USD545439S1 - Blood glucose meter - Google Patents
Blood glucose meter Download PDFInfo
- Publication number
- USD545439S1 USD545439S1 US29/230,988 US23098805F USD545439S US D545439 S1 USD545439 S1 US D545439S1 US 23098805 F US23098805 F US 23098805F US D545439 S USD545439 S US D545439S
- Authority
- US
- United States
- Prior art keywords
- blood glucose
- glucose meter
- meter shown
- view
- elevational view
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 title claims description 11
- 239000008280 blood Substances 0.000 title claims description 11
- 210000004369 blood Anatomy 0.000 title claims description 11
- 239000008103 glucose Substances 0.000 title claims description 11
Images
Description
The broken line showing of a test strip used with the blood glucose meter is for illustrative purposes only, and forms no part of the claimed design.
Claims (1)
- The ornamental design for a blood glucose meter, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/230,988 USD545439S1 (en) | 2005-04-15 | 2005-05-31 | Blood glucose meter |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10672805 | 2005-04-15 | ||
| US29/230,988 USD545439S1 (en) | 2005-04-15 | 2005-05-31 | Blood glucose meter |
Related Parent Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US11/106,728 Continuation-In-Part US20050240119A1 (en) | 2004-04-16 | 2005-04-15 | Blood glucose meter having integral lancet device and test strip storage vial for single handed use and methods for using same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD545439S1 true USD545439S1 (en) | 2007-06-26 |
Family
ID=38179357
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/230,988 Expired - Lifetime USD545439S1 (en) | 2005-04-15 | 2005-05-31 | Blood glucose meter |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD545439S1 (en) |
Cited By (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20080311675A1 (en) * | 2007-05-22 | 2008-12-18 | Becton, Dickinson And Company | Dyes having ratiometric fluorescence response for detecting metabolites |
| USD585993S1 (en) * | 2007-04-25 | 2009-02-03 | Tanita Corporation | Urine glucose meter |
| USD585992S1 (en) * | 2007-04-25 | 2009-02-03 | Tanita Corporation | Urine glucose meter |
| USD588702S1 (en) * | 2006-04-26 | 2009-03-17 | Lorenz Biotech S.P.A. | Medical apparatus |
| US20090104714A1 (en) * | 2007-10-18 | 2009-04-23 | Becton, Dickinson And Company | Visual glucose sensor and methods of use thereof |
| USD608005S1 (en) * | 2008-09-01 | 2010-01-12 | Terumo Kabushiki Kaisha | Glucose meter |
| USD614773S1 (en) * | 2007-12-07 | 2010-04-27 | Kinetik Medical Devices, Ltd. | Blood pressure monitor |
| USD667948S1 (en) * | 2011-09-09 | 2012-09-25 | pendiq GmbH | Injection device |
| USD670375S1 (en) * | 2011-12-16 | 2012-11-06 | Becton Dickinson France | Medical injector |
| USD677380S1 (en) * | 2011-01-24 | 2013-03-05 | Abbvie Biotechnology Ltd. | Automatic injection device |
| USD679391S1 (en) * | 2011-07-19 | 2013-04-02 | Timothy Mark Chinowsky | Cartridge for medical device |
| USD681839S1 (en) * | 2011-12-16 | 2013-05-07 | Micromode Medical Limited | Electrostimulation device |
| USD696770S1 (en) * | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Autoinjector |
| US8668670B2 (en) | 2004-06-23 | 2014-03-11 | Abbvie Biotechnology Ltd | Automatic injection devices |
| USD702848S1 (en) * | 2012-06-18 | 2014-04-15 | Myoscience, Inc. | Handheld device |
| USD703337S1 (en) * | 2012-02-28 | 2014-04-22 | Activator Methods International, Ltd | Medical device |
| USD706433S1 (en) * | 2012-02-28 | 2014-06-03 | Activator Methods International, Ltd | Medical device |
| USD706434S1 (en) * | 2011-10-14 | 2014-06-03 | Luzmon Uk Limited | Control unit |
| USD707352S1 (en) * | 2011-06-03 | 2014-06-17 | Biogen Idec Ma Inc. | Medicament delivery device |
| USD707351S1 (en) * | 2012-04-11 | 2014-06-17 | Namtall AB | Automatic syringe |
| US9082272B2 (en) | 2010-10-28 | 2015-07-14 | Louise Mohn | Circuit for applying heat and electrical stimulation |
| USD742524S1 (en) * | 2014-11-17 | 2015-11-03 | Bayer Healthcare Llc | Analyte meter |
| USD744638S1 (en) * | 2011-09-29 | 2015-12-01 | Medline Industries, Inc. | Suction handle |
| USD749717S1 (en) | 2014-05-30 | 2016-02-16 | Medline Industries, Inc. | Suction handle |
| US9345633B2 (en) | 2012-07-19 | 2016-05-24 | Activator Methods International, Ltd. | Chiropractic adjustor system and method |
| USD765254S1 (en) * | 2015-02-16 | 2016-08-30 | Samsung Electronics Co., Ltd. | Medical device |
| US9486584B2 (en) | 2006-06-30 | 2016-11-08 | Abbvie Biotechnology Ltd. | Automatic injection device |
| US9561328B2 (en) | 2009-04-29 | 2017-02-07 | Abbvie Biotechnology Ltd | Automatic injection device |
| USD787680S1 (en) * | 2015-06-18 | 2017-05-23 | Maureen Donohue | Glucose monitor and lancet combination |
| USD789519S1 (en) * | 2014-03-03 | 2017-06-13 | Sanofi | Medicament injection device |
| US9878102B2 (en) | 2011-01-24 | 2018-01-30 | Abbvie Biotechnology Ltd. | Automatic injection devices having overmolded gripping surfaces |
| US9884143B2 (en) | 2014-05-30 | 2018-02-06 | Medline Industries, Inc. | Medical personal-services suction handle |
| USD817331S1 (en) * | 2015-07-02 | 2018-05-08 | Datalogic Ip Tech S.R.L. | Portable terminal |
| USD822212S1 (en) * | 2016-10-20 | 2018-07-03 | Visiomed Group | Connected mini blood glucose meter |
| USD893021S1 (en) * | 2019-02-05 | 2020-08-11 | Portal Instruments, Inc. | Needle-free injector |
| USD895106S1 (en) * | 2019-04-18 | 2020-09-01 | Sun Pharmaceutical Industries Limited | Medical pen injector |
| USD946761S1 (en) * | 2020-02-20 | 2022-03-22 | Quanta Computer Inc. | Blood glucose injection recorder |
| US11911329B2 (en) | 2017-09-18 | 2024-02-27 | Activator Methods International, Ltd. | Chiropractic adjusting instrument system and method |
Citations (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD392740S (en) * | 1996-12-31 | 1998-03-24 | Lifescan, Inc. | Blood glucose monitoring system |
| USD399566S (en) * | 1997-08-04 | 1998-10-13 | Lifescan, Inc. | Blood glucose meter |
| USD418602S (en) | 1997-01-24 | 2000-01-04 | Abbott Laboratories | Measuring instrument for analysis of blood constituents |
| USD425990S (en) | 1999-04-26 | 2000-05-30 | Becton, Dickinson And Company | Combined blood monitoring and delivery unit |
| USD427312S (en) | 1998-12-07 | 2000-06-27 | Amira Medical | Combined blood sampling device and meter |
| US6099484A (en) | 1996-05-17 | 2000-08-08 | Amira Medical | Methods and apparatus for sampling and analyzing body fluid |
| USD429527S (en) | 1999-08-06 | 2000-08-15 | Roche Diagnostics Corporation | Coagulation characteristic testing instrument |
| USD429814S (en) | 1999-07-16 | 2000-08-22 | Roche Diagnostics Corporation | Blood lancette |
| USD435657S (en) | 2000-06-19 | 2000-12-26 | Roche Diagnostics Corporation | Meter |
| USD448294S1 (en) | 2000-10-30 | 2001-09-25 | Roche Diagnostics Corporation | Container lid |
| US20010027277A1 (en) | 2000-03-24 | 2001-10-04 | Klitmose Lars Peter | Disposable lancet combined with a reagent carrying strip and a system for extracting and analysing blood in the body utilizing such a disposable lancet |
| US6302855B1 (en) | 1998-05-20 | 2001-10-16 | Novo Nordisk A/S | Medical apparatus for use by a patient for medical self treatment of diabetes |
| US6352514B1 (en) | 1996-05-17 | 2002-03-05 | Amira Medical | Methods and apparatus for sampling and analyzing body fluid |
| US20020130042A1 (en) | 2000-03-02 | 2002-09-19 | Moerman Piet H.C. | Combined lancet and electrochemical analyte-testing apparatus |
| USD465849S1 (en) * | 2001-11-13 | 2002-11-19 | Hypoguard Limited | Blood glucose meter |
| US20020177763A1 (en) | 2001-05-22 | 2002-11-28 | Burns David W. | Integrated lancets and methods |
| USD471280S1 (en) * | 2001-09-26 | 2003-03-04 | Roche Diagnostics Corporation | Meter |
| USD471983S1 (en) * | 2001-09-04 | 2003-03-18 | Hypoguard Limited | Blood glucose meter |
| US20030191415A1 (en) | 2001-03-29 | 2003-10-09 | Piet Moerman | Integrated sample testing meter |
| US6645219B2 (en) | 2001-09-07 | 2003-11-11 | Amira Medical | Rotatable penetration depth adjusting arrangement |
| US20030212345A1 (en) | 2002-05-09 | 2003-11-13 | Mcallister Devin | Minimal procedure analyte test system |
| USD487594S1 (en) | 2000-10-30 | 2004-03-16 | Roche Diagnostics Corporation | Container for a test strip drum |
| USD491275S1 (en) | 2003-01-15 | 2004-06-08 | Becton, Dickinson And Company | Blood glucose test strip vial |
| US20040138588A1 (en) | 2002-11-06 | 2004-07-15 | Saikley Charles R | Automatic biological analyte testing meter with integrated lancing device and methods of use |
| USD493536S1 (en) * | 2002-05-15 | 2004-07-27 | Roche Diagnostics Corporation | Glucose meter |
| US20040267229A1 (en) | 2001-08-16 | 2004-12-30 | Piet Moerman | In-situ adapter for a testing device |
| USD506007S1 (en) | 2003-01-15 | 2005-06-07 | Becton, Dickinson And Company | Combined blood monitoring and delivery unit |
| US20050143675A1 (en) | 2003-12-31 | 2005-06-30 | Home Diagnostics, Inc. | Integrated diagnostic test system |
| USD510711S1 (en) * | 2003-12-03 | 2005-10-18 | Inverness Medical Limted | Analyte test meter |
| US20050240119A1 (en) | 2004-04-16 | 2005-10-27 | Becton, Dickinson And Company | Blood glucose meter having integral lancet device and test strip storage vial for single handed use and methods for using same |
| US7001344B2 (en) | 2001-06-12 | 2006-02-21 | Pelikan Technologies, Inc. | Blood sampling device with diaphragm actuated lancet |
| USD518397S1 (en) * | 2005-07-20 | 2006-04-04 | Thermo Orion Inc. | Ionic meter |
-
2005
- 2005-05-31 US US29/230,988 patent/USD545439S1/en not_active Expired - Lifetime
Patent Citations (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6352514B1 (en) | 1996-05-17 | 2002-03-05 | Amira Medical | Methods and apparatus for sampling and analyzing body fluid |
| US6099484A (en) | 1996-05-17 | 2000-08-08 | Amira Medical | Methods and apparatus for sampling and analyzing body fluid |
| USD392740S (en) * | 1996-12-31 | 1998-03-24 | Lifescan, Inc. | Blood glucose monitoring system |
| USD418602S (en) | 1997-01-24 | 2000-01-04 | Abbott Laboratories | Measuring instrument for analysis of blood constituents |
| USD399566S (en) * | 1997-08-04 | 1998-10-13 | Lifescan, Inc. | Blood glucose meter |
| US6302855B1 (en) | 1998-05-20 | 2001-10-16 | Novo Nordisk A/S | Medical apparatus for use by a patient for medical self treatment of diabetes |
| USD427312S (en) | 1998-12-07 | 2000-06-27 | Amira Medical | Combined blood sampling device and meter |
| USD425990S (en) | 1999-04-26 | 2000-05-30 | Becton, Dickinson And Company | Combined blood monitoring and delivery unit |
| USD429814S (en) | 1999-07-16 | 2000-08-22 | Roche Diagnostics Corporation | Blood lancette |
| USD429527S (en) | 1999-08-06 | 2000-08-15 | Roche Diagnostics Corporation | Coagulation characteristic testing instrument |
| US20050011759A1 (en) | 2000-03-02 | 2005-01-20 | Moerman Piet H. C. | Combined lancet and electrochemical analyte-testing apparatus |
| US20020130042A1 (en) | 2000-03-02 | 2002-09-19 | Moerman Piet H.C. | Combined lancet and electrochemical analyte-testing apparatus |
| US20010027277A1 (en) | 2000-03-24 | 2001-10-04 | Klitmose Lars Peter | Disposable lancet combined with a reagent carrying strip and a system for extracting and analysing blood in the body utilizing such a disposable lancet |
| USD435657S (en) | 2000-06-19 | 2000-12-26 | Roche Diagnostics Corporation | Meter |
| USD448294S1 (en) | 2000-10-30 | 2001-09-25 | Roche Diagnostics Corporation | Container lid |
| USD487594S1 (en) | 2000-10-30 | 2004-03-16 | Roche Diagnostics Corporation | Container for a test strip drum |
| US20030191415A1 (en) | 2001-03-29 | 2003-10-09 | Piet Moerman | Integrated sample testing meter |
| US20020177763A1 (en) | 2001-05-22 | 2002-11-28 | Burns David W. | Integrated lancets and methods |
| US7001344B2 (en) | 2001-06-12 | 2006-02-21 | Pelikan Technologies, Inc. | Blood sampling device with diaphragm actuated lancet |
| US20040267229A1 (en) | 2001-08-16 | 2004-12-30 | Piet Moerman | In-situ adapter for a testing device |
| USD471983S1 (en) * | 2001-09-04 | 2003-03-18 | Hypoguard Limited | Blood glucose meter |
| US6645219B2 (en) | 2001-09-07 | 2003-11-11 | Amira Medical | Rotatable penetration depth adjusting arrangement |
| USD471280S1 (en) * | 2001-09-26 | 2003-03-04 | Roche Diagnostics Corporation | Meter |
| USD465849S1 (en) * | 2001-11-13 | 2002-11-19 | Hypoguard Limited | Blood glucose meter |
| US20030212345A1 (en) | 2002-05-09 | 2003-11-13 | Mcallister Devin | Minimal procedure analyte test system |
| USD493536S1 (en) * | 2002-05-15 | 2004-07-27 | Roche Diagnostics Corporation | Glucose meter |
| US20040138588A1 (en) | 2002-11-06 | 2004-07-15 | Saikley Charles R | Automatic biological analyte testing meter with integrated lancing device and methods of use |
| USD491275S1 (en) | 2003-01-15 | 2004-06-08 | Becton, Dickinson And Company | Blood glucose test strip vial |
| USD506007S1 (en) | 2003-01-15 | 2005-06-07 | Becton, Dickinson And Company | Combined blood monitoring and delivery unit |
| USD510711S1 (en) * | 2003-12-03 | 2005-10-18 | Inverness Medical Limted | Analyte test meter |
| US20050143675A1 (en) | 2003-12-31 | 2005-06-30 | Home Diagnostics, Inc. | Integrated diagnostic test system |
| US20050240119A1 (en) | 2004-04-16 | 2005-10-27 | Becton, Dickinson And Company | Blood glucose meter having integral lancet device and test strip storage vial for single handed use and methods for using same |
| USD518397S1 (en) * | 2005-07-20 | 2006-04-04 | Thermo Orion Inc. | Ionic meter |
Cited By (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9764090B2 (en) | 2004-06-23 | 2017-09-19 | Abbvie Biotechnology Ltd | Relating to automatic injection devices |
| US8668670B2 (en) | 2004-06-23 | 2014-03-11 | Abbvie Biotechnology Ltd | Automatic injection devices |
| US9017287B2 (en) | 2004-06-23 | 2015-04-28 | Abbvie Biotechnology Ltd | Automatic injection devices |
| USD588702S1 (en) * | 2006-04-26 | 2009-03-17 | Lorenz Biotech S.P.A. | Medical apparatus |
| US9486584B2 (en) | 2006-06-30 | 2016-11-08 | Abbvie Biotechnology Ltd. | Automatic injection device |
| USD585993S1 (en) * | 2007-04-25 | 2009-02-03 | Tanita Corporation | Urine glucose meter |
| USD585992S1 (en) * | 2007-04-25 | 2009-02-03 | Tanita Corporation | Urine glucose meter |
| US8772047B2 (en) | 2007-05-22 | 2014-07-08 | Becton, Dickinson And Company | Dyes having ratiometric fluorescence response for detecting metabolites |
| US20080311675A1 (en) * | 2007-05-22 | 2008-12-18 | Becton, Dickinson And Company | Dyes having ratiometric fluorescence response for detecting metabolites |
| US9023661B2 (en) | 2007-10-18 | 2015-05-05 | Becton, Dickinson And Company | Visual glucose sensor and methods of use thereof |
| US20090104714A1 (en) * | 2007-10-18 | 2009-04-23 | Becton, Dickinson And Company | Visual glucose sensor and methods of use thereof |
| USD614773S1 (en) * | 2007-12-07 | 2010-04-27 | Kinetik Medical Devices, Ltd. | Blood pressure monitor |
| USD608005S1 (en) * | 2008-09-01 | 2010-01-12 | Terumo Kabushiki Kaisha | Glucose meter |
| US9561328B2 (en) | 2009-04-29 | 2017-02-07 | Abbvie Biotechnology Ltd | Automatic injection device |
| US9082272B2 (en) | 2010-10-28 | 2015-07-14 | Louise Mohn | Circuit for applying heat and electrical stimulation |
| USD694879S1 (en) * | 2011-01-24 | 2013-12-03 | Abbvie Biotechnology Ltd | Automatic injection device |
| US9878102B2 (en) | 2011-01-24 | 2018-01-30 | Abbvie Biotechnology Ltd. | Automatic injection devices having overmolded gripping surfaces |
| USD677380S1 (en) * | 2011-01-24 | 2013-03-05 | Abbvie Biotechnology Ltd. | Automatic injection device |
| US11565048B2 (en) | 2011-01-24 | 2023-01-31 | Abbvie Biotechnology Ltd. | Automatic injection devices having overmolded gripping surfaces |
| USD707352S1 (en) * | 2011-06-03 | 2014-06-17 | Biogen Idec Ma Inc. | Medicament delivery device |
| USD679391S1 (en) * | 2011-07-19 | 2013-04-02 | Timothy Mark Chinowsky | Cartridge for medical device |
| USD667948S1 (en) * | 2011-09-09 | 2012-09-25 | pendiq GmbH | Injection device |
| USD780306S1 (en) | 2011-09-29 | 2017-02-28 | Medline Industries, Inc. | Suction handle |
| USD828548S1 (en) | 2011-09-29 | 2018-09-11 | Medline Industries, Inc. | Suction handle |
| USD744638S1 (en) * | 2011-09-29 | 2015-12-01 | Medline Industries, Inc. | Suction handle |
| USD706434S1 (en) * | 2011-10-14 | 2014-06-03 | Luzmon Uk Limited | Control unit |
| USD681839S1 (en) * | 2011-12-16 | 2013-05-07 | Micromode Medical Limited | Electrostimulation device |
| USD670375S1 (en) * | 2011-12-16 | 2012-11-06 | Becton Dickinson France | Medical injector |
| USD703337S1 (en) * | 2012-02-28 | 2014-04-22 | Activator Methods International, Ltd | Medical device |
| USD706433S1 (en) * | 2012-02-28 | 2014-06-03 | Activator Methods International, Ltd | Medical device |
| USD707351S1 (en) * | 2012-04-11 | 2014-06-17 | Namtall AB | Automatic syringe |
| USD696770S1 (en) * | 2012-04-13 | 2013-12-31 | Becton, Dickinson And Company | Autoinjector |
| USD702848S1 (en) * | 2012-06-18 | 2014-04-15 | Myoscience, Inc. | Handheld device |
| US9345633B2 (en) | 2012-07-19 | 2016-05-24 | Activator Methods International, Ltd. | Chiropractic adjustor system and method |
| US10667977B2 (en) | 2012-07-19 | 2020-06-02 | Activator Methods International, Ltd. | Chiropractic adjustor system and method |
| US9687405B2 (en) | 2012-07-19 | 2017-06-27 | Activator Methods International, Ltd. | Chiropractic adjusting instrument system and method |
| USD789519S1 (en) * | 2014-03-03 | 2017-06-13 | Sanofi | Medicament injection device |
| US9884143B2 (en) | 2014-05-30 | 2018-02-06 | Medline Industries, Inc. | Medical personal-services suction handle |
| USD749717S1 (en) | 2014-05-30 | 2016-02-16 | Medline Industries, Inc. | Suction handle |
| USD779053S1 (en) | 2014-05-30 | 2017-02-14 | Medline Industries, Inc. | Suction handle |
| USD742524S1 (en) * | 2014-11-17 | 2015-11-03 | Bayer Healthcare Llc | Analyte meter |
| USD765254S1 (en) * | 2015-02-16 | 2016-08-30 | Samsung Electronics Co., Ltd. | Medical device |
| USD787680S1 (en) * | 2015-06-18 | 2017-05-23 | Maureen Donohue | Glucose monitor and lancet combination |
| USD817331S1 (en) * | 2015-07-02 | 2018-05-08 | Datalogic Ip Tech S.R.L. | Portable terminal |
| USD836639S1 (en) | 2015-07-02 | 2018-12-25 | Datalogic Ip Tech S.R.L. | Portable terminal |
| USD822212S1 (en) * | 2016-10-20 | 2018-07-03 | Visiomed Group | Connected mini blood glucose meter |
| US11911329B2 (en) | 2017-09-18 | 2024-02-27 | Activator Methods International, Ltd. | Chiropractic adjusting instrument system and method |
| US12295898B2 (en) | 2017-09-18 | 2025-05-13 | Activator Methods International, Ltd. | Chiropractic adjusting instrument system and method |
| USD893021S1 (en) * | 2019-02-05 | 2020-08-11 | Portal Instruments, Inc. | Needle-free injector |
| USD895106S1 (en) * | 2019-04-18 | 2020-09-01 | Sun Pharmaceutical Industries Limited | Medical pen injector |
| USD946761S1 (en) * | 2020-02-20 | 2022-03-22 | Quanta Computer Inc. | Blood glucose injection recorder |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD545439S1 (en) | Blood glucose meter | |
| USD491275S1 (en) | Blood glucose test strip vial | |
| USD548347S1 (en) | Device for measuring constituents in the blood | |
| USD546454S1 (en) | Blood glucose meter | |
| USD569508S1 (en) | Medical instrument | |
| USD512512S1 (en) | Blood glucose test strip | |
| USD484600S1 (en) | Blood glucose test meter | |
| USD546456S1 (en) | Blood glucose meter | |
| USD546952S1 (en) | Blood glucose meter | |
| USD585135S1 (en) | Glucose meter | |
| USD594120S1 (en) | Medical instrument | |
| USD549827S1 (en) | Blood analyzer | |
| USD570479S1 (en) | Medical instrument | |
| USD585137S1 (en) | Glucose meter | |
| USD581056S1 (en) | Glucose meter | |
| USD608892S1 (en) | Glucose meter | |
| USD499805S1 (en) | Meter for determining concentration of analytes | |
| USD557415S1 (en) | Medical instrument | |
| USD548116S1 (en) | Double-ended measuring spoons | |
| USD545436S1 (en) | Blood analyte meter | |
| USD541941S1 (en) | Sphygmomanometer | |
| USD571013S1 (en) | Sphygmomanometer | |
| USD548836S1 (en) | Medical probe | |
| USD580548S1 (en) | Medical instrument | |
| USD571914S1 (en) | Medical instrument |