USD574644S1 - Detachably mounted head restraint - Google Patents
Detachably mounted head restraint Download PDFInfo
- Publication number
- USD574644S1 USD574644S1 US29/286,117 US28611707F USD574644S US D574644 S1 USD574644 S1 US D574644S1 US 28611707 F US28611707 F US 28611707F US D574644 S USD574644 S US D574644S
- Authority
- US
- United States
- Prior art keywords
- detachably mounted
- head restraint
- mounted head
- view
- elevational view
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- PICXIOQBANWBIZ-UHFFFAOYSA-N zinc;1-oxidopyridine-2-thione Chemical class [Zn+2].[O-]N1C=CC=CC1=S.[O-]N1C=CC=CC1=S PICXIOQBANWBIZ-UHFFFAOYSA-N 0.000 description 1
Images
Description
The broken line representations of the head and shoulders of a person, the portion of a seat and headrest, and the attachment straps shown in FIG. 7 are included solely for illustrative purposes, forming no part of the claimed design.
Claims (1)
- The ornamental design for a detachably mounted head restraint, as shown and described.
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/286,117 USD574644S1 (en) | 2007-04-23 | 2007-04-23 | Detachably mounted head restraint |
| CA 122650 CA122650S (en) | 2007-04-23 | 2007-10-10 | Detachably mounted head restraint |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/286,117 USD574644S1 (en) | 2007-04-23 | 2007-04-23 | Detachably mounted head restraint |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD574644S1 true USD574644S1 (en) | 2008-08-12 |
Family
ID=39678942
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/286,117 Expired - Lifetime USD574644S1 (en) | 2007-04-23 | 2007-04-23 | Detachably mounted head restraint |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | USD574644S1 (en) |
| CA (1) | CA122650S (en) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD582707S1 (en) * | 2008-03-17 | 2008-12-16 | Rgp Dental, Inc. | Seat back |
| USD585675S1 (en) * | 2008-01-25 | 2009-02-03 | Igo Furniture (Foshan) Ltd. | Curved headrest frame |
| US20090257616A1 (en) * | 2008-04-15 | 2009-10-15 | Sony Corporation | Speaker system |
| USD899817S1 (en) * | 2018-08-03 | 2020-10-27 | Shen Zhen Stand By Me Technology Limited | Automobile headrest cushion |
| USD925939S1 (en) * | 2019-11-06 | 2021-07-27 | GoPlus Corp. | Backrest for a chair |
| USD994408S1 (en) * | 2023-05-22 | 2023-08-08 | Qiuya Zhao | Backrest |
Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2474386A (en) * | 1944-06-19 | 1949-06-28 | Volkmann John | Headband and earphone mounting |
| US3384719A (en) * | 1964-10-21 | 1968-05-21 | Gen Electric | Stereophonic speaker arrangement |
| US4991222A (en) * | 1986-12-01 | 1991-02-05 | Nixdorf Hans W | Sound reproducer |
| US5154477A (en) * | 1991-04-09 | 1992-10-13 | Jim Lacy | Head support for vehicle seat backs |
| USD353497S (en) * | 1992-10-29 | 1994-12-20 | Ab Noco-Stolar | Passenger seat |
| US5640458A (en) * | 1989-10-25 | 1997-06-17 | Sony Corporation | Audio signal reproducing apparatus |
| USD436271S1 (en) * | 1999-12-10 | 2001-01-16 | Alessandro Corti | Headrest accessory |
| US20030103637A1 (en) * | 2001-12-04 | 2003-06-05 | Jui-Shu Huang | Headphone |
| US20050179300A1 (en) * | 1998-08-13 | 2005-08-18 | O'connor Richard W. | Winged headrest with safety features for vehicular use |
| US20060083397A1 (en) * | 2004-10-19 | 2006-04-20 | Obo Pro.2 Inc. | Wireless headphone with a self-actuated switch |
| US7124425B1 (en) * | 1999-03-08 | 2006-10-17 | Immersion Entertainment, L.L.C. | Audio/video system and method utilizing a head mounted apparatus with noise attenuation |
| USD539572S1 (en) | 2005-06-03 | 2007-04-03 | Nguyen Son K | Detachably mounted head restraint |
| USD552077S1 (en) * | 2006-06-13 | 2007-10-02 | Robert Brunner | Headphone |
-
2007
- 2007-04-23 US US29/286,117 patent/USD574644S1/en not_active Expired - Lifetime
- 2007-10-10 CA CA 122650 patent/CA122650S/en not_active Expired - Lifetime
Patent Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2474386A (en) * | 1944-06-19 | 1949-06-28 | Volkmann John | Headband and earphone mounting |
| US3384719A (en) * | 1964-10-21 | 1968-05-21 | Gen Electric | Stereophonic speaker arrangement |
| US4991222A (en) * | 1986-12-01 | 1991-02-05 | Nixdorf Hans W | Sound reproducer |
| US5640458A (en) * | 1989-10-25 | 1997-06-17 | Sony Corporation | Audio signal reproducing apparatus |
| US5154477A (en) * | 1991-04-09 | 1992-10-13 | Jim Lacy | Head support for vehicle seat backs |
| USD353497S (en) * | 1992-10-29 | 1994-12-20 | Ab Noco-Stolar | Passenger seat |
| US20050179300A1 (en) * | 1998-08-13 | 2005-08-18 | O'connor Richard W. | Winged headrest with safety features for vehicular use |
| US7124425B1 (en) * | 1999-03-08 | 2006-10-17 | Immersion Entertainment, L.L.C. | Audio/video system and method utilizing a head mounted apparatus with noise attenuation |
| USD436271S1 (en) * | 1999-12-10 | 2001-01-16 | Alessandro Corti | Headrest accessory |
| US20030103637A1 (en) * | 2001-12-04 | 2003-06-05 | Jui-Shu Huang | Headphone |
| US20060083397A1 (en) * | 2004-10-19 | 2006-04-20 | Obo Pro.2 Inc. | Wireless headphone with a self-actuated switch |
| USD539572S1 (en) | 2005-06-03 | 2007-04-03 | Nguyen Son K | Detachably mounted head restraint |
| USD552077S1 (en) * | 2006-06-13 | 2007-10-02 | Robert Brunner | Headphone |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD585675S1 (en) * | 2008-01-25 | 2009-02-03 | Igo Furniture (Foshan) Ltd. | Curved headrest frame |
| USD582707S1 (en) * | 2008-03-17 | 2008-12-16 | Rgp Dental, Inc. | Seat back |
| US20090257616A1 (en) * | 2008-04-15 | 2009-10-15 | Sony Corporation | Speaker system |
| US8130987B2 (en) * | 2008-04-15 | 2012-03-06 | Sony Corporation | Speaker system with a plurality of openings in side walls of each of two speaker boxes |
| USD899817S1 (en) * | 2018-08-03 | 2020-10-27 | Shen Zhen Stand By Me Technology Limited | Automobile headrest cushion |
| USD925939S1 (en) * | 2019-11-06 | 2021-07-27 | GoPlus Corp. | Backrest for a chair |
| USD994408S1 (en) * | 2023-05-22 | 2023-08-08 | Qiuya Zhao | Backrest |
Also Published As
| Publication number | Publication date |
|---|---|
| CA122650S (en) | 2008-09-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD595530S1 (en) | Pillow with X straps | |
| USD552362S1 (en) | Chair | |
| USD570624S1 (en) | Seat cushion and back pad of a chair | |
| USD615453S1 (en) | Head restraint for securing to an upper portion of a travel seat and for use in stabilizing a passenger's head to permit sleep | |
| USD624343S1 (en) | Pillow | |
| USD607661S1 (en) | Chair | |
| USD603201S1 (en) | Sanitary headrest cover | |
| USD554224S1 (en) | Inflatable lounge | |
| USD632875S1 (en) | Ponytail-accommodating ballcap | |
| USD573800S1 (en) | Baby bath seat | |
| USD577209S1 (en) | Children's chair | |
| USD531434S1 (en) | Seat and back rest for a chair | |
| USD573816S1 (en) | Chair seat | |
| USD571129S1 (en) | Seat frame | |
| USD601329S1 (en) | Head visor | |
| USD532227S1 (en) | Seat and back rest for a chair | |
| USD573379S1 (en) | Stool seat | |
| USD584479S1 (en) | Wearable seating cushion | |
| USD610842S1 (en) | Chair frame | |
| USD618945S1 (en) | Airbag lumbar support pillow | |
| USD554223S1 (en) | Inflatable lounge | |
| USD574644S1 (en) | Detachably mounted head restraint | |
| USD536200S1 (en) | Seat and back rest for a chair | |
| USD539572S1 (en) | Detachably mounted head restraint | |
| USD591996S1 (en) | Seating pad |