO2018158305A1 (en) | 2017-02-28 | 2018-09-07 | Nyxoah S.A. | Surgical implant system |
| USD862690S1 (en) * | 2018-07-03 | 2019-10-08 | Haselmeier Ag | Medical injector |
| USD895106S1 (en) | 2019-04-18 | 2020-09-01 | Sun Pharmaceutical Industries Limited | Medical pen injector |
| USD926973S1 (en) | 2019-09-05 | 2021-08-03 | Novo Nordisk A/S | Injection device |
| USD995762S1 (en) * | 2020-05-11 | 2023-08-15 | Sanofi-Aventis Deutschland Gmbh | Pen-shaped injector |
| CA224573S (en) * | 2020-11-24 | 2024-01-17 | Nipro Corp | Cryopreservation container |
| USD1057961S1 (en) * | 2022-01-31 | 2025-01-14 | Ira Shandles | Surface neuro probe |
| USD1051365S1 (en) * | 2022-05-04 | 2024-11-12 | Sanofi-Aventis Deutschland Gmbh | Medical injection device |
| USD1092723S1 (en) | 2022-12-21 | 2025-09-09 | Novo Nordisk A/S | Injection device |
| USD1116096S1 (en) * | 2023-10-06 | 2026-03-03 | Phillips-Medisize A/S | Injector pen |
| USD1116094S1 (en) * | 2023-10-06 | 2026-03-03 | Phillips-Medisize A/S | Injector pen |
Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD368961S (en) * | 1994-10-12 | 1996-04-16 | Pharmacia Ab | Multiple dose injector |
| USD462760S1 (en) * | 2001-06-13 | 2002-09-10 | Eli Lilly And Company | Medication delivery apparatus |
| USD479748S1 (en) * | 2002-03-08 | 2003-09-16 | Dca Design International Limited | Medicament delivery device |
| USD479747S1 (en) * | 2002-03-08 | 2003-09-16 | Dca Design International Limited | Medicament delivery device |
| USD482724S1 (en) * | 2002-06-07 | 2003-11-25 | Mitsubishi Pencil Co., Ltd. | Ballpoint pen |
| USD492027S1 (en) * | 2002-11-09 | 2004-06-22 | Dca Design International Limited | Pen-type injector |
| USD492405S1 (en) * | 2002-11-09 | 2004-06-29 | Dca Design International Limited | Pen-type injector |
| USD499485S1 (en) * | 2002-11-09 | 2004-12-07 | Dca Design International Limited | Pen-type injector |
| USD501253S1 (en) * | 2002-11-09 | 2005-01-25 | Dca Design International Limited | Pen-type injector |
| USD553681S1 (en) * | 2006-03-29 | 2007-10-23 | Cotapaxi Custom Design And Manufacturing, Llc | Pen |
Family Cites Families (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2398544A (en) * | 1945-01-06 | 1946-04-16 | Marshall L Lockhart | Hypodermic injector |
| US3045593A (en) * | 1960-11-21 | 1962-07-24 | United Aircraft Corp | Ballot marker |
| US3254836A (en) * | 1964-09-03 | 1966-06-07 | Claire D Corpian | Teachers' correction pen |
| USD289424S (en) * | 1984-11-21 | 1987-04-21 | Precise Meters Co., Ltd. | Combined pen, watch, compass, calendar and tire pressure gauge or similar article |
| US4627445A (en) * | 1985-04-08 | 1986-12-09 | Garid, Inc. | Glucose medical monitoring system |
| US4973318A (en) * | 1988-02-10 | 1990-11-27 | D.C.P. Af 1988 A/S | Disposable syringe |
| USD324070S (en) * | 1989-10-19 | 1992-02-18 | Tombow Pencil Co. Ltd. | Mechanical pencil |
| US5334144A (en) * | 1992-10-30 | 1994-08-02 | Becton, Dickinson And Company | Single use disposable needleless injector |
| US5569214A (en) * | 1994-09-20 | 1996-10-29 | Becton Dickinson And Company | Dose setting knob adapter for medication delivery pen |
| US6110149A (en) * | 1996-09-13 | 2000-08-29 | Novo Nordisk A/S | Syringe |
| USD390872S (en) * | 1996-11-21 | 1998-02-17 | Kotobuki & Co., Ltd. | Combined computer input pen and writing instrument with cap member therefor |
| US6454746B1 (en) * | 1997-06-04 | 2002-09-24 | Eli Lilly And Company | Medication delivery apparatus |
| USD426299S (en) * | 1997-06-04 | 2000-06-06 | Eli Lilly And Company | Medication delivery instrument |
| USD414201S (en) * | 1998-09-29 | 1999-09-21 | Sanford Corporation | Double-ended marking pen |
| US6277099B1 (en) * | 1999-08-06 | 2001-08-21 | Becton, Dickinson And Company | Medication delivery pen |
| USD426572S (en) * | 1999-08-12 | 2000-06-13 | The Gillette Company | Writing instrument |
| USD451138S1 (en) * | 2001-01-25 | 2001-11-27 | Advance Watch Company, Ltd. | Writing instrument with illumination recess |
| US20020165499A1 (en) * | 2001-04-13 | 2002-11-07 | Slate John B. | Jet injector having a mechanism for creating air-in-tip |
| EP1392377B1 (en) * | 2001-05-16 | 2007-02-28 | Eli Lilly And Company | Medication injector apparatus with drive assembly that facilitates reset |
| EP1409048A2 (en) * | 2001-06-08 | 2004-04-21 | Eli Lilly And Company | Needle hiding assembly for a medication injector |
| USD479602S1 (en) * | 2002-03-08 | 2003-09-09 | Dca Design International Limited | Medicament delivery device |
| CA100549S (en) * | 2002-03-09 | 2003-08-27 | Aventis Pharma Deutschland Gmbh | Medication delivery device |
| USD506005S1 (en) * | 2002-03-09 | 2005-06-07 | Aventis Pharma Deutschland Gmbh | Medical device for the injection of fluid medicaments |
| US9486581B2 (en) * | 2002-09-11 | 2016-11-08 | Becton, Dickinson And Company | Injector device with force lock-out and injection rate limiting mechanisms |
| USD483067S1 (en) * | 2002-10-30 | 2003-12-02 | Mitsubishi Pencil Co., Ltd. | Ballpoint pen |
| DE10250629A1 (en) * | 2002-10-30 | 2004-05-19 | Tecpharma Licensing Ag | Method and device for indicating and dosing when administering a product |
| USD482122S1 (en) * | 2002-12-27 | 2003-11-11 | Becton Dickinson And Company | Handle |
| US6932794B2 (en) * | 2003-04-03 | 2005-08-23 | Becton, Dickinson And Company | Medication delivery pen |
| US20060155246A1 (en) * | 2003-04-15 | 2006-07-13 | Akio Higuchi | Medical anesthetic needle |
| USD518175S1 (en) * | 2003-10-31 | 2006-03-28 | Wilson-Cook Medical Inc. | Handle for medical devices, and medical device assemblies using a handle |
| USD502739S1 (en) * | 2004-03-04 | 2005-03-08 | Elmer's Product, Inc. | Material dispenser |
| USD516719S1 (en) * | 2004-03-11 | 2006-03-07 | Playtex Products, Inc. | Tampon applicator plunger |
| WO2005089333A2 (en) * | 2004-03-15 | 2005-09-29 | Oakville Hong Kong Company Limited | Lancet device and method of use |
| JP2008516710A (en) * | 2004-10-21 | 2008-05-22 | ノボ・ノルデイスク・エー/エス | Infusion device having means for signaling the elapsed time since the last release |
| US7621891B2 (en) * | 2004-12-06 | 2009-11-24 | Washington Biotech Corporation | Method and apparatus for delivering epinephrine |
| USD550363S1 (en) * | 2005-03-05 | 2007-09-04 | Roche Diagnostics Operations, Inc. | Lancing device |
| USD567939S1 (en) * | 2005-03-08 | 2008-04-29 | Berlin-Chemie Aktiengesellschaft | Syringe |
| USD548835S1 (en) * | 2005-04-13 | 2007-08-14 | Tecpharma Licensing Ag | Injection device |
| USD546447S1 (en) * | 2005-07-06 | 2007-07-10 | Maree Louise White | Surgical needle apparatus |
| USD551341S1 (en) * | 2005-09-02 | 2007-09-18 | Tecpharma Licensing Ag | Injection device |
| JP4834389B2 (en) * | 2005-11-29 | 2011-12-14 | 前田産業株式会社 | Injection device |
| GB0524604D0 (en) * | 2005-12-02 | 2006-01-11 | Owen Mumford Ltd | Injection method and apparatus |
| USD599010S1 (en) * | 2006-10-30 | 2009-08-25 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD580069S1 (en) * | 2006-12-28 | 2008-11-04 | Unitma Co., Ltd. | Tissue micro arrayer |
| AU313437S (en) * | 2007-01-17 | 2007-03-23 | Needle | |
| USD598496S1 (en) * | 2007-05-31 | 2009-08-18 | Kabushiki Kaisha Pilot Corporation | Fountain pen |
-
2007
- 2007-03-30 US US29/274,152 patent/USD599010S1/en not_active Expired - Lifetime
- 2007-03-30 US US29/274,155 patent/USD600795S1/en not_active Expired - Lifetime
- 2007-03-30 US US29/274,154 patent/USD626216S1/en not_active Expired - Lifetime
- 2007-03-30 US US29/274,153 patent/USD599011S1/en not_active Expired - Lifetime
- 2007-03-30 US US29/274,156 patent/USD598539S1/en not_active Expired - Lifetime
- 2007-03-30 CA CA 120175 patent/CA120175S/en not_active Expired - Lifetime
- 2007-03-30 CA CA 120174 patent/CA120174S/en not_active Expired - Lifetime
- 2007-03-30 CA CA 120180 patent/CA120180S/en not_active Expired - Lifetime
- 2007-03-30 US US29/274,149 patent/USD599008S1/en not_active Expired - Lifetime
- 2007-03-30 CA CA 120177 patent/CA120177S/en not_active Expired - Lifetime
- 2007-03-30 CA CA 120178 patent/CA120178S/en not_active Expired - Lifetime
- 2007-03-30 CA CA 120176 patent/CA120176S/en not_active Expired - Lifetime
- 2007-03-30 US US29/274,151 patent/USD599009S1/en not_active Expired - Lifetime
- 2007-03-30 CA CA 120179 patent/CA120179S/en not_active Expired - Lifetime
- 2007-03-30 US US29/274,150 patent/USD600794S1/en not_active Expired - Lifetime
-
2009
- 2009-05-20 US US29/311,659 patent/USD610251S1/en not_active Expired - Lifetime
- 2009-05-20 US US29/311,660 patent/USD610676S1/en not_active Expired - Lifetime
- 2009-05-20 US US29/311,657 patent/USD608442S1/en not_active Expired - Lifetime
- 2009-05-20 US US29/311,670 patent/USD610252S1/en not_active Expired - Lifetime
- 2009-05-20 US US29/311,661 patent/USD610677S1/en not_active Expired - Lifetime
- 2009-05-20 US US29/311,662 patent/USD606650S1/en not_active Expired - Lifetime
- 2009-05-20 US US29/311,658 patent/USD606649S1/en not_active Expired - Lifetime
Patent Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD368961S (en) * | 1994-10-12 | 1996-04-16 | Pharmacia Ab | Multiple dose injector |
| USD462760S1 (en) * | 2001-06-13 | 2002-09-10 | Eli Lilly And Company | Medication delivery apparatus |
| USD479748S1 (en) * | 2002-03-08 | 2003-09-16 | Dca Design International Limited | Medicament delivery device |
| USD479747S1 (en) * | 2002-03-08 | 2003-09-16 | Dca Design International Limited | Medicament delivery device |
| USD482724S1 (en) * | 2002-06-07 | 2003-11-25 | Mitsubishi Pencil Co., Ltd. | Ballpoint pen |
| USD492027S1 (en) * | 2002-11-09 | 2004-06-22 | Dca Design International Limited | Pen-type injector |
| USD492405S1 (en) * | 2002-11-09 | 2004-06-29 | Dca Design International Limited | Pen-type injector |
| USD499485S1 (en) * | 2002-11-09 | 2004-12-07 | Dca Design International Limited | Pen-type injector |
| USD501253S1 (en) * | 2002-11-09 | 2005-01-25 | Dca Design International Limited | Pen-type injector |
| USD503797S1 (en) * | 2002-11-09 | 2005-04-05 | Dca Design International Limited | Pen-type injector |
| USD505490S1 (en) * | 2002-11-09 | 2005-05-24 | Dca Design International Limited | Pen-type injector |
| USD540465S1 (en) * | 2002-11-09 | 2007-04-10 | Dca Design International Limited | Pen-type injector |
| USD553681S1 (en) * | 2006-03-29 | 2007-10-23 | Cotapaxi Custom Design And Manufacturing, Llc | Pen |
Cited By (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD652136S1 (en) * | 2008-10-11 | 2012-01-10 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD717428S1 (en) | 2010-11-19 | 2014-11-11 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD725771S1 (en) | 2010-11-19 | 2015-03-31 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD722158S1 (en) | 2010-11-19 | 2015-02-03 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD717940S1 (en) | 2010-11-19 | 2014-11-18 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD716442S1 (en) | 2010-12-06 | 2014-10-28 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD719257S1 (en) | 2010-12-06 | 2014-12-09 | Sanofi-Aventis Deutschland Gmbh | Medical injector |
| USD703314S1 (en) | 2012-04-13 | 2014-04-22 | Becton, Dickinson And Company | Self injection device |
| USD676957S1 (en) | 2012-04-13 | 2013-02-26 | Becton, Dickinson And Company | Self injection device |
| USD696774S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Autoinjector |
| USD696771S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Self injection device |
| USD697205S1 (en) | 2012-04-13 | 2014-01-07 | Becton, Dickinson And Company | Autoinjector |
| USD696775S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Autoinjector |
| USD696770S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Autoinjector |
| USD696773S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Self injection device |
| USD696772S1 (en) | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Autoinjector |
| USD696397S1 (en) | 2012-04-13 | 2013-12-24 | Becton, Dickinson And Company | Autoinjector |
| USD680643S1 (en) | 2012-04-13 | 2013-04-23 | Becton, Dickinson And Company | Self injection device window |
| USD708317S1 (en) | 2012-04-13 | 2014-07-01 | Becton, Dickinson And Company | Autoinjector |
| USD740937S1 (en) | 2012-04-13 | 2015-10-13 | Becton Dickinson And Company | Self injection device window |
| USD752211S1 (en) * | 2012-08-01 | 2016-03-22 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD688790S1 (en) | 2012-10-05 | 2013-08-27 | Becton, Dickinson And Company | Self-injection device |
| USD688792S1 (en) | 2012-10-05 | 2013-08-27 | Becton, Dickinson And Company | Self-injection device |
| USD688791S1 (en) | 2012-10-05 | 2013-08-27 | Becton, Dickinson And Company | Self-injection device |
| USD688793S1 (en) | 2012-10-05 | 2013-08-27 | Becton, Dickinson And Company | Self-injection device |
| USD752738S1 (en) * | 2013-09-20 | 2016-03-29 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD773039S1 (en) * | 2014-01-17 | 2016-11-29 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD770038S1 (en) | 2014-06-26 | 2016-10-25 | Eli Lilly And Company | Medication injection device |
| USD752210S1 (en) | 2014-08-27 | 2016-03-22 | Merck Sharp & Dohme Corp. | Medical injector pen |
| USD773647S1 (en) | 2014-08-27 | 2016-12-06 | Merck Sharp & Dohme Corp. | Medical injector pen |
| USD773646S1 (en) | 2014-08-27 | 2016-12-06 | Merck Sharp & Dohme Corp | Medical injector pen |
| USD777907S1 (en) | 2014-08-27 | 2017-01-31 | Merck Sharp & Dohme Corp. | Medical injector pen |
| USD777908S1 (en) | 2014-08-27 | 2017-01-31 | Merck Sharp & Dohme Corp. | Medical injector pen |
| USD810283S1 (en) | 2014-08-27 | 2018-02-13 | Merck Sharp & Dohme Corp. | Medical injector pen |
| USD819199S1 (en) | 2014-08-27 | 2018-05-29 | Merck Sharp & Dohme Corp. | Medical injector pen |
| US11484654B2 (en) | 2017-06-30 | 2022-11-01 | Regeneron Pharmaceuticals, Inc. | Auto-injector with anti-roll features |
| USD888938S1 (en) * | 2017-07-03 | 2020-06-30 | Sanofi-Aventis Deutschland Gmbh | Pen-shaped injector |
| USD888939S1 (en) * | 2017-07-03 | 2020-06-30 | Sanofi-Aventis Deutschland Gmbh | Pen-shaped injector |
| USD892311S1 (en) | 2017-10-25 | 2020-08-04 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD916277S1 (en) | 2017-10-25 | 2021-04-13 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD898191S1 (en) | 2017-10-25 | 2020-10-06 | Sanofi-Aventis Deutschland Gmbh | Cap of an injection device |
| USD901008S1 (en) | 2017-10-25 | 2020-11-03 | Sanofi-Aventis Deutschland Gmbh | Cap of an injection device |
| USD892312S1 (en) | 2017-10-25 | 2020-08-04 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD934413S1 (en) | 2017-10-25 | 2021-10-26 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD908867S1 (en) | 2017-10-25 | 2021-01-26 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD903107S1 (en) | 2017-11-06 | 2020-11-24 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD878561S1 (en) * | 2017-11-06 | 2020-03-17 | Sanofi-Aventis Deutschland Gmbh | Injection device |
| USD903856S1 (en) | 2018-06-29 | 2020-12-01 | Regeneron Pharmaceuticals, Inc. | Auto-injector |
| USD932006S1 (en) | 2018-11-21 | 2021-09-28 | Regeneron Pharmaceuticals, Inc. | Auto-injector cap |
| USD958973S1 (en) | 2018-11-21 | 2022-07-26 | Regeneron Pharmaceuticals, Inc. | Auto-injector cap |
| USD1079937S1 (en) | 2020-09-11 | 2025-06-17 | Sanofi | Medical injector |
| USD1054018S1 (en) * | 2022-11-04 | 2024-12-10 | Sanofi-Aventis Deutschland Gmbh | Medical injection device |
Also Published As
| Publication number | Publication date |
|---|---|
| USD606650S1 (en) | 2009-12-22 |
| USD610676S1 (en) | 2010-02-23 |
| USD606649S1 (en) | 2009-12-22 |
| USD610677S1 (en) | 2010-02-23 |
| USD599009S1 (en) | 2009-08-25 |
| USD599011S1 (en) | 2009-08-25 |
| CA120177S (en) | 2009-06-01 |
| USD626216S1 (en) | 2010-10-26 |
| CA120174S (en) | 2009-06-01 |
| USD600794S1 (en) | 2009-09-22 |
| USD610251S1 (en) | 2010-02-16 |
| USD600795S1 (en) | 2009-09-22 |
| CA120179S (en) | 2009-06-01 |
| USD610252S1 (en) | 2010-02-16 |
| CA120180S (en) | 2009-06-01 |
| USD599008S1 (en) | 2009-08-25 |
| CA120175S (en) | 2009-06-01 |
| USD608442S1 (en) | 2010-01-19 |
| CA120176S (en) | 2009-06-01 |
| USD599010S1 (en) | 2009-08-25 |
| CA120178S (en) | 2009-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD598539S1 (en) | Medical injector | |
| USD641077S1 (en) | Medical injector | |
| USD717428S1 (en) | Medical injector | |
| USD618789S1 (en) | Medical injector | |
| USD722158S1 (en) | Medical injector | |
| USD716442S1 (en) | Medical injector | |
| USD725771S1 (en) | Medical injector | |
| USD719257S1 (en) | Medical injector | |
| USD717940S1 (en) | Medical injector | |
| USD605679S1 (en) | Camera | |
| USD587262S1 (en) | Personal digital assistant | |
| USD550093S1 (en) | Bottle | |
| USD601246S1 (en) | Disposable diaper with camouflage pattern | |
| USD553019S1 (en) | Wristwatch | |
| USD620036S1 (en) | Camera | |
| USD638535S1 (en) | Disposable diaper with camouflage pattern | |
| USD546208S1 (en) | Wristwatch | |
| USD660998S1 (en) | Star-shaped light | |
| USD584139S1 (en) | Packaging container | |
| USD622609S1 (en) | Over the counter medicinal container with surface ornamentation | |
| USD604349S1 (en) | Camera | |
| USD576938S1 (en) | Aircraft | |
| USD607461S1 (en) | Key cap | |
| USD530567S1 (en) | Handle | |
| USD618291S1 (en) | Puzzle |