SE188800C1 - - Google Patents
Info
- Publication number
- SE188800C1 SE188800C1 SE188800DA SE188800C1 SE 188800 C1 SE188800 C1 SE 188800C1 SE 188800D A SE188800D A SE 188800DA SE 188800 C1 SE188800 C1 SE 188800C1
- Authority
- SE
- Sweden
- Prior art keywords
- elements
- belt
- fuel elements
- metal
- tubes
- Prior art date
Links
- 239000000446 fuel Substances 0.000 claims description 22
- 229910052751 metal Inorganic materials 0.000 claims description 14
- 239000002184 metal Substances 0.000 claims description 14
- 238000009826 distribution Methods 0.000 claims description 3
- 229910052770 Uranium Inorganic materials 0.000 description 5
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 5
- 238000003466 welding Methods 0.000 description 4
- 239000002826 coolant Substances 0.000 description 3
- 229910001220 stainless steel Inorganic materials 0.000 description 3
- 239000010935 stainless steel Substances 0.000 description 3
- XLYOFNOQVPJJNP-ZSJDYOACSA-N Heavy water Chemical compound [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- -1 moderator Substances 0.000 description 1
- 239000003507 refrigerant Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- JFALSRSLKYAFGM-OIOBTWANSA-N uranium-235 Chemical compound [235U] JFALSRSLKYAFGM-OIOBTWANSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Monitoring And Testing Of Nuclear Reactors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE188800T |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE188800C1 true SE188800C1 (enrdf_load_html_response) | 1963-01-01 |
Family
ID=41975714
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE188800D SE188800C1 (enrdf_load_html_response) |
Country Status (1)
| Country | Link |
|---|---|
| SE (1) | SE188800C1 (enrdf_load_html_response) |
-
0
- SE SE188800D patent/SE188800C1/sv unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO132821B (enrdf_load_html_response) | ||
| US2938845A (en) | Superheating in a boiling water reactor | |
| US3137635A (en) | Fuel elements for nuclear reactors | |
| US3629066A (en) | Fuel assembly for nuclear reactors and helical spacers have bundles of fuel pins | |
| US4285771A (en) | Nuclear core and fuel assemblies | |
| US3291696A (en) | Fuel element for high temperature and high power density nuclear reactor | |
| US3941654A (en) | Tubular fuel cluster | |
| US4526741A (en) | Fuel assembly for the production of tritium in light water reactors | |
| US3212991A (en) | Continuous support fuel rod spacer system | |
| US3108053A (en) | Heat transfer systems for nuclear reactors | |
| SE188800C1 (enrdf_load_html_response) | ||
| US3179570A (en) | Thermal exchange of the fuel elements in nuclear reactor | |
| US2863814A (en) | Neutronic reactor fuel element | |
| US3755077A (en) | Nuclear fuel assembly | |
| US3137637A (en) | Fuel elements for nuclear reactors | |
| US3116213A (en) | Heat exchange elements suitable for use as fuel elements for nuclear reactors | |
| GB920256A (en) | Improvements in fuel elements for nuclear reactors | |
| US3345267A (en) | Fuel rod structure | |
| GB1054933A (enrdf_load_html_response) | ||
| US3324008A (en) | Fuel rod structure | |
| US3093565A (en) | Nuclear reactors | |
| GB1010524A (en) | Improvements in elemental fuel cells for heavy water moderated nuclear reactors | |
| US3658645A (en) | Nuclear reactors | |
| US3212987A (en) | Neutronic reactor with interlocking diffuser end grid | |
| GB978737A (en) | Improvements in fuel rods for nuclear reactors |