US12173135B2 - Plasticizer and plastic product - Google Patents
Plasticizer and plastic product Download PDFInfo
- Publication number
- US12173135B2 US12173135B2 US17/102,617 US202017102617A US12173135B2 US 12173135 B2 US12173135 B2 US 12173135B2 US 202017102617 A US202017102617 A US 202017102617A US 12173135 B2 US12173135 B2 US 12173135B2
- Authority
- US
- United States
- Prior art keywords
- nnc
- nno
- noc
- noo
- plasticizer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active, expires
Links
- 239000004014 plasticizer Substances 0.000 title claims abstract description 104
- 229920003023 plastic Polymers 0.000 title claims description 29
- 239000004033 plastic Substances 0.000 title claims description 29
- 125000003277 amino group Chemical group 0.000 claims abstract description 47
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 44
- 150000001413 amino acids Chemical class 0.000 claims abstract description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 23
- 125000000524 functional group Chemical group 0.000 claims description 46
- 229940024606 amino acid Drugs 0.000 claims description 36
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 21
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 13
- -1 phosphoryl group Chemical group 0.000 claims description 12
- 229920000728 polyester Polymers 0.000 claims description 10
- 239000004626 polylactic acid Substances 0.000 claims description 8
- 229920000747 poly(lactic acid) Polymers 0.000 claims description 7
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 claims description 5
- 229940009098 aspartate Drugs 0.000 claims description 4
- 239000005014 poly(hydroxyalkanoate) Substances 0.000 claims description 4
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 4
- 229920002961 polybutylene succinate Polymers 0.000 claims description 3
- 239000004631 polybutylene succinate Substances 0.000 claims description 3
- 229920000903 polyhydroxyalkanoate Polymers 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims 1
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 2
- 239000000178 monomer Substances 0.000 description 311
- 239000002202 Polyethylene glycol Substances 0.000 description 188
- 229920001223 polyethylene glycol Polymers 0.000 description 188
- 229920001451 polypropylene glycol Polymers 0.000 description 184
- 235000014113 dietary fatty acids Nutrition 0.000 description 108
- 229930195729 fatty acid Natural products 0.000 description 108
- 239000000194 fatty acid Substances 0.000 description 108
- 150000004665 fatty acids Chemical class 0.000 description 108
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 45
- 235000001014 amino acid Nutrition 0.000 description 31
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 30
- 238000006116 polymerization reaction Methods 0.000 description 23
- 150000001555 benzenes Chemical class 0.000 description 14
- 102000007372 Ataxin-1 Human genes 0.000 description 11
- 108010032963 Ataxin-1 Proteins 0.000 description 11
- 208000009415 Spinocerebellar Ataxias Diseases 0.000 description 11
- 201000003624 spinocerebellar ataxia type 1 Diseases 0.000 description 11
- 230000002349 favourable effect Effects 0.000 description 10
- 230000002209 hydrophobic effect Effects 0.000 description 9
- 230000002708 enhancing effect Effects 0.000 description 8
- 229920000704 biodegradable plastic Polymers 0.000 description 6
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 230000015556 catabolic process Effects 0.000 description 5
- 238000006731 degradation reaction Methods 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 4
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 238000006065 biodegradation reaction Methods 0.000 description 4
- 235000020776 essential amino acid Nutrition 0.000 description 4
- 239000003797 essential amino acid Substances 0.000 description 4
- 239000004475 Arginine Substances 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 3
- LRKATBAZQAWAGV-UHFFFAOYSA-N Hexatriacontylic acid Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC(O)=O LRKATBAZQAWAGV-UHFFFAOYSA-N 0.000 description 3
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 3
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 3
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 3
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 3
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 3
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 3
- 239000004472 Lysine Substances 0.000 description 3
- 101100073352 Streptomyces halstedii sch1 gene Proteins 0.000 description 3
- 101100073357 Streptomyces halstedii sch2 gene Proteins 0.000 description 3
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- MBMBGCFOFBJSGT-KUBAVDMBSA-N all-cis-docosa-4,7,10,13,16,19-hexaenoic acid Chemical compound CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCC(O)=O MBMBGCFOFBJSGT-KUBAVDMBSA-N 0.000 description 3
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000000875 corresponding effect Effects 0.000 description 3
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 3
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 3
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 3
- HOBAELRKJCKHQD-UHFFFAOYSA-N (8Z,11Z,14Z)-8,11,14-eicosatrienoic acid Natural products CCCCCC=CCC=CCC=CCCCCCCC(O)=O HOBAELRKJCKHQD-UHFFFAOYSA-N 0.000 description 2
- IJFXRHURBJZNAO-UHFFFAOYSA-N 3-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC(O)=C1 IJFXRHURBJZNAO-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- DCXYFEDJOCDNAF-UHFFFAOYSA-N Asparagine Natural products OC(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- GHVNFZFCNZKVNT-UHFFFAOYSA-N Decanoic acid Natural products CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 2
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 2
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 2
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 description 2
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 2
- 229920000331 Polyhydroxybutyrate Polymers 0.000 description 2
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 2
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 2
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 2
- 239000004473 Threonine Substances 0.000 description 2
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 235000004279 alanine Nutrition 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 229960001230 asparagine Drugs 0.000 description 2
- 235000009582 asparagine Nutrition 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 210000000170 cell membrane Anatomy 0.000 description 2
- 235000018417 cysteine Nutrition 0.000 description 2
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 2
- 230000000593 degrading effect Effects 0.000 description 2
- HOBAELRKJCKHQD-QNEBEIHSSA-N dihomo-γ-linolenic acid Chemical compound CCCCC\C=C/C\C=C/C\C=C/CCCCCCC(O)=O HOBAELRKJCKHQD-QNEBEIHSSA-N 0.000 description 2
- 235000020669 docosahexaenoic acid Nutrition 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 229930195712 glutamate Natural products 0.000 description 2
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 2
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229960000310 isoleucine Drugs 0.000 description 2
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 description 2
- 229930182817 methionine Natural products 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- SJWFXCIHNDVPSH-UHFFFAOYSA-N octan-2-ol Chemical compound CCCCCCC(C)O SJWFXCIHNDVPSH-UHFFFAOYSA-N 0.000 description 2
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 2
- 235000008729 phenylalanine Nutrition 0.000 description 2
- 229960005190 phenylalanine Drugs 0.000 description 2
- 239000005015 poly(hydroxybutyrate) Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 150000004671 saturated fatty acids Chemical class 0.000 description 2
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 2
- KZTFUVCDBLODBR-WNQIDUERSA-N (2S)-2-aminobutanedioic acid 2-hydroxybenzoic acid Chemical compound C(C=1C(O)=CC=CC1)(=O)O.N[C@@H](CC(=O)O)C(=O)O KZTFUVCDBLODBR-WNQIDUERSA-N 0.000 description 1
- FDKWRPBBCBCIGA-REOHCLBHSA-N (2r)-2-azaniumyl-3-$l^{1}-selanylpropanoate Chemical compound [Se]C[C@H](N)C(O)=O FDKWRPBBCBCIGA-REOHCLBHSA-N 0.000 description 1
- URXZXNYJPAJJOQ-FPLPWBNLSA-N (Z)-icos-13-enoic acid Chemical compound CCCCCC\C=C/CCCCCCCCCCCC(O)=O URXZXNYJPAJJOQ-FPLPWBNLSA-N 0.000 description 1
- ULNRTPCFRBIMKL-GHVJWSGMSA-N (e)-2-tetracosenoic acid Chemical compound CCCCCCCCCCCCCCCCCCCCC\C=C\C(O)=O ULNRTPCFRBIMKL-GHVJWSGMSA-N 0.000 description 1
- UKAUYVFTDYCKQA-UHFFFAOYSA-N -2-Amino-4-hydroxybutanoic acid Natural products OC(=O)C(N)CCO UKAUYVFTDYCKQA-UHFFFAOYSA-N 0.000 description 1
- GYSCBCSGKXNZRH-UHFFFAOYSA-N 1-benzothiophene-2-carboxamide Chemical compound C1=CC=C2SC(C(=O)N)=CC2=C1 GYSCBCSGKXNZRH-UHFFFAOYSA-N 0.000 description 1
- IBKKDSPQRUFRBM-UHFFFAOYSA-N 2-(2-hydroxyethoxy)propan-1-ol Chemical compound OCC(C)OCCO IBKKDSPQRUFRBM-UHFFFAOYSA-N 0.000 description 1
- WIFSDCDETBPLOR-UHFFFAOYSA-N 2-aminobenzoic acid Chemical group NC1=CC=CC=C1C(O)=O.NC1=CC=CC=C1C(O)=O WIFSDCDETBPLOR-UHFFFAOYSA-N 0.000 description 1
- LODHFNUFVRVKTH-ZHACJKMWSA-N 2-hydroxy-n'-[(e)-3-phenylprop-2-enoyl]benzohydrazide Chemical compound OC1=CC=CC=C1C(=O)NNC(=O)\C=C\C1=CC=CC=C1 LODHFNUFVRVKTH-ZHACJKMWSA-N 0.000 description 1
- MMDUJZZONSLMRD-UHFFFAOYSA-N 2-hydroxybenzoic acid;propane-1,2,3-triol Chemical group OCC(O)CO.OC(=O)C1=CC=CC=C1O MMDUJZZONSLMRD-UHFFFAOYSA-N 0.000 description 1
- AJHPGXZOIAYYDW-UHFFFAOYSA-N 3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=CC=C1C#N AJHPGXZOIAYYDW-UHFFFAOYSA-N 0.000 description 1
- ALYNCZNDIQEVRV-PZFLKRBQSA-N 4-amino-3,5-ditritiobenzoic acid Chemical compound [3H]c1cc(cc([3H])c1N)C(O)=O ALYNCZNDIQEVRV-PZFLKRBQSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- IJYZHIOOBGIINM-WDSKDSINSA-N Arg-Ser Chemical compound OC[C@@H](C(O)=O)NC(=O)[C@@H](N)CCCN=C(N)N IJYZHIOOBGIINM-WDSKDSINSA-N 0.000 description 1
- IIFDPDVJAHQFSR-WHFBIAKZSA-N Asn-Glu Chemical compound NC(=O)C[C@H](N)C(=O)N[C@H](C(O)=O)CCC(O)=O IIFDPDVJAHQFSR-WHFBIAKZSA-N 0.000 description 1
- HSPSXROIMXIJQW-BQBZGAKWSA-N Asp-His Chemical compound OC(=O)C[C@H](N)C(=O)N[C@H](C(O)=O)CC1=CNC=N1 HSPSXROIMXIJQW-BQBZGAKWSA-N 0.000 description 1
- FDKWRPBBCBCIGA-UWTATZPHSA-N D-Selenocysteine Natural products [Se]C[C@@H](N)C(O)=O FDKWRPBBCBCIGA-UWTATZPHSA-N 0.000 description 1
- XUIIKFGFIJCVMT-GFCCVEGCSA-N D-thyroxine Chemical compound IC1=CC(C[C@@H](N)C(O)=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-GFCCVEGCSA-N 0.000 description 1
- 235000021298 Dihomo-γ-linolenic acid Nutrition 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- JRDYDYXZKFNNRQ-XPUUQOCRSA-N Gly-Ala-Val Chemical compound CC(C)[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)CN JRDYDYXZKFNNRQ-XPUUQOCRSA-N 0.000 description 1
- 101000619708 Homo sapiens Peroxiredoxin-6 Proteins 0.000 description 1
- LCWXJXMHJVIJFK-UHFFFAOYSA-N Hydroxylysine Natural products NCC(O)CC(N)CC(O)=O LCWXJXMHJVIJFK-UHFFFAOYSA-N 0.000 description 1
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- FFFHZYDWPBMWHY-VKHMYHEASA-N L-homocysteine Chemical compound OC(=O)[C@@H](N)CCS FFFHZYDWPBMWHY-VKHMYHEASA-N 0.000 description 1
- UKAUYVFTDYCKQA-VKHMYHEASA-N L-homoserine Chemical compound OC(=O)[C@@H](N)CCO UKAUYVFTDYCKQA-VKHMYHEASA-N 0.000 description 1
- ZFOMKMMPBOQKMC-KXUCPTDWSA-N L-pyrrolysine Chemical compound C[C@@H]1CC=N[C@H]1C(=O)NCCCC[C@H]([NH3+])C([O-])=O ZFOMKMMPBOQKMC-KXUCPTDWSA-N 0.000 description 1
- TYYLDKGBCJGJGW-UHFFFAOYSA-N L-tryptophan-L-tyrosine Natural products C=1NC2=CC=CC=C2C=1CC(N)C(=O)NC(C(O)=O)CC1=CC=C(O)C=C1 TYYLDKGBCJGJGW-UHFFFAOYSA-N 0.000 description 1
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- QLDHBYRUNQZIJQ-DKIMLUQUSA-N Leu-Ile-Phe Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC1=CC=CC=C1)C(O)=O QLDHBYRUNQZIJQ-DKIMLUQUSA-N 0.000 description 1
- 235000021353 Lignoceric acid Nutrition 0.000 description 1
- CQXMAMUUWHYSIY-UHFFFAOYSA-N Lignoceric acid Natural products CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCCC1=CC=C(O)C=C1 CQXMAMUUWHYSIY-UHFFFAOYSA-N 0.000 description 1
- OAPNERBWQWUPTI-YUMQZZPRSA-N Lys-Gln Chemical compound NCCCC[C@H](N)C(=O)N[C@H](C(O)=O)CCC(N)=O OAPNERBWQWUPTI-YUMQZZPRSA-N 0.000 description 1
- WTEYUROYEKWTOT-UHFFFAOYSA-N Nc1ccccc1C(O)=O.OC(=O)c1ccccc1O Chemical group Nc1ccccc1C(O)=O.OC(=O)c1ccccc1O WTEYUROYEKWTOT-UHFFFAOYSA-N 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- 102100022239 Peroxiredoxin-6 Human genes 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- APIDTRXFGYOLLH-VQVTYTSYSA-N Thr-Met Chemical compound CSCC[C@@H](C(O)=O)NC(=O)[C@@H](N)[C@@H](C)O APIDTRXFGYOLLH-VQVTYTSYSA-N 0.000 description 1
- TYYLDKGBCJGJGW-WMZOPIPTSA-N Trp-Tyr Chemical compound C([C@H](NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)N)C(O)=O)C1=CC=C(O)C=C1 TYYLDKGBCJGJGW-WMZOPIPTSA-N 0.000 description 1
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Natural products CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 1
- FKNHDDTXBWMZIR-GEMLJDPKSA-N acetic acid;(2s)-1-[(2r)-2-amino-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid Chemical compound CC(O)=O.SC[C@H](N)C(=O)N1CCC[C@H]1C(O)=O FKNHDDTXBWMZIR-GEMLJDPKSA-N 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- 210000004102 animal cell Anatomy 0.000 description 1
- GONOPSZTUGRENK-UHFFFAOYSA-N benzyl(trichloro)silane Chemical compound Cl[Si](Cl)(Cl)CC1=CC=CC=C1 GONOPSZTUGRENK-UHFFFAOYSA-N 0.000 description 1
- 239000013533 biodegradable additive Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- GWHCXVQVJPWHRF-UHFFFAOYSA-N cis-tetracosenoic acid Natural products CCCCCCCCC=CCCCCCCCCCCCCCC(O)=O GWHCXVQVJPWHRF-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- YSMODUONRAFBET-UHFFFAOYSA-N delta-DL-hydroxylysine Natural products NCC(O)CCC(N)C(O)=O YSMODUONRAFBET-UHFFFAOYSA-N 0.000 description 1
- PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 description 1
- 229940090949 docosahexaenoic acid Drugs 0.000 description 1
- YSMODUONRAFBET-UHNVWZDZSA-N erythro-5-hydroxy-L-lysine Chemical compound NC[C@H](O)CC[C@H](N)C(O)=O YSMODUONRAFBET-UHNVWZDZSA-N 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- FARYTWBWLZAXNK-WAYWQWQTSA-N ethyl (z)-3-(methylamino)but-2-enoate Chemical compound CCOC(=O)\C=C(\C)NC FARYTWBWLZAXNK-WAYWQWQTSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 108010027668 glycyl-alanyl-valine Proteins 0.000 description 1
- QJHBJHUKURJDLG-UHFFFAOYSA-N hydroxy-L-lysine Natural products NCCCCC(NO)C(O)=O QJHBJHUKURJDLG-UHFFFAOYSA-N 0.000 description 1
- 229960002591 hydroxyproline Drugs 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- VUZPPFZMUPKLLV-UHFFFAOYSA-N methane;hydrate Chemical compound C.O VUZPPFZMUPKLLV-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- NJTGANWAUPEOAX-UHFFFAOYSA-N molport-023-220-454 Chemical compound OCC(O)CO.OCC(O)CO NJTGANWAUPEOAX-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- ZKZBPNGNEQAJSX-UHFFFAOYSA-N selenocysteine Natural products [SeH]CC(N)C(O)=O ZKZBPNGNEQAJSX-UHFFFAOYSA-N 0.000 description 1
- 235000016491 selenocysteine Nutrition 0.000 description 1
- 229940055619 selenocysteine Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- QZZGJDVWLFXDLK-UHFFFAOYSA-N tetracosanoic acid Chemical compound CCCCCCCCCCCCCCCCCCCCCCCC(O)=O QZZGJDVWLFXDLK-UHFFFAOYSA-N 0.000 description 1
- 229940034208 thyroxine Drugs 0.000 description 1
- XUIIKFGFIJCVMT-UHFFFAOYSA-N thyroxine-binding globulin Natural products IC1=CC(CC([NH3+])C([O-])=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-UHFFFAOYSA-N 0.000 description 1
- FGMPLJWBKKVCDB-UHFFFAOYSA-N trans-L-hydroxy-proline Natural products ON1CCCC1C(O)=O FGMPLJWBKKVCDB-UHFFFAOYSA-N 0.000 description 1
- 108010044292 tryptophyltyrosine Proteins 0.000 description 1
- 239000004474 valine Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/76—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring
- C07C69/84—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring of monocyclic hydroxy carboxylic acids, the hydroxy groups and the carboxyl groups of which are bound to carbon atoms of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/45—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups
- C07C233/53—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
- C07C233/54—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring having the carbon atom of the carboxamide group bound to a hydrogen atom or to a carbon atom of a saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/04—Saturated ethers
- C07C43/10—Saturated ethers of polyhydroxy compounds
- C07C43/11—Polyethers containing —O—(C—C—O—)n units with ≤ 2 n≤ 10
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/76—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring
- C07C69/84—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring of monocyclic hydroxy carboxylic acids, the hydroxy groups and the carboxyl groups of which are bound to carbon atoms of a six-membered aromatic ring
- C07C69/92—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring of monocyclic hydroxy carboxylic acids, the hydroxy groups and the carboxyl groups of which are bound to carbon atoms of a six-membered aromatic ring with etherified hydroxyl groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/06—Ethers; Acetals; Ketals; Ortho-esters
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/10—Esters; Ether-esters
- C08K5/101—Esters; Ether-esters of monocarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/10—Esters; Ether-esters
- C08K5/101—Esters; Ether-esters of monocarboxylic acids
- C08K5/103—Esters; Ether-esters of monocarboxylic acids with polyalcohols
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/17—Amines; Quaternary ammonium compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/17—Amines; Quaternary ammonium compounds
- C08K5/175—Amines; Quaternary ammonium compounds containing COOH-groups; Esters or salts thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/20—Carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L33/00—Compositions of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical, or of salts, anhydrides, esters, amides, imides or nitriles thereof; Compositions of derivatives of such polymers
- C08L33/04—Homopolymers or copolymers of esters
- C08L33/06—Homopolymers or copolymers of esters of esters containing only carbon, hydrogen and oxygen, which oxygen atoms are present only as part of the carboxyl radical
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/04—Polyesters derived from hydroxycarboxylic acids, e.g. lactones
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L71/00—Compositions of polyethers obtained by reactions forming an ether link in the main chain; Compositions of derivatives of such polymers
- C08L71/02—Polyalkylene oxides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/0008—Organic ingredients according to more than one of the "one dot" groups of C08K5/01 - C08K5/59
- C08K5/0016—Plasticisers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L2201/00—Properties
- C08L2201/06—Biodegradable
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02W—CLIMATE CHANGE MITIGATION TECHNOLOGIES RELATED TO WASTEWATER TREATMENT OR WASTE MANAGEMENT
- Y02W90/00—Enabling technologies or technologies with a potential or indirect contribution to greenhouse gas [GHG] emissions mitigation
- Y02W90/10—Bio-packaging, e.g. packing containers made from renewable resources or bio-plastics
Definitions
- the present disclosure relates to an additive for plastic materials. More particularly, the present disclosure relates to a biodegradable plasticizer.
- biodegradable plastics such as polylactic acid (PLA), poly(butylene succinate) (PBS) and poly(butylene adipate-co-terephthalate) (PBAT).
- PLA polylactic acid
- PBS poly(butylene succinate)
- PBAT poly(butylene adipate-co-terephthalate)
- properties of this type of plastics are still not as good as petroleum-based plastics.
- polylactic acid has excellent rigidity and high transparency, but lacks enough durability, heat resistance, impact resistance, flexibility and airtightness, which limits the applications of polylactic acid.
- biodegradable additives can be added to change the flexibility and durability of biodegradable plastics.
- the enhancement of biodegradation in properties of biodegradable plastics made by adding conventional additives is still insufficient.
- the conventional additives are likely to release and have higher cost, so there has a lot of improvements for the conventional additives.
- the conditions for degradation of biodegradable plastics are tough.
- plastic products made of polylactic acid can completely degrade into carbon dioxide and water only under particular environmental conditions for a sufficient time, and then enter the cycle without harming the natural environment.
- the important trend for future is to develop an additive, which can enhance the degradation rate to facilitate biodegradable plastics quickly degrading and entering the natural environment.
- a plasticizer which is biodegradable, has a molecule including a central structure, at least two connecting structures and at least one side-chain structure.
- the central structure includes at least one of a benzene derivative and at least one amino acid.
- the at least two connecting structures are respectively connected to the central structure, wherein the at least two connecting structures include a first connecting structure and a second connecting structure.
- the first connecting structure is an amine group
- the second connecting structure is a carboxyl group.
- the at least one side-chain structure is a chain of multiple carbon atoms, and the at least one side-chain structure is connected to at least one of the first connecting structure and the second connecting structure.
- An amide bond is formed as the at least one side-chain structure connected to the amine group
- an ester bond is formed as the at least one side-chain structure connected to the carboxyl group.
- a plastic product which is biodegradable, includes the plasticizer of the aforementioned aspect and a polyester plastic, wherein the polyester plastic is a polylactic acid, a polybutylene succinate, a poly(butylene adipate-co-terephthalate) or a polyhydroxyalkanoate, and the plasticizer is mixed with the polyester plastic.
- a plasticizer which is biodegradable, has a molecule including at least two central structures, at least two connecting structures and a side-chain structure.
- Each of the central structures includes at least one of a benzene derivative and at least one amino acid.
- Each of the connecting structures is a carboxyl group, and each of the central structures is connected to at least one of the connecting structures.
- the side-chain structure is a chain of multiple carbon atoms, each of the central structures is connected to the side-chain structure through the connecting structures, and an ester bond is formed as the side-chain structure connected to each of the carboxyl groups.
- FIG. 1 is a structural schematic view of a molecule of a plasticizer according to the 1st embodiment of the present disclosure.
- FIG. 2 is a structural schematic view of a molecule of a plasticizer according to the 2nd embodiment of the present disclosure.
- FIG. 3 is a structural schematic view of a molecule of a plasticizer according to the 3rd embodiment of the present disclosure.
- FIG. 4 is a structural schematic view of a molecule of a plasticizer according to the 4th embodiment of the present disclosure.
- FIG. 5 is a structural schematic view of a molecule of a plasticizer according to the 5th embodiment of the present disclosure.
- FIG. 6 is a structural schematic view of a molecule of a plasticizer according to the 6th embodiment of the present disclosure.
- FIG. 7 is a structural schematic view of a molecule of a plasticizer according to the 7th embodiment of the present disclosure.
- FIG. 8 is a structural schematic view of a molecule of a plasticizer according to the 8th embodiment of the present disclosure.
- FIG. 9 is a structural schematic view of a molecule of a plasticizer according to the 9th embodiment of the present disclosure.
- FIG. 10 is a structural schematic view of a molecule of a plasticizer according to the 10th embodiment of the present disclosure.
- FIG. 11 is a structural schematic view of a molecule of a plasticizer according to the 11th embodiment of the present disclosure.
- FIG. 12 is a structural schematic view of a molecule of a plasticizer according to the 12th embodiment of the present disclosure.
- FIG. 13 is a structural schematic view of a molecule of a plasticizer according to the 13th embodiment of the present disclosure.
- FIG. 14 is a structural schematic view of a molecule of a plasticizer according to the 14th embodiment of the present disclosure.
- FIG. 15 shows results of biodegradation tests of the comparison, the 29th Example and the 30th Example.
- a plasticizer which is biodegradable, has a molecule including a central structure, at least two connecting structures and at least one side-chain structure.
- the at least two connecting structures are respectively connected to the central structure, and the side-chain structure is connected to at least one of the at least two connecting structures.
- the central structure includes at least one of a benzene derivative and at least one amino acid. It is favorable for maintaining the biodegradability of the plasticizer by having the benzene derivative.
- the amino acid can be degraded and metabolized in animal cells, so that it is favorable for enhancing the biodegradability of the plasticizer.
- the central structure can be the benzene derivative, and can further include the amino acid.
- the central structure can be the amino acid, and can include at least two of the amino acid.
- the residue of the amino acid can be acidic, basic, hydrophilic or hydrophobic, so that it is favorable for adjusting the properties of the plasticizer according to the residue characteristics of the amino acid.
- the benzene derivative can be compounds with similar structures, such as 2-aminobenzoic acid, 3-aminobenzoic acid, 4-aminobenzoic acid, 2-hydroxybenzoic acid, 3-hydroxybenzoic acid or 4-hydroxybenzoic acid.
- the amino acid can be standard amino acids, essential amino acids which humans cannot synthesize, modified amino acids (such as hydroxyproline, hydroxylysine or thyroxine) or other non-standard amino acids (such as homocysteine, homoserine or ornithine).
- modified amino acids such as hydroxyproline, hydroxylysine or thyroxine
- non-standard amino acids such as homocysteine, homoserine or ornithine.
- the standard amino acids and essential amino acids are listed in Table 1 below.
- the central structure can also be glycerol (propane-1,2,3-triol) or 2-(2-hydroxyethoxy)propan-1-ol.
- the at least two connecting structures include a first connecting structure and a second connecting structure.
- the first connecting structure is an amine group
- the second connecting structure is a carboxyl group.
- the position of the amine group and the position of the carboxyl group can be adjacent to each other (ortho) or not adjacent (meta or para) on the benzene derivative.
- the amine group can be a functional group of —NH 2 , —NHR, or —NR2. Moreover, the amine group can be a primary amine, a secondary amine, a tertiary amine or a quaternary ammonium cation. Furthermore, a hydroxyl group can be substituted for the amine group of the first connecting structure. When the side-chain structure is connected to the hydroxyl group, the connection therebetween can be split through hydrolysis reaction, so that it is favorable for enhancing the biodegradability of the plasticizer.
- the two connecting structures are respectively the first connecting structure and the second connecting structure.
- the molecule of the plasticizer can include three connecting structures, which are respectively the first connecting structure, the second connecting structure and a third connecting structure.
- the third connecting structure can be the residue of the amino acid.
- the amine group of the residue from lysine can be taken as the third connecting structure, or the carboxyl group of the residue from aspartate can be taken as the third connecting structure.
- the molecule of the plasticizer can include four connecting structures, which are respectively the first connecting structure, the second connecting structure, the third connecting structure and a fourth connecting structure.
- the third connecting structure and the fourth connecting structure can be the same functional groups, such as the binary amine groups of the residues from arginine, or can be different functional groups. Furthermore, when the central structure includes a plurality of amino acids, the molecule of the plasticizer can include more than five connecting structures.
- the side-chain structure is a chain of multiple carbon atoms.
- the number of carbon atoms of the side-chain structure can be 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19 or 20, etc.
- the side-chain structure can include an oxygen atom to form an ether group, and the number of oxygen atoms of the side-chain structure can be 1, 2, 3, 4, 5, 6 or 7, etc.
- the side-chain structure can be a saturated fatty acid.
- the number of carbon atoms of the saturated fatty acid can be 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35 or 36, such as acetic acid (lipid number C2:0), butyric acid (C4:0), hexanoic acid (C6:0), octanoic acid (C8:0), decanoic acid (C10:0), lauric acid (C12:0), lignoceric acid (C24:0), or hexatriacontanoic acid (C36:0).
- the side-chain structure can be an unsaturated fatty acid.
- the number of carbon atoms of the unsaturated fatty acid can be 14, 15, 16, 17, 18, 19, 20, 21, 22, 23 or 24, and the number of double bonds of the unsaturated fatty acid can be 1, 2, 3, 4, 5 or 6, such as paullinic acid (C20:1), dihomo- ⁇ -linolenic acid (DGLA, C20:3), docosahexaenoic acid (DHA, C22:6), or tetracosenoic acid (C24:1).
- the side-chain structure can be formed by continuous polymerization with ethylene glycol, polyethylene glycol (PEG), propylene glycol or polypropylene glycol (PPG) as monomers. Moreover, the side-chain structure can be formed by polymerization of the monomers selected from the group consisting of ethylene glycol, polyethylene glycol, propylene glycol and polypropylene glycol.
- the side-chain structure is formed by polymerization of the abovementioned monomers, the required molecular weight of the plasticizer can be controlled, and the hydrophilicity and hydrophobicity of the plasticizer are properly adjusted, so that it is favorable for the plasticizer performing the superior characteristics and enhancing the compatibility of the plasticizer mixing with the plastic.
- the side-chain structure is connected to at least one of the first connecting structure and the second connecting structure, that is, the central structure is connected to the side-chain structure through the first connecting structure and/or the second connecting structure by a method of esterification, dehydration or peptide synthesis.
- an amide bond is formed, so that it is favorable for enhancing the efficiency of the plasticizer degraded by the enzyme, and further improving the biodegradability of the plasticizer.
- an ester bond is formed.
- an ether bond is formed. The ether bond can be split through hydrolysis reaction in a particular environment, so that it is favorable for enhancing the biodegradability of the plasticizer.
- the plasticizer can further include at least one polar functional group connected to the side-chain structure, and the polar functional group can be located in the middle or at the end of the side-chain structure.
- the polar functional group can be a carboxyl group (—COOH), a hydroxyl group (—OH), an amine group (—NH 2 ) or a phosphoryl group (—PO(OH) 2 ).
- the plasticizer can include at least two of the polar functional group, which are selected from the group consisting of the carboxyl group, the hydroxyl group, the amine group and the phosphoryl group.
- the polar functional group is arranged according to different requirements, so that it is favorable for enhancing the hydrophilicity of the plasticizer and the compatibility between the plasticizer and the plastic, which helps the plasticizer mix with the plastic.
- nNC a number of carbon atoms of the side-chain structure which is connected to the amine group
- nOC a number of carbon atoms of the side-chain structure which is connected to the carboxyl group
- a number of oxygen atoms of the side-chain structure which is connected to the amine group is nNO.
- a number of oxygen atoms of the side-chain structure which is connected to the carboxyl group is nOO.
- a number of carbon atoms of the side-chain structure which is connected to the hydroxyl group is nO′C.
- a number of oxygen atoms of the side-chain structure which is connected to the hydroxyl group is nO′O.
- nNC and nNO of the side-chain structure are counted from the nitrogen atom of the amine group.
- nOC, nOO, nO′C and nO′O of the side-chain structure are counted from the oxygen atom of the carboxyl group or the hydroxyl group.
- the carbon atoms or the oxygen atoms in the polar functional group are not included as calculating nNC, nNO, nOC, nOO, nO′C and nO′O.
- nO′C is taken as nOC and nO′O is taken as nOO during calculation.
- the molecular weight of the plasticizer is MwP
- the following condition is satisfied: 450 Dalton ⁇ MwP.
- a plasticizer which is biodegradable, has a molecule including at least two central structures, at least two connecting structures and a side-chain structure. Each of the central structures is connected to at least one of the connecting structures. Each of the central structures is connected to the side-chain structure through the connecting structures, that is, the central structures are all connected to the same side-chain structure.
- the detailed features of the central structures, the connecting structures and the side-chain structure are the same as the abovementioned plasticizer, and an explanation in this regard will not be provided again.
- a plastic product wherein the plastic product is biodegradable.
- the plastic product includes the aforementioned plasticizer and a polyester plastic, wherein the polyester plastic can be a polylactic acid, a polybutylene succinate, a poly(butylene adipate-co-terephthalate) or a polyhydroxyalkanoate (PHA), and the plasticizer is mixed with the polyester plastic.
- the type of the polyester plastic is chosen to ensure that the plasticizer is mixed with the plastic of high compatibility, so that it is favorable for enhancing the ductility of the plastic and reducing the possibility of releasing of the plasticizer.
- the polyhydroxyalkanoate can be a polyhydroxybutyrate (PHB).
- FIG. 1 is a structural schematic view of a molecule of a plasticizer 100 according to the 1st embodiment of the present disclosure.
- the molecule of the plasticizer 100 according to the 1st embodiment includes a central structure 110 , two connecting structures and a side-chain structure 130 .
- the central structure 110 is a benzene derivative.
- the two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 110 , respectively.
- the first connecting structure is an amine group 121
- the second connecting structure is a carboxyl group (not shown in drawings).
- the side-chain structure 130 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- the side-chain structure 130 is connected to the second connecting structure to form an ester bond 122 ′.
- FIG. 2 is a structural schematic view of a molecule of a plasticizer 200 according to the 2nd embodiment of the present disclosure.
- the molecule of the plasticizer 200 according to the 2nd embodiment includes a central structure 210 , two connecting structures, a side-chain structure 230 and a polar functional group 260 .
- the central structure 210 is a benzene derivative.
- the two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 210 , respectively.
- the first connecting structure is an amine group 221
- the second connecting structure is a carboxyl group (not shown in drawings).
- the side-chain structure 230 is formed by polymerization with propylene glycol or polypropylene glycol as monomers.
- the side-chain structure 230 is connected to the second connecting structure to form an ester bond 222 ′.
- the polar functional group 260 is connected to the side-chain structure 230 .
- FIG. 3 is a structural schematic view of a molecule of a plasticizer 300 according to the 3rd embodiment of the present disclosure.
- the molecule of the plasticizer 300 according to the 3rd embodiment includes a central structure 310 , two connecting structures and a side-chain structure 330 .
- the central structure 310 is a benzene derivative.
- the two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 310 , respectively.
- the first connecting structure is an amine group 321
- the second connecting structure is a carboxyl group (not shown in drawings).
- the side-chain structure 330 is formed by a first short chain 331 connected to a second short chain 332 .
- the first short chain 331 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- the second short chain 332 is formed by polymerization with propylene glycol or polypropylene glycol as monomers.
- the side-chain structure 330 is connected to the second connecting structure to form an ester bond 322 ′.
- FIG. 4 is a structural schematic view of a molecule of a plasticizer 400 according to the 4th embodiment of the present disclosure.
- the molecule of the plasticizer 400 according to the 4th embodiment includes a central structure 410 , two connecting structures and a side-chain structure 430 .
- the central structure 410 is a benzene derivative.
- the two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 410 , respectively.
- the first connecting structure is an amine group (not shown in drawings), and the second connecting structure is a carboxyl group 422 .
- the side-chain structure 430 is a fatty acid.
- the side-chain structure 430 is connected to the first connecting structure to form an amide bond 421 ′.
- FIG. 5 is a structural schematic view of a molecule of a plasticizer 500 according to the 5th embodiment of the present disclosure.
- the molecule of the plasticizer 500 according to the 5th embodiment includes a central structure 510 , two connecting structures, two side-chain structures 530 , 540 and a polar functional group 560 .
- the central structure 510 is a benzene derivative.
- the two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 510 , respectively.
- the first connecting structure is an amine group (not shown in drawings)
- the second connecting structure is a carboxyl group (not shown in drawings).
- the side-chain structure 530 is formed by a first short chain 531 connected to a second short chain 532 .
- the first short chain 531 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- the second short chain 532 is formed by polymerization with propylene glycol or polypropylene glycol as monomers.
- the side-chain structure 530 is connected to the second connecting structure to form an ester bond 522 ′.
- the side-chain structure 540 is a fatty acid.
- the side-chain structure 540 is connected to the first connecting structure to form an amide bond 521 ′.
- the polar functional group 560 is connected to the side-chain structure 530 .
- FIG. 6 is a structural schematic view of a molecule of a plasticizer 600 according to the 6th embodiment of the present disclosure.
- the molecule of the plasticizer 600 according to the 6th embodiment includes a central structure 610 , two connecting structures, a side-chain structure 630 and a polar functional group 660 .
- the central structure 610 is an amino acid and includes a residue 611 .
- the two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 610 , respectively.
- the first connecting structure is an amine group 621
- the second connecting structure is a carboxyl group (not shown in drawings).
- the side-chain structure 630 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- the side-chain structure 630 is connected to the second connecting structure to form an ester bond 622 ′.
- the polar functional group 660 is connected to the side-chain structure 630 .
- FIG. 7 is a structural schematic view of a molecule of a plasticizer 700 according to the 7th embodiment of the present disclosure.
- the molecule of the plasticizer 700 according to the 7th embodiment includes a central structure 710 , two connecting structures and a side-chain structure 730 .
- the central structure 710 is an amino acid and includes a residue 711 .
- the two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 710 , respectively.
- the first connecting structure is an amine group 721
- the second connecting structure is a carboxyl group (not shown in drawings).
- the side-chain structure 730 is formed by polymerization with propylene glycol or polypropylene glycol as monomers.
- the side-chain structure 730 is connected to the second connecting structure to form an ester bond 722 ′.
- FIG. 8 is a structural schematic view of a molecule of a plasticizer 800 according to the 8th embodiment of the present disclosure.
- the molecule of the plasticizer 800 according to the 8th embodiment includes a central structure 810 , two connecting structures and a side-chain structure 830 .
- the central structure 810 is an amino acid and includes a residue 811 .
- the two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 810 , respectively.
- the first connecting structure is an amine group 821
- the second connecting structure is a carboxyl group (not shown in drawings).
- the side-chain structure 830 is formed by a first short chain 831 connected to a second short chain 832 .
- the first short chain 831 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- the second short chain 832 is formed by polymerization with propylene glycol or polypropylene glycol as monomers.
- the side-chain structure 830 is connected to the second connecting structure to form an ester bond 822 ′.
- FIG. 9 is a structural schematic view of a molecule of a plasticizer 900 according to the 9th embodiment of the present disclosure.
- the molecule of the plasticizer 900 according to the 9th embodiment includes a central structure 910 , two connecting structures and a side-chain structure 930 .
- the central structure 910 is an amino acid and includes a residue 911 .
- the two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 910 , respectively.
- the first connecting structure is an amine group (not shown in drawings), and the second connecting structure is a carboxyl group 922 .
- the side-chain structure 930 is a fatty acid.
- the side-chain structure 930 is connected to the first connecting structure to form an amide bond 921 ′.
- FIG. 10 is a structural schematic view of a molecule of a plasticizer 1000 according to the 10th embodiment of the present disclosure.
- the molecule of the plasticizer 1000 according to the 10th embodiment includes central structure 1010 , two connecting structures, two side-chain structures 1030 , 1040 and a polar functional group 1060 .
- the central structure 1010 is an amino acid and includes a residue 1011 .
- the two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 1010 , respectively.
- the first connecting structure is an amine group (not shown in drawings)
- the second connecting structure is a carboxyl group (not shown in drawings).
- the side-chain structure 1030 is formed by a first short chain 1031 connected to a second short chain 1032 .
- the first short chain 1031 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- the second short chain 1032 is formed by polymerization with propylene glycol or polypropylene glycol as monomers.
- the side-chain structure 1030 is connected to the second connecting structure to form an ester bond 1022 ′.
- the side-chain structure 1040 is a fatty acid.
- the side-chain structure 1040 is connected to the first connecting structure to form an amide bond 1021 ′.
- the polar functional group 1060 is connected to the side-chain structure 1030 .
- FIG. 11 is a structural schematic view of a molecule of a plasticizer 1100 according to the 11th embodiment of the present disclosure.
- the molecule of the plasticizer 1100 according to the 11th embodiment includes a central structure 1110 , three connecting structures, three side-chain structures 1130 , 1140 , 1150 and a polar functional group 1160 .
- the central structure 1110 includes two amino acids, and each of the two amino acids includes a residue 1111 , 1112 .
- the three connecting structures are a first connecting structure, a second connecting structure and a third connecting structure and connected to the central structure 1110 , respectively.
- the first connecting structure is an amine group (not shown in drawings), and each of the second connecting structure and the third connecting structure is a carboxyl group (not shown in drawings).
- the third connecting structure is connected to the residue 1111 .
- the side-chain structure 1130 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- the side-chain structure 1130 is connected to the second connecting structure to form an ester bond 1122 ′.
- the side-chain structure 1140 is a fatty acid.
- the side-chain structure 1140 is connected to the first connecting structure to form an amide bond 1121 ′.
- the side-chain structure 1150 is formed by a first short chain 1151 connected to a second short chain 1152 .
- the first short chain 1151 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- the second short chain 1152 is formed by polymerization with propylene glycol or polypropylene glycol as monomers.
- the side-chain structure 1150 is connected to the third connecting structure to form an ester bond 1123 ′.
- the polar functional group 1160 is connected to the side-chain structure 1150 .
- FIG. 12 is a structural schematic view of a molecule of a plasticizer 1200 according to the 12th embodiment of the present disclosure.
- the molecule of the plasticizer 1200 according to the 12th embodiment includes a central structure 1210 , three connecting structures and three side-chain structures 1230 , 1240 , 1250 .
- the central structure 1210 includes two amino acids, and each of the two amino acids includes a residue 1211 , 1212 .
- the three connecting structures are a first connecting structure, a second connecting structure and a third connecting structure and connected to the central structure 1210 , respectively.
- Each of the first connecting structure and the third connecting structure is an amine group (not shown in drawings), and the second connecting structure is a carboxyl group (not shown in drawings).
- the third connecting structure is connected to the residue 1212 .
- the side-chain structure 1230 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- the side-chain structure 1230 is connected to the second connecting structure to form an ester bond 1222 ′.
- the side-chain structure 1240 is a fatty acid.
- the side-chain structure 1240 is connected to the first connecting structure to form an amide bond 1221 ′.
- the side-chain structure 1250 is a fatty acid.
- the side-chain structure 1250 is connected to the third connecting structure to form an amide bond 1223 ′.
- FIG. 13 is a structural schematic view of a molecule of a plasticizer 1300 according to the 13th embodiment of the present disclosure.
- the molecule of the plasticizer 1300 according to the 13th embodiment includes a central structure 1310 , four connecting structures, three side-chain structures 1330 , 1340 , 1350 and a polar functional group 1360 .
- the central structure 1310 includes three amino acids, and each of the three amino acids includes a residue 1311 , 1312 , 1313 .
- the four connecting structures are a first connecting structure, a second connecting structure, a third connecting structure and a fourth connecting structure and connected to the central structure 1310 , respectively.
- the first connecting structure is an amine group 1321
- each of the second connecting structure and the third connecting structure is a carboxyl group (not shown in drawings)
- the fourth connecting structure is an amine group (not shown in drawings).
- the third connecting structure and the fourth connecting structure are connected to the residue 1311 and the residue 1313 , respectively.
- the side-chain structure 1330 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- the side-chain structure 1330 is connected to the second connecting structure to form an ester bond 1322 ′.
- the side-chain structure 1340 is formed by a first short chain 1341 connected to a second short chain 1342 .
- the first short chain 1341 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- the second short chain 1342 is formed by polymerization with propylene glycol or polypropylene glycol as monomers.
- the side-chain structure 1340 is connected to the third connecting structure to form an ester bond 1323 ′.
- the side-chain structure 1350 is a fatty acid.
- the side-chain structure 1350 is connected to the fourth connecting structure to form an amide bond 1324 ′.
- the polar functional group 1360 is connected to the side-chain structure 1330 .
- FIG. 14 is a structural schematic view of a molecule of a plasticizer 1400 according to the 14th embodiment of the present disclosure.
- the molecule of the plasticizer 1400 according to the 14th embodiment includes two central structures 1410 a , 1410 b , two connecting structures, a side-chain structure 1430 and two polar functional groups 1460 a , 1460 b.
- Each of the central structures 1410 a , 1410 b is a benzene derivative.
- Each of the central structures 1410 a , 1410 b is connected to the corresponding one of the connecting structures, that is, the central structure 1410 a is connected to one of the connecting structures, and the central structure 1410 b is connected to the other one of the connecting structures.
- Both of the connecting structures are carboxyl groups (not shown in drawings).
- the side-chain structure 1430 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers.
- Each of the central structures 1410 a , 1410 b is connected to the side-chain structure 1430 through the connecting structure to form an ester bond 1420 a , 1420 b.
- Each of the polar functional groups 1460 a , 1460 b is connected to the corresponding one of the central structures 1410 a , 1410 b.
- the side-chain structures connected to the amine group, the carboxyl group and the hydroxyl group are named as SCA, SCC and SCH, respectively.
- SCA side-chain structures connected to the amine group
- SCC side-chain structures connected to the amine group
- SCA1 and SCA2 side-chain structures connected to the amine group in the 1st Example
- a number of carbon atoms and a number of oxygen atoms of the side-chain structure SCA1 are nNC SCA1 and nNO SCA1 , respectively.
- a number of carbon atoms and a number of oxygen atoms of the side-chain structure SCA2 are nNC SCA2 and nNO SCA2 , respectively.
- a number of carbon atoms and a number of oxygen atoms of the side-chain structure SCC are nOC SCC and nOO SCC , respectively.
- SCA1, SCA2 and SCC are only for marking the side-chain structures to clearly understand the characteristics of the side-chain structures, and do not make a difference to the calculation of carbon atoms and oxygen atoms of nNO, nNC, nOC and nOO as claimed. That is, nNC SCA1 is taken as nNC, nNO SCA1 is taken nNO, nNC SCA2 is taken as nNC, nNO SCA2 is taken as nNO, nOC SCC is taken as nOC and nOO SCC is taken as nOO during calculation.
- nNC SCA1 is taken as nNC
- nNO SCA1 is taken nNO
- nNC SCA2 is taken as nNC
- nNO SCA2 is taken as nNO
- nOC SCC is taken as nOC
- nOO SCC is taken as nOO during calculation.
- Example 6th Example Central Structure Hydroxybenzoic Acid Propane-1,2,3-Triol Structure of Para Position SMILES Notation C1 ⁇ CC( ⁇ CC ⁇ C1C( ⁇ O)OC C(C(COCCOCCOCCC)O C(OCC(OCC(OCCCC)C)C) CCOCCOCCC)OCCOCC C)OC(COC(COC(COC(C OCCC CC)C)C)C)C
- Example 10th Example 11th Example IUPAC Name of Glycine Alanine Valine Central Structure Structural Formula Molecular Weight 75.07 89.09 117.15 MwP (g/mol) Abbreviation 1 Gly Ala Val Abbreviation 2 G A V Residue Property Hydrophilic Hydrophobic Hydrophobic Representative Structure as Side-Chain Structure Being PEG Representative Structure as Side-Chain Structure Being PPG Representative Structure as Side-Chain Structure Being Fatty Acid (CH 3 (CH 2 ) n COOH, n ⁇ 3) Side-Chain Structure Being PEG and PPG Number of 12 12 12 PEG Monomers Number of 0 0 0 PPG Monomers Molecular Weight, MwP 603.7 617.7 645.8 (g/mol, Dalton) nNC 0 0 0 nOC 24 24 24 nNO 0 0 0 nOO 12 12 12 nNC/(nNC + nOC) 0 0 0 nOC/nOO 2 2 2 n
- nNC 15 15 nOC 15 15 nNO 0 0 nOO 5 5 nNC/(nNC + nOC) 0.50 0.50 nNC/(nNC + nOO) 0.75 0.75 nNO/(nNO + nOC) 0.00 0.00 0.00 nNO/(nNO + nOO) 0.00 0.00 Number of 2 2 PEG Monomers Number of 2 2 PPG Monomers Fatty Acid 15 15 CH 3 (CH 2 ) n COOH, n ?
- Example 26th Example IUPAC Name of Threonine Methionine Central Structure Structural Formula Molecular Weight 119.12 149.21 MwP (g/mol) Abbreviation 1 Thr Met Abbreviation 2 T M Residue Property Hydrophilic Hydrophobic Representative Structure as Side-Chain Structure Being PEG Representative Structure as Side-Chain Structure Being PPG Representative Structure 1 as Side-Chain Structure Being Fatty Acid (CH 3 (CH 2 ) n COOH, n ⁇ 3) Representative Structure 2 as Side-Chain Structure Being Fatty Acid (CH 3 (CH 2 ) n COOH, n ⁇ 3) — Representative Structure 3 as Side-Chain Structure Being Fatty Acid (CH 3 (CH 2 ) n COOH, n ⁇ 3) — Side-Chain Structure Being PEG and PPG Number of 12 12 PEG Monomers Number of 0 0 PPG Monomers Molecular 647.8 677.8 Weight, MwP (g/mol, Dalton) nNC
- nNC 15 15 nOC 15 15 nNO 0 0 nOO 5 5 nNC/(nNC + nOC) 0.50 0.50 nNC/(nNC + nOO) 0.75 0.75 nNO/(nNO + nOC) 0.00 0.00 0.00 nNO/(nNO + nOO) 0.00 0.00 Number of 2 2 PEG Monomers Number of 2 2 PPG Monomers Fatty Acid 15 15 CH 3 (CH 2 ) n COOH, n ?
- FIG. 15 shows results of biodegradation tests of the comparison, the 29th Example and the 30th Example.
- the biodegradation tests (ASTM 5338) of the plasticizers with different molecular structures are performed below.
- the comparison, the 29th Example and the 30th Example are tested, and the degrees of degradation under different days are listed in the following table.
- the biodegradable plasticizer is developed by investigating a novel molecular structure.
- the plasticizer has the abilities of improving the plastic texture, meeting the requirements for widespread applications, and further enhancing the degradation and cycle of the plastic.
- the plasticizer includes the first connecting structure and the second connecting structure, includes the benzene derivative and/or the amino acid as the central structure, and is grafted with the side-chain structure of the chain with multiple carbon atoms.
- the plasticizer can further include the polar functional group to adjust the hydrophilicity and hydrophobicity of the plasticizer.
- the plasticizer which reaches desire durability, heat resistance, impact resistance and flexibility, and is harmless to human body, hard to release and low-cost, is developed to meet the target of high biodegradability.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Biological Depolymerization Polymers (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polyesters Or Polycarbonates (AREA)
Abstract
A plasticizer, which is biodegradable, has a molecule including a central structure, at least two connecting structures and at least one side-chain structure. The central structure includes at least one of a benzene derivative and at least one amino acid. The connecting structures are respectively connected to the central structure, wherein the connecting structures include a first connecting structure and a second connecting structure. The first connecting structure is an amine group, and the second connecting structure is a carboxyl group. The side-chain structure is a chain of multiple carbon atoms, and the side-chain structure is connected to at least one of the first connecting structure and the second connecting structure. An amide bond is formed as the side-chain structure connected to the amine group, and an ester bond is formed as the side-chain structure connected to the carboxyl group.
Description
This application claims priority to U.S. Provisional Application Ser. No. 62/939,733, filed Nov. 25, 2019, which is herein incorporated by reference.
The present disclosure relates to an additive for plastic materials. More particularly, the present disclosure relates to a biodegradable plasticizer.
In order to solve the environmental problems brought on by plastic products, biodegradable plastics, such as polylactic acid (PLA), poly(butylene succinate) (PBS) and poly(butylene adipate-co-terephthalate) (PBAT), have already been developed. However, properties of this type of plastics are still not as good as petroleum-based plastics. For example, polylactic acid has excellent rigidity and high transparency, but lacks enough durability, heat resistance, impact resistance, flexibility and airtightness, which limits the applications of polylactic acid.
To deal with problems in properties, textures and costs of biodegradable plastics, conventional biodegradable additives can be added to change the flexibility and durability of biodegradable plastics. However, the enhancement of biodegradation in properties of biodegradable plastics made by adding conventional additives is still insufficient. Also, the conventional additives are likely to release and have higher cost, so there has a lot of improvements for the conventional additives. Furthermore, the conditions for degradation of biodegradable plastics are tough. For example, plastic products made of polylactic acid can completely degrade into carbon dioxide and water only under particular environmental conditions for a sufficient time, and then enter the cycle without harming the natural environment. However, it is pretty difficult for plastic products of polylactic acid naturally and completely degrading in a typical environment. In this regard, the important trend for future is to develop an additive, which can enhance the degradation rate to facilitate biodegradable plastics quickly degrading and entering the natural environment.
According to one aspect of the present disclosure, a plasticizer, which is biodegradable, has a molecule including a central structure, at least two connecting structures and at least one side-chain structure. The central structure includes at least one of a benzene derivative and at least one amino acid. The at least two connecting structures are respectively connected to the central structure, wherein the at least two connecting structures include a first connecting structure and a second connecting structure. The first connecting structure is an amine group, and the second connecting structure is a carboxyl group. The at least one side-chain structure is a chain of multiple carbon atoms, and the at least one side-chain structure is connected to at least one of the first connecting structure and the second connecting structure. An amide bond is formed as the at least one side-chain structure connected to the amine group, and an ester bond is formed as the at least one side-chain structure connected to the carboxyl group. When a number of carbon atoms of the side-chain structure which is connected to the amine group is nNC, and a number of carbon atoms of the side-chain structure which is connected to the carboxyl group is nOC, the following condition is satisfied: 0≤nNC/(nNC+nOC)≤1.00, wherein each of nNC and nOC is 0 or positive integer, but nNC and nOC are not 0 at the same time.
According to another aspect of the present disclosure, a plastic product, which is biodegradable, includes the plasticizer of the aforementioned aspect and a polyester plastic, wherein the polyester plastic is a polylactic acid, a polybutylene succinate, a poly(butylene adipate-co-terephthalate) or a polyhydroxyalkanoate, and the plasticizer is mixed with the polyester plastic.
According to another aspect of the present disclosure, a plasticizer, which is biodegradable, has a molecule including at least two central structures, at least two connecting structures and a side-chain structure. Each of the central structures includes at least one of a benzene derivative and at least one amino acid. Each of the connecting structures is a carboxyl group, and each of the central structures is connected to at least one of the connecting structures. The side-chain structure is a chain of multiple carbon atoms, each of the central structures is connected to the side-chain structure through the connecting structures, and an ester bond is formed as the side-chain structure connected to each of the carboxyl groups.
The present disclosure can be more fully understood by reading the following detailed description of the embodiment, with reference made to the accompanying drawings as follows:
A plasticizer, which is biodegradable, has a molecule including a central structure, at least two connecting structures and at least one side-chain structure. The at least two connecting structures are respectively connected to the central structure, and the side-chain structure is connected to at least one of the at least two connecting structures.
The central structure includes at least one of a benzene derivative and at least one amino acid. It is favorable for maintaining the biodegradability of the plasticizer by having the benzene derivative. The amino acid can be degraded and metabolized in animal cells, so that it is favorable for enhancing the biodegradability of the plasticizer. Moreover, the central structure can be the benzene derivative, and can further include the amino acid. Furthermore, the central structure can be the amino acid, and can include at least two of the amino acid. The residue of the amino acid can be acidic, basic, hydrophilic or hydrophobic, so that it is favorable for adjusting the properties of the plasticizer according to the residue characteristics of the amino acid.
The benzene derivative can be compounds with similar structures, such as 2-aminobenzoic acid, 3-aminobenzoic acid, 4-aminobenzoic acid, 2-hydroxybenzoic acid, 3-hydroxybenzoic acid or 4-hydroxybenzoic acid.
The amino acid can be standard amino acids, essential amino acids which humans cannot synthesize, modified amino acids (such as hydroxyproline, hydroxylysine or thyroxine) or other non-standard amino acids (such as homocysteine, homoserine or ornithine). The standard amino acids and essential amino acids are listed in Table 1 below.
| TABLE 1 |
| Standard Amino Acids and Essential Amino Acids |
| Amino Acid | Abbreviation | Essential Amino Acid | ||
| Alanine | Ala | No | ||
| Arginine | Arg | No | ||
| Asparagine | Asn | No | ||
| Aspartate | Asp | No | ||
| Cysteine | Cys | No | ||
| Glutamate | Glu | No | ||
| Glutamine | Gln | No | ||
| Glycine | Gly | No | ||
| Histidine | His | Yes | ||
| Isoleucine | Ile | Yes | ||
| Leucine | Leu | Yes | ||
| Lysine | Lys | Yes | ||
| Methionine | Met | Yes | ||
| Phenylalanine | Phe | Yes | ||
| Proline | Pro | No | ||
| Pyrrolysine | Pyl | No | ||
| Selenocysteine | Sec | No | ||
| Serine | Ser | No | ||
| Threonine | Thr | Yes | ||
| Tryptophan | Trp | Yes | ||
| Tyrosine | Tyr | No | ||
| Valine | Val | Yes | ||
The central structure can also be glycerol (propane-1,2,3-triol) or 2-(2-hydroxyethoxy)propan-1-ol.
The at least two connecting structures include a first connecting structure and a second connecting structure. The first connecting structure is an amine group, and the second connecting structure is a carboxyl group.
If the central structure is the benzene derivative, the position of the amine group and the position of the carboxyl group can be adjacent to each other (ortho) or not adjacent (meta or para) on the benzene derivative.
The amine group can be a functional group of —NH2, —NHR, or —NR2. Moreover, the amine group can be a primary amine, a secondary amine, a tertiary amine or a quaternary ammonium cation. Furthermore, a hydroxyl group can be substituted for the amine group of the first connecting structure. When the side-chain structure is connected to the hydroxyl group, the connection therebetween can be split through hydrolysis reaction, so that it is favorable for enhancing the biodegradability of the plasticizer.
When the molecule of the plasticizer includes two connecting structures, the two connecting structures are respectively the first connecting structure and the second connecting structure. Moreover, the molecule of the plasticizer can include three connecting structures, which are respectively the first connecting structure, the second connecting structure and a third connecting structure. The third connecting structure can be the residue of the amino acid. For example, the amine group of the residue from lysine can be taken as the third connecting structure, or the carboxyl group of the residue from aspartate can be taken as the third connecting structure. Further, the molecule of the plasticizer can include four connecting structures, which are respectively the first connecting structure, the second connecting structure, the third connecting structure and a fourth connecting structure. The third connecting structure and the fourth connecting structure can be the same functional groups, such as the binary amine groups of the residues from arginine, or can be different functional groups. Furthermore, when the central structure includes a plurality of amino acids, the molecule of the plasticizer can include more than five connecting structures.
The side-chain structure is a chain of multiple carbon atoms. The number of carbon atoms of the side-chain structure can be 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19 or 20, etc. Moreover, the side-chain structure can include an oxygen atom to form an ether group, and the number of oxygen atoms of the side-chain structure can be 1, 2, 3, 4, 5, 6 or 7, etc.
The side-chain structure can be a saturated fatty acid. The number of carbon atoms of the saturated fatty acid can be 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35 or 36, such as acetic acid (lipid number C2:0), butyric acid (C4:0), hexanoic acid (C6:0), octanoic acid (C8:0), decanoic acid (C10:0), lauric acid (C12:0), lignoceric acid (C24:0), or hexatriacontanoic acid (C36:0).
The side-chain structure can be an unsaturated fatty acid. The number of carbon atoms of the unsaturated fatty acid can be 14, 15, 16, 17, 18, 19, 20, 21, 22, 23 or 24, and the number of double bonds of the unsaturated fatty acid can be 1, 2, 3, 4, 5 or 6, such as paullinic acid (C20:1), dihomo-γ-linolenic acid (DGLA, C20:3), docosahexaenoic acid (DHA, C22:6), or tetracosenoic acid (C24:1).
The side-chain structure can be formed by continuous polymerization with ethylene glycol, polyethylene glycol (PEG), propylene glycol or polypropylene glycol (PPG) as monomers. Moreover, the side-chain structure can be formed by polymerization of the monomers selected from the group consisting of ethylene glycol, polyethylene glycol, propylene glycol and polypropylene glycol. The side-chain structure is formed by polymerization of the abovementioned monomers, the required molecular weight of the plasticizer can be controlled, and the hydrophilicity and hydrophobicity of the plasticizer are properly adjusted, so that it is favorable for the plasticizer performing the superior characteristics and enhancing the compatibility of the plasticizer mixing with the plastic.
The side-chain structure is connected to at least one of the first connecting structure and the second connecting structure, that is, the central structure is connected to the side-chain structure through the first connecting structure and/or the second connecting structure by a method of esterification, dehydration or peptide synthesis.
When the side-chain structure is connected to the amine group, an amide bond is formed, so that it is favorable for enhancing the efficiency of the plasticizer degraded by the enzyme, and further improving the biodegradability of the plasticizer. Moreover, when the side-chain structure is connected to the carboxyl group, an ester bond is formed. Furthermore, when the side-chain structure is connected to the hydroxyl group, an ether bond is formed. The ether bond can be split through hydrolysis reaction in a particular environment, so that it is favorable for enhancing the biodegradability of the plasticizer.
The plasticizer can further include at least one polar functional group connected to the side-chain structure, and the polar functional group can be located in the middle or at the end of the side-chain structure. Moreover, the polar functional group can be a carboxyl group (—COOH), a hydroxyl group (—OH), an amine group (—NH2) or a phosphoryl group (—PO(OH)2). Furthermore, the plasticizer can include at least two of the polar functional group, which are selected from the group consisting of the carboxyl group, the hydroxyl group, the amine group and the phosphoryl group. The polar functional group is arranged according to different requirements, so that it is favorable for enhancing the hydrophilicity of the plasticizer and the compatibility between the plasticizer and the plastic, which helps the plasticizer mix with the plastic.
When a number of carbon atoms of the side-chain structure which is connected to the amine group is nNC, and a number of carbon atoms of the side-chain structure which is connected to the carboxyl group is nOC, the following condition is satisfied: 0≤nNC/(nNC+nOC)≤1.00, wherein each of nNC and nOC is 0 or positive integer, but nNC and nOC are not 0 at the same time. Moreover, the following conditions can be satisfied: 0.01≤nNC/(nNC+nOC); nNC/(nNC+nOC)≤1.00; 0.05≤nNC/(nNC+nOC)≤0.95; 0.10≤nNC/(nNC+nOC)≤0.90; 0.15≤nNC/(nNC+nOC)≤0.80; 0.20≤nNC/(nNC+nOC)≤0.70; 0.25≤nNC/(nNC+nOC)≤0.60; 0.30≤nNC/(nNC+nOC)≤0.50; or 0.35≤nNC/(nNC+nOC)≤0.40.
A number of oxygen atoms of the side-chain structure which is connected to the amine group is nNO. A number of oxygen atoms of the side-chain structure which is connected to the carboxyl group is nOO. A number of carbon atoms of the side-chain structure which is connected to the hydroxyl group is nO′C. A number of oxygen atoms of the side-chain structure which is connected to the hydroxyl group is nO′O. nNC and nNO of the side-chain structure are counted from the nitrogen atom of the amine group. nOC, nOO, nO′C and nO′O of the side-chain structure are counted from the oxygen atom of the carboxyl group or the hydroxyl group. The carbon atoms or the oxygen atoms in the polar functional group are not included as calculating nNC, nNO, nOC, nOO, nO′C and nO′O. nO′C is taken as nOC and nO′O is taken as nOO during calculation.
When the molecular weight of the plasticizer is MwP, the following condition is satisfied: 450 Dalton≤MwP. As the molecular weight of the plasticizer is larger, it is more difficult for the plasticizer to pass through the cell membrane, so that it is favorable for preventing the plasticizer directly passing through the cell membrane into the cell. Moreover, the following conditions can be satisfied: MwP≤2000 Dalton; 475 Dalton≤MwP≤1000 Dalton; 500 Dalton≤MwP; 525 Dalton≤MwP; 550 Dalton≤MwP; or 600 Daltons≤MwP≤1500 Dalton.
Each of the aforementioned features of the plasticizer can be utilized in various combinations for achieving the corresponding effects.
According to another aspect of the present disclosure, a plasticizer, which is biodegradable, has a molecule including at least two central structures, at least two connecting structures and a side-chain structure. Each of the central structures is connected to at least one of the connecting structures. Each of the central structures is connected to the side-chain structure through the connecting structures, that is, the central structures are all connected to the same side-chain structure. The detailed features of the central structures, the connecting structures and the side-chain structure are the same as the abovementioned plasticizer, and an explanation in this regard will not be provided again.
According to the present disclosure, a plastic product is provided, wherein the plastic product is biodegradable. The plastic product includes the aforementioned plasticizer and a polyester plastic, wherein the polyester plastic can be a polylactic acid, a polybutylene succinate, a poly(butylene adipate-co-terephthalate) or a polyhydroxyalkanoate (PHA), and the plasticizer is mixed with the polyester plastic. The type of the polyester plastic is chosen to ensure that the plasticizer is mixed with the plastic of high compatibility, so that it is favorable for enhancing the ductility of the plastic and reducing the possibility of releasing of the plasticizer. Moreover, the polyhydroxyalkanoate can be a polyhydroxybutyrate (PHB).
The central structure 110 is a benzene derivative.
The two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 110, respectively. The first connecting structure is an amine group 121, and the second connecting structure is a carboxyl group (not shown in drawings).
The side-chain structure 130 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. The side-chain structure 130 is connected to the second connecting structure to form an ester bond 122′.
The central structure 210 is a benzene derivative.
The two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 210, respectively. The first connecting structure is an amine group 221, and the second connecting structure is a carboxyl group (not shown in drawings).
The side-chain structure 230 is formed by polymerization with propylene glycol or polypropylene glycol as monomers. The side-chain structure 230 is connected to the second connecting structure to form an ester bond 222′.
The polar functional group 260 is connected to the side-chain structure 230.
The central structure 310 is a benzene derivative.
The two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 310, respectively. The first connecting structure is an amine group 321, and the second connecting structure is a carboxyl group (not shown in drawings).
The side-chain structure 330 is formed by a first short chain 331 connected to a second short chain 332. The first short chain 331 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. The second short chain 332 is formed by polymerization with propylene glycol or polypropylene glycol as monomers. The side-chain structure 330 is connected to the second connecting structure to form an ester bond 322′.
The central structure 410 is a benzene derivative.
The two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 410, respectively. The first connecting structure is an amine group (not shown in drawings), and the second connecting structure is a carboxyl group 422.
The side-chain structure 430 is a fatty acid. The side-chain structure 430 is connected to the first connecting structure to form an amide bond 421′.
The central structure 510 is a benzene derivative.
The two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 510, respectively. The first connecting structure is an amine group (not shown in drawings), and the second connecting structure is a carboxyl group (not shown in drawings).
The side-chain structure 530 is formed by a first short chain 531 connected to a second short chain 532. The first short chain 531 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. The second short chain 532 is formed by polymerization with propylene glycol or polypropylene glycol as monomers. The side-chain structure 530 is connected to the second connecting structure to form an ester bond 522′.
The side-chain structure 540 is a fatty acid. The side-chain structure 540 is connected to the first connecting structure to form an amide bond 521′.
The polar functional group 560 is connected to the side-chain structure 530.
The central structure 610 is an amino acid and includes a residue 611.
The two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 610, respectively. The first connecting structure is an amine group 621, and the second connecting structure is a carboxyl group (not shown in drawings).
The side-chain structure 630 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. The side-chain structure 630 is connected to the second connecting structure to form an ester bond 622′.
The polar functional group 660 is connected to the side-chain structure 630.
The central structure 710 is an amino acid and includes a residue 711.
The two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 710, respectively. The first connecting structure is an amine group 721, and the second connecting structure is a carboxyl group (not shown in drawings).
The side-chain structure 730 is formed by polymerization with propylene glycol or polypropylene glycol as monomers. The side-chain structure 730 is connected to the second connecting structure to form an ester bond 722′.
The central structure 810 is an amino acid and includes a residue 811.
The two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 810, respectively. The first connecting structure is an amine group 821, and the second connecting structure is a carboxyl group (not shown in drawings).
The side-chain structure 830 is formed by a first short chain 831 connected to a second short chain 832. The first short chain 831 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. The second short chain 832 is formed by polymerization with propylene glycol or polypropylene glycol as monomers. The side-chain structure 830 is connected to the second connecting structure to form an ester bond 822′.
The central structure 910 is an amino acid and includes a residue 911.
The two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 910, respectively. The first connecting structure is an amine group (not shown in drawings), and the second connecting structure is a carboxyl group 922.
The side-chain structure 930 is a fatty acid. The side-chain structure 930 is connected to the first connecting structure to form an amide bond 921′.
The central structure 1010 is an amino acid and includes a residue 1011.
The two connecting structures are a first connecting structure and a second connecting structure and connected to the central structure 1010, respectively. The first connecting structure is an amine group (not shown in drawings), and the second connecting structure is a carboxyl group (not shown in drawings).
The side-chain structure 1030 is formed by a first short chain 1031 connected to a second short chain 1032. The first short chain 1031 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. The second short chain 1032 is formed by polymerization with propylene glycol or polypropylene glycol as monomers. The side-chain structure 1030 is connected to the second connecting structure to form an ester bond 1022′.
The side-chain structure 1040 is a fatty acid. The side-chain structure 1040 is connected to the first connecting structure to form an amide bond 1021′.
The polar functional group 1060 is connected to the side-chain structure 1030.
The central structure 1110 includes two amino acids, and each of the two amino acids includes a residue 1111, 1112.
The three connecting structures are a first connecting structure, a second connecting structure and a third connecting structure and connected to the central structure 1110, respectively. The first connecting structure is an amine group (not shown in drawings), and each of the second connecting structure and the third connecting structure is a carboxyl group (not shown in drawings). The third connecting structure is connected to the residue 1111.
The side-chain structure 1130 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. The side-chain structure 1130 is connected to the second connecting structure to form an ester bond 1122′.
The side-chain structure 1140 is a fatty acid. The side-chain structure 1140 is connected to the first connecting structure to form an amide bond 1121′.
The side-chain structure 1150 is formed by a first short chain 1151 connected to a second short chain 1152. The first short chain 1151 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. The second short chain 1152 is formed by polymerization with propylene glycol or polypropylene glycol as monomers. The side-chain structure 1150 is connected to the third connecting structure to form an ester bond 1123′.
The polar functional group 1160 is connected to the side-chain structure 1150.
The central structure 1210 includes two amino acids, and each of the two amino acids includes a residue 1211, 1212.
The three connecting structures are a first connecting structure, a second connecting structure and a third connecting structure and connected to the central structure 1210, respectively. Each of the first connecting structure and the third connecting structure is an amine group (not shown in drawings), and the second connecting structure is a carboxyl group (not shown in drawings). The third connecting structure is connected to the residue 1212.
The side-chain structure 1230 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. The side-chain structure 1230 is connected to the second connecting structure to form an ester bond 1222′.
The side-chain structure 1240 is a fatty acid. The side-chain structure 1240 is connected to the first connecting structure to form an amide bond 1221′.
The side-chain structure 1250 is a fatty acid. The side-chain structure 1250 is connected to the third connecting structure to form an amide bond 1223′.
The central structure 1310 includes three amino acids, and each of the three amino acids includes a residue 1311, 1312, 1313.
The four connecting structures are a first connecting structure, a second connecting structure, a third connecting structure and a fourth connecting structure and connected to the central structure 1310, respectively. The first connecting structure is an amine group 1321, each of the second connecting structure and the third connecting structure is a carboxyl group (not shown in drawings), and the fourth connecting structure is an amine group (not shown in drawings). The third connecting structure and the fourth connecting structure are connected to the residue 1311 and the residue 1313, respectively.
The side-chain structure 1330 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. The side-chain structure 1330 is connected to the second connecting structure to form an ester bond 1322′.
The side-chain structure 1340 is formed by a first short chain 1341 connected to a second short chain 1342. The first short chain 1341 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. The second short chain 1342 is formed by polymerization with propylene glycol or polypropylene glycol as monomers. The side-chain structure 1340 is connected to the third connecting structure to form an ester bond 1323′.
The side-chain structure 1350 is a fatty acid. The side-chain structure 1350 is connected to the fourth connecting structure to form an amide bond 1324′.
The polar functional group 1360 is connected to the side-chain structure 1330.
Each of the central structures 1410 a, 1410 b is a benzene derivative.
Each of the central structures 1410 a, 1410 b is connected to the corresponding one of the connecting structures, that is, the central structure 1410 a is connected to one of the connecting structures, and the central structure 1410 b is connected to the other one of the connecting structures. Both of the connecting structures are carboxyl groups (not shown in drawings).
The side-chain structure 1430 is formed by polymerization with ethylene glycol or polyethylene glycol as monomers. Each of the central structures 1410 a, 1410 b is connected to the side-chain structure 1430 through the connecting structure to form an ester bond 1420 a, 1420 b.
Each of the polar functional groups 1460 a, 1460 b is connected to the corresponding one of the central structures 1410 a, 1410 b.
According to the above description of the present disclosure, the following specific examples are provided for further explanation.
In the 1st Example to the 8th Example, the side-chain structures connected to the amine group, the carboxyl group and the hydroxyl group are named as SCA, SCC and SCH, respectively. For the molecule of the plasticizer including a plurality of the side-chain structures connected to a same functional group, for example, two side-chain structures are connected to the amine group in the 1st Example, so the two side-chain structures are named as SCA1 and SCA2, respectively. The names of other side-chain structures follow the same rule, and an explanation in this regard will not be provided again.
| 1st Example | 2nd Example | |
| Central Structure | Aminobenzoic Acid | Aminobenzoic Acid |
| Structure of Para Position |
 |
 |
| SMILES Notation | C1═CC(═CC═C1C(═O)OC | C1═CC(═CC═C1C(═O)OC |
| COCCOCCO[H])N(C(CCC | C(OCC(OCC(OCC(O[H])C) | |
| CCCC)═O)C(CCCCCCC)═O | C)C)C)N(C(CCCCCCC)═O)[H] | |
| InChI Notation | InChI = 1S/C29H47NO7/c1- | InChI = 1S/C27H45NO7/c1- |
| 3-5-7-9-11-13-27(32)30(28 | 6-7-8-9-10-11-26(30)28-25- | |
| (33)14-12-10-8-6-4-2)26-17- | 14-12-24(13-15-25)27(31) | |
| 15-25(16-18-26)29(34)37- | 35-19-23(5)34-18-22(4)33- | |
| 24-23-36-22-21-35-20-19- | 17-21(3)32-16-20(2)29/h12- | |
| 31/h15-18, 31H, 3-14, 19- | 15, 20-23, 29H, 6-11, 16-1 | |
| 24H2, 1-2H3 | 9H2, 1-5H3, (H, 28, 30) | |
| Molecular Formula | C29H47NO7 | C27H45NO7 |
| Molecular Weight | 521.693 | 495.655 |
| MwP | ||
| (g/mol, Dalton) | ||
| Structure of Ortho Position | With Steric Hindrance |
 |
| Structure of Meta Position |
 |
 |
| Side-Chain Structure SCA1 Connected to |
| nNC |
| 8 | 8 | |
| nNO | 0 | 0 |
| nNC/(nNC + nNO) | 1 | 1 |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCA2 Connected to |
| nNC |
| 8 | 0 | |
| nNO | 0 | 0 |
| nNC/(nNC + nNO) | 1 | — |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCC Connected to Carboxyl Group |
| nOC | 6 | 12 |
| |
2 | 3 |
| nOC/(nOC + nOO) | 0.75 | 0.80 |
| Polar Functional | OH | OH |
| Group |
| Relationship Between Numbers of Atoms of |
| Side-Chain Structures SCA1, SCA2 and SCC |
| nNCSCA1/(nNCSCA1 + | 0.6 | 0.4 |
| nOCSCC) | ||
| nNCSCA2/(nNCSCA2 + | 0.6 | 0.0 |
| nOCSCC) | ||
| nNCSCA1/(nNCSCA1 + | 0.8 | 0.7 |
| nOOSCC) | ||
| nNCSCA2/(nNCSCA2 + | 0.8 | 0.0 |
| nOOSCC) | ||
| nNOSCA1/(nNOSCA1 + | 0.0 | 0.0 |
| nOCSCC) | ||
| nNOSCA2/(nNOSCA2 + | 0.0 | 0.0 |
| nOCSCC) | ||
| nNOSCA1/(nNOSCA1 + | 0.0 | 0.0 |
| nOOSCC) | ||
| nNOSCA2/(nNOSCA2 + | 0.0 | 0.0 |
| nOOSCC) | ||
Furthermore, in the 1st Example to the 8th Example, a number of carbon atoms and a number of oxygen atoms of the side-chain structure SCA1 are nNCSCA1 and nNOSCA1, respectively. A number of carbon atoms and a number of oxygen atoms of the side-chain structure SCA2 are nNCSCA2 and nNOSCA2, respectively. A number of carbon atoms and a number of oxygen atoms of the side-chain structure SCC are nOCSCC and nOOSCC, respectively. SCA1, SCA2 and SCC are only for marking the side-chain structures to clearly understand the characteristics of the side-chain structures, and do not make a difference to the calculation of carbon atoms and oxygen atoms of nNO, nNC, nOC and nOO as claimed. That is, nNCSCA1 is taken as nNC, nNOSCA1 is taken nNO, nNCSCA2 is taken as nNC, nNOSCA2 is taken as nNO, nOCSCC is taken as nOC and nOOSCC is taken as nOO during calculation. The information in the following tables has the same definition, and an explanation in this regard will not be provided again.
| 3rd Example | 4th Example | |
| Central Structure | Aminobenzoic Acid | Hydroxybenzoic Acid |
| Structure of Para Position |
 |
 |
| SMILES Notation | C1═CC(═CC═C1C(═O)OC | C1═CC(═CC═C1C(═O)OC |
| COCCOCCOCCOCCO[H]) | COCCOCCOCCCC)OCC | |
| N(C(CCCCCCC)═O)[H] | OCCOCCOCCCC | |
| InChI Notation | InChI = 1S/C25H41NO8/c1- | InChI = 1S/C27H46O9/c1-3- |
| 2-3-4-5-6-7-24(28)26-23-10- | 5-11-29-13-15-31-17-19-33- | |
| 8-22(9-11-23)25(29)34-21- | 21-23-35-26-9-7-25(8-10- | |
| 20-33-19-18-32-17-16-31- | 26)27(28)36-24-22-34-20- | |
| 15-14-30-13-12-27/h8-11, | 18-32-16-14-30-12-6-4-2/h | |
| 27H, 2-7, 12-21H2, 1H3, (H, | 7-10H, 3-6, 11-24H2, 1-2H3 | |
| 26, 28) | ||
| Molecular Formula | C25H41NO8 | C27H46O9 |
| Molecular Weight | 483.601 | 514.655 |
| MwP | ||
| (g/mol, Dalton) | ||
| Structure of Ortho Position |
 |
 |
| Structure of Meta Position |
 |
 |
| Side-Chain Structure SCA1 Connected to Amine Group |
| nNC | 8 | 0 |
| nNO | 0 | 0 |
| nNC/(nNC + nNO) | 1 | — |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCA2 Connected to Amine Group |
| nNC | 0 | 0 |
| nNO | 0 | 0 |
| nNC/(nNC + nNO) | — | — |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCC Connected to Carboxyl Group |
| nOC | 10 | 10 |
| nOO | 4 | 3 |
| nOC/(nOC + nOO) | 0.71 | 0.77 |
| Polar Functional | OH | — |
| Group |
| Relationship Between Numbers of Atoms of |
| Side-Chain Structures SCA1, SCA2 and SCC |
| nNCSCA1/(nNCSCA1 + | 0.4 | 0.0 |
| nOCSCC) | ||
| nNCSCA2/(nNCSCA2 + | 0.0 | 0.0 |
| nOCSCC) | ||
| nNCSCA1/(nNCSCA1 + | 0.7 | 0.0 |
| nOOSCC) | ||
| nNCSCA2/(nNCSCA2 + | 0.0 | 0.0 |
| nOOSCC) | ||
| nNOSCA1/(nNOSCA1 + | 0.0 | 0.0 |
| nOCSCC) | ||
| nNOSCA2/(nNOSCA2 + | 0.0 | 0.0 |
| nOCSCC) | ||
| nNOSCA1/(nNOSCA1 + | 0.0 | 0.0 |
| nOOSCC) | ||
| nNOSCA2/(nNOSCA2 + | 0.0 | 0.0 |
| nOOSCC) |
| Side-Chain Structure SCH1 Connected to Hydroxyl Group |
| nO′C | — | 10 |
| nO′O | — | 3 |
| nO′C/(nO′C + nO′O) | — | 0.77 |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCH2 Connected to Hydroxyl Group |
| nO′C | — | 0 |
| nO′O | — | 0 |
| nO′C/(nO′C + nO′O) | — | — |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCH3 Connected to Hydroxyl Group |
| nO′C | — | 0 |
| nO′O | — | 0 |
| nO′C/(nO′C + nO′O) | — | — |
| Polar Functional | — | — |
| Group | ||
| 5th Example | 6th Example | |
| Central Structure | Hydroxybenzoic Acid | Propane-1,2,3-Triol |
| Structure of Para Position |
 |
 |
| SMILES Notation | C1═CC(═CC═C1C(═O)OC | C(C(COCCOCCOCCC)O |
| C(OCC(OCC(OCCCC)C)C) | CCOCCOCCC)OCCOCC | |
| C)OC(COC(COC(COC(C | OCCC | |
| CC)C)C)C)C | ||
| InChI Notation | InChI = 1S/C34H60O9/c1-10- | InChI = 1S/C24H50O9/c1-4- |
| 12-18-36-26(4)19-38-28 | 7-25-10-13-28-16-18-31-22- | |
| (6)21-40-30(8)23-42-34(35) | 24(33-21-20-30-15-12-27- | |
| 32-14-16-33(17-15-32)43- | 9-6-3)23-32-19-17-29-14- | |
| 31(9)24-41-29(7)22-39-27 | 11-26-8-5-2/h24H, 4-23H2, | |
| (5)20-37-25(3)13-11-2/h14- | 1-3H3 | |
| 17, 25-31H, 10-13, 18-24H2, | ||
| 1-9H3 | ||
| Molecular Formula | C34H60O9 | C24H50O9 |
| Molecular Weight | 612.843 | 482.654 |
| MwP | ||
| (g/mol, Dalton) | ||
| Structure of Ortho Position |
 |
— |
| Structure of Meta Position |
 |
— |
| Side-Chain Structure SCA1 Connected to Amine Group |
| nNC | 0 | 0 |
| nNO | 0 | 0 |
| nNC/(nNC + nNO) | — | — |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCA2 Connected to Amine Group |
| nNC | 0 | 0 |
| nNO | 0 | 0 |
| nNC/(nNC + nNO) | — | — |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCC Connected to Carboxyl Group |
| nOC | 13 | 0 |
| nOO | 3 | 0 |
| nOC/(nOC + nOO) | 0.81 | — |
| Polar Functional | — | — |
| Group |
| Relationship Between Numbers of Atoms of |
| Side-Chain Structures SCA1, SCA2 and SCC |
| nNCSCA1/(nNCSCA1 + | 0.0 | — |
| nOCSCC) | ||
| nNCSCA2/(nNCSCA2 + | 0.0 | — |
| nOCSCC) | ||
| nNCSCA1/(nNCSCA1 + | 0.0 | — |
| nOOSCC) | ||
| nNCSCA2/(nNCSCA2 + | 0.0 | — |
| nOOSCC) | ||
| nNOSCA1/(nNOSCA1 + | 0.0 | — |
| nOCSCC) | ||
| nNOSCA2/(nNOSCA2 + | 0.0 | — |
| nOCSCC) | ||
| nNOSCA1/(nNOSCA1 + | 0.0 | — |
| nOOSCC) | ||
| nNOSCA2/(nNOSCA2 + | 0.0 | — |
| nOOSCC) |
| Side-Chain Structure SCH1 Connected to Hydroxyl Group |
| nO′C | 14 | 7 |
| nO′O | 3 | 2 |
| nO′C/(nO′C + nO′O) | 0.82 | 0.78 |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCH2 Connected to Hydroxyl Group |
| nO′C | 0 | 7 |
| nO′O | 0 | 2 |
| nO′C/(nO′C + NO′O) | — | 0.78 |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCH3 Connected to Hydroxyl Group |
| nO′C | 0 | 7 |
| nO′O | 0 | 2 |
| nO′C/(nO′C + nO′O) | — | 0.78 |
| Polar Functional | — | — |
| Group | ||
| 7th Example | 8th Example | |
| Central Structure | Propane-1,2,3-Triol | 2-(2-Hydroxyethoxy) |
| Propan-1-ol | ||
| Structure |
 |
 |
| SMILES Notation | C(C(COC(COC(COCCC)C) | C(OC(COC(COCCCC(CC) |
| C)OCCOCCOCCC)OC(C | CC)C)C)C(OCC(OCCCC | |
| OC(COCCC)C)C | (CC)CC)C)C | |
| InChI Notation | InChI = 1S/C28H58O9/c1-8- | InChI = 1S/C28H58O5/c1-9- |
| 11-29-14-15-30-16-17-33- | 27(10-2)15-13-17-29-19-23 | |
| 28(22-36-26(6)20-34-24(4) | (5)31-21-25(7)33-22-26(8) | |
| 18-31-12-9-2)23-37-27(7)21- | 32-20-24(6)30-18-14-16-28 | |
| 35-25(5)19-32-13-10-3/h | (11-3)12-4/h23-28H, 9-22 | |
| 24-28H, 8-23H2, 1-7H3 | H2, 1-8H3 | |
| Molecular Formula | C28H58O9 | C28H58O5 |
| Molecular Weight | 538.761 | 474.763 |
| MwP | ||
| (g/mol, Dalton) | ||
| Side-Chain Structure SCA1 Connected to Amine Group |
| nNC | 0 | 0 |
| nNO | 0 | 0 |
| nNC/(nNC + nNO) | — | — |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCA2 Connected to Amine Group |
| nNC | 0 | 0 |
| nNO | 0 | 0 |
| nNC/(nNC + nNO) | — | — |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCC Connected to Carboxyl Group |
| nOC | 0 | 0 |
| nOO | 0 | 0 |
| nOC/(nOC + nOO) | — | — |
| Polar Functional | — | — |
| Group |
| Relationship Between Numbers of Atoms of |
| Side-Chain Structures SCA1, SCA2 and SCC |
| nNCSCA1/(nNCSCA1 + | — | — |
| nOCSCC) | ||
| nNCSCA2/(nNCSCA2 + | — | — |
| nOCSCC) | ||
| nNCSCA1/(nNCSCA1 + | — | — |
| nOOSCC) | ||
| nNCSCA2/(nNCSCA2 + | — | — |
| nOOSCC) | ||
| nNOSCA1/(nNOSCA1 + | — | — |
| nOCSCC) | ||
| nNOSCA2/(nNOSCA2 + | — | — |
| nOCSCC) | ||
| nNOSCA1/(nNOSCA1 + | — | — |
| nOOSCC) | ||
| nNOSCA2/(nNOSCA2 + | — | — |
| nOOSCC) |
| Side-Chain Structure SCH1 Connected to Hydroxyl Group |
| nO′C | 9 | 11 |
| nO′O | 2 | 1 |
| nO′C/(nO′C + nO′O) | 0.82 | 0.92 |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCH2 Connected to Hydroxyl Group |
| nO′C | 7 | 11 |
| nO′O | 2 | 1 |
| nO′C/(nO′C + nO′O) | 0.78 | 0.92 |
| Polar Functional | — | — |
| Group |
| Side-Chain Structure SCH3 Connected to Hydroxyl Group |
| nO′C | 9 | 0 |
| nO′O | 2 | 0 |
| nO′C/(nO′C + nO′O) | 0.82 | — |
| Polar Functional | — | — |
| Group | ||
| 9th Example | 10th Example | 11th Example | |
| IUPAC Name of | Glycine | Alanine | Valine |
| Central Structure | |||
| Structural Formula |
 |
 |
 |
| Molecular Weight | 75.07 | 89.09 | 117.15 |
| MwP (g/mol) | |||
| |
Gly | Ala | Val |
| Abbreviation 2 | G | A | V |
| Residue Property | Hydrophilic | Hydrophobic | Hydrophobic |
| Representative Structure as Side-Chain Structure Being PEG |
 |
 |
 |
| Representative Structure as Side-Chain Structure Being PPG |
 |
 |
 |
| Representative Structure as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, n ≥ 3) |
 |
 |
 |
| Side-Chain Structure Being PEG and PPG |
| Number of | 12 | 12 | 12 |
| PEG Monomers | |||
| Number of | 0 | 0 | 0 |
| PPG Monomers | |||
| Molecular | |||
| Weight, MwP | 603.7 | 617.7 | 645.8 |
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 24 | 24 | 24 |
| nNO | 0 | 0 | 0 |
| nOO | 12 | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 2 | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 0 | 0 | 0 |
| PEG Monomers | |||
| Number of | 12 | 12 | 12 |
| PPG Monomers | |||
| Molecular | 772.0 | 786.0 | 814.1 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 36 | 36 | 36 |
| nNO | 0 | 0 | 0 |
| nOO | 12 | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 6 | 6 | 6 |
| PEG Monomers | |||
| Number of | 6 | 6 | 6 |
| PPG Monomers | |||
| Molecular | 687.9 | 701.9 | 729.9 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 30 | 30 | 30 |
| nNO | 0 | 0 | 0 |
| nOO | 12 | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 2 | 2 | 2 |
| PEG Monomers | |||
| Number of | 5 | 5 | 5 |
| PPG Monomers | |||
| Molecular | 453.6 | 467.6 | 495.7 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 19 | 19 | 19 |
| nNO | 0 | 0 | 0 |
| nOO | 7 | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 5 | 5 | 5 |
| PEG Monomers | |||
| Number of | 2 | 2 | 2 |
| PPG Monomers | |||
| Molecular | 411.5 | 425.5 | 453.6 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 16 | 16 | 16 |
| nNO | 0 | 0 | 0. |
| nOO | 7 | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 2 | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 5 | 5 | 5 |
| PEG Monomers | |||
| Number of | 5 | 5 | 5 |
| PPG Monomers | |||
| Molecular | 585.7 | 599.8 | 627.8 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 25 | 25 | 25 |
| nNO | 0 | 0 | 0 |
| nOO | 10 | 10 | 10 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 4 | 4 | 4 |
| PEG Monomers | |||
| Number of | 4 | 4 | 4 |
| PPG Monomers | |||
| Molecular | 483.6 | 497.6 | 525.7 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 20 | 20 | 20 |
| nNO | 0 | 0 | 0 |
| nOO | 8 | 8 | 8 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 8 | 8 | 8 |
| PEG Monomers | |||
| Number of | 8 | 8 | 8 |
| PPG Monomers | |||
| Molecular | 892.1 | 906.1 | 934.2 |
| Weight MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 40 | 40 | 40 |
| nNO | 0 | 0 | 0 |
| nOO | 16 | 16 | 16 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Side-Chain Structure Being PEG, PPG and Fatty Acid |
| Number of | 3 | 3 | 3 |
| PEG Monomers | |||
| Number of | 3 | 3 | 3 |
| PPG Monomers | |||
| Fatty Acid | 3 | 3 | 3 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 465.5 | 479.5 | 507.6 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 5 | 5 | 5 |
| nOC | 15 | 15 | 15 |
| nNO | 0 | 0 | 0 |
| nOO | 6 | 6 | 6 |
| nNC/(nNC + nOC) | 0.25 | 0.25 | 0.25 |
| nNC/(nNC + nOO) | 0.45 | 0.45 | 0.45 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 0 | 0 | 0 |
| PEG Monomers | |||
| Number of | 8 | 8 | 8 |
| PPG Monomers | |||
| Fatty Acid | 5 | 5 | 5 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 651.8 | 665.8 | 693.8 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 7 | 7 | 7 |
| nOC | 24 | 24 | 24 |
| nNO | 0 | 0 | 0 |
| nOO | 8 | 8 | 8 |
| nNC/(nNC + nOC) | 0.23 | 0.23 | 0.23 |
| nNC/(nNC + nOO) | 0.47 | 0.47 | 0.47 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 5 | 5 | 5 |
| PEG Monomers | |||
| Number of | 4 | 4 | 4 |
| PPG Monomers | |||
| Fatty Acid | 7 | 7 | 7 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 667.7 | 681.7 | 709.8 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 9 | 9 | 9 |
| nOC | 22 | 22 | 22 |
| nNO | 0 | 0 | 0 |
| nOO | 9 | 9 | 9 |
| nNC/(nNC + nOC) | 0.29 | 0.29 | 0.29 |
| nNC/(nNC + nOO) | 0.50 | 0.50 | 0.50 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 2 | 2 | 2 |
| PEG Monomers | |||
| Number of | 2 | 2 | 2 |
| PPG Monomers | |||
| Fatty Acid | 9 | 9 | 9 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 447.4 | 461.4 | 489.5 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 11 | 11 | 11 |
| nOC | 10 | 10 | 10 |
| nNO | 0 | 0 | 0 |
| nOO | 4 | 4 | 4 |
| nNC/(nNC + nOC) | 0.52 | 0.52 | 0.52 |
| nNC/(nNC + nOO) | 0.73 | 0.73 | 0.73 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 5 | 5 | 5 |
| PEG Monomers | |||
| Number of | 2 | 2 | 2 |
| PPG Monomers | |||
| Fatty Acid | 11 | 11 | 11 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 607.6 | 621.6 | 649.6 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 13 | 13 | 13 |
| nOC | 16 | 16 | 16 |
| nNO | 0 | 0 | 0 |
| nOO | 7 | 7 | 7 |
| nNC/(nNC + nOC) | 0.45 | 0.45 | 0.45 |
| nNC/(nNC + nOO) | 0.65 | 0.65 | 0.65 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 0 | 0 | 0 |
| PEG Monomers | |||
| Number of | 5 | 5 | 5 |
| PPG Monomers | |||
| Fatty Acid | 13 | 13 | 13 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 589.5 | 603.5 | 631.6 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 15 | 15 | 15 |
| nOC | 15 | 15 | 15 |
| nNO | 0 | 0 | 0 |
| nOO | 5 | 5 | 5 |
| nNC/(nNC + nOC) | 0.50 | 0.50 | 0.50 |
| nNC/(nNC + nOO) | 0.75 | 0.75 | 0.75 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 2 | 2 | 2 |
| PEG Monomers | |||
| Number of | 2 | 2 | 2 |
| PPG Monomers | |||
| Fatty Acid | 15 | 15 | 15 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 531.4 | 545.4 | 573.5 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 17 | 17 | 17 |
| nOC | 10 | 10 | 10 |
| nNO | 0 | 0 | 0 |
| nOO | 4 | 4 | 4 |
| nNC/(nNC + nOC) | 0.63 | 0.63 | 0.63 |
| nNC/(nNC + nOO) | 0.81 | 0.81 | 0.81 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 0 | 0 | 0 |
| PEG Monomers | |||
| Number of | 0 | 0 | 0 |
| PPG Monomers | |||
| Fatty Acid | 34 | 34 | 34 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 593.1 | 607.2 | 635.2 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 36 | 36 | 36 |
| nOC | 0 | 0 | 0 |
| nNO | 0 | 0 | 0 |
| nOO | 0 | 0 | 0 |
| nNC/(nNC + nOC) | 1.00 | 1.00 | 1.00 |
| nNC/(nNC + nOO) | 1.00 | 1.00 | 1.00 |
| nNO/(nNO + nOC) | — | — | — |
| nNO/(nNO + nOO) | — | — | — |
| 12th Example | 13th Example | 14th Example | |
| IUPAC Name of | Leucine | Isoleucine | Phenylala-nine |
| Central Structure | |||
| Structural Formula |
 |
 |
 |
| Molecular Weight | 131.17 | 131.17 | 165.19 |
| MwP (g/mol) | |||
| |
Leu | Ile | Phe |
| Abbreviation 2 | L | I | F |
| Residue Property | Hydrophobic | Hydrophobic | Hydrophobic |
| Representative Structure as Side-Chain Structure Being PEG |
 |
 |
 |
| Representative Structure as Side-Chain Structure Being PPG |
 |
 |
 |
| Representative Structure as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, n ≥ 3) |
 |
 |
 |
| Side-Chain Structure Being PEG and PPG |
| Number of | 12 | 12 | 12 |
| PEG Monomers | |||
| Number of | 0 | 0 | 0 |
| PPG Monomers | |||
| Molecular | 659.8 | 659.8 | 693.8 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 24 | 24 | 24 |
| nNO | 0 | 0 | 0 |
| nOO | 12 | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 2 | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 0 | 0 | 0 |
| PEG Monomers | |||
| Number of | 12 | 12 | 12 |
| PPG Monomers | |||
| Molecular | 828.1 | 828.1 | 862.1 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 36 | 36 | 36 |
| nNO | 0 | 0 | 0 |
| nOO | 12 | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 6 | 6 | 6 |
| PEG Monomers | |||
| Number of | 6 | 6 | 6 |
| PPG Monomers | |||
| Molecular | 744.0 | 744.0 | 778.0 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 30 | 30 | 30 |
| nNO | 0 | 0 | 0 |
| nOO | 12 | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 2 | 2 | 2 |
| PEG Monomers | |||
| Number of | 5 | 5 | 5 |
| PPG Monomers | |||
| Molecular | 509.7 | 509.7 | 543.7 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 19 | 19 | 19 |
| nNO | 0 | 0 | 0 |
| nOO | 7 | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/nNO + nOC) | 0 | 0 | 0 |
| nNO/nNO + nOO) | 0 | 0 | 0 |
| Number of | 5 | 5 | 5 |
| PEG Monomers | |||
| Number of | 2 | 2 | 2 |
| PPG Monomers | |||
| Molecular | 467.6 | 467.6 | 501.6 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 16 | 16 | 16 |
| nNO | 0 | 0 | 0 |
| nOO | 7 | 7 | 7 |
| nNC/nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 2 | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 5 | 5 | 5 |
| PEG Monomers | |||
| Number of | 5 | 5 | 5 |
| PPG Monomers | |||
| Molecular | 641.8 | 641.8 | 675.9 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNc | 0 | 0 | 0 |
| nOC | 25 | 25 | 25 |
| nNO | 0 | 0 | 0 |
| nOO | 10 | 10 | 10 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 4 | 4 | 4 |
| PEG Monomers | |||
| Number of | 4 | 4 | 4 |
| PPG Monomers | |||
| Molecular | 539.7 | 539.7 | 573.7 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 20 | 20 | 20 |
| nNO | 0 | 0 | 0 |
| nOO | 8 | 8 | 8 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Number of | 8 | 8 | 8 |
| PEG Monomers | |||
| Number of | 8 | 8 | 8 |
| PPG Monomers | |||
| Molecular | 948.2 | 948.2 | 982.2 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 0 | 0 | 0 |
| nOC | 40 | 40 | 40 |
| nNO | 0 | 0 | 0 |
| nOO | 16 | 16 | 16 |
| nNC/(nNC + nOC) | 0 | 0 | 0 |
| nOC/nOO | 3 | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 | 0 |
| Side-Chain Structure Being PEG, PPG and Fatty Acid |
| Number of | 3 | 3 | 3 |
| PEG Monomers | |||
| Number of | 3 | 3 | 3 |
| PPG Monomers | |||
| Fatty Acid | 3 | 3 | 3 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 521.6 | 521.6 | 555.6 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 5 | 6 | 5 |
| nOC | 15 | 15 | 15 |
| nNO | 0 | 0 | 0 |
| nOO | 6 | 6 | 6 |
| nNC/(nNC + nOC) | 0.25 | 0.25 | 0.25 |
| nNC/(nNC + nOO) | 0.45 | 0.45 | 0.45 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 0 | 0 | 0 |
| PEG Monomers | |||
| Number of | 8 | 8 | 8 |
| PPG Monomers | |||
| Fatty Acid | 5 | 5 | 5 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 707.9 | 707.9 | 741.9 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 7 | 7 | 7 |
| nOC | 24 | 24 | 24 |
| nNO | 0 | 0 | 0 |
| nOO | 8 | 8 | 8 |
| nNC/nNC + nOC) | 0.23 | 0.23 | 0.23 |
| nNC/nNC + nOO) | 0.47 | 0.47 | 0.47 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 5 | 5 | 5 |
| PEG Monomers | |||
| Number of | 4 | 4 | 4 |
| PPG Monomers | |||
| Fatty Acid | 7 | 7 | 7 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 723.8 | 723.8 | 757.8 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 9 | 9 | 9 |
| nOC | 22 | 22 | 22 |
| nNO | 0 | 0 | 0 |
| nOO | 9 | 9 | 9 |
| nNC/(nNC + nOC) | 0.29 | 0.29 | 0.29 |
| nNC/(nNC + nOO) | 0.50 | 0.50 | 0.50 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 2 | 2 | 2 |
| PEG Monomers | |||
| Number of | 2 | 2 | 2 |
| PPG Monomers | |||
| Fatty Acid | 9 | 9 | 9 |
| CH3(CH2), COOH, | |||
| n = ? | |||
| Molecular | 503.5 | 503.5 | 537.5 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 11 | 11 | 11 |
| nOC | 10 | 10 | 10 |
| nNO | 0 | 0 | 0 |
| nOO | 4 | 4 | 4 |
| nNC/(nNC + nOC) | 0.52 | 0.52 | 0.52 |
| nNC/(nNC + nOO) | 0.73 | 0.73 | 0.73 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 5 | 5 | 5 |
| PEG Monomers | |||
| Number of | 2 | 2 | 2 |
| PPG Monomers | |||
| Fatty Acid | 11 | 11 | 11 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 663.7 | 663.7 | 697.7 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 13 | 13 | 13 |
| nOC | 16 | 16 | 16 |
| nNO | 0 | 0 | 0 |
| nOO | 7 | 7 | 7 |
| nNC/(nNC + nOC) | 0.45 | 0.45 | 0.45 |
| nNC/(nNC + nOO) | 0.65 | 0.65 | 0.65 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 0 | 0 | 0 |
| PEG Monomers | |||
| Number of | 5 | 5 | 5 |
| PPG Monomers | |||
| Fatty Acid | 13 | 13 | 13 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 645.6 | 645.6 | 679.6 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 15 | 15 | 15 |
| nOC | 15 | 15 | 15 |
| nNO | 0 | 0 | 0 |
| nOO | 5 | 5 | 5 |
| nNC/(nNC + nOC) | 0.50 | 0.50 | 0.50 |
| nNC/(nNC + nOO) | 0.75 | 0.75 | 0.75 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 2 | 2 | 2 |
| PEG Monomers | |||
| Number of | 2 | 2 | 2 |
| PPG Monomers | |||
| Fatty Acid | 15 | 15 | 15 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 587.5 | 587.5 | 621.5 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 17 | 17 | 17 |
| nOC | 10 | 10 | 10 |
| nNO | 0 | 0 | 0 |
| nOO | 4 | 4 | 4 |
| nNC/(nNC + nOC) | 0.63 | 0.63 | 0.63 |
| nNC/(nNC + nOO) | 0.81 | 0.81 | 0.81 |
| nNO/(nNO + nOC) | 0.00 | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 | 0.00 |
| Number of | 0 | 0 | 0 |
| PEG Monomers | |||
| Number of | 0 | 0 | 0 |
| PPG Monomers | |||
| Fatty Acid | 34 | 34 | 34 |
| CH3(CH2)nCOOH, | |||
| n = ? | |||
| Molecular | 649.2 | 649.2 | 683.3 |
| Weight, MwP | |||
| (g/mol, Dalton) | |||
| nNC | 36 | 36 | 36 |
| nOC | 0 | 0 | 0 |
| nNO | 0 | 0 | 0 |
| nOO | 0 | 0 | 0 |
| nNC/(nNC + nOC) | 1.00 | 1.00 | 1.00 |
| nNC/(nNC + nOO) | 1.00 | 1.00 | 1.00 |
| nNO/(nNO + nOC) | — | — | — |
| nNO/(nNO + nOO) | — | — | — |
| 15th Example | 16th Example | |
| IUPAC Name of | Tryptophan | Tyrosine |
| Central Structure | ||
| Structural Formula |
 |
 |
| Molecular Weight | 204.23 | 181.19 |
| MwP (g/mol) | ||
| |
Trp | Tyr |
| Abbreviation 2 | W | Y |
| Residue Property | Hydrophobic | Hydrophilic |
| Representative Structure as Side-Chain Structure Being PEG |
 |
 |
| Representative Structure as Side-Chain Structure Being PPG |
 |
 |
| |
 |
 |
| |
— |
 |
| Representative Structure 3 as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, n ≥ 3) | — |
 |
| Side-Chain Structure Being PEG and PPG |
| Number of | 12 | 12 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Molecular | 732.9 | 709.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 12 | 12 |
| PPG Monomers | ||
| Molecular | 901.2 | 878.1 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 36 | 36 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 6 | 6 |
| PEG Monomers | ||
| Number of | 6 | 6 |
| PPG Monomers | ||
| Molecular | 817.0 | 794.0 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 30 | 30 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 582.7 | 559.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 19 | 19 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Molecular | 540.7 | 517.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 714.9 | 691.9 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 25 | 25 |
| nNO | 0 | 0 |
| nOO | 10 | 10 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 4 | 4 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Molecular | 612.8 | 589.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 20 | 20 |
| nNO | 0 | 0 |
| nOO | 8 | 8 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 8 | 8 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Molecular | 1021.3 | 998.2 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 40 | 40 |
| nNO | 0 | 0 |
| nOO | 16 | 16 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Side-Chain Structure Being PEG, PPG and Fatty Acid |
| Number of | 3 | 3 |
| PEG Monomers | ||
| Number of | 3 | 3 |
| PPG Monomers | ||
| Fatty Acid | 3 | 3 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 594.7 | 571.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 5 | 5 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 6 | 6 |
| nNC/(nNC + nOC) | 0.25 | 0.25 |
| nNC/(nNC + nOO) | 0.45 | 0.45 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Fatty Acid | 5 | 5 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 780.9 | 757.9 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 7 | 7 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 8 | 8 |
| nNC/(nNC + nOC) | 0.23 | 0.23 |
| nNC/(nNC + nOO) | 0.47 | 0.47 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 6 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Fatty Acid | 7 | 7 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 796.9 | 773.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 9 | 9 |
| nOC | 22 | 22 |
| nNO | 0 | 0 |
| nOO | 9 | 9 |
| nNC/n(NC + nOC) | 0.29 | 0.29 |
| nNC/(nNC + nOO) | 0.50 | 0.50 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 9 | 9 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 576.6 | 553.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 11 | 11 |
| nOC | 10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.62 | 0.52 |
| nNC/(nNC + nOO) | 0.73 | 0.73 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 6 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 11 | 11 |
| CH3(CH2)nCOOH | ||
| n = ? | ||
| Molecular | 736.7 | 713.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 13 | 13 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0.45 | 0.45 |
| nNC/(nNC + nOO) | 0.65 | 0.65 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Fatty Acid | 13 | 13 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 718.7 | 695.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 15 | 15 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 5 | 5 |
| nNC/(nNC + nOC) | 0.50 | 0.50 |
| nNC/(nNC + nOO) | 0.75 | 0.75 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 15 | 15 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 660.6 | 637.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 17 | 17 |
| nOC | 10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.63 | 0.63 |
| nNC/(nNC + nOO) | 0.81 | 0.81 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Fatty Acid | 34 | 34 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 722.3 | 699.3 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 36 | 36 |
| nOC | 0 | 0 |
| nNO | 0 | 0 |
| nOO | 0 | 0 |
| nNC/(nNC + nOC) | 1.00 | 1.00 |
| nNC/(nNC + nOO) | 1.00 | 1.00 |
| nNO/(nNO + nOC) | — | — |
| nNO/(nNO + nOO) | — | — |
| 17th Example | 18th Example | |
| IUPAC Name of | Aspartate | Histidine |
| Central Structure | ||
| Structural Formula |
 |
 |
| Molecular Weight | 133.1 | 155.16 |
| MwP (g/mol) | ||
| |
Asp | His |
| Abbreviation 2 | D | H |
| Residue Property | Acidic | |
| Representative Structure | ||
| 1 as Side-Chain Structure Being PEG |
 |
 |
| |
 |
— |
| |
 |
 |
| |
 |
— |
| Representative Structure as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, H, n ≥ 3) |
 |
 |
| Side-Chain Structure Being PEG and PPG |
| Number of | 12 | 12 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Molecular | 661.7 | 683.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 12 | 12 |
| PPG Monomers | ||
| Molecular | 830.0 | 852.1 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 36 | 36 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 6 | 6 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 745.9 | 768.0 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 30 | 30 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 6 | 6 |
| PPG Monomers | ||
| Molecular | 511.6 | 533.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 19 | 19 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Molecular | 469.5 | 491.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 643.8 | 665.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 25 | 25 |
| nNO | 0 | 0 |
| nOO | 10 | 10 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 4 | 4 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Molecular | 541.6 | 563.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 20 | 20 |
| nNO | 0 | 0 |
| nOO | 8 | 8 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 8 | 8 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Molecular | 950.2 | 972.2 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 40 | 40 |
| nNO | 0 | 0 |
| nOO | 16 | 16 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Side-Chain Structure Being PEG, PPG and Fatty Acid |
| Number of | 3 | 3 |
| PEG Monomers | ||
| Number of | 3 | 3 |
| PPG Monomers | ||
| Fatty Acid | 3 | 3 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 523.6 | 545.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 5 | 5 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 6 | 6 |
| nNC/(nNC + nOC) | 0.25 | 0.25 |
| nNC/(nNC + nOO) | 0.45 | 0.45 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Fatty Acid | 5 | 5 |
| CH3(CH2)nCOOH | ||
| n = ? | ||
| Molecular | 709.8 | 731.9 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 7 | 7 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 8 | 8 |
| nNC/(nNC + nOC) | 0.23 | 0.23 |
| nNC/(nNC + nOO) | 0.47 | 0.47 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Fatty Acid | 7 | 7 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 725.7 | 747.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 9 | 9 |
| nOC | 22 | 22 |
| nNO | 0 | 0 |
| nOO | 9 | 9 |
| nNC/(nNC + nOC) | 0.29 | 0.29 |
| nNC/(nNC + nOO) | 0.50 | 0.50 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 9 | 9 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 505.4 | 527.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 11 | 11 |
| nOC | 10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.52 | 0.52 |
| nNC/(nNC + nOO) | 0.73 | 0.73 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 11 | 11 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 665.6 | 687.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 13 | 13 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0.45 | 0.45 |
| nNC/(nNC + nOO) | 0.65 | 0.65 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Fatty Acid | 13 | 13 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 647.6 | 669.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 15 | 15 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 5 | 5 |
| nNC/(nNC + nOC) | 0.50 | 0.50 |
| nNC/(nNC + nOO) | 0.75 | 0.75 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 15 | 15 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 589.4 | 611.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 17 | 17 |
| nOC | 10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.63 | 0.63 |
| nNC/(nNC + nOO) | 0.81 | 0.81 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Fatty Acid | 34 | 34 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 651.2 | 673.2 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 36 | 36 |
| nOC | 0 | 0 |
| nNO | 0 | 0 |
| nOO | 0 | 0 |
| nNC/(nNC + nOC) | 1.00 | 1.00 |
| nNC/(nNC + nOO) | 1.00 | 1.00 |
| nNO/(nNO + nOC) | — | — |
| nNO/(nNO + nOO) | — | — |
| 19th Example | 20th Example | |
| IUPAC Name of | Asparagine | Glutamate |
| Central Structure | ||
| Structural Formula |
 |
 |
| Molecular Weight | 132.12 | 147.13 |
| MwP (g/mol) | ||
| |
Asn | Glu |
| Abbreviation 2 | N | E |
| Residue Property | Hydrophilic | Acidic |
| |
 |
 |
| |
— |
 |
| |
 |
 |
| |
— |
 |
| |
 |
 |
| Representative Structure 2 as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, |
 |
— |
| n ≥ 3) | ||
| Representative Structure 3 as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, n ≥ 3) |
 |
— |
| Side-Chain Structure Being PEG and PPG |
| Number of | 12 | 12 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Molecular | 660.8 | 675.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 12 | 12 |
| PPG Monomers | ||
| Molecular | 829.1 | 844.1 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 36 | 36 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 6 | 6 |
| PEG Monomers | ||
| Number of | 6 | 6 |
| PPG Monomers | ||
| Molecular | 744.9 | 759.9 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 30 | 30 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 510.6 | 525.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 19 | 19 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Molecular | 468.5 | 483.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 642.8 | 657.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 25 | 25 |
| nNO | 0 | 0 |
| nOO | 10 | 10 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 4 | 4 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Molecular | 540.6 | 555.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 20 | 20 |
| nNO | 0 | 0 |
| nOO | 8 | 8 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 8 | 8 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Molecular | 949.2 | 964.2 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 40 | 40 |
| nNO | 0 | 0 |
| nOO | 16 | 16 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Side-Chain Structure Being PEG, PPG and Fatty Acid |
| Number of | 3 | 3 |
| PEG Monomers | ||
| Number of | 3 | 3 |
| PPG Monomers | ||
| Fatty Acid | 3 | 3 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 522.6 | 537.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 5 | 5 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 6 | 6 |
| nNC/(nNC + nOC) | 0.25 | 0.25 |
| nNC/(nNC + nOO) | 0.45 | 0.45 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Fatty Acid | 5 | 5 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 708.8 | 723.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 7 | 7 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 8 | 8 |
| nNC/(nNC + nOC) | 0.23 | 0.23 |
| nNC/(nNC + nOO) | 0.47 | 0.47 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Fatty Acid | 7 | 7 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 724.8 | 739.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 9 | 9 |
| nOC | 22 | 22 |
| nNO | 0 | 0 |
| nOO | 9 | 9 |
| nNC/(nNC + nOC) | 0.29 | 0.29 |
| nNC/(nNC + nOO) | 0.50 | 0.50 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 9 | 9 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 504.4 | 519.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 11 | 11 |
| nOC | 10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.52 | 0.62 |
| nNC/(nNC + nOO) | 0.73 | 0.73 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 11 | 11 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 664.6 | 679.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 13 | 13 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0.45 | 0.46 |
| nNC/(nNC + nOO) | 0.65 | 0.65 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Fatty Acid | 13 | 13 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 646.6 | 661.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 15 | 15 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 5 | 5 |
| nNC/(nNC + nOC) | 0.50 | 0.50 |
| nNC/(nNC + nOO) | 0.75 | 0.75 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 15 | 15 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 588.4 | 603.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 17 | 17 |
| nOC | 10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.63 | 0.63 |
| nNC/(nNC + nOO) | 0.81 | 0.81 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Fatty Acid | 34 | 34 |
| CH3(CH2)nCOOH | ||
| n = ? | ||
| Molecular | 650.2 | 665.2 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 36 | 36 |
| nOC | 0 | 0 |
| nNO | 0 | 0 |
| nOO | 0 | 0 |
| nNC/(nNC + nOC) | 1.00 | 1.00 |
| nNC/(nNC + nOO) | 1.00 | 1.00 |
| nNO/(nNO + nOC) | — | — |
| nNO/(nNO + nOO) | — | — |
| 21st Example | 22nd Example | |
| IUPAC Name of | Lysine | Glutamine |
| Central Structure | ||
| Structural Formula |
 |
 |
| Molecular Weight | 146.19 | 146.15 |
| MwP (g/mol) | ||
| |
Lys | Gln |
| Abbreviation 2 | K | Q |
| Residue Property | Basic | Hydrophilic |
| Representative Structure as Side-Chain Structure Being PEG |
 |
 |
| Representative Structure as Side-Chain Structure Being PPG |
 |
 |
| |
 |
 |
| Representative Structure 2 as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, |
 |
— |
| n ≥ 3) | ||
| Representative Structure 3 as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, n ≥ 3) |
 |
— |
| Side-Chain Structure Being PEG and PPG |
| Number of | 12 | 12 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Molecular | 674.8 | 674.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 12 | 12 |
| PPG Monomers | ||
| Molecular | 843.1 | 843.1 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 36 | 36 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 6 | 6 |
| PEG Monomers | ||
| Number of | 6 | 6 |
| PPG Monomers | ||
| Molecular | 759.0 | 758.9 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 30 | 30 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 524.7 | 524.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 19 | 19 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number Of | 5 | 6 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Molecular | 482.6 | 482.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 656.9 | 656.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 25 | 25 |
| nNO | 0 | 0 |
| nOO | 10 | 10 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 4 | 4 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Molecular | 554.7 | 554.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 20 | 20 |
| nNO | 0 | 0 |
| nOO | 8 | 8 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 8 | 8 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Molecular | 963.2 | 963.2 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 40 | 40 |
| nNO | 0 | 0 |
| nOO | 16 | 16 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Side-Chain Structure Being PEG, PPG and Fatty Acid |
| Number of | 3 | 3 |
| PEG Monomers | ||
| Number of | 3 | 3 |
| PPG Monomers | ||
| Fatty Acid | 3 | 3 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 536.6 | 536.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 5 | 5 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 6 | 6 |
| nNC/(nNC + nOC) | 0.25 | 0.25 |
| nNC/(nNC + nOO) | 0.45 | 0.45 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Fatty Acid | 5 | 5 |
| CH3(CH2)nCOOH | ||
| n = ? | ||
| Molecular | 722.9 | 722.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 7 | 7 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 8 | 8 |
| nNC/(nNC + nOC) | 0.23 | 0.23 |
| nNC/(nNC + nOO) | 0.47 | 0.47 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Fatty Acid | 7 | 7 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 738.8 | 738.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNO | 9 | 9 |
| nOC | 22 | 22 |
| nNO | 0 | 0 |
| nOO | 9 | 9 |
| nNC/(nNC + nOC) | 0.29 | 0.29 |
| nNC/(nNC + nOO) | 0.50 | 0.50 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 9 | 9 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 518.5 | 518.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 11 | 11 |
| nOC | 10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.52 | 0.52 |
| nNC/(nNC + nOO) | 0.73 | 0.73 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 11 | 11 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 678.7 | 678.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 13 | 13 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0.46 | 0.45 |
| nNC/(nNC + nOO) | 0.65 | 0.65 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Fatty Acid | 13 | 13 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 660.6 | 660.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 15 | 15 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 5 | 5 |
| nNC/(nNC + nOC) | 0.50 | 0.50 |
| nNC/(nNC + nOO) | 0.75 | 0.75 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 15 | 15 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 602.5 | 602.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 17 | 17 |
| nOC | 10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.63 | 0.63 |
| nNC/(nNC + nOO) | 0.81 | 0.81 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Fatty Acid | 34 | 34 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 664.3 | 664.2 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 36 | 36 |
| nOC | 0 | 0 |
| nNO | 0 | 0 |
| nOO | 0 | 0 |
| nNC/(nNC + nOC) | 1.00 | 1.00 |
| nNC/(nNC + nOO) | 1.00 | 1.00 |
| nNO/(nNO + nOC) | — | — |
| nNO/(nNO + nOO) | — | — |
| 23rd Example | 24th Example | |
| IUPAC Name of | Arginine | Serine |
| Central Structure | ||
| Structural Formula |
 |
 |
| Molecular Weight | 174.2 | 105.09 |
| MwP (g/mol) | ||
| |
Arg | Ser |
| Abbreviation 2 | R | S |
| Residue Property | Basic | Hydrophilic |
| Representative Structure as Side-Chain Structure Being PEG |
 |
 |
| Representative Structure as Side-Chain Structure Being PPG |
 |
 |
| |
 |
 |
| Representative Structure 2 as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, |
 |
 |
| n ≥ 3) | ||
| Representative Structure 3 as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, n ≥ 3) |
 |
 |
| Side-Chain Structure Being PEG and PPG |
| Number of | 12 | 12 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Molecular | 702.8 | 633.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 12 | 12 |
| PPG Monomers | ||
| Molecular | 871.1 | 802.0 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 36 | 36 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 6 | 6 |
| PEG Monomers | ||
| Number of | 6 | 6 |
| PPG Monomers | ||
| Molecular | 787.0 | 717.9 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 30 | 30 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 552.7 | 483.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 19 | 19 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Molecular | 510.6 | 441.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 684.9 | 615.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 25 | 25 |
| nNO | 0 | 0 |
| nOO | 10 | 10 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 4 | 4 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Molecular | 582.7 | 513.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 20 | 20 |
| nNO | 0 | 0 |
| nOO | 8 | 8 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 8 | 8 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Molecular | 991.3 | 922.1 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 40 | 40 |
| nNO | 0 | 0 |
| nOO | 16 | 16 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Side-Chain Structure Being PEG, PPG and Fatty Acid |
| Number of | 3 | 3 |
| PEG Monomers | ||
| Number of | 3 | 3 |
| PPG Monomers | ||
| Fatty Acid | 3 | 3 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 564.7 | 495.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 5 | 5 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 6 | 6 |
| nNC/(nNC + nOC) | 0.25 | 0.25 |
| nNC/(nNC + nOO) | 0.45 | 0.45 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Fatty Acid | 5 | 5 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 750.9 | 681.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 7 | 7 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 8 | 8 |
| nNC/(nNC + nOC) | 0.23 | 0.23 |
| nNC/(nNC + nOO) | 0.47 | 0.47 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Fatty Acid | 7 | 7 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 766.8 | 697.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 9 | 9 |
| nOC | 22 | 22 |
| nNO | 0 | 0 |
| nOO | 9 | 9 |
| nNC/(nNC + nOC) | 0.29 | 0.29 |
| nNC/(nNC + nOO) | 0.50 | 0.50 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 9 | 9 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 546.5 | 477.4 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 11 | 11 |
| nOC | 10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.52 | 0.52 |
| nNC/(nNC + nOO) | 0.73 | 0.73 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 11 | 11 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 706.7 | 637.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 13 | 13 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0.45 | 0.45 |
| nNC/(nNC + nOO) | 0.65 | 0.65 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Fatty Acid | 13 | 13 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 688.7 | 619.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 15 | 15 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 5 | 5 |
| nNC/(nNC + nOC) | 0.50 | 0.50 |
| nNC/(nNC + nOO) | 0.75 | 0.75 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 15 | 15 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 630.5 | 561.4 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 17 | 17 |
| |
10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.63 | 0.63 |
| nNC/(nNC + nOO) | 0.81 | 0.81 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Fatty Acid | 34 | 34 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 692.3 | 623.2 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 36 | 36 |
| nOC | 0 | 0 |
| nNO | 0 | 0 |
| nOO | 0 | 0 |
| nNC/(nNC + nOC) | 1.00 | 1.00 |
| nNC/(nNC + nOO) | 1.00 | 1.00 |
| nNO/(nNO + nOC) | — | — |
| nNO/(nNO + nOO) | — | — |
| 25th Example | 26th Example | |
| IUPAC Name of | Threonine | Methionine |
| Central Structure | ||
| Structural Formula |
 |
 |
| Molecular Weight | 119.12 | 149.21 |
| MwP (g/mol) | ||
| |
Thr | Met |
| Abbreviation 2 | T | M |
| Residue Property | Hydrophilic | Hydrophobic |
| Representative Structure as Side-Chain Structure Being PEG |
 |
 |
| Representative Structure as Side-Chain Structure Being PPG |
 |
 |
| |
 |
 |
| |
 |
— |
| Representative Structure 3 as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, n ≥ 3) |
 |
— |
| Side-Chain Structure Being PEG and PPG |
| Number of | 12 | 12 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Molecular | 647.8 | 677.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/ |
2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 12 | 12 |
| PPG Monomers | ||
| Molecular | 816.1 | 846.2 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 36 | 36 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 6 | 6 |
| PEG Monomers | ||
| Number of | 6 | 6 |
| PPG Monomers | ||
| Molecular | 731.9 | 762.0 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| |
30 | 30 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 497.6 | 527.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 19 | 19 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Molecular | 455.5 | 486.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/ |
2 | 2 |
| nNO/(nNO+ nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 629.8 | 659.9 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 25 | 25 |
| nNO | 0 | 0 |
| |
10 | 10 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 4 | 4 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Molecular | 527.6 | 557.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| |
20 | 20 |
| nNO | 0 | 0 |
| |
8 | 8 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 8 | 8 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Molecular | 936.2 | 966.3 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| |
40 | 40 |
| nNO | 0 | 0 |
| nOO | 16 | 16 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Side-Chain Structure Being PEG, PPG and Fatty Acid |
| Number of | 3 | 3 |
| PEG Monomers | ||
| Number of | 3 | 3 |
| PPG Monomers | ||
| Fatty Acid | ||
| CH3(CH2)nCOOH, | 3 | 3 |
| n = ? | ||
| Molecular | 509.6 | 539.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 5 | 5 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 6 | 6 |
| nNC/(nNC + nOC) | 0.25 | 0.25 |
| nNC/(nNC + nOO) | 0.45 | 0.45 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Fatty Acid | 5 | 5 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 695.8 | 725.9 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 7 | 7 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| |
8 | 8 |
| nNC/(nNC + nOC) | 0.23 | 0.23 |
| nNC/(nNC + nOO) | 0.47 | 0.47 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Fatty Acid | 7 | 7 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 711.8 | 741.9 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| |
9 | 9 |
| nOC | 22 | 22 |
| nNO | 0 | 0 |
| |
9 | 9 |
| nNC/(nNC + nOC) | 0.29 | 0.29 |
| nNC/(nNC + nOO) | 0.50 | 0.60 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| |
9 | 9 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 491.4 | 521.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 11 | 11 |
| |
10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.52 | 0.52 |
| nNC/(nNC + nOO) | 0.73 | 0.73 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 11 | 11 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 651.6 | 681.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 13 | 13 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0.45 | 0.45 |
| nNC/(nNC + nOO) | 0.65 | 0.65 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Fatty Acid | 13 | 13 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 633.6 | 663.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 15 | 15 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 5 | 5 |
| nNC/(nNC + nOC) | 0.50 | 0.50 |
| nNC/(nNC + nOO) | 0.75 | 0.75 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 15 | 15 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 575.4 | 605.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 17 | 17 |
| |
10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.63 | 0.63 |
| nNC/(nNC + nOO) | 0.81 | 0.81 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Fatty Acid | 34 | 34 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 637.2 | 667.3 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 36 | 36 |
| nOC | 0 | 0 |
| nNO | 0 | 0 |
| nOO | 0 | 0 |
| nNC/(nNC + nOC) | 1.00 | 1.00 |
| nNC/(nNC + nOO) | 1.00 | 1.00 |
| nNO/(nNO + nOC) | — | — |
| nNO/(nNO + nOO) | — | — |
| 27th Example | 28th Example | |
| IUPAC Name of | Cysteine | Proline |
| Central Structure | ||
| Structural Formula |
 |
 |
| Molecular Weight | 121.16 | 115.13 |
| MwP (g/mol) | ||
| |
Cys | Pro |
| Abbreviation 2 | C | P |
| Residue Property | Hydrophilic | Hydrophobic |
| Representative Structure as Side-Chain Structure Being PEG |
 |
 |
| Representative Structure as Side-Chain Structure Being PPG |
 |
 |
| Representative Structure as Side-Chain Structure Being Fatty Acid (CH3(CH2)nCOOH, n ≥ 3) |
 |
— |
| Side-Chain Structure Being PEG and PPG |
| Number of | 12 | 12 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Molecular | 649.8 | 643.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/ |
2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 12 | 12 |
| PPG Monomers | ||
| Molecular | 818.1 | 812.1 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 36 | 36 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 6 | 6 |
| PEG Monomers | ||
| Number of | 6 | 6 |
| PPG Monomers | ||
| Molecular | 734.0 | 727.9 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| |
30 | 30 |
| nNO | 0 | 0 |
| nOO | 12 | 12 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 499.7 | 493.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 19 | 19 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Molecular | 457.6 | 451.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/ |
2 | 2 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Molecular | 631.8 | 625.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| nOC | 25 | 25 |
| nNO | 0 | 0 |
| |
10 | 10 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 4 | 4 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Molecular | 529.7 | 523.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| |
20 | 20 |
| nNO | 0 | 0 |
| |
8 | 8 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Number of | 8 | 8 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Molecular | 938.2 | 932.2 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 0 | 0 |
| |
40 | 40 |
| nNO | 0 | 0 |
| nOO | 16 | 16 |
| nNC/(nNC + nOC) | 0 | 0 |
| nOC/nOO | 3 | 3 |
| nNO/(nNO + nOC) | 0 | 0 |
| nNO/(nNO + nOO) | 0 | 0 |
| Side-Chain Structure Being PEG, PPG and Fatty Acid |
| Number of | 3 | 3 |
| PEG Monomers | ||
| Number of | 3 | 3 |
| PPG Monomers | ||
| Fatty Acid | 3 | 0 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 511.6 | 421.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 5 | 0 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 6 | 6 |
| nNC/(nNC + nOC) | 0.25 | 0.00 |
| nNC/(nNC + nOO) | 0.45 | 0.00 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 8 | 8 |
| PPG Monomers | ||
| Fatty Acid | 5 | — |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 697.9 | 579.8 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 7 | 0 |
| nOC | 24 | 24 |
| nNO | 0 | 0 |
| |
8 | 8 |
| nNC/(nNC + nOC) | 0.23 | 0.00 |
| nNC/(nNC + nOO) | 0.47 | 0.00 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 4 | 4 |
| PPG Monomers | ||
| Fatty Acid | 7 | — |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 713.8 | 567.7 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| |
9 | 0 |
| nOC | 22 | 22 |
| nNO | 0 | 0 |
| |
9 | 9 |
| nNC/(nNC + nOC) | 0.29 | 0.00 |
| nNC/(nNC + nOO) | 0.50 | 0.00 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| |
9 | — |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 493.5 | 319.4 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 11 | 0 |
| |
10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.52 | 0.00 |
| nNC/(nNC + nOO) | 0.73 | 0.00 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 5 | 5 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 11 | — |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 653.6 | 451.6 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 13 | 0 |
| nOC | 16 | 16 |
| nNO | 0 | 0 |
| nOO | 7 | 7 |
| nNC/(nNC + nOC) | 0.45 | 0.00 |
| nNC/(nNC + nOO) | 0.65 | 0.00 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 5 | 5 |
| PPG Monomers | ||
| Fatty Acid | 13 | — |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 635.6 | 405.5 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 15 | 0 |
| nOC | 15 | 15 |
| nNO | 0 | 0 |
| nOO | 5 | 5 |
| nNC/(nNC + nOC) | 0.50 | 0.00 |
| nNC/(nNC + nOO) | 0.75 | 0.00 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 2 | 2 |
| PEG Monomers | ||
| Number of | 2 | 2 |
| PPG Monomers | ||
| Fatty Acid | 15 | — |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 577.5 | 319.4 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 17 | 0 |
| |
10 | 10 |
| nNO | 0 | 0 |
| nOO | 4 | 4 |
| nNC/(nNC + nOC) | 0.63 | 0.00 |
| nNC/(nNC + nOO) | 0.81 | 0.00 |
| nNO/(nNO + nOC) | 0.00 | 0.00 |
| nNO/(nNO + nOO) | 0.00 | 0.00 |
| Number of | 0 | 0 |
| PEG Monomers | ||
| Number of | 0 | 0 |
| PPG Monomers | ||
| Fatty Acid | 34 | 0 |
| CH3(CH2)nCOOH, | ||
| n = ? | ||
| Molecular | 639.2 | 115.1 |
| Weight, MwP | ||
| (g/mol, Dalton) | ||
| nNC | 36 | 0 |
| nOC | 0 | 0 |
| nNO | 0 | 0 |
| nOO | 0 | 0 |
| nNC/(nNC + nOC) | 1.00 | — |
| nNC/(nNC + nOO) | 1.00 | — |
| nNO/(nNO + nOC) | — | — |
| nNO/(nNO + nOO) | — | — |
| Comparison | 29th Example | 30th Example | |
| Central | Citric Acid | Amino Acid | Bezene Derivative |
| Structure | Derivative | Derivative | |
| Product | Acetyl Tributyl | Dioctyl | Ethylene Glycol |
| Name | Citrate | DL-Aspartate | Disalicylate |
| Structural Formula |
 |
 |
 |
| |
Aspartate | | |
| Reactant | |||
| 2 | Octanol | Ethylene Glycol | |
| days | Degree of Degradation (%) |
| 0 | 0 | 0 | 0 |
| 3 | 1.53 | 6.70 | 3.21 |
| 7 | 13.22 | 8.53 | 1.97 |
| 12 | 20.84 | 20.53 | 1.09 |
| 15 | 25.38 | 26.53 | 1.87 |
| 19 | 26.71 | 35.22 | 4.13 |
| 24 | 28.89 | 44.08 | 6.63 |
| 28 | 30.29 | 48.75 | 13.13 |
| 33 | 29.64 | 51.62 | 17.63 |
| 36 | 33.87 | 53.72 | 26.70 |
| 40 | 33.87 | 55.78 | 33.47 |
| 45 | 34.64 | 57.19 | 38.10 |
| 49 | 39.24 | 58.41 | 43.93 |
| 54 | 39.81 | 59.35 | 47.28 |
| 58 | 41.33 | 59.61 | 60.14 |
| 63 | 42.10 | 59.85 | 67.90 |
| 67 | 41.59 | 60.34 | 69.50 |
| 71 | 42.04 | 62.58 | 71.37 |
| 75 | 42.47 | 63.96 | 72.99 |
| 81 | 42.89 | 63.75 | 73.19 |
| 85 | 44.19 | 62.72 | 73.19 |
| 89 | 44.65 | 64.14 | 73.53 |
| 93 | 44.65 | 65.04 | 78.89 |
| 98 | 44.24 | 65.04 | 78.51 |
| 102 | 44.86 | 66.44 | 78.14 |
| 105 | 44.36 | 66.44 | 78.50 |
| 109 | 43.39 | 66.25 | 81.63 |
| 114 | 44.42 | 66.04 | 81.09 |
| 118 | 44.11 | 66.80 | 84.55 |
| 124 | 44.11 | 66.80 | 84.55 |
| 128 | 44.73 | 67.01 | 86.04 |
| 132 | 44.88 | 66.81 | 86.55 |
| 137 | 45.54 | 66.81 | 86.81 |
| 140 | 45.19 | 66.81 | 86.58 |
| 144 | 45.51 | 66.01 | 86.58 |
| 147 | 45.18 | 64.81 | 87.69 |
| 151 | 45.18 | 64.62 | 88.54 |
| 155 | 45.18 | 64.23 | 88.54 |
| 158 | 45.00 | 65.50 | 87.80 |
| 161 | 45.00 | 66.30 | 87.80 |
| 165 | 45.00 | 66.92 | 87.80 |
| 168 | 44.78 | 65.84 | 88.40 |
| 172 | 43.19 | 67.51 | 89.55 |
| 175 | 43.19 | 69.97 | 89.91 |
| 179 | 42.55 | 71.93 | 91.46 |
According to the present disclosure, the biodegradable plasticizer is developed by investigating a novel molecular structure. The plasticizer has the abilities of improving the plastic texture, meeting the requirements for widespread applications, and further enhancing the degradation and cycle of the plastic. The plasticizer includes the first connecting structure and the second connecting structure, includes the benzene derivative and/or the amino acid as the central structure, and is grafted with the side-chain structure of the chain with multiple carbon atoms. The plasticizer can further include the polar functional group to adjust the hydrophilicity and hydrophobicity of the plasticizer. The plasticizer, which reaches desire durability, heat resistance, impact resistance and flexibility, and is harmless to human body, hard to release and low-cost, is developed to meet the target of high biodegradability.
The foregoing description, for purpose of explanation, has been described with reference to specific embodiments and examples. It is to be noted that Tables show different data of the different examples; however, the data of the different examples are obtained from experiments. The embodiments and examples were chosen and described in order to best explain the principles of the disclosure and its practical applications, to thereby enable others skilled in the art to best utilize the disclosure and various embodiments or examples with various modifications as are suited to the particular use contemplated. The embodiments and examples depicted above and the appended drawings are exemplary and are not intended to be exhaustive or to limit the scope of the present disclosure to the precise forms disclosed. Many modifications and variations are possible in view of the above teachings.
Claims (11)
1. A plasticizer, which is biodegradable, a molecule of the plasticizer comprising:
a central structure comprising at least one amino acid; and
at least two side-chain structures, wherein each of the at least two side-chain structures is a chain of multiple carbon atoms, an amide bond is formed as one of the at least two side-chain structures connected to an amine group of the at least one amino acid, and an ester bond is formed as another one of the at least two side-chain structures connected to an a carboxyl group of the at least one amino acid;
wherein a number of carbon atoms of the side-chain structure which is connected to the amine group is nNC, a number of carbon atoms of the side-chain structure which is connected to the carboxyl group is nOC, and the following condition is satisfied:
0.01≤nNC/(nNC+nOC)<1.00;
0.01≤nNC/(nNC+nOC)<1.00;
wherein nNC is positive integer and nOC is positive integer.
2. The plasticizer of claim 1 , wherein the following condition is satisfied:
0.20≤nNC/(nNC+nOC)≤0.70.
0.20≤nNC/(nNC+nOC)≤0.70.
3. The plasticizer of claim 2 , wherein the following condition is satisfied:
0.30≤nNC/(nNC+nOC)≤0.50.
0.30≤nNC/(nNC+nOC)≤0.50.
4. The plasticizer of claim 1 , wherein the number of carbon atoms of the side-chain structure which is connected to the amine group is nNC, a number of oxygen atoms of the side-chain structure which is connected to the carboxyl group is nOO, and the following condition is satisfied:
0.45≤nNC/(nNC+nOO)≤1.00.
0.45≤nNC/(nNC+nOO)≤1.00.
5. The plasticizer of claim 1 , wherein the at least one amino acid is aspartate acid.
6. The plasticizer of claim 1 , wherein the central structure comprises at least two of the amino acid.
7. The plasticizer of claim 1 , wherein a molecular weight of the plasticizer is MwP, and the following condition is satisfied:
450 Dalton≤MwP.
450 Dalton≤MwP.
8. The plasticizer of claim 1 , further comprising:
at least one polar functional group connected to one of the at least two side-chain structures, wherein the at least one polar functional group is a carboxyl group, a hydroxyl group, an amine group or a phosphoryl group.
9. The plasticizer of claim 8 , wherein the plasticizer comprises at least two of the polar functional group, which are selected from the group consisting of the carboxyl group, the hydroxyl group, the amine group and the phosphoryl group.
10. A plastic product, which is biodegradable, comprising:
the plasticizer of claim 1 ; and
a polyester plastic, wherein the polyester plastic is a polylactic acid, a polybutylene succinate, a poly (butylene adipate-co-terephthalate) or a polyhydroxyalkanoate;
wherein the plasticizer is mixed with the polyester plastic.
11. The plasticizer of claim 1 , wherein the number of carbon atoms of the side-chain structure which is connected to the carboxyl group is nOC, a number of oxygen atoms of the side-chain structure which is connected to the carboxyl group is nOO, and the following condition is satisfied:
2≤nOC/nOO.
2≤nOC/nOO.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US17/102,617 US12173135B2 (en) | 2019-11-25 | 2020-11-24 | Plasticizer and plastic product |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201962939733P | 2019-11-25 | 2019-11-25 | |
| US17/102,617 US12173135B2 (en) | 2019-11-25 | 2020-11-24 | Plasticizer and plastic product |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| US20210155771A1 US20210155771A1 (en) | 2021-05-27 |
| US12173135B2 true US12173135B2 (en) | 2024-12-24 |
Family
ID=73597840
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US17/102,617 Active 2042-04-13 US12173135B2 (en) | 2019-11-25 | 2020-11-24 | Plasticizer and plastic product |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US12173135B2 (en) |
| EP (1) | EP3825354A1 (en) |
| JP (1) | JP7796474B2 (en) |
| CN (3) | CN116003877A (en) |
| TW (3) | TWI806290B (en) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TWI848480B (en) * | 2022-12-22 | 2024-07-11 | 星歐光學股份有限公司 | Plasticizer, plastic composition, and plastic product |
| CN119263986B (en) * | 2024-09-25 | 2025-09-23 | 扬州惠通生物新材料有限公司 | A salicylate plasticizer, its preparation method and use |
Citations (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20030100645A1 (en) | 2001-08-01 | 2003-05-29 | Ahmed Sharf U. | Breathable biodegradable hot melt composition |
| US20030235639A1 (en) * | 2002-06-20 | 2003-12-25 | Jingping Lin | Plasticized prolamine compositions |
| CN1572825A (en) | 2003-06-03 | 2005-02-02 | 住友橡胶工业株式会社 | Rubber composition for tread and pneumatic tyre using the same |
| CN101456970A (en) | 2007-12-11 | 2009-06-17 | 北京金源化学集团有限公司 | Non-toxic fatty acid ester plasticiser mixture for polyvinyl chloride resin |
| KR100962877B1 (en) | 2002-11-08 | 2010-06-09 | 가부시키가이샤 아데카 | Polyester plasticizer and chlorine-containing resin composition |
| US20110003930A1 (en) | 2008-03-11 | 2011-01-06 | Sergio Brunetti | Biodegradable elastomeric compound |
| US20130245133A1 (en) | 2011-02-11 | 2013-09-19 | Bezwada Biomedical, Llc. | Amino acid derivatives and absorbable polymers therefrom |
| US20140277337A1 (en) | 2013-03-14 | 2014-09-18 | Medtronic Vascular, Inc. | Medical Device and Plasticized Nylon |
| US20150208743A1 (en) * | 2006-03-01 | 2015-07-30 | Curtis P. Hamann | Polylactic Acid Gloves and Methods of Manufacturing Same |
| US20160145297A1 (en) | 2013-06-12 | 2016-05-26 | Merck Patent Gmbh | Hydroxy-ethylene derivatives for the treatment of arthrosis |
| US9534104B2 (en) | 2013-01-28 | 2017-01-03 | Exxonmobil Chemical Patents Inc. | Plasticizer blends and use thereof |
| JP2017514823A (en) | 2014-04-30 | 2017-06-08 | ロレアルＬ′Ｏｒｅａｌ | Composition comprising microcapsules comprising reflective particles |
| CN107286311A (en) | 2016-03-30 | 2017-10-24 | 圆容生物医药无锡有限公司 | Macromolecular plasticizer and preparation method thereof |
| US10131863B2 (en) | 2014-04-11 | 2018-11-20 | Novozymes A/S | Detergent composition |
| US20190031601A1 (en) | 2016-01-29 | 2019-01-31 | University Of Mississippi | Biologically Active Cannabidiol Analogs |
| US11024440B2 (en) | 2016-11-24 | 2021-06-01 | Eneos Corporation | Conductive thermoplastic elastomer composition |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61162042A (en) * | 1985-01-12 | 1986-07-22 | Konishiroku Photo Ind Co Ltd | Heat developed image receiving element |
| CN1189174A (en) * | 1995-05-03 | 1998-07-29 | Dsm有限公司 | star branched polyamide |
| JP2002241289A (en) * | 2001-02-16 | 2002-08-28 | Ichimaru Pharcos Co Ltd | Thickened keratin layer softener |
| EP2204396B1 (en) * | 2005-04-22 | 2021-08-25 | Mitsubishi Chemical Corporation | Biomass-resource derived polyester and production process thereof |
| US7842761B2 (en) * | 2008-04-03 | 2010-11-30 | Lapol, Llc | Bioderived plasticizer for biopolymers |
| US20100129674A1 (en) * | 2008-11-21 | 2010-05-27 | Chemetall Corp. | Aminobenzoic acid polymer compositions and films; methods of forming and using the same |
| US8461372B2 (en) * | 2011-02-11 | 2013-06-11 | Rao S. Bezwada | Amino acid derivatives and absorbable polymers therefrom |
| CN103524727A (en) * | 2013-09-29 | 2014-01-22 | 河南新大新材料股份有限公司 | Preparation method of dibenzoate polyethylene glycol plasticizer |
| EP2939653A1 (en) * | 2014-04-30 | 2015-11-04 | L'Oréal | Composition comprising microcapsules containing particles with a high wet point |
| TWI689547B (en) * | 2014-10-13 | 2020-04-01 | 美商摩諾索公司 | Water-soluble polyvinyl alcohol film with plasticizer blend, related methods and related articles |
| DE102017214045A1 (en) * | 2017-08-11 | 2019-02-14 | Clariant Plastics & Coatings Ltd | Flame retardant polyamide compositions and their use |
| JP7031633B2 (en) * | 2018-03-28 | 2022-03-08 | 荒川化学工業株式会社 | Adhesive-imparting resin emulsion and water-based adhesive / adhesive composition |
| CN110372827B (en) * | 2019-06-06 | 2022-03-18 | 江苏苏博特新材料股份有限公司 | Concrete superplasticizer and preparation method thereof |
-
2020
- 2020-11-24 CN CN202310204869.7A patent/CN116003877A/en active Pending
- 2020-11-24 TW TW110147045A patent/TWI806290B/en active
- 2020-11-24 CN CN202011326626.3A patent/CN112831091B/en active Active
- 2020-11-24 TW TW112117820A patent/TWI878878B/en active
- 2020-11-24 EP EP20209637.6A patent/EP3825354A1/en active Pending
- 2020-11-24 CN CN202310204873.3A patent/CN116082703A/en active Pending
- 2020-11-24 US US17/102,617 patent/US12173135B2/en active Active
- 2020-11-24 TW TW109141199A patent/TWI753671B/en active
- 2020-11-24 JP JP2020194313A patent/JP7796474B2/en active Active
Patent Citations (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20030100645A1 (en) | 2001-08-01 | 2003-05-29 | Ahmed Sharf U. | Breathable biodegradable hot melt composition |
| US20030235639A1 (en) * | 2002-06-20 | 2003-12-25 | Jingping Lin | Plasticized prolamine compositions |
| KR100962877B1 (en) | 2002-11-08 | 2010-06-09 | 가부시키가이샤 아데카 | Polyester plasticizer and chlorine-containing resin composition |
| CN1572825A (en) | 2003-06-03 | 2005-02-02 | 住友橡胶工业株式会社 | Rubber composition for tread and pneumatic tyre using the same |
| US8148458B2 (en) | 2003-06-03 | 2012-04-03 | Sumitomo Rubber Industries, Ltd. | Rubber composition for tread and pneumatic tire using the same |
| US20150208743A1 (en) * | 2006-03-01 | 2015-07-30 | Curtis P. Hamann | Polylactic Acid Gloves and Methods of Manufacturing Same |
| CN101456970A (en) | 2007-12-11 | 2009-06-17 | 北京金源化学集团有限公司 | Non-toxic fatty acid ester plasticiser mixture for polyvinyl chloride resin |
| US20110003930A1 (en) | 2008-03-11 | 2011-01-06 | Sergio Brunetti | Biodegradable elastomeric compound |
| JP2011513564A (en) | 2008-03-11 | 2011-04-28 | ア．ピ．イ． アップリカツィオーニ プラスティケ インデュストリアリ ソシエタ ペル アチオニ | Biodegradable elastomer composition |
| US20130245133A1 (en) | 2011-02-11 | 2013-09-19 | Bezwada Biomedical, Llc. | Amino acid derivatives and absorbable polymers therefrom |
| US9534104B2 (en) | 2013-01-28 | 2017-01-03 | Exxonmobil Chemical Patents Inc. | Plasticizer blends and use thereof |
| US20140277337A1 (en) | 2013-03-14 | 2014-09-18 | Medtronic Vascular, Inc. | Medical Device and Plasticized Nylon |
| US20160145297A1 (en) | 2013-06-12 | 2016-05-26 | Merck Patent Gmbh | Hydroxy-ethylene derivatives for the treatment of arthrosis |
| US10131863B2 (en) | 2014-04-11 | 2018-11-20 | Novozymes A/S | Detergent composition |
| JP2017514823A (en) | 2014-04-30 | 2017-06-08 | ロレアルＬ′Ｏｒｅａｌ | Composition comprising microcapsules comprising reflective particles |
| US10617609B2 (en) | 2014-04-30 | 2020-04-14 | L'oreal | Composition comprising microcapsules containing reflective particles |
| US20190031601A1 (en) | 2016-01-29 | 2019-01-31 | University Of Mississippi | Biologically Active Cannabidiol Analogs |
| CN107286311A (en) | 2016-03-30 | 2017-10-24 | 圆容生物医药无锡有限公司 | Macromolecular plasticizer and preparation method thereof |
| US11024440B2 (en) | 2016-11-24 | 2021-06-01 | Eneos Corporation | Conductive thermoplastic elastomer composition |
Non-Patent Citations (1)
| Title |
|---|
| Ya-Luo Bai, "DowDuPont's Second-Generation Picolinamide-Type Fungicide Florylpicoxamid Will Be Registered in 2023", Agroinfo & Advanced Pesticide, published online Dec. 13, 2018, http://www.agroinfo.com.cn/news_detail_11366.html, published by Jiangsu Pesticide Research Institute Company LTD. |
Also Published As
| Publication number | Publication date |
|---|---|
| TW202212450A (en) | 2022-04-01 |
| TW202334301A (en) | 2023-09-01 |
| TWI878878B (en) | 2025-04-01 |
| JP7796474B2 (en) | 2026-01-09 |
| TWI806290B (en) | 2023-06-21 |
| JP2021085036A (en) | 2021-06-03 |
| CN116003877A (en) | 2023-04-25 |
| TW202120611A (en) | 2021-06-01 |
| TWI753671B (en) | 2022-01-21 |
| US20210155771A1 (en) | 2021-05-27 |
| CN112831091B (en) | 2023-03-21 |
| CN112831091A (en) | 2021-05-25 |
| EP3825354A1 (en) | 2021-05-26 |
| CN116082703A (en) | 2023-05-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US12173135B2 (en) | Plasticizer and plastic product | |
| US10774181B2 (en) | N-maleimidyl polymer derivatives | |
| US7960502B2 (en) | Sterically hindered poly(ethylene glycol) alkanoic acids and derivatives thereof | |
| US6774180B2 (en) | Synthesis of high molecular weight non-peptidic polymer derivatives | |
| US5672662A (en) | Poly(ethylene glycol) and related polymers monosubstituted with propionic or butanoic acids and functional derivatives thereof for biotechnical applications | |
| US8728493B2 (en) | Polymer based compositions and conjugates of non-steroidal anti-inflammatory drugs | |
| US20010041172A1 (en) | Water-soluble polymer conjugates of artelinic acid | |
| Li et al. | Synthesis of linear polyether polyol derivatives as new materials for bioconjugation | |
| HU226294B1 (en) | Peg-urate oxidase conjugates and use thereof | |
| US20110071079A1 (en) | Self-assembling poly(diol citrates)-protein hydrogels | |
| US20140041802A1 (en) | Biocompatible adhesive polymers | |
| US12403199B2 (en) | Asymmetrically branched degradable polyethylene glycol derivative | |
| US20220153992A1 (en) | Branched and degradable polyethylene glycol derivative |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AS | Assignment |
Owner name: LARGAN MEDICAL CO., LTD., TAIWAN Free format text: ASSIGNMENT OF ASSIGNORS INTEREST;ASSIGNORS:CHEN, WEI-YUAN;LU, TZU-RONG;CHEN, YI-LING;AND OTHERS;SIGNING DATES FROM 20201102 TO 20201103;REEL/FRAME:054454/0356 |
|
| FEPP | Fee payment procedure |
Free format text: ENTITY STATUS SET TO UNDISCOUNTED (ORIGINAL EVENT CODE: BIG.); ENTITY STATUS OF PATENT OWNER: LARGE ENTITY |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: APPLICATION DISPATCHED FROM PREEXAM, NOT YET DOCKETED |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: DOCKETED NEW CASE - READY FOR EXAMINATION |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: NON FINAL ACTION MAILED |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: RESPONSE TO NON-FINAL OFFICE ACTION ENTERED AND FORWARDED TO EXAMINER |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: FINAL REJECTION MAILED |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: ADVISORY ACTION MAILED |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: DOCKETED NEW CASE - READY FOR EXAMINATION |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: NON FINAL ACTION MAILED |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: RESPONSE TO NON-FINAL OFFICE ACTION ENTERED AND FORWARDED TO EXAMINER |
|
| ZAAB | Notice of allowance mailed |
Free format text: ORIGINAL CODE: MN/=. |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: NOTICE OF ALLOWANCE MAILED -- APPLICATION RECEIVED IN OFFICE OF PUBLICATIONS |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: PUBLICATIONS -- ISSUE FEE PAYMENT VERIFIED |
|
| STCF | Information on status: patent grant |
Free format text: PATENTED CASE |