USD587428S1 - Edible pet chew - Google Patents
Edible pet chew Download PDFInfo
- Publication number
- USD587428S1 USD587428S1 US29/261,922 US26192206F USD587428S US D587428 S1 USD587428 S1 US D587428S1 US 26192206 F US26192206 F US 26192206F US D587428 S USD587428 S US D587428S
- Authority
- US
- United States
- Prior art keywords
- pet chew
- edible pet
- edible
- chew
- view
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- VAYOSLLFUXYJDT-RDTXWAMCSA-N Lysergic acid diethylamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N(CC)CC)C2)=C3C2=CNC3=C1 VAYOSLLFUXYJDT-RDTXWAMCSA-N 0.000 description 1
Images
Description
The 'GREENIES” logo that forms a part of one embodiment of the claimed edible pet chew is a trademark of Mars, Incorporated.
Claims (1)
- The ornamental design for an edible pet chew, substantially as shown and described.
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/261,922 USD587428S1 (en) | 2006-06-21 | 2006-06-21 | Edible pet chew |
| TW095307107F TWD122932S1 (en) | 2006-06-21 | 2006-12-20 | Edible pet chew |
| DO2006000058F DOS2006000058S (en) | 2006-06-21 | 2006-12-21 | ANIMAL MASTER |
| AU200615854F AU313202S (en) | 2006-06-21 | 2006-12-21 | Edible pet chew |
| AU200615853F AU313201S (en) | 2006-06-21 | 2006-12-21 | Edible pet chew |
| CA 118864 CA118864S (en) | 2006-06-21 | 2006-12-21 | Edible pet chew |
| GT200600079F GT200600079S (en) | 2006-06-21 | 2006-12-21 | EDIBLE MASTER FOR PETS |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/261,922 USD587428S1 (en) | 2006-06-21 | 2006-06-21 | Edible pet chew |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD587428S1 true USD587428S1 (en) | 2009-03-03 |
Family
ID=40385541
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/261,922 Expired - Lifetime USD587428S1 (en) | 2006-06-21 | 2006-06-21 | Edible pet chew |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | USD587428S1 (en) |
| AU (2) | AU313201S (en) |
| CA (1) | CA118864S (en) |
| DO (1) | DOS2006000058S (en) |
| GT (1) | GT200600079S (en) |
| TW (1) | TWD122932S1 (en) |
Cited By (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8360008B2 (en) | 2006-08-07 | 2013-01-29 | J.W. Pet Company, Inc. | Chew toys comprising biologically degradable material |
| USD684746S1 (en) * | 2011-03-31 | 2013-06-25 | Ilio Products | Edible dog chew |
| USD708418S1 (en) | 2013-02-20 | 2014-07-08 | Radio Systems Corporation | Dog bone chew consumable |
| USD708417S1 (en) | 2013-02-20 | 2014-07-08 | Radio Systems Corporation | Dog bone chew consumable |
| USD715016S1 (en) * | 2014-01-15 | 2014-10-14 | Mei-Jung Huang | Chew for pets |
| USD717016S1 (en) | 2013-10-02 | 2014-11-11 | Foster and Smith, Inc. | Animal chew |
| US8904966B2 (en) | 2010-12-13 | 2014-12-09 | Precision Pet Products | Articulating consumable chew toy |
| USD740518S1 (en) | 2014-07-10 | 2015-10-13 | T.F.H. Publications, Inc. | Pet chew |
| USD745241S1 (en) * | 2014-09-24 | 2015-12-15 | Redbarn Pet Products, Inc. | Dental bone product |
| USD759341S1 (en) | 2014-12-17 | 2016-06-21 | Natural Balance Pet Foods, Inc. | Pet chew |
| USD802881S1 (en) | 2016-06-30 | 2017-11-21 | Mars, Incorporated | Food product |
| USD803514S1 (en) | 2016-09-02 | 2017-11-28 | Mars, Incorporated | Food product |
| USD803513S1 (en) | 2016-09-02 | 2017-11-28 | Mars, Incorporated | Food product |
| USD803515S1 (en) | 2016-09-02 | 2017-11-28 | Mars, Incorporated | Food product |
| USD803512S1 (en) | 2016-09-02 | 2017-11-28 | Mars, Incorporated | Food product |
| USD804141S1 (en) | 2016-09-02 | 2017-12-05 | Mars, Incorporated | Food product |
| USD810394S1 (en) | 2016-06-30 | 2018-02-20 | Mars, Incorporated | Food product |
| USD822340S1 (en) | 2017-01-09 | 2018-07-10 | Société des Produits Nestlé S.A. | Pet treat |
| USD822339S1 (en) | 2017-01-09 | 2018-07-10 | Société des Produits Nestlé S.A. | Pet treat |
| USD822335S1 (en) | 2016-09-02 | 2018-07-10 | Mars, Incorporated | Food product |
| USD822943S1 (en) | 2016-06-30 | 2018-07-17 | Mars, Incorporated | Food product |
| USD825885S1 (en) | 2016-06-30 | 2018-08-21 | Mars, Incorporated | Food product |
| US10299496B2 (en) | 2015-08-13 | 2019-05-28 | Mary Elizabeth Goldberg | Pet-medicine-capsule wrapper apparatus and method |
| USD903227S1 (en) | 2019-08-26 | 2020-12-01 | Polyshot Corporation | Toothbrush shaped pet treat |
| USD942092S1 (en) * | 2019-03-27 | 2022-01-25 | Big Heart Pet, Inc. | Pet chew |
| USD946861S1 (en) * | 2017-08-23 | 2022-03-29 | Polyshot Corporation | Toothbrush shaped pet treat |
| USD948840S1 (en) | 2019-03-18 | 2022-04-19 | Polyshot Corporation | Dual material pet treat |
| USD1000751S1 (en) * | 2021-04-14 | 2023-10-10 | Upper Dog Comercial LTDA | Pet treat |
| USD1026397S1 (en) * | 2022-10-12 | 2024-05-14 | Blue Buffalo Enterprises, Inc. | Pet dental chew |
| USD1059699S1 (en) | 2020-07-02 | 2025-01-28 | Spectrum Brands, Inc. | Animal dental chew |
| USD1103556S1 (en) | 2024-02-22 | 2025-12-02 | Redbarn Pet Products, LLC | Dental treat |
Citations (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2103083A (en) | 1936-03-30 | 1937-12-21 | Indexo Finger Tooth Brush Inc | Teeth cleaning and gum massaging device |
| US4109649A (en) | 1976-08-30 | 1978-08-29 | Iyomasa Arthur N | Foot massager |
| USD303728S (en) | 1987-01-05 | 1989-10-03 | Nabisco Brands, Inc. | Canine biscuit |
| USD305952S (en) * | 1987-01-05 | 1990-02-13 | Nabisco Brands, Inc. | Canine biscuit |
| USD305950S (en) * | 1987-01-05 | 1990-02-13 | Nabisco Brands, Inc. | Canine biscuit |
| USD320495S (en) * | 1988-09-09 | 1991-10-08 | Pallesen Steven A | Pet food biscuit |
| US5240720A (en) | 1990-05-10 | 1993-08-31 | Axelrod Herbert R | Dog chew with modifiable texture |
| USD338993S (en) * | 1991-12-04 | 1993-09-07 | Edible spoon | |
| US6116191A (en) * | 1998-07-24 | 2000-09-12 | The Hartz Mountain Corporation | Composite chew toy |
| US6168822B1 (en) | 1998-09-30 | 2001-01-02 | Sara Lee Corporation | Method for producing a bone-in ham steak |
| USD499226S1 (en) * | 2003-05-23 | 2004-12-07 | T.F.H. Publications, Inc. | Dog chew |
| USD503998S1 (en) * | 2003-03-25 | 2005-04-12 | T.F.H. Publications, Inc. | Dog chew |
| USD528736S1 (en) * | 2005-03-28 | 2006-09-26 | The Iams Company | Pet food supplement |
| USD529667S1 (en) * | 2004-10-21 | 2006-10-03 | T.F.H. Publications, Inc. | Dog chew |
| US20060222748A1 (en) | 2005-03-30 | 2006-10-05 | Masao Kobayashi | Dough processing apparatus |
| USD530481S1 (en) | 2005-01-24 | 2006-10-24 | The Iams Company | Pet food supplement |
| USD531365S1 (en) * | 2004-09-29 | 2006-10-31 | T.F.H. Publications, Inc. | Pet chew |
| US20070101946A1 (en) * | 2005-11-08 | 2007-05-10 | Barbara Penny | Dog Toy Toothbrush |
| US20080041320A1 (en) * | 2006-06-21 | 2008-02-21 | Mars, Incorporated | Dog chew |
-
2006
- 2006-06-21 US US29/261,922 patent/USD587428S1/en not_active Expired - Lifetime
- 2006-12-20 TW TW095307107F patent/TWD122932S1/en unknown
- 2006-12-21 DO DO2006000058F patent/DOS2006000058S/en unknown
- 2006-12-21 GT GT200600079F patent/GT200600079S/en unknown
- 2006-12-21 AU AU200615853F patent/AU313201S/en not_active Expired - Lifetime
- 2006-12-21 AU AU200615854F patent/AU313202S/en not_active Expired - Lifetime
- 2006-12-21 CA CA 118864 patent/CA118864S/en not_active Expired - Lifetime
Patent Citations (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2103083A (en) | 1936-03-30 | 1937-12-21 | Indexo Finger Tooth Brush Inc | Teeth cleaning and gum massaging device |
| US4109649A (en) | 1976-08-30 | 1978-08-29 | Iyomasa Arthur N | Foot massager |
| USD303728S (en) | 1987-01-05 | 1989-10-03 | Nabisco Brands, Inc. | Canine biscuit |
| USD305952S (en) * | 1987-01-05 | 1990-02-13 | Nabisco Brands, Inc. | Canine biscuit |
| USD305950S (en) * | 1987-01-05 | 1990-02-13 | Nabisco Brands, Inc. | Canine biscuit |
| USD320495S (en) * | 1988-09-09 | 1991-10-08 | Pallesen Steven A | Pet food biscuit |
| US5240720A (en) | 1990-05-10 | 1993-08-31 | Axelrod Herbert R | Dog chew with modifiable texture |
| USD338993S (en) * | 1991-12-04 | 1993-09-07 | Edible spoon | |
| US6116191A (en) * | 1998-07-24 | 2000-09-12 | The Hartz Mountain Corporation | Composite chew toy |
| US6168822B1 (en) | 1998-09-30 | 2001-01-02 | Sara Lee Corporation | Method for producing a bone-in ham steak |
| USD503998S1 (en) * | 2003-03-25 | 2005-04-12 | T.F.H. Publications, Inc. | Dog chew |
| USD499226S1 (en) * | 2003-05-23 | 2004-12-07 | T.F.H. Publications, Inc. | Dog chew |
| USD531365S1 (en) * | 2004-09-29 | 2006-10-31 | T.F.H. Publications, Inc. | Pet chew |
| USD529667S1 (en) * | 2004-10-21 | 2006-10-03 | T.F.H. Publications, Inc. | Dog chew |
| USD530481S1 (en) | 2005-01-24 | 2006-10-24 | The Iams Company | Pet food supplement |
| USD528736S1 (en) * | 2005-03-28 | 2006-09-26 | The Iams Company | Pet food supplement |
| US20060222748A1 (en) | 2005-03-30 | 2006-10-05 | Masao Kobayashi | Dough processing apparatus |
| US20070101946A1 (en) * | 2005-11-08 | 2007-05-10 | Barbara Penny | Dog Toy Toothbrush |
| US20080041320A1 (en) * | 2006-06-21 | 2008-02-21 | Mars, Incorporated | Dog chew |
Non-Patent Citations (4)
| Title |
|---|
| Care-A-Lot Pet Supply Warehouse catalog, Oct. 9, 2003, p. 14. * |
| PetCare advertisement, Iams Tartar Treats, Mar. 2006. * |
| U.S. Appl. No. 29/261,921, filed Jun. 21, 2006, by Allen A. Torney et al., entitled "Edible Pet Chew". |
| U.S. Appl. No. 29/261,924, filed Jun. 21, 2006, by Allen A. Torney et al., entitled "Edible Pet Chew". |
Cited By (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8360008B2 (en) | 2006-08-07 | 2013-01-29 | J.W. Pet Company, Inc. | Chew toys comprising biologically degradable material |
| US8904966B2 (en) | 2010-12-13 | 2014-12-09 | Precision Pet Products | Articulating consumable chew toy |
| USD684746S1 (en) * | 2011-03-31 | 2013-06-25 | Ilio Products | Edible dog chew |
| USD708418S1 (en) | 2013-02-20 | 2014-07-08 | Radio Systems Corporation | Dog bone chew consumable |
| USD708417S1 (en) | 2013-02-20 | 2014-07-08 | Radio Systems Corporation | Dog bone chew consumable |
| USD717016S1 (en) | 2013-10-02 | 2014-11-11 | Foster and Smith, Inc. | Animal chew |
| USD715016S1 (en) * | 2014-01-15 | 2014-10-14 | Mei-Jung Huang | Chew for pets |
| USD740518S1 (en) | 2014-07-10 | 2015-10-13 | T.F.H. Publications, Inc. | Pet chew |
| USD745241S1 (en) * | 2014-09-24 | 2015-12-15 | Redbarn Pet Products, Inc. | Dental bone product |
| USD759341S1 (en) | 2014-12-17 | 2016-06-21 | Natural Balance Pet Foods, Inc. | Pet chew |
| US10863757B2 (en) | 2015-08-13 | 2020-12-15 | Mary Elizabeth Goldberg | Pet-medicine-capsule wrapper apparatus and method |
| US10299496B2 (en) | 2015-08-13 | 2019-05-28 | Mary Elizabeth Goldberg | Pet-medicine-capsule wrapper apparatus and method |
| USD825885S1 (en) | 2016-06-30 | 2018-08-21 | Mars, Incorporated | Food product |
| USD802881S1 (en) | 2016-06-30 | 2017-11-21 | Mars, Incorporated | Food product |
| USD810394S1 (en) | 2016-06-30 | 2018-02-20 | Mars, Incorporated | Food product |
| USD822943S1 (en) | 2016-06-30 | 2018-07-17 | Mars, Incorporated | Food product |
| USD803512S1 (en) | 2016-09-02 | 2017-11-28 | Mars, Incorporated | Food product |
| USD804141S1 (en) | 2016-09-02 | 2017-12-05 | Mars, Incorporated | Food product |
| USD803513S1 (en) | 2016-09-02 | 2017-11-28 | Mars, Incorporated | Food product |
| USD822335S1 (en) | 2016-09-02 | 2018-07-10 | Mars, Incorporated | Food product |
| USD803514S1 (en) | 2016-09-02 | 2017-11-28 | Mars, Incorporated | Food product |
| USD803515S1 (en) | 2016-09-02 | 2017-11-28 | Mars, Incorporated | Food product |
| USD822340S1 (en) | 2017-01-09 | 2018-07-10 | Société des Produits Nestlé S.A. | Pet treat |
| USD822339S1 (en) | 2017-01-09 | 2018-07-10 | Société des Produits Nestlé S.A. | Pet treat |
| USD946861S1 (en) * | 2017-08-23 | 2022-03-29 | Polyshot Corporation | Toothbrush shaped pet treat |
| USD948840S1 (en) | 2019-03-18 | 2022-04-19 | Polyshot Corporation | Dual material pet treat |
| USD942092S1 (en) * | 2019-03-27 | 2022-01-25 | Big Heart Pet, Inc. | Pet chew |
| USD903227S1 (en) | 2019-08-26 | 2020-12-01 | Polyshot Corporation | Toothbrush shaped pet treat |
| USD1059699S1 (en) | 2020-07-02 | 2025-01-28 | Spectrum Brands, Inc. | Animal dental chew |
| USD1000751S1 (en) * | 2021-04-14 | 2023-10-10 | Upper Dog Comercial LTDA | Pet treat |
| USD1026397S1 (en) * | 2022-10-12 | 2024-05-14 | Blue Buffalo Enterprises, Inc. | Pet dental chew |
| USD1103556S1 (en) | 2024-02-22 | 2025-12-02 | Redbarn Pet Products, LLC | Dental treat |
Also Published As
| Publication number | Publication date |
|---|---|
| AU313202S (en) | 2007-03-05 |
| DOS2006000058S (en) | 2007-09-15 |
| CA118864S (en) | 2008-01-29 |
| GT200600079S (en) | 2009-06-18 |
| TWD122932S1 (en) | 2008-05-21 |
| AU313201S (en) | 2007-03-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD587428S1 (en) | Edible pet chew | |
| USD585177S1 (en) | Pet chew | |
| USD586976S1 (en) | Pet chew | |
| USD585627S1 (en) | Pet chew | |
| USD667594S1 (en) | Pet habitat | |
| USD593277S1 (en) | Pet food | |
| USD605367S1 (en) | Pet kennel | |
| USD594182S1 (en) | Animal chew | |
| USD603134S1 (en) | Pet chew | |
| USD571366S1 (en) | Video eyewear | |
| USD572426S1 (en) | Pet dental chew | |
| USD591480S1 (en) | Cube string animal chew | |
| USD552696S1 (en) | Exercise ball with handle | |
| USD546005S1 (en) | Pet kennel | |
| USD591539S1 (en) | Table | |
| USD514278S1 (en) | Pet chew | |
| USD575907S1 (en) | Pet shelter | |
| USD587427S1 (en) | Edible pet chew | |
| USD556275S1 (en) | Ball | |
| USD545507S1 (en) | Pet kennel | |
| USD536506S1 (en) | Edible pet chew | |
| USD587429S1 (en) | Edible pet chew | |
| USD506294S1 (en) | Pet feeding stand | |
| USD551399S1 (en) | Pet kennel | |
| USD621102S1 (en) | Animal grooming apparatus |