SU496716A3 - Способ получени перкарбоновых кислот - Google Patents
Способ получени перкарбоновых кислотInfo
- Publication number
- SU496716A3 SU496716A3 SU1688972A SU1688972A SU496716A3 SU 496716 A3 SU496716 A3 SU 496716A3 SU 1688972 A SU1688972 A SU 1688972A SU 1688972 A SU1688972 A SU 1688972A SU 496716 A3 SU496716 A3 SU 496716A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- ether
- acid
- hydrogen peroxide
- mono
- methyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 17
- 239000002253 acid Substances 0.000 title claims description 13
- 150000007513 acids Chemical class 0.000 title claims description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 43
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 238000004821 distillation Methods 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 9
- 150000001735 carboxylic acids Chemical class 0.000 claims description 8
- 229910052698 phosphorus Inorganic materials 0.000 claims description 6
- 239000011574 phosphorus Substances 0.000 claims description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 150000002903 organophosphorus compounds Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 2
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 235000014443 Pyrus communis Nutrition 0.000 claims 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 230000002378 acidificating effect Effects 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 230000003993 interaction Effects 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 230000002101 lytic effect Effects 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 239000002994 raw material Substances 0.000 claims 1
- -1 alkylene radical Chemical class 0.000 description 38
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 28
- 239000000203 mixture Substances 0.000 description 22
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 239000012071 phase Substances 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 229910019142 PO4 Inorganic materials 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 239000010452 phosphate Substances 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 6
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000012442 inert solvent Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 238000010533 azeotropic distillation Methods 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 3
- UWNADWZGEHDQAB-UHFFFAOYSA-N 2,5-dimethylhexane Chemical group CC(C)CCC(C)C UWNADWZGEHDQAB-UHFFFAOYSA-N 0.000 description 2
- SZNYYWIUQFZLLT-UHFFFAOYSA-N 2-methyl-1-(2-methylpropoxy)propane Chemical compound CC(C)COCC(C)C SZNYYWIUQFZLLT-UHFFFAOYSA-N 0.000 description 2
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 2
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 229940072049 amyl acetate Drugs 0.000 description 2
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- UCQFCFPECQILOL-UHFFFAOYSA-N diethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OCC UCQFCFPECQILOL-UHFFFAOYSA-N 0.000 description 2
- ZJXZSIYSNXKHEA-UHFFFAOYSA-L ethyl phosphate(2-) Chemical compound CCOP([O-])([O-])=O ZJXZSIYSNXKHEA-UHFFFAOYSA-L 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- MLFHJEHSLIIPHL-UHFFFAOYSA-N isoamyl acetate Chemical compound CC(C)CCOC(C)=O MLFHJEHSLIIPHL-UHFFFAOYSA-N 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 150000004965 peroxy acids Chemical class 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- SNFZGONQCTYGML-UHFFFAOYSA-N (1-hydroxycyclohexyl) dihydrogen phosphate Chemical compound P(=O)(O)(O)OC1(CCCCC1)O SNFZGONQCTYGML-UHFFFAOYSA-N 0.000 description 1
- KPRMTLXLUPSXMR-UHFFFAOYSA-N (3-chlorophenyl)phosphonic acid Chemical compound OP(O)(=O)C1=CC=CC(Cl)=C1 KPRMTLXLUPSXMR-UHFFFAOYSA-N 0.000 description 1
- MFJMZOUFSWSBNV-UHFFFAOYSA-N 1-chloro-2-(2-chlorophenoxy)benzene Chemical compound ClC1=CC=CC=C1OC1=CC=CC=C1Cl MFJMZOUFSWSBNV-UHFFFAOYSA-N 0.000 description 1
- URUJZHZLCCIILC-UHFFFAOYSA-N 1-chloro-4-(4-chlorophenoxy)benzene Chemical compound C1=CC(Cl)=CC=C1OC1=CC=C(Cl)C=C1 URUJZHZLCCIILC-UHFFFAOYSA-N 0.000 description 1
- BPIUIOXAFBGMNB-UHFFFAOYSA-N 1-hexoxyhexane Chemical compound CCCCCCOCCCCCC BPIUIOXAFBGMNB-UHFFFAOYSA-N 0.000 description 1
- AGZRBJLATOQBCH-UHFFFAOYSA-N 1-methoxy-2-(2-methoxyphenoxy)benzene Chemical compound COC1=CC=CC=C1OC1=CC=CC=C1OC AGZRBJLATOQBCH-UHFFFAOYSA-N 0.000 description 1
- OQDTVHIDNIUURR-UHFFFAOYSA-N 1-methoxy-3-(3-methoxyphenoxy)benzene Chemical compound COC1=CC=CC(OC=2C=C(OC)C=CC=2)=C1 OQDTVHIDNIUURR-UHFFFAOYSA-N 0.000 description 1
- CBDLNOVOFXJEOB-UHFFFAOYSA-N 1-methoxy-4-(4-methoxyphenoxy)benzene Chemical compound C1=CC(OC)=CC=C1OC1=CC=C(OC)C=C1 CBDLNOVOFXJEOB-UHFFFAOYSA-N 0.000 description 1
- SVWHXFUUCAUJSN-UHFFFAOYSA-N 1-methyl-1$l^{5}-phospholane 1-oxide Chemical compound CP1(=O)CCCC1 SVWHXFUUCAUJSN-UHFFFAOYSA-N 0.000 description 1
- NSIKSSLASOEOJY-UHFFFAOYSA-N 1-methyl-3-(3-methylcyclohexyl)oxycyclohexane Chemical compound C1C(C)CCCC1OC1CC(C)CCC1 NSIKSSLASOEOJY-UHFFFAOYSA-N 0.000 description 1
- FDLFMPKQBNPIER-UHFFFAOYSA-N 1-methyl-3-(3-methylphenoxy)benzene Chemical compound CC1=CC=CC(OC=2C=C(C)C=CC=2)=C1 FDLFMPKQBNPIER-UHFFFAOYSA-N 0.000 description 1
- AOPDRZXCEAKHHW-UHFFFAOYSA-N 1-pentoxypentane Chemical compound CCCCCOCCCCC AOPDRZXCEAKHHW-UHFFFAOYSA-N 0.000 description 1
- KQGAIKIRKNMYOR-UHFFFAOYSA-N 1-tert-butyl-4-(4-tert-butylphenoxy)benzene Chemical compound C1=CC(C(C)(C)C)=CC=C1OC1=CC=C(C(C)(C)C)C=C1 KQGAIKIRKNMYOR-UHFFFAOYSA-N 0.000 description 1
- ZZKHJIRWLISXLG-UHFFFAOYSA-N 2-(2-cyanophenoxy)benzonitrile Chemical compound N#CC1=CC=CC=C1OC1=CC=CC=C1C#N ZZKHJIRWLISXLG-UHFFFAOYSA-N 0.000 description 1
- BHQBQWOZHYUVTL-UHFFFAOYSA-N 2-(3-methylbutoxy)ethylbenzene Chemical compound CC(C)CCOCCC1=CC=CC=C1 BHQBQWOZHYUVTL-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- NJBCRXCAPCODGX-UHFFFAOYSA-N 2-methyl-n-(2-methylpropyl)propan-1-amine Chemical compound CC(C)CNCC(C)C NJBCRXCAPCODGX-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- RCEJCSULJQNRQQ-UHFFFAOYSA-N 2-methylbutanenitrile Chemical compound CCC(C)C#N RCEJCSULJQNRQQ-UHFFFAOYSA-N 0.000 description 1
- QGFFCYYGWIXRCL-UHFFFAOYSA-N 2-phenylethylphosphane Chemical compound PCCC1=CC=CC=C1 QGFFCYYGWIXRCL-UHFFFAOYSA-N 0.000 description 1
- DNNJZXKGVFRAIT-UHFFFAOYSA-N 3-(3-cyanophenoxy)benzonitrile Chemical compound N#CC1=CC=CC(OC=2C=C(C=CC=2)C#N)=C1 DNNJZXKGVFRAIT-UHFFFAOYSA-N 0.000 description 1
- ZKIHXXUBAHKCSN-UHFFFAOYSA-N 3-methyl-1-(3-methylpentoxy)pentane Chemical compound CCC(C)CCOCCC(C)CC ZKIHXXUBAHKCSN-UHFFFAOYSA-N 0.000 description 1
- HTXMJCHSFOPGME-UHFFFAOYSA-N 4,7-dimethoxy-1,3-benzodioxole Chemical compound COC1=CC=C(OC)C2=C1OCO2 HTXMJCHSFOPGME-UHFFFAOYSA-N 0.000 description 1
- RSAUOQFEFINEDM-UHFFFAOYSA-N 4-(4-cyanophenoxy)benzonitrile Chemical compound C1=CC(C#N)=CC=C1OC1=CC=C(C#N)C=C1 RSAUOQFEFINEDM-UHFFFAOYSA-N 0.000 description 1
- OMYMWDFOOFWXCW-UHFFFAOYSA-N 4-methyl-1-(4-methylpentoxy)pentane Chemical compound CC(C)CCCOCCCC(C)C OMYMWDFOOFWXCW-UHFFFAOYSA-N 0.000 description 1
- DPNLUCKAZIFDLB-UHFFFAOYSA-N 7-chloroheptan-1-ol Chemical compound OCCCCCCCCl DPNLUCKAZIFDLB-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 241000533363 Apion Species 0.000 description 1
- WVIDLPXBFQWSHV-UHFFFAOYSA-N COC1CCC(CC1)OC1CCC(CC1)OC Chemical compound COC1CCC(CC1)OC1CCC(CC1)OC WVIDLPXBFQWSHV-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- KKUKTXOBAWVSHC-UHFFFAOYSA-N Dimethylphosphate Chemical compound COP(O)(=O)OC KKUKTXOBAWVSHC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010062717 Increased upper airway secretion Diseases 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- 241001674048 Phthiraptera Species 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- HRKAMJBPFPHCSD-UHFFFAOYSA-N Tri-isobutylphosphate Chemical compound CC(C)COP(=O)(OCC(C)C)OCC(C)C HRKAMJBPFPHCSD-UHFFFAOYSA-N 0.000 description 1
- VHEGWTYOYHSONP-UHFFFAOYSA-N [P]C#N Chemical compound [P]C#N VHEGWTYOYHSONP-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229940076134 benzene Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- LREAZWJEBORMTB-UHFFFAOYSA-N bis(2-methylpropyl)phosphane Chemical compound CC(C)CPCC(C)C LREAZWJEBORMTB-UHFFFAOYSA-N 0.000 description 1
- HRQGCQVOJVTVLU-UHFFFAOYSA-N bis(chloromethyl) ether Chemical compound ClCOCCl HRQGCQVOJVTVLU-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- NDTCXABJQNJPCF-UHFFFAOYSA-N chlorocyclopentane Chemical compound ClC1CCCC1 NDTCXABJQNJPCF-UHFFFAOYSA-N 0.000 description 1
- 239000000571 coke Substances 0.000 description 1
- OCDXZFSOHJRGIL-UHFFFAOYSA-N cyclohexyloxycyclohexane Chemical compound C1CCCCC1OC1CCCCC1 OCDXZFSOHJRGIL-UHFFFAOYSA-N 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- WDMPXBQEGRZZNA-UHFFFAOYSA-N cyclopentylazanide Chemical compound [NH-]C1CCCC1 WDMPXBQEGRZZNA-UHFFFAOYSA-N 0.000 description 1
- DVIDIZXCFDHODG-UHFFFAOYSA-N cyclopentylphosphane Chemical compound PC1CCCC1 DVIDIZXCFDHODG-UHFFFAOYSA-N 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical compound CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 1
- PTLIZOFGXLGHSY-UHFFFAOYSA-N dibutylphosphane Chemical compound CCCCPCCCC PTLIZOFGXLGHSY-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- UZBQIPPOMKBLAS-UHFFFAOYSA-N diethylazanide Chemical compound CC[N-]CC UZBQIPPOMKBLAS-UHFFFAOYSA-N 0.000 description 1
- VZZJVOCVAZHETD-UHFFFAOYSA-N diethylphosphane Chemical compound CCPCC VZZJVOCVAZHETD-UHFFFAOYSA-N 0.000 description 1
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 1
- UXOKOCYPPZYPPY-UHFFFAOYSA-N dimethyl hydrogen phosphate;methane Chemical compound C.COP(O)(=O)OC UXOKOCYPPZYPPY-UHFFFAOYSA-N 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- MTWCVKTUVWXLFS-UHFFFAOYSA-N dipropylphosphane Chemical compound CCCPCCC MTWCVKTUVWXLFS-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- GJJASJCGLOUWAC-UHFFFAOYSA-N ethoxycyclohexane Chemical compound CCOC1CCCCC1 GJJASJCGLOUWAC-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 1
- GATNOFPXSDHULC-UHFFFAOYSA-N ethylphosphonic acid Chemical compound CCP(O)(O)=O GATNOFPXSDHULC-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- KGPPDNUWZNWPSI-UHFFFAOYSA-N flurotyl Chemical compound FC(F)(F)COCC(F)(F)F KGPPDNUWZNWPSI-UHFFFAOYSA-N 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229940117955 isoamyl acetate Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- GHDIHPNJQVDFBL-UHFFFAOYSA-N methoxycyclohexane Chemical compound COC1CCCCC1 GHDIHPNJQVDFBL-UHFFFAOYSA-N 0.000 description 1
- DPBRCTOMQAMINP-UHFFFAOYSA-N methoxymethylcyclopentane Chemical compound COCC1CCCC1 DPBRCTOMQAMINP-UHFFFAOYSA-N 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- CFXPMULQHZOSRO-UHFFFAOYSA-N methyl 3-(3-methoxycarbonylphenoxy)benzoate Chemical compound COC(=O)C1=CC=CC(OC=2C=C(C=CC=2)C(=O)OC)=C1 CFXPMULQHZOSRO-UHFFFAOYSA-N 0.000 description 1
- CGARGJZZBOHMIZ-UHFFFAOYSA-N methyl 4-(4-methoxycarbonylphenoxy)benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1OC1=CC=C(C(=O)OC)C=C1 CGARGJZZBOHMIZ-UHFFFAOYSA-N 0.000 description 1
- CAAULPUQFIIOTL-UHFFFAOYSA-N methyl dihydrogen phosphate Chemical compound COP(O)(O)=O CAAULPUQFIIOTL-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- RDOXTESZEPMUJZ-UHFFFAOYSA-N methyl phenyl ether Natural products COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 1
- LVVACMOOTCZPBO-UHFFFAOYSA-N methyl(propyl)phosphane Chemical compound CCCPC LVVACMOOTCZPBO-UHFFFAOYSA-N 0.000 description 1
- XUXJHBAJZQREDB-UHFFFAOYSA-N methylbutylamide Natural products CCC(C)C(N)=O XUXJHBAJZQREDB-UHFFFAOYSA-N 0.000 description 1
- UNFUYWDGSFDHCW-UHFFFAOYSA-N monochlorocyclohexane Chemical compound ClC1CCCCC1 UNFUYWDGSFDHCW-UHFFFAOYSA-N 0.000 description 1
- ZQGJEUVBUVKZKS-UHFFFAOYSA-N n,2-dimethylpropan-2-amine Chemical compound CNC(C)(C)C ZQGJEUVBUVKZKS-UHFFFAOYSA-N 0.000 description 1
- YKYONYBAUNKHLG-UHFFFAOYSA-N n-Propyl acetate Natural products CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- NSNOXLZAKBVTDW-UHFFFAOYSA-N n-cyclobutylcyclobutanamine Chemical compound C1CCC1NC1CCC1 NSNOXLZAKBVTDW-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 208000026435 phlegm Diseases 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 150000003008 phosphonic acid esters Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- MAHQPELWLUTHNP-UHFFFAOYSA-N propoxycyclohexane Chemical compound CCCOC1CCCCC1 MAHQPELWLUTHNP-UHFFFAOYSA-N 0.000 description 1
- 229940090181 propyl acetate Drugs 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000003351 stiffener Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical class FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 1
- KJNVZTIMVKZSJR-UHFFFAOYSA-N trimethoxymethyl dihydrogen phosphate Chemical compound COC(OC)(OC)OP(O)(O)=O KJNVZTIMVKZSJR-UHFFFAOYSA-N 0.000 description 1
- WVLBCYQITXONBZ-UHFFFAOYSA-N trimethyl phosphate Chemical compound COP(=O)(OC)OC WVLBCYQITXONBZ-UHFFFAOYSA-N 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
- C07C407/003—Separation; Purification; Stabilisation; Use of additives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2038318A DE2038318C3 (de) | 1970-08-01 | 1970-08-01 | Verfahren zur Herstellung von Percarbonsänrelösungen oder Percarbonsäuren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU496716A3 true SU496716A3 (ru) | 1975-12-25 |
Family
ID=5778614
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1688972A SU496716A3 (ru) | 1970-08-01 | 1971-07-30 | Способ получени перкарбоновых кислот |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3845112A (OSRAM) |
| JP (1) | JPS5314531B1 (OSRAM) |
| AT (1) | AT316497B (OSRAM) |
| BE (1) | BE770778A (OSRAM) |
| CA (1) | CA951324A (OSRAM) |
| DE (1) | DE2038318C3 (OSRAM) |
| ES (1) | ES393839A1 (OSRAM) |
| FR (1) | FR2101175B1 (OSRAM) |
| GB (1) | GB1363916A (OSRAM) |
| NL (1) | NL7110584A (OSRAM) |
| RO (1) | RO62195A (OSRAM) |
| SU (1) | SU496716A3 (OSRAM) |
| ZA (1) | ZA715095B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4172086A (en) * | 1977-03-28 | 1979-10-23 | Fmc Corporation | Process for the manufacture of peroxycarboxylic acids |
| DE3320497A1 (de) * | 1983-06-07 | 1984-12-13 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von wasserunloeslichen peroxycarbonsaeuren |
| WO1995024388A1 (en) * | 1994-03-09 | 1995-09-14 | Kemira Chemicals B.V. | A method for the preparation of aqueous solutions containing performic acid as well as their use |
| US20090043123A1 (en) * | 2007-08-10 | 2009-02-12 | Fmc Corporation | Dilute Stabilized Peracetic Acid Production and Treatment Process |
-
1970
- 1970-08-01 DE DE2038318A patent/DE2038318C3/de not_active Expired
-
1971
- 1971-07-27 RO RO67822A patent/RO62195A/ro unknown
- 1971-07-29 US US00167529A patent/US3845112A/en not_active Expired - Lifetime
- 1971-07-29 CA CA119,379,A patent/CA951324A/en not_active Expired
- 1971-07-29 GB GB3573571A patent/GB1363916A/en not_active Expired
- 1971-07-30 NL NL7110584A patent/NL7110584A/xx not_active Application Discontinuation
- 1971-07-30 AT AT06675/71A patent/AT316497B/de not_active IP Right Cessation
- 1971-07-30 ZA ZA715095A patent/ZA715095B/xx unknown
- 1971-07-30 SU SU1688972A patent/SU496716A3/ru active
- 1971-07-30 BE BE770778A patent/BE770778A/xx unknown
- 1971-07-30 FR FR717128175A patent/FR2101175B1/fr not_active Expired
- 1971-07-30 JP JP5684971A patent/JPS5314531B1/ja active Pending
- 1971-07-31 ES ES393839A patent/ES393839A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2038318C3 (de) | 1978-08-17 |
| RO62195A (OSRAM) | 1977-06-15 |
| ES393839A1 (es) | 1973-08-16 |
| NL7110584A (OSRAM) | 1972-02-03 |
| US3845112A (en) | 1974-10-29 |
| FR2101175A1 (OSRAM) | 1972-03-31 |
| GB1363916A (en) | 1974-08-21 |
| AT316497B (de) | 1974-06-15 |
| BE770778A (fr) | 1972-01-31 |
| CA951324A (en) | 1974-07-16 |
| ZA715095B (en) | 1972-04-26 |
| DE2038318B2 (de) | 1977-12-08 |
| JPS5314531B1 (OSRAM) | 1978-05-18 |
| DE2038318A1 (de) | 1972-02-10 |
| FR2101175B1 (OSRAM) | 1973-06-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2067036T3 (es) | Productos de alcoxilacion de derivados de acidos carboxilicos y/o acidos carboxilicos que contienen grupos oh. | |
| SU496716A3 (ru) | Способ получени перкарбоновых кислот | |
| ES2090055T3 (es) | Productos de reaccion de acidos alfa-aminoetileno fosfonicos y compuestos epoxi y su uso en composiciones de revestimiento. | |
| SE448452B (sv) | Forfarande for framstellning och isolering av metyl-t-butyleter | |
| GB660021A (en) | Continuous esterification process | |
| US2460233A (en) | Esters of sulfolene halohydrins | |
| JP2629237B2 (ja) | ペンタエリスリトール部分エステルの製造法 | |
| CS585987A2 (en) | Method of continuous extraction | |
| SU475769A3 (ru) | Способ получени -капролактона | |
| RU2057115C1 (ru) | Способ получения пластификатора на основе сложных эфиров смеси дикарбоновых кислот с числом углеродных атомов 4 - 6 | |
| US4814491A (en) | Hemiacetals of glyoxylic esters and a process for the isolation of glyoxylic esters | |
| US1972579A (en) | Esters of 2-ethylbutanol-1 | |
| Ross et al. | The polymerization of undecylenic acid | |
| US2555595A (en) | Esters of unsaturated acidbranched chain hexadiene polymer adducts | |
| SU960158A1 (ru) | Способ получени диметил(изопропенилэтинил)карбинола | |
| KR100393435B1 (ko) | 지방족이산과아디프산의혼합물로부터지방족이산의분리방법 | |
| JPS54132502A (en) | Preparation of esters | |
| Midorikawa | The Condensations of Furfural with Acetylacetone and Ethyl Propionylacetate | |
| SU1004353A1 (ru) | 3,4,9,10-Аллилтрицикло (4,2,2,0 @ )-дец-7-ен-карбоксилат в качестве св зующего в литьевых пресс-композици х | |
| US3074965A (en) | Pyrane bskivaiwes | |
| US2533250A (en) | Ester of 1,5-pentanediol and its preparation | |
| SU385960A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ ХЛОРСОДЕРЖАЩИХ ЭФИРОВ ДИЦИКЛОПЕНТАДИЕНА1Изобретение относитс к способу получени хлорэфиров дициклопентадиена, в частности сложно-простых или простых эфиров, которые могут найти применение в качестве многофункционального пластификатора полимеров, а также растворител . | |
| GB645218A (en) | Esterification using azeotropic distillation | |
| SU172301A1 (ru) | Способ получения эфиров карбоновых кислот | |
| SU910597A1 (ru) | Способ получени отвердител дл жидкостекольной смеси в литейном производстве |