USD540797S1 - Display device with a cylindrical pedestal - Google Patents
Display device with a cylindrical pedestal Download PDFInfo
- Publication number
- USD540797S1 USD540797S1 US29/253,464 US25346406F USD540797S US D540797 S1 USD540797 S1 US D540797S1 US 25346406 F US25346406 F US 25346406F US D540797 S USD540797 S US D540797S
- Authority
- US
- United States
- Prior art keywords
- display device
- cylindrical pedestal
- pedestal
- cylindrical
- view
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title claims description 3
Images
Description
FIG. 1 is a front view of a display device with a cylindrical pedestal, in accordance with the new design;
FIG. 2 is a rear view thereof;
FIG. 3 is a left view thereof;
FIG. 4 is a right view thereof;
FIG. 5 is a top plan view thereof;
FIG. 6 is a bottom plan view thereof; and,
FIG. 7 is a perspective view thereof.
Claims (1)
- The ornamental design for a display device with a cylindrical pedestal, as shown and described.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN200530124496 | 2005-09-16 | ||
| CN200530124496 | 2005-09-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD540797S1 true USD540797S1 (en) | 2007-04-17 |
Family
ID=37914591
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/253,464 Expired - Lifetime USD540797S1 (en) | 2005-09-16 | 2006-02-08 | Display device with a cylindrical pedestal |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD540797S1 (en) |
Cited By (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD569898S1 (en) * | 2007-01-22 | 2008-05-27 | Toshiba Tec Kabushiki Kaisha | Cash register for a point of sales terminal |
| USD586566S1 (en) * | 2008-01-22 | 2009-02-17 | Ipevo Corp. | Digital photo frame |
| USD627823S1 (en) * | 2010-01-19 | 2010-11-23 | Ligouri Thomas A | Message board |
| USD628199S1 (en) | 2009-07-14 | 2010-11-30 | Panasonic Corporation | Display device |
| USD650822S1 (en) * | 2010-06-03 | 2011-12-20 | Hitachi Consumer Electronics Co., Ltd. | Image display with projector |
| USD806068S1 (en) * | 2015-12-18 | 2017-12-26 | Hongfujin Precision Electronics (Chongqing) Co., Ltd. | All in one computer |
| USD897338S1 (en) * | 2016-08-08 | 2020-09-29 | Microsoft Corporation | Computing device |
| USD920324S1 (en) * | 2018-12-27 | 2021-05-25 | Razer (Asia-Pacific) Pte. Ltd. | Display |
| USD928228S1 (en) * | 2020-04-28 | 2021-08-17 | Toast, Inc. | Electronic device |
| USD933122S1 (en) * | 2020-06-08 | 2021-10-12 | Senor Tech Co., Ltd. | Point-of-sale (POS) terminal |
| USD934857S1 (en) * | 2020-06-02 | 2021-11-02 | Dell Products, L.P. | Display |
| USD935521S1 (en) * | 2020-01-07 | 2021-11-09 | Posbank Co., Ltd. | Wall-mounted POS device |
| USD936136S1 (en) * | 2020-01-07 | 2021-11-16 | Posbank Co., Ltd. | Foldable POS apparatus |
| USD1016140S1 (en) * | 2023-05-19 | 2024-02-27 | SpotOn Transact, LLC | Set of electronic devices |
| USD1080620S1 (en) * | 2019-05-31 | 2025-06-24 | Apple Inc. | Electronic device |
| USD1117195S1 (en) * | 2024-09-30 | 2026-03-10 | Suzhou Pinyu Precision Mechanical Co., Ltd. | Display screen |
Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD442951S1 (en) * | 1999-11-30 | 2001-05-29 | International Business Machines Corporation | Integrated computer and display system |
| USD464049S1 (en) * | 2001-05-11 | 2002-10-08 | Sony Computer Entertainment Inc. | Monitor display |
| USD469085S1 (en) * | 2002-01-29 | 2003-01-21 | International Business Machines Corporation | Integrated all-in-one computer |
| USD475687S1 (en) * | 2001-05-11 | 2003-06-10 | Sony Corporation | Monitor display |
| US20030189155A1 (en) * | 2002-04-05 | 2003-10-09 | Andrew Serbinski | Stabilized flat panel touch monitor |
| USD499730S1 (en) * | 2003-08-20 | 2004-12-14 | Sharp Kabushiki Kaisha | Monitor for computer |
| USD504426S1 (en) * | 2004-06-08 | 2005-04-26 | Flextronics International Usa, Inc. | Desktop computer |
-
2006
- 2006-02-08 US US29/253,464 patent/USD540797S1/en not_active Expired - Lifetime
Patent Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD442951S1 (en) * | 1999-11-30 | 2001-05-29 | International Business Machines Corporation | Integrated computer and display system |
| USD464049S1 (en) * | 2001-05-11 | 2002-10-08 | Sony Computer Entertainment Inc. | Monitor display |
| USD475687S1 (en) * | 2001-05-11 | 2003-06-10 | Sony Corporation | Monitor display |
| USD469085S1 (en) * | 2002-01-29 | 2003-01-21 | International Business Machines Corporation | Integrated all-in-one computer |
| US20030189155A1 (en) * | 2002-04-05 | 2003-10-09 | Andrew Serbinski | Stabilized flat panel touch monitor |
| USD499730S1 (en) * | 2003-08-20 | 2004-12-14 | Sharp Kabushiki Kaisha | Monitor for computer |
| USD504426S1 (en) * | 2004-06-08 | 2005-04-26 | Flextronics International Usa, Inc. | Desktop computer |
Cited By (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD569898S1 (en) * | 2007-01-22 | 2008-05-27 | Toshiba Tec Kabushiki Kaisha | Cash register for a point of sales terminal |
| USD586566S1 (en) * | 2008-01-22 | 2009-02-17 | Ipevo Corp. | Digital photo frame |
| USD628199S1 (en) | 2009-07-14 | 2010-11-30 | Panasonic Corporation | Display device |
| USD627823S1 (en) * | 2010-01-19 | 2010-11-23 | Ligouri Thomas A | Message board |
| USD650822S1 (en) * | 2010-06-03 | 2011-12-20 | Hitachi Consumer Electronics Co., Ltd. | Image display with projector |
| USD806068S1 (en) * | 2015-12-18 | 2017-12-26 | Hongfujin Precision Electronics (Chongqing) Co., Ltd. | All in one computer |
| USD897338S1 (en) * | 2016-08-08 | 2020-09-29 | Microsoft Corporation | Computing device |
| USD920324S1 (en) * | 2018-12-27 | 2021-05-25 | Razer (Asia-Pacific) Pte. Ltd. | Display |
| USD1080620S1 (en) * | 2019-05-31 | 2025-06-24 | Apple Inc. | Electronic device |
| USD936136S1 (en) * | 2020-01-07 | 2021-11-16 | Posbank Co., Ltd. | Foldable POS apparatus |
| USD935521S1 (en) * | 2020-01-07 | 2021-11-09 | Posbank Co., Ltd. | Wall-mounted POS device |
| USD928228S1 (en) * | 2020-04-28 | 2021-08-17 | Toast, Inc. | Electronic device |
| USD934857S1 (en) * | 2020-06-02 | 2021-11-02 | Dell Products, L.P. | Display |
| USD933122S1 (en) * | 2020-06-08 | 2021-10-12 | Senor Tech Co., Ltd. | Point-of-sale (POS) terminal |
| USD1016140S1 (en) * | 2023-05-19 | 2024-02-27 | SpotOn Transact, LLC | Set of electronic devices |
| USD1086277S1 (en) | 2023-05-19 | 2025-07-29 | SpotOn Transact, LLC | Electronic device |
| USD1117195S1 (en) * | 2024-09-30 | 2026-03-10 | Suzhou Pinyu Precision Mechanical Co., Ltd. | Display screen |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD502152S1 (en) | Video display device | |
| USD554687S1 (en) | Sunglasses | |
| USD552154S1 (en) | Sunglasses | |
| USD545779S1 (en) | Television set | |
| USD584702S1 (en) | Television set | |
| USD552571S1 (en) | Television set | |
| USD546303S1 (en) | Television set | |
| USD552050S1 (en) | Television set | |
| USD545780S1 (en) | Television set | |
| USD545282S1 (en) | Television set | |
| USD570311S1 (en) | Television set | |
| USD548836S1 (en) | Medical probe | |
| USD553876S1 (en) | Cabinet | |
| USD502154S1 (en) | Video display device | |
| USD540797S1 (en) | Display device with a cylindrical pedestal | |
| USD547755S1 (en) | Display stand | |
| USD534214S1 (en) | Display board with timer | |
| USD498235S1 (en) | Liquid crystal display | |
| USD561242S1 (en) | Point of sale terminal with advertising panels | |
| USD542500S1 (en) | Display device | |
| USD504856S1 (en) | Instrument panel | |
| USD548227S1 (en) | Display stand | |
| USD518107S1 (en) | Spinning display | |
| USD502907S1 (en) | Instrument panel | |
| USD504371S1 (en) | Instrument panel |