USD548422S1 - Slope adjustable head for pedestal jack - Google Patents
Slope adjustable head for pedestal jack Download PDFInfo
- Publication number
- USD548422S1 USD548422S1 US29/258,704 US25870406F USD548422S US D548422 S1 USD548422 S1 US D548422S1 US 25870406 F US25870406 F US 25870406F US D548422 S USD548422 S US D548422S
- Authority
- US
- United States
- Prior art keywords
- adjustable head
- slope adjustable
- pedestal jack
- jack
- pedestal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title claims description 6
Images
Description
The second component is not shown in FIGS. 11 through 18 and the first component is not shown in FIGS. 19 through 26 for convenience of illustration.
Claims (1)
- The ornamental design for a slope adjustable head for pedestal jack, as shown and described.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AU200514780F AU304890S (en) | 2005-10-28 | 2005-10-28 | Slope adjustable head for pedestal jack |
| AU200514780 | 2005-10-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD548422S1 true USD548422S1 (en) | 2007-08-07 |
Family
ID=38324952
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/258,704 Expired - Lifetime USD548422S1 (en) | 2005-10-28 | 2006-04-26 | Slope adjustable head for pedestal jack |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | USD548422S1 (en) |
| AU (1) | AU304890S (en) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD641534S1 (en) * | 2010-05-12 | 2011-07-12 | Alan Sian Ghee Lee | Base for adjustable pedestal |
| USD644404S1 (en) * | 2009-09-04 | 2011-08-30 | Alan Sian Ghee Lee | Adjustable pedestal |
| USD649434S1 (en) * | 2010-02-08 | 2011-11-29 | Thomas & Betts International, Inc. | Multi-purpose roof-top support |
| USD683104S1 (en) * | 2012-08-30 | 2013-05-21 | Norco Industries, Inc. | Floor jack extension |
| US20150028177A1 (en) * | 2013-07-24 | 2015-01-29 | Michael Vargas | Trailer jack stand support |
| USD728185S1 (en) * | 2013-03-15 | 2015-04-28 | The Ipe Clip Fastener Co., Llc | Tiltable lockable elevating pedestal |
| US9022356B2 (en) | 2012-08-30 | 2015-05-05 | Norco Industries, Inc. | Removable saddle and extension for floor jack |
| USD842682S1 (en) * | 2016-02-05 | 2019-03-12 | Elmich Pte Ltd. | Pedestal adaptor |
| USD1067020S1 (en) * | 2024-04-01 | 2025-03-18 | Chuangyong Huang | Support device |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD312442S (en) * | 1988-06-13 | 1990-11-27 | Attwood Corporation | Boat deck gas fill |
| USD331064S (en) * | 1990-05-18 | 1992-11-17 | Deere & Company | Port plug for hydraulic cylinders |
| USD341016S (en) * | 1991-12-03 | 1993-11-02 | Elephant Chain Block Company Limited | Over-load cutout device for hand-operated, hoisting and pulling machine |
| USD347920S (en) * | 1993-01-22 | 1994-06-14 | Ingersoll-Rand Company | Free-chain indicator knob for a lever hoist |
| USD425281S (en) * | 1999-06-24 | 2000-05-16 | Ridge Ralph B | Car jack appliance |
| USD431512S (en) * | 1999-06-30 | 2000-10-03 | Excelsior-Henderson Motorcycle Manufacturing Company | Gas cap |
| USD443747S1 (en) * | 2000-10-24 | 2001-06-12 | Ralph B. Ridge | Car jack appliance |
| USD509039S1 (en) * | 2003-02-19 | 2005-08-30 | Cequent Trailer Products, Inc. | Jack mount |
-
2005
- 2005-10-28 AU AU200514780F patent/AU304890S/en not_active Expired - Lifetime
-
2006
- 2006-04-26 US US29/258,704 patent/USD548422S1/en not_active Expired - Lifetime
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD312442S (en) * | 1988-06-13 | 1990-11-27 | Attwood Corporation | Boat deck gas fill |
| USD331064S (en) * | 1990-05-18 | 1992-11-17 | Deere & Company | Port plug for hydraulic cylinders |
| USD341016S (en) * | 1991-12-03 | 1993-11-02 | Elephant Chain Block Company Limited | Over-load cutout device for hand-operated, hoisting and pulling machine |
| USD347920S (en) * | 1993-01-22 | 1994-06-14 | Ingersoll-Rand Company | Free-chain indicator knob for a lever hoist |
| USD425281S (en) * | 1999-06-24 | 2000-05-16 | Ridge Ralph B | Car jack appliance |
| USD431512S (en) * | 1999-06-30 | 2000-10-03 | Excelsior-Henderson Motorcycle Manufacturing Company | Gas cap |
| USD443747S1 (en) * | 2000-10-24 | 2001-06-12 | Ralph B. Ridge | Car jack appliance |
| USD509039S1 (en) * | 2003-02-19 | 2005-08-30 | Cequent Trailer Products, Inc. | Jack mount |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD644404S1 (en) * | 2009-09-04 | 2011-08-30 | Alan Sian Ghee Lee | Adjustable pedestal |
| USD649434S1 (en) * | 2010-02-08 | 2011-11-29 | Thomas & Betts International, Inc. | Multi-purpose roof-top support |
| USD641534S1 (en) * | 2010-05-12 | 2011-07-12 | Alan Sian Ghee Lee | Base for adjustable pedestal |
| USD683104S1 (en) * | 2012-08-30 | 2013-05-21 | Norco Industries, Inc. | Floor jack extension |
| US9022356B2 (en) | 2012-08-30 | 2015-05-05 | Norco Industries, Inc. | Removable saddle and extension for floor jack |
| USD728185S1 (en) * | 2013-03-15 | 2015-04-28 | The Ipe Clip Fastener Co., Llc | Tiltable lockable elevating pedestal |
| USD738589S1 (en) * | 2013-03-15 | 2015-09-08 | The Ipé Clip Fastener Company, LLC | Tiltable lockable elevating pedestal joist support |
| US20150028177A1 (en) * | 2013-07-24 | 2015-01-29 | Michael Vargas | Trailer jack stand support |
| USD842682S1 (en) * | 2016-02-05 | 2019-03-12 | Elmich Pte Ltd. | Pedestal adaptor |
| USD1067020S1 (en) * | 2024-04-01 | 2025-03-18 | Chuangyong Huang | Support device |
Also Published As
| Publication number | Publication date |
|---|---|
| AU304890S (en) | 2006-01-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD503559S1 (en) | Chair | |
| USD540550S1 (en) | Side chair | |
| USD545080S1 (en) | Stand | |
| USD566979S1 (en) | Chair | |
| USD536096S1 (en) | Operation table | |
| USD514741S1 (en) | Lighter | |
| USD552885S1 (en) | Table | |
| USD508812S1 (en) | Depression cushion | |
| USD559008S1 (en) | Stand | |
| USD537856S1 (en) | USB monitor | |
| USD510670S1 (en) | Desk | |
| USD552884S1 (en) | Table | |
| USD507710S1 (en) | Desk | |
| USD508343S1 (en) | Desk | |
| USD522827S1 (en) | Angle grinder | |
| USD523308S1 (en) | Angle grinder | |
| USD522826S1 (en) | Angle grinder | |
| USD536886S1 (en) | Combination chair and folding table | |
| USD552883S1 (en) | Table | |
| USD548422S1 (en) | Slope adjustable head for pedestal jack | |
| USD552882S1 (en) | Table | |
| USD553187S1 (en) | Stencil | |
| USD521265S1 (en) | Chair | |
| USD553347S1 (en) | Controller | |
| USD489912S1 (en) | Folding chair |