USD141498S - Design for a grain bin - Google Patents
Design for a grain bin Download PDFInfo
- Publication number
- USD141498S USD141498S US D141498 S USD141498 S US D141498S
- Authority
- US
- United States
- Prior art keywords
- design
- grain bin
- norquist
- larkin
- wilbur
- Prior art date
Links
- PHTXVQQRWJXYPP-UHFFFAOYSA-N Ethyltrifluoromethylaminoindane Chemical compound C1=C(C(F)(F)F)C=C2CC(NCC)CC2=C1 PHTXVQQRWJXYPP-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
Images
Description
lJune 5, 1945. v. c. NoRQulsT ETAI. De- 141,498
UNITED STATES PATENT CFFICE DESIGN FOR A GRAIN BIN Victor C. Norquist and Wilbur B. Larkin, Kansas City, Mo., assignors to Butler Manufacturing Q Company, Kansas City, Mo., a corporation of Missouri Application March 5, 1945, Serial No. 118,265
Term of patent 14 years (Cl. D13-1) To all whom it may concern.' Fig. 1 is a plan view of a grain bin embodying Be it known that we, Victor C. Norquist and my design, Wilbur B. Larkin, citizens of the United States, Fig. 2 is a side elevational view. residing at Kansas City, in the county of Jackson We claim: and State of Missouri, have invented a new, The ornamental design for a grain bin, suboriginal, and ornamental Design for a Grain Bin, stantially as shown. of which the following is a specification, reference VICTORl C. NORQUIST. being had to the accompanying drawing, forming WILBUR B. LARKIN.
part thereof, in which,
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD141498S (en) | Design for a grain bin | |
| USD142578S (en) | Design for a compact | |
| USD142319S (en) | Design fob a game board | |
| USD140046S (en) | Design for a pot handle | |
| USD141953S (en) | Design for a shoe | |
| USD104654S (en) | Design for a button | |
| USD142318S (en) | Design for a game board | |
| USD143666S (en) | Design for a juice extractor | |
| USD145836S (en) | Design for a rotary mower housing | |
| USD142863S (en) | Design for a pencil sharpener | |
| USD143548S (en) | Liturgical medallion or similar article | |
| USD141013S (en) | Design for a wheeled toy | |
| USD142628S (en) | Design for a container cap | |
| USD143402S (en) | Roll roofing or similar article | |
| USD146441S (en) | Design for a thermometer | |
| USD70290S (en) | Design for lace | |
| USD141397S (en) | Design for an electrical outlet | |
| USD142536S (en) | Design for a weighing scale | |
| USD143399S (en) | Design for a tie clasp | |
| USD144920S (en) | Design for a multipurpose tool | |
| USD142620S (en) | Design fob a container cap | |
| USD142829S (en) | Design for a hat | |
| USD143549S (en) | Liturgical medallion or similar article | |
| USD145027S (en) | Display cabinet or similar article | |
| USD124326S (en) | Design for a tire groover |