USD460641S1 - Pedestal - Google Patents
Pedestal Download PDFInfo
- Publication number
- USD460641S1 USD460641S1 US29/139,628 US13962801F USD460641S US D460641 S1 USD460641 S1 US D460641S1 US 13962801 F US13962801 F US 13962801F US D460641 S USD460641 S US D460641S
- Authority
- US
- United States
- Prior art keywords
- pedestal
- view
- ornamental design
- side perspective
- perspective
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title claims description 3
Images
Description
FIG. 1 is a top side perspective view of a pedestal showing my new design;
FIG. 2 is a side perspective view showing several aspects of a pattern that continues around the circumference thereof; and,
FIG. 3 is a top perspective view thereof.
Claims (1)
- The ornamental design for a pedestal, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/139,628 USD460641S1 (en) | 2001-04-03 | 2001-04-03 | Pedestal |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/139,628 USD460641S1 (en) | 2001-04-03 | 2001-04-03 | Pedestal |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD460641S1 true USD460641S1 (en) | 2002-07-23 |
Family
ID=22487562
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/139,628 Expired - Lifetime USD460641S1 (en) | 2001-04-03 | 2001-04-03 | Pedestal |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD460641S1 (en) |
Cited By (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD523181S1 (en) | 2005-01-21 | 2006-06-13 | Mayer Robert H | Pedestal sink |
| USD530109S1 (en) * | 2005-06-24 | 2006-10-17 | Brunswick Bowling & Billiards Corporation | Ottoman |
| USD536901S1 (en) | 2005-06-24 | 2007-02-20 | Brunswick Bowling & Billiards Corporation | Bowling ball rack and table |
| USD540571S1 (en) * | 2004-04-26 | 2007-04-17 | Wabush Valley Manufacturing, Inc. | Base for an outdoor furniture piece |
| USD553308S1 (en) * | 2005-12-07 | 2007-10-16 | Sasha Klein | Animal training device |
| USD579675S1 (en) * | 2007-04-25 | 2008-11-04 | Kohler Co. | Stool |
| USD593778S1 (en) | 2008-08-11 | 2009-06-09 | Michael Frank Muhich | Pedestal |
| USD595968S1 (en) * | 2008-01-18 | 2009-07-14 | John George Korban | Swell stool |
| USD647726S1 (en) * | 2010-08-27 | 2011-11-01 | Strauch C Randolph | Pedestal |
| USD663969S1 (en) * | 2011-06-27 | 2012-07-24 | The Vollrath Company, L.L.C. | Riser |
| USD666426S1 (en) * | 2011-08-31 | 2012-09-04 | Newsom Designs LLC | Time out stool |
| USD670094S1 (en) * | 2012-04-04 | 2012-11-06 | Jeanette Prestandrea | Children's invertible hourglass timer seat |
| USD671368S1 (en) * | 2010-03-14 | 2012-11-27 | Stewart Anna M | Attachable pedestal |
| USD677073S1 (en) * | 2011-08-31 | 2013-03-05 | Keter Plastic Ltd. | Combined cooler and table |
| USD729975S1 (en) * | 2013-06-11 | 2015-05-19 | Mya Saray, Llc | Hookah stem |
| USD749883S1 (en) * | 2013-09-30 | 2016-02-23 | Kohler Interiors Furniture Company | Table |
| USD756139S1 (en) * | 2014-06-05 | 2016-05-17 | Humanscale Corporation | Stool |
| USD878067S1 (en) * | 2019-10-15 | 2020-03-17 | Yiwu Locyop Household Product co., Ltd | Telescopic stool |
| USD879486S1 (en) * | 2018-07-18 | 2020-03-31 | Leiamoon LLC | Electronic steam seat |
| USD913279S1 (en) * | 2019-01-25 | 2021-03-16 | Zoobean Llc | Device |
| USD915500S1 (en) * | 2020-03-09 | 2021-04-06 | Lakeshore Equipment Company | Drum |
| USD916178S1 (en) * | 2020-03-09 | 2021-04-13 | Lakeshore Equipment Company | Drum |
| USD917904S1 (en) * | 2019-11-02 | 2021-05-04 | 39F Usa Inc | Stool |
| USD922784S1 (en) * | 2019-06-04 | 2021-06-22 | The Prophet Corporation | Stackable active seat |
| US11045005B2 (en) | 2019-06-04 | 2021-06-29 | The Prophet Corporation | Stackable active seat |
| USD978609S1 (en) * | 2020-06-16 | 2023-02-21 | Xiamen Harvesty E-commerce Co., Ltd | Cupcake stand |
| USD1056445S1 (en) * | 2022-09-13 | 2025-01-07 | Van Hung Dinh | Parasol base |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD243295S (en) | 1975-06-16 | 1977-02-08 | Hartinger George J | Pedestal base |
| USD249300S (en) | 1976-10-20 | 1978-09-12 | Arpad Szabo | Table or similar article |
-
2001
- 2001-04-03 US US29/139,628 patent/USD460641S1/en not_active Expired - Lifetime
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD243295S (en) | 1975-06-16 | 1977-02-08 | Hartinger George J | Pedestal base |
| USD249300S (en) | 1976-10-20 | 1978-09-12 | Arpad Szabo | Table or similar article |
Non-Patent Citations (2)
| Title |
|---|
| Calif-Asia Hermosa Rattan, c1974, p. 52, table at lower right. |
| Willow and Reed May 15, 1979, p. 4, table at bottom.* |
Cited By (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD540571S1 (en) * | 2004-04-26 | 2007-04-17 | Wabush Valley Manufacturing, Inc. | Base for an outdoor furniture piece |
| USD523181S1 (en) | 2005-01-21 | 2006-06-13 | Mayer Robert H | Pedestal sink |
| USD530109S1 (en) * | 2005-06-24 | 2006-10-17 | Brunswick Bowling & Billiards Corporation | Ottoman |
| USD536901S1 (en) | 2005-06-24 | 2007-02-20 | Brunswick Bowling & Billiards Corporation | Bowling ball rack and table |
| USD553308S1 (en) * | 2005-12-07 | 2007-10-16 | Sasha Klein | Animal training device |
| USD579675S1 (en) * | 2007-04-25 | 2008-11-04 | Kohler Co. | Stool |
| USD595968S1 (en) * | 2008-01-18 | 2009-07-14 | John George Korban | Swell stool |
| USD593778S1 (en) | 2008-08-11 | 2009-06-09 | Michael Frank Muhich | Pedestal |
| USD671368S1 (en) * | 2010-03-14 | 2012-11-27 | Stewart Anna M | Attachable pedestal |
| USD647726S1 (en) * | 2010-08-27 | 2011-11-01 | Strauch C Randolph | Pedestal |
| USD663969S1 (en) * | 2011-06-27 | 2012-07-24 | The Vollrath Company, L.L.C. | Riser |
| USD666426S1 (en) * | 2011-08-31 | 2012-09-04 | Newsom Designs LLC | Time out stool |
| USD677073S1 (en) * | 2011-08-31 | 2013-03-05 | Keter Plastic Ltd. | Combined cooler and table |
| USD670094S1 (en) * | 2012-04-04 | 2012-11-06 | Jeanette Prestandrea | Children's invertible hourglass timer seat |
| USD729975S1 (en) * | 2013-06-11 | 2015-05-19 | Mya Saray, Llc | Hookah stem |
| USD771421S1 (en) * | 2013-09-30 | 2016-11-15 | Baker, Knapp & Tubbs, Inc. | Table |
| USD749883S1 (en) * | 2013-09-30 | 2016-02-23 | Kohler Interiors Furniture Company | Table |
| USD756139S1 (en) * | 2014-06-05 | 2016-05-17 | Humanscale Corporation | Stool |
| USD879486S1 (en) * | 2018-07-18 | 2020-03-31 | Leiamoon LLC | Electronic steam seat |
| USD913279S1 (en) * | 2019-01-25 | 2021-03-16 | Zoobean Llc | Device |
| USD934853S1 (en) | 2019-01-25 | 2021-11-02 | Zoobean Llc | Device |
| USD922784S1 (en) * | 2019-06-04 | 2021-06-22 | The Prophet Corporation | Stackable active seat |
| US11045005B2 (en) | 2019-06-04 | 2021-06-29 | The Prophet Corporation | Stackable active seat |
| USD878067S1 (en) * | 2019-10-15 | 2020-03-17 | Yiwu Locyop Household Product co., Ltd | Telescopic stool |
| USD917904S1 (en) * | 2019-11-02 | 2021-05-04 | 39F Usa Inc | Stool |
| USD916178S1 (en) * | 2020-03-09 | 2021-04-13 | Lakeshore Equipment Company | Drum |
| USD915500S1 (en) * | 2020-03-09 | 2021-04-06 | Lakeshore Equipment Company | Drum |
| USD978609S1 (en) * | 2020-06-16 | 2023-02-21 | Xiamen Harvesty E-commerce Co., Ltd | Cupcake stand |
| USD1056445S1 (en) * | 2022-09-13 | 2025-01-07 | Van Hung Dinh | Parasol base |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD460641S1 (en) | Pedestal | |
| USD471889S1 (en) | Headset | |
| USD481326S1 (en) | Earring | |
| USD426988S (en) | Pedestal table | |
| USD454263S1 (en) | Speaker stand | |
| USD513394S1 (en) | Pendant | |
| USD443713S1 (en) | Under cabinet lighting fixture | |
| USD452767S1 (en) | Cap | |
| USD442462S1 (en) | Pull | |
| USD473927S1 (en) | Sprayer nozzle | |
| USD464807S1 (en) | Nonwoven fabric | |
| USD473431S1 (en) | Combined juicer and strainer | |
| USD472008S1 (en) | Chandelier | |
| USD461432S1 (en) | Round planter | |
| USD467742S1 (en) | Stool | |
| USD447893S1 (en) | Illuminant pedestal table | |
| USD462921S1 (en) | Gemstone | |
| USD446054S1 (en) | Table | |
| USD466828S1 (en) | Jewelry setting | |
| USD434687S (en) | Ring | |
| USD424966S (en) | Jewelry ring | |
| USD450862S1 (en) | Candleholder | |
| USD463754S1 (en) | Jewelry setting | |
| USD471662S1 (en) | Lantern | |
| USD440081S1 (en) | Table |