SU356857A1 - - Google Patents
Info
- Publication number
- SU356857A1 SU356857A1 SU1495231A SU1495231A SU356857A1 SU 356857 A1 SU356857 A1 SU 356857A1 SU 1495231 A SU1495231 A SU 1495231A SU 1495231 A SU1495231 A SU 1495231A SU 356857 A1 SU356857 A1 SU 356857A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- diazo
- compound
- azo
- component
- diazo compound
- Prior art date
Links
- 150000008049 diazo compounds Chemical class 0.000 description 20
- 239000000463 material Substances 0.000 description 18
- 150000001875 compounds Chemical class 0.000 description 12
- -1 p-amino-M-ethyl-M-benzylaniline Chemical compound 0.000 description 11
- 239000000758 substrate Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- 230000007935 neutral effect Effects 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 6
- 239000012954 diazonium Substances 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- 150000001989 diazonium salts Chemical class 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000002028 premature Effects 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 150000003839 salts Chemical group 0.000 description 3
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- HUCBKRHYYQNKJQ-UHFFFAOYSA-N 1,5-diethylcyclohexa-2,4-dien-1-amine Chemical compound C(C)C1(CC(=CC=C1)CC)N HUCBKRHYYQNKJQ-UHFFFAOYSA-N 0.000 description 1
- QCNYVWXUGRBLOI-UHFFFAOYSA-N CC1=[N+](CC(NS(C)(=O)=O)=O)C(C=C(C(OC)=C2)OC)=C2S1.[Br-] Chemical compound CC1=[N+](CC(NS(C)(=O)=O)=O)C(C=C(C(OC)=C2)OC)=C2S1.[Br-] QCNYVWXUGRBLOI-UHFFFAOYSA-N 0.000 description 1
- 101100149737 Caenorhabditis elegans sng-1 gene Proteins 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 230000005670 electromagnetic radiation Effects 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003142 primary aromatic amines Chemical class 0.000 description 1
- 239000001397 quillaja saponaria molina bark Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 229930182490 saponin Natural products 0.000 description 1
- 150000007949 saponins Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU894642834A Addition SU1611798A2 (ru) | 1989-01-30 | 1989-01-30 | Складной поддон |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU356857A1 true SU356857A1 (cs) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI74825B (fi) | Tvaokomponent-diazo-ljuskopiematerial. | |
| US3365296A (en) | Light-sensitive ultraviolet absorbing compounds and diazotype materials containing the same | |
| US2336309A (en) | Diazotype photographic material | |
| CA1119873A (en) | Diazo composition containing an azo coupling component precursor, a light sensitive acid progenitor and a carboxylic anhydride | |
| US2429249A (en) | Stabilized aryl diazo-n-sulfonate light-sensitive material | |
| SU356857A1 (cs) | ||
| US2618555A (en) | Process for positive diazotype and negative metal reduction images and light-sensitive material therefor | |
| US2593839A (en) | Diazotype photoprinting material | |
| US3169869A (en) | Diazotype material | |
| US3881931A (en) | Method for developing black diazotype photographic light-sensitive materials | |
| US2537106A (en) | Poly-acetoacetyl derivatives of polyamines as azo components in diazotype photoprinting material | |
| US2532126A (en) | Diazotype photographic material | |
| US2661291A (en) | Antidiffusion diazotypes having tetrazo diphenyls as the light sensitive agent | |
| US3910794A (en) | Imidazole couplers for two component diazotype systems | |
| US2688543A (en) | Poly-acetoacetyl derivatives of polyamines as azo components in diazotype photoprinting material | |
| US4033773A (en) | Radiation produced colored photopolymer systems | |
| US3660581A (en) | Thermally developable diazotype printing paper and composition therefor | |
| US2547843A (en) | Diazotyes containing 6-hydroxy-1, 3-benzoxathiolone-2 and its derivatives | |
| CA1066104A (en) | Diazotype material containing a diazoimino compound | |
| US3387977A (en) | Diazotype layer containing acetoacetamido coupling components | |
| US3719491A (en) | Diazo-type reproduction process | |
| US2531004A (en) | Acetonitriles as azo components in diazotypes | |
| US2655448A (en) | Diazotype photoprinting process | |
| HU185996B (en) | Compositions containing of diazo-type materials developable under heat effect | |
| US3676138A (en) | Formation of dyes suited for reproduction purposes |