PH31068A - Process for the production of terephthalic acid. - Google Patents
Process for the production of terephthalic acid.Info
- Publication number
- PH31068A PH31068A PH43989A PH43989A PH31068A PH 31068 A PH31068 A PH 31068A PH 43989 A PH43989 A PH 43989A PH 43989 A PH43989 A PH 43989A PH 31068 A PH31068 A PH 31068A
- Authority
- PH
- Philippines
- Prior art keywords
- production
- terephthalic acid
- terephthalic
- acid
- Prior art date
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title 2
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919104776A GB9104776D0 (en) | 1991-03-07 | 1991-03-07 | Process for the production of terephthalic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH31068A true PH31068A (en) | 1998-02-05 |
Family
ID=34044105
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH43989A PH31068A (en) | 1991-03-07 | 1992-02-28 | Process for the production of terephthalic acid. |
Country Status (2)
| Country | Link |
|---|---|
| MY (2) | MY142064A (en) |
| PH (1) | PH31068A (en) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7955814B2 (en) | 2003-01-17 | 2011-06-07 | Danisco A/S | Method |
| US7955813B2 (en) | 2003-01-17 | 2011-06-07 | Danisco, A/S | Method of using lipid acyltransferase |
| US7960150B2 (en) | 2007-01-25 | 2011-06-14 | Danisco A/S | Production of a lipid acyltransferase from transformed Bacillus licheniformis cells |
| US7972638B2 (en) | 1998-07-21 | 2011-07-05 | Danisco A/S | Foodstuff |
| US8012732B2 (en) | 2004-03-12 | 2011-09-06 | Danisco A/S | Fungal lypolytic and amylase enzyme composition and methods using the same |
| US8030044B2 (en) | 2003-12-24 | 2011-10-04 | Danisco A/S | Lipid acyltransferases |
| USRE43135E1 (en) | 2001-05-18 | 2012-01-24 | Danisco A/S | Method of improving dough and bread quality |
| US8192782B2 (en) | 2004-07-16 | 2012-06-05 | Danisco A/S | Enzymatic oil-degumming method |
| US8440435B2 (en) | 2003-12-24 | 2013-05-14 | Dupont Nutrition Biosciences Aps | Method for reducing 1,2-diglyceride content of an edible oil |
| US8652809B2 (en) | 2007-08-17 | 2014-02-18 | Dupont Nutrition Biosciences Aps | Method for producing ultra-heat treatment milk |
-
1992
- 1992-02-28 PH PH43989A patent/PH31068A/en unknown
- 1992-03-06 MY MYPI92000363A patent/MY142064A/en unknown
-
1997
- 1997-01-03 MY MYPI9700019 patent/MY121931A/en unknown
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7972638B2 (en) | 1998-07-21 | 2011-07-05 | Danisco A/S | Foodstuff |
| US8163315B2 (en) | 1998-07-21 | 2012-04-24 | Danisco A/S | Foodstuff |
| USRE43135E1 (en) | 2001-05-18 | 2012-01-24 | Danisco A/S | Method of improving dough and bread quality |
| US8278062B2 (en) | 2003-01-14 | 2012-10-02 | Dupont Nutrition Biosciences Aps | Method of using lipid acyltransferase |
| US7955814B2 (en) | 2003-01-17 | 2011-06-07 | Danisco A/S | Method |
| US7955813B2 (en) | 2003-01-17 | 2011-06-07 | Danisco, A/S | Method of using lipid acyltransferase |
| US8030044B2 (en) | 2003-12-24 | 2011-10-04 | Danisco A/S | Lipid acyltransferases |
| US8440435B2 (en) | 2003-12-24 | 2013-05-14 | Dupont Nutrition Biosciences Aps | Method for reducing 1,2-diglyceride content of an edible oil |
| US8012732B2 (en) | 2004-03-12 | 2011-09-06 | Danisco A/S | Fungal lypolytic and amylase enzyme composition and methods using the same |
| US8192782B2 (en) | 2004-07-16 | 2012-06-05 | Danisco A/S | Enzymatic oil-degumming method |
| US8535900B2 (en) | 2004-07-16 | 2013-09-17 | Dupont Nutrition Biosciences Aps | Lipolytic enzyme uses thereof in the food industry |
| US8889371B2 (en) | 2004-07-16 | 2014-11-18 | Dupont Nutrition Biosciences Aps | Lipolytic enzyme: uses thereof in the food industry |
| US7960150B2 (en) | 2007-01-25 | 2011-06-14 | Danisco A/S | Production of a lipid acyltransferase from transformed Bacillus licheniformis cells |
| US8652809B2 (en) | 2007-08-17 | 2014-02-18 | Dupont Nutrition Biosciences Aps | Method for producing ultra-heat treatment milk |
Also Published As
| Publication number | Publication date |
|---|---|
| MY121931A (en) | 2006-03-31 |
| MY142064A (en) | 2010-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EG19876A (en) | Process for the production of terephthalic acid | |
| EP0498591A3 (en) | Process for the production of terephthalic acid | |
| SG52279A1 (en) | Process for the production of purified terephthalic acid | |
| SG43676A1 (en) | Process for the production of acetic acid | |
| HU9200253D0 (en) | Process for the production of amino acid derivatves | |
| ZA9610202B (en) | Process for the production of terephthalic acid | |
| HU9200392D0 (en) | Process for the production of new beta-amino-alpha-hydroxycarboxyl-acid | |
| HU9201929D0 (en) | Process for the production of imidazo-diazepines | |
| EP0439007A3 (en) | Process for producing 2,6-naphthalene dicarboxylic acid | |
| EP0551596A3 (en) | Process for producing naphtalenedicarboxylic acid | |
| PH31068A (en) | Process for the production of terephthalic acid. | |
| EP0502384A3 (en) | Process for the recovery of adipic acid | |
| HU9201714D0 (en) | Process for the production of betha-ketocarbonic acid esthers | |
| IL84620A0 (en) | Process for the manufacture of terephthalic acid | |
| ZA929873B (en) | Process for the manufacture of 2-alkoxymethylacrolein. | |
| ZA929443B (en) | Novel process for preparing 4-amino-5-hexenoic acid. | |
| HUT65728A (en) | Improved process for the production of glycosil-transpherases | |
| AU1255492A (en) | Process for the production of cyanoacetic acid | |
| HU911081D0 (en) | Process for the fermentative production of d-izocitric acid | |
| EP0514885A3 (en) | New process for the production of 7-amino-3-azidomethyl-3-cephem-4-carboxylic acid | |
| EP0510391A3 (en) | Process for the production of polyphenylenethers | |
| HU910171D0 (en) | Process for the production of pyrazole-carbonic acid derivatives | |
| EG20633A (en) | Process for the production of purified terephthalic acid | |
| EP0534412A3 (en) | Process for the production of 4-chloro-trichloro-methyl benzene | |
| GB9211441D0 (en) | Process for the production of purified terephthalic acid |