KR20180043580A - 생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물 - Google Patents
생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물 Download PDFInfo
- Publication number
- KR20180043580A KR20180043580A KR1020160136458A KR20160136458A KR20180043580A KR 20180043580 A KR20180043580 A KR 20180043580A KR 1020160136458 A KR1020160136458 A KR 1020160136458A KR 20160136458 A KR20160136458 A KR 20160136458A KR 20180043580 A KR20180043580 A KR 20180043580A
- Authority
- KR
- South Korea
- Prior art keywords
- composition
- extract
- comparative example
- comparative
- atopic dermatitis
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 121
- 239000000284 extract Substances 0.000 title claims abstract description 62
- 208000002874 Acne Vulgaris Diseases 0.000 title claims abstract description 45
- 206010000496 acne Diseases 0.000 title claims abstract description 45
- 206010012438 Dermatitis atopic Diseases 0.000 title claims abstract description 38
- 201000008937 atopic dermatitis Diseases 0.000 title claims abstract description 38
- 239000002537 cosmetic Substances 0.000 claims abstract description 119
- 241000411851 herbal medicine Species 0.000 claims abstract description 24
- 230000003020 moisturizing effect Effects 0.000 claims abstract description 23
- 241001600434 Plectroglyphidodon lacrymatus Species 0.000 claims abstract description 20
- 241000191967 Staphylococcus aureus Species 0.000 claims abstract description 13
- 230000002087 whitening effect Effects 0.000 claims abstract description 13
- 241000186427 Cutibacterium acnes Species 0.000 claims abstract description 12
- 229940055019 propionibacterium acne Drugs 0.000 claims abstract description 12
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229910052737 gold Inorganic materials 0.000 claims abstract description 9
- 239000010931 gold Substances 0.000 claims abstract description 9
- 240000001972 Gardenia jasminoides Species 0.000 claims abstract 2
- 239000003814 drug Substances 0.000 claims description 25
- 230000000694 effects Effects 0.000 claims description 24
- 229940079593 drug Drugs 0.000 claims description 22
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 claims description 14
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- 229910052732 germanium Inorganic materials 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 239000007864 aqueous solution Substances 0.000 claims description 8
- 239000004615 ingredient Substances 0.000 claims description 8
- 238000011282 treatment Methods 0.000 claims description 7
- 229940058015 1,3-butylene glycol Drugs 0.000 claims description 6
- 235000019437 butane-1,3-diol Nutrition 0.000 claims description 6
- 239000002994 raw material Substances 0.000 claims description 4
- 229910052878 cordierite Inorganic materials 0.000 claims description 3
- JSKIRARMQDRGJZ-UHFFFAOYSA-N dimagnesium dioxido-bis[(1-oxido-3-oxo-2,4,6,8,9-pentaoxa-1,3-disila-5,7-dialuminabicyclo[3.3.1]nonan-7-yl)oxy]silane Chemical compound [Mg++].[Mg++].[O-][Si]([O-])(O[Al]1O[Al]2O[Si](=O)O[Si]([O-])(O1)O2)O[Al]1O[Al]2O[Si](=O)O[Si]([O-])(O1)O2 JSKIRARMQDRGJZ-UHFFFAOYSA-N 0.000 claims description 3
- 239000000843 powder Substances 0.000 claims description 2
- 241000234314 Zingiber Species 0.000 claims 2
- 235000006886 Zingiber officinale Nutrition 0.000 claims 2
- 235000008397 ginger Nutrition 0.000 claims 2
- 230000002265 prevention Effects 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 124
- 206010003645 Atopy Diseases 0.000 abstract description 16
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 12
- 230000002195 synergetic effect Effects 0.000 abstract description 3
- 231100000676 disease causative agent Toxicity 0.000 abstract description 2
- 230000017066 negative regulation of growth Effects 0.000 abstract description 2
- 230000000052 comparative effect Effects 0.000 description 193
- 210000003491 skin Anatomy 0.000 description 51
- 239000000344 soap Substances 0.000 description 28
- 239000003921 oil Substances 0.000 description 24
- 235000019198 oils Nutrition 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 23
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 21
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 17
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- -1 fatty acid ester Chemical class 0.000 description 15
- 210000004027 cell Anatomy 0.000 description 13
- 239000006071 cream Substances 0.000 description 13
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 12
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 12
- 230000006872 improvement Effects 0.000 description 12
- 235000014113 dietary fatty acids Nutrition 0.000 description 11
- 239000000194 fatty acid Substances 0.000 description 11
- 229930195729 fatty acid Natural products 0.000 description 11
- 210000002374 sebum Anatomy 0.000 description 11
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 10
- VCUFZILGIRCDQQ-KRWDZBQOSA-N N-[[(5S)-2-oxo-3-(2-oxo-3H-1,3-benzoxazol-6-yl)-1,3-oxazolidin-5-yl]methyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C1O[C@H](CN1C1=CC2=C(NC(O2)=O)C=C1)CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F VCUFZILGIRCDQQ-KRWDZBQOSA-N 0.000 description 10
- 101710155857 C-C motif chemokine 2 Proteins 0.000 description 9
- 102000000018 Chemokine CCL2 Human genes 0.000 description 9
- 210000002510 keratinocyte Anatomy 0.000 description 9
- 150000003431 steroids Chemical class 0.000 description 9
- 102000004890 Interleukin-8 Human genes 0.000 description 8
- 108090001007 Interleukin-8 Proteins 0.000 description 8
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 8
- 235000011187 glycerol Nutrition 0.000 description 8
- XKTZWUACRZHVAN-VADRZIEHSA-N interleukin-8 Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@@H](NC(C)=O)CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CCSC)C(=O)N1[C@H](CCC1)C(=O)N1[C@H](CCC1)C(=O)N[C@@H](C)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC(O)=CC=1)C(=O)N[C@H](CO)C(=O)N1[C@H](CCC1)C(N)=O)C1=CC=CC=C1 XKTZWUACRZHVAN-VADRZIEHSA-N 0.000 description 8
- 229940096397 interleukin-8 Drugs 0.000 description 8
- 102000004127 Cytokines Human genes 0.000 description 7
- 108090000695 Cytokines Proteins 0.000 description 7
- 238000000605 extraction Methods 0.000 description 7
- 239000006210 lotion Substances 0.000 description 7
- 244000111489 Gardenia augusta Species 0.000 description 6
- 102000004889 Interleukin-6 Human genes 0.000 description 6
- 108090001005 Interleukin-6 Proteins 0.000 description 6
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 6
- 230000000845 anti-microbial effect Effects 0.000 description 6
- 238000012790 confirmation Methods 0.000 description 6
- 210000003780 hair follicle Anatomy 0.000 description 6
- 239000003755 preservative agent Substances 0.000 description 6
- 229960004063 propylene glycol Drugs 0.000 description 6
- 235000013772 propylene glycol Nutrition 0.000 description 6
- 230000028327 secretion Effects 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- 206010061218 Inflammation Diseases 0.000 description 5
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 5
- JAWMENYCRQKKJY-UHFFFAOYSA-N [3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-ylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]methanone Chemical compound N1N=NC=2CN(CCC=21)CC1=NOC2(C1)CCN(CC2)C(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F JAWMENYCRQKKJY-UHFFFAOYSA-N 0.000 description 5
- 208000006673 asthma Diseases 0.000 description 5
- 230000001965 increasing effect Effects 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000002609 medium Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 206010033733 Papule Diseases 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- POJWUDADGALRAB-UHFFFAOYSA-N allantoin Chemical compound NC(=O)NC1NC(=O)NC1=O POJWUDADGALRAB-UHFFFAOYSA-N 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 230000006870 function Effects 0.000 description 4
- 230000004054 inflammatory process Effects 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 230000002335 preservative effect Effects 0.000 description 4
- 210000001732 sebaceous gland Anatomy 0.000 description 4
- PRAKJMSDJKAYCZ-UHFFFAOYSA-N squalane Chemical compound CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C PRAKJMSDJKAYCZ-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 3
- 241000723353 Chrysanthemum Species 0.000 description 3
- 235000007516 Chrysanthemum Nutrition 0.000 description 3
- 244000247747 Coptis groenlandica Species 0.000 description 3
- 235000002991 Coptis groenlandica Nutrition 0.000 description 3
- 206010012735 Diarrhoea Diseases 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 206010016654 Fibrosis Diseases 0.000 description 3
- 108010076876 Keratins Proteins 0.000 description 3
- 102000011782 Keratins Human genes 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 206010037660 Pyrexia Diseases 0.000 description 3
- 229920002125 Sokalan® Polymers 0.000 description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 3
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 3
- 229960003957 dexamethasone Drugs 0.000 description 3
- 230000007613 environmental effect Effects 0.000 description 3
- 239000000686 essence Substances 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 238000004299 exfoliation Methods 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 230000004761 fibrosis Effects 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 235000019634 flavors Nutrition 0.000 description 3
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 3
- 229940088597 hormone Drugs 0.000 description 3
- 239000005556 hormone Substances 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 3
- 239000002085 irritant Substances 0.000 description 3
- 231100000021 irritant Toxicity 0.000 description 3
- 230000003902 lesion Effects 0.000 description 3
- 150000002632 lipids Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 3
- 235000019271 petrolatum Nutrition 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 239000011148 porous material Substances 0.000 description 3
- 238000011321 prophylaxis Methods 0.000 description 3
- 239000008213 purified water Substances 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 231100000241 scar Toxicity 0.000 description 3
- 229940124597 therapeutic agent Drugs 0.000 description 3
- CUNWUEBNSZSNRX-RKGWDQTMSA-N (2r,3r,4r,5s)-hexane-1,2,3,4,5,6-hexol;(z)-octadec-9-enoic acid Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O CUNWUEBNSZSNRX-RKGWDQTMSA-N 0.000 description 2
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- POJWUDADGALRAB-PVQJCKRUSA-N Allantoin Natural products NC(=O)N[C@@H]1NC(=O)NC1=O POJWUDADGALRAB-PVQJCKRUSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 2
- 102000019034 Chemokines Human genes 0.000 description 2
- 108010012236 Chemokines Proteins 0.000 description 2
- 108010066551 Cholestenone 5 alpha-Reductase Proteins 0.000 description 2
- 208000032544 Cicatrix Diseases 0.000 description 2
- 241001112695 Clostridiales Species 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- 206010013786 Dry skin Diseases 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 206010020751 Hypersensitivity Diseases 0.000 description 2
- 102000004388 Interleukin-4 Human genes 0.000 description 2
- 108090000978 Interleukin-4 Proteins 0.000 description 2
- 239000004166 Lanolin Substances 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 208000003251 Pruritus Diseases 0.000 description 2
- 241000238711 Pyroglyphidae Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 244000204900 Talipariti tiliaceum Species 0.000 description 2
- MUMGGOZAMZWBJJ-DYKIIFRCSA-N Testostosterone Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 MUMGGOZAMZWBJJ-DYKIIFRCSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229960000458 allantoin Drugs 0.000 description 2
- 208000026935 allergic disease Diseases 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 210000003056 antler Anatomy 0.000 description 2
- 235000013871 bee wax Nutrition 0.000 description 2
- 239000012166 beeswax Substances 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 229960000541 cetyl alcohol Drugs 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 235000012343 cottonseed oil Nutrition 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 230000037336 dry skin Effects 0.000 description 2
- 230000002500 effect on skin Effects 0.000 description 2
- 210000002615 epidermis Anatomy 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 239000012091 fetal bovine serum Substances 0.000 description 2
- 210000002950 fibroblast Anatomy 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 229940075507 glyceryl monostearate Drugs 0.000 description 2
- 229940046533 house dust mites Drugs 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 235000019388 lanolin Nutrition 0.000 description 2
- 229940039717 lanolin Drugs 0.000 description 2
- 239000000944 linseed oil Substances 0.000 description 2
- 235000021388 linseed oil Nutrition 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 229940062713 mite extract Drugs 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- JXTPJDDICSTXJX-UHFFFAOYSA-N n-Triacontane Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCC JXTPJDDICSTXJX-UHFFFAOYSA-N 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 230000001575 pathological effect Effects 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 150000003077 polyols Chemical class 0.000 description 2
- 239000001818 polyoxyethylene sorbitan monostearate Substances 0.000 description 2
- 235000010989 polyoxyethylene sorbitan monostearate Nutrition 0.000 description 2
- 229920000136 polysorbate Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000037387 scars Effects 0.000 description 2
- 229960005078 sorbitan sesquioleate Drugs 0.000 description 2
- 229940032094 squalane Drugs 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 208000003265 stomatitis Diseases 0.000 description 2
- 210000000434 stratum corneum Anatomy 0.000 description 2
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 230000036572 transepidermal water loss Effects 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000000341 volatile oil Substances 0.000 description 2
- 239000003871 white petrolatum Substances 0.000 description 2
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- NVKAWKQGWWIWPM-ABEVXSGRSA-N 17-β-hydroxy-5-α-Androstan-3-one Chemical compound C1C(=O)CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CC[C@H]21 NVKAWKQGWWIWPM-ABEVXSGRSA-N 0.000 description 1
- COPFWAGBXIWZNK-UHFFFAOYSA-N 2,3-bis(6-methylheptanoyloxy)propyl 6-methylheptanoate Chemical compound CC(C)CCCCC(=O)OCC(OC(=O)CCCCC(C)C)COC(=O)CCCCC(C)C COPFWAGBXIWZNK-UHFFFAOYSA-N 0.000 description 1
- SPSPIUSUWPLVKD-UHFFFAOYSA-N 2,3-dibutyl-6-methylphenol Chemical compound CCCCC1=CC=C(C)C(O)=C1CCCC SPSPIUSUWPLVKD-UHFFFAOYSA-N 0.000 description 1
- QCDWFXQBSFUVSP-UHFFFAOYSA-N 2-phenoxyethanol Chemical compound OCCOC1=CC=CC=C1 QCDWFXQBSFUVSP-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- CYDQOEWLBCCFJZ-UHFFFAOYSA-N 4-(4-fluorophenyl)oxane-4-carboxylic acid Chemical compound C=1C=C(F)C=CC=1C1(C(=O)O)CCOCC1 CYDQOEWLBCCFJZ-UHFFFAOYSA-N 0.000 description 1
- HBTAOSGHCXUEKI-UHFFFAOYSA-N 4-chloro-n,n-dimethyl-3-nitrobenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 HBTAOSGHCXUEKI-UHFFFAOYSA-N 0.000 description 1
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-M 4-hydroxybenzoate Chemical compound OC1=CC=C(C([O-])=O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-M 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- 206010000087 Abdominal pain upper Diseases 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 206010000871 Acute monocytic leukaemia Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- APKFDSVGJQXUKY-KKGHZKTASA-N Amphotericin-B Natural products O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1C=CC=CC=CC=CC=CC=CC=C[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 APKFDSVGJQXUKY-KKGHZKTASA-N 0.000 description 1
- 241001480043 Arthrodermataceae Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 102100031151 C-C chemokine receptor type 2 Human genes 0.000 description 1
- 101710149815 C-C chemokine receptor type 2 Proteins 0.000 description 1
- 101150083327 CCR2 gene Proteins 0.000 description 1
- 101100504320 Caenorhabditis elegans mcp-1 gene Proteins 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000723436 Chamaecyparis obtusa Species 0.000 description 1
- 108050000299 Chemokine receptor Proteins 0.000 description 1
- 102000009410 Chemokine receptor Human genes 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- 241000037740 Coptis chinensis Species 0.000 description 1
- 241000218203 Coptis japonica Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- XMSXQFUHVRWGNA-UHFFFAOYSA-N Decamethylcyclopentasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 XMSXQFUHVRWGNA-UHFFFAOYSA-N 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 1
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 description 1
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 description 1
- 206010015967 Eye swelling Diseases 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 235000018958 Gardenia augusta Nutrition 0.000 description 1
- CMBYOWLFQAFZCP-UHFFFAOYSA-N Hexyl dodecanoate Chemical compound CCCCCCCCCCCC(=O)OCCCCCC CMBYOWLFQAFZCP-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- 102000003816 Interleukin-13 Human genes 0.000 description 1
- 108090000176 Interleukin-13 Proteins 0.000 description 1
- 206010023126 Jaundice Diseases 0.000 description 1
- 239000002211 L-ascorbic acid Substances 0.000 description 1
- 235000000069 L-ascorbic acid Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000589902 Leptospira Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 239000004909 Moisturizer Substances 0.000 description 1
- 208000035489 Monocytic Acute Leukemia Diseases 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 241000123069 Ocyurus chrysurus Species 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 208000012868 Overgrowth Diseases 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- 235000019482 Palm oil Nutrition 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- 241000972673 Phellodendron amurense Species 0.000 description 1
- 241000424774 Plagiorhegma dubium Species 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 239000012980 RPMI-1640 medium Substances 0.000 description 1
- 206010037888 Rash pustular Diseases 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 206010057190 Respiratory tract infections Diseases 0.000 description 1
- 239000006146 Roswell Park Memorial Institute medium Substances 0.000 description 1
- 240000004534 Scutellaria baicalensis Species 0.000 description 1
- 235000017089 Scutellaria baicalensis Nutrition 0.000 description 1
- 206010052891 Skin bacterial infection Diseases 0.000 description 1
- 229920002385 Sodium hyaluronate Polymers 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 102000004887 Transforming Growth Factor beta Human genes 0.000 description 1
- 108090001012 Transforming Growth Factor beta Proteins 0.000 description 1
- 208000036029 Uterine contractions during pregnancy Diseases 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 239000013566 allergen Substances 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- APKFDSVGJQXUKY-INPOYWNPSA-N amphotericin B Chemical compound O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 APKFDSVGJQXUKY-INPOYWNPSA-N 0.000 description 1
- 229960003942 amphotericin b Drugs 0.000 description 1
- 239000003098 androgen Substances 0.000 description 1
- 230000001548 androgenic effect Effects 0.000 description 1
- 229960003473 androstanolone Drugs 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 229960002903 benzyl benzoate Drugs 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 230000023555 blood coagulation Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000006085 branching agent Substances 0.000 description 1
- 230000010083 bronchial hyperresponsiveness Effects 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- CZBZUDVBLSSABA-UHFFFAOYSA-N butylated hydroxyanisole Chemical compound COC1=CC=C(O)C(C(C)(C)C)=C1.COC1=CC=C(O)C=C1C(C)(C)C CZBZUDVBLSSABA-UHFFFAOYSA-N 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 229960001631 carbomer Drugs 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000002612 cardiopulmonary effect Effects 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000006143 cell culture medium Substances 0.000 description 1
- 230000010307 cell transformation Effects 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229940082500 cetostearyl alcohol Drugs 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000005827 chlorofluoro hydrocarbons Chemical class 0.000 description 1
- 208000037976 chronic inflammation Diseases 0.000 description 1
- 208000037893 chronic inflammatory disorder Diseases 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 239000004035 construction material Substances 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- DNTGGZPQPQTDQF-XBXARRHUSA-N crotamiton Chemical compound C/C=C/C(=O)N(CC)C1=CC=CC=C1C DNTGGZPQPQTDQF-XBXARRHUSA-N 0.000 description 1
- 229960003338 crotamiton Drugs 0.000 description 1
- 229940086555 cyclomethicone Drugs 0.000 description 1
- 238000013016 damping Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000004925 denaturation Methods 0.000 description 1
- 230000036425 denaturation Effects 0.000 description 1
- 230000037304 dermatophytes Effects 0.000 description 1
- 210000004207 dermis Anatomy 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 229940031578 diisopropyl adipate Drugs 0.000 description 1
- 229940031569 diisopropyl sebacate Drugs 0.000 description 1
- 229940008099 dimethicone Drugs 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- XFKBBSZEQRFVSL-UHFFFAOYSA-N dipropan-2-yl decanedioate Chemical compound CC(C)OC(=O)CCCCCCCCC(=O)OC(C)C XFKBBSZEQRFVSL-UHFFFAOYSA-N 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 235000011869 dried fruits Nutrition 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 208000001848 dysentery Diseases 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 230000002996 emotional effect Effects 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 210000000981 epithelium Anatomy 0.000 description 1
- 238000002481 ethanol extraction Methods 0.000 description 1
- 229940093499 ethyl acetate Drugs 0.000 description 1
- 210000002744 extracellular matrix Anatomy 0.000 description 1
- 210000000887 face Anatomy 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 229960005150 glycerol Drugs 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 230000036074 healthy skin Effects 0.000 description 1
- 208000014617 hemorrhoid Diseases 0.000 description 1
- 235000008216 herbs Nutrition 0.000 description 1
- 229940100463 hexyl laurate Drugs 0.000 description 1
- 238000007602 hot air drying Methods 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical class C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 230000008105 immune reaction Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical class OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 230000007803 itching Effects 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 208000019423 liver disease Diseases 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 230000013011 mating Effects 0.000 description 1
- 210000002752 melanocyte Anatomy 0.000 description 1
- 230000009245 menopause Effects 0.000 description 1
- 244000000010 microbial pathogen Species 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 230000001333 moisturizer Effects 0.000 description 1
- 210000001616 monocyte Anatomy 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 231100000957 no side effect Toxicity 0.000 description 1
- 230000037311 normal skin Effects 0.000 description 1
- KSCKTBJJRVPGKM-UHFFFAOYSA-N octan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCCCCCC[O-].CCCCCCCC[O-].CCCCCCCC[O-].CCCCCCCC[O-] KSCKTBJJRVPGKM-UHFFFAOYSA-N 0.000 description 1
- 239000003129 oil well Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 229940124595 oriental medicine Drugs 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 238000012261 overproduction Methods 0.000 description 1
- 239000002540 palm oil Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 229960005323 phenoxyethanol Drugs 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229950008882 polysorbate Drugs 0.000 description 1
- 229940068977 polysorbate 20 Drugs 0.000 description 1
- 229940113124 polysorbate 60 Drugs 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000009993 protective function Effects 0.000 description 1
- 208000008128 pulmonary tuberculosis Diseases 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 208000029561 pustule Diseases 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 229940071089 sarcosinate Drugs 0.000 description 1
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical compound C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 1
- 230000037390 scarring Effects 0.000 description 1
- 210000004378 sebocyte Anatomy 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 230000037380 skin damage Effects 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 230000004215 skin function Effects 0.000 description 1
- 206010040872 skin infection Diseases 0.000 description 1
- 230000036548 skin texture Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 229940010747 sodium hyaluronate Drugs 0.000 description 1
- 239000001540 sodium lactate Substances 0.000 description 1
- 229940005581 sodium lactate Drugs 0.000 description 1
- 235000011088 sodium lactate Nutrition 0.000 description 1
- 229940045920 sodium pyrrolidone carboxylate Drugs 0.000 description 1
- YWIVKILSMZOHHF-QJZPQSOGSA-N sodium;(2s,3s,4s,5r,6r)-6-[(2s,3r,4r,5s,6r)-3-acetamido-2-[(2s,3s,4r,5r,6r)-6-[(2r,3r,4r,5s,6r)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2- Chemical compound [Na+].CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 YWIVKILSMZOHHF-QJZPQSOGSA-N 0.000 description 1
- HYRLWUFWDYFEES-UHFFFAOYSA-M sodium;2-oxopyrrolidine-1-carboxylate Chemical compound [Na+].[O-]C(=O)N1CCCC1=O HYRLWUFWDYFEES-UHFFFAOYSA-M 0.000 description 1
- 239000001587 sorbitan monostearate Substances 0.000 description 1
- 235000011076 sorbitan monostearate Nutrition 0.000 description 1
- 229940035048 sorbitan monostearate Drugs 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- 229960005322 streptomycin Drugs 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 210000004003 subcutaneous fat Anatomy 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 230000008093 supporting effect Effects 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229960003604 testosterone Drugs 0.000 description 1
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontyl alcohol Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 1
- ZRKFYGHZFMAOKI-QMGMOQQFSA-N tgfbeta Chemical compound C([C@H](NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCSC)C(C)C)[C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(O)=O)C1=CC=C(O)C=C1 ZRKFYGHZFMAOKI-QMGMOQQFSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 230000006032 tissue transformation Effects 0.000 description 1
- 150000003611 tocopherol derivatives Chemical class 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 210000003708 urethra Anatomy 0.000 description 1
- 210000003932 urinary bladder Anatomy 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 238000009777 vacuum freeze-drying Methods 0.000 description 1
- 229940099259 vaseline Drugs 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 230000001018 virulence Effects 0.000 description 1
- 238000003809 water extraction Methods 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000000230 xanthan gum Substances 0.000 description 1
- 229920001285 xanthan gum Polymers 0.000 description 1
- 235000010493 xanthan gum Nutrition 0.000 description 1
- 229940082509 xanthan gum Drugs 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Images
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K36/00—Medicinal preparations of undetermined constitution containing material from algae, lichens, fungi or plants, or derivatives thereof, e.g. traditional herbal medicines
- A61K36/18—Magnoliophyta (angiosperms)
- A61K36/185—Magnoliopsida (dicotyledons)
- A61K36/53—Lamiaceae or Labiatae (Mint family), e.g. thyme, rosemary or lavender
- A61K36/539—Scutellaria (skullcap)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K36/00—Medicinal preparations of undetermined constitution containing material from algae, lichens, fungi or plants, or derivatives thereof, e.g. traditional herbal medicines
- A61K36/13—Coniferophyta (gymnosperms)
- A61K36/14—Cupressaceae (Cypress family), e.g. juniper or cypress
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K36/00—Medicinal preparations of undetermined constitution containing material from algae, lichens, fungi or plants, or derivatives thereof, e.g. traditional herbal medicines
- A61K36/18—Magnoliophyta (angiosperms)
- A61K36/185—Magnoliopsida (dicotyledons)
- A61K36/71—Ranunculaceae (Buttercup family), e.g. larkspur, hepatica, hydrastis, columbine or goldenseal
- A61K36/718—Coptis (goldthread)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K36/00—Medicinal preparations of undetermined constitution containing material from algae, lichens, fungi or plants, or derivatives thereof, e.g. traditional herbal medicines
- A61K36/18—Magnoliophyta (angiosperms)
- A61K36/185—Magnoliopsida (dicotyledons)
- A61K36/74—Rubiaceae (Madder family)
- A61K36/744—Gardenia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K36/00—Medicinal preparations of undetermined constitution containing material from algae, lichens, fungi or plants, or derivatives thereof, e.g. traditional herbal medicines
- A61K36/18—Magnoliophyta (angiosperms)
- A61K36/185—Magnoliopsida (dicotyledons)
- A61K36/75—Rutaceae (Rue family)
- A61K36/756—Phellodendron, e.g. corktree
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/96—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution
- A61K8/97—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution from algae, fungi, lichens or plants; from derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/96—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution
- A61K8/97—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution from algae, fungi, lichens or plants; from derivatives thereof
- A61K8/9755—Gymnosperms [Coniferophyta]
- A61K8/9761—Cupressaceae [Cypress family], e.g. juniper or cypress
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q17/00—Barrier preparations; Preparations brought into direct contact with the skin for affording protection against external influences, e.g. sunlight, X-rays or other harmful rays, corrosive materials, bacteria or insect stings
- A61Q17/005—Antimicrobial preparations
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q19/00—Preparations for care of the skin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2300/00—Mixtures or combinations of active ingredients, wherein at least one active ingredient is fully defined in groups A61K31/00 - A61K41/00
-
- Y10S514/857—
Landscapes
- Health & Medical Sciences (AREA)
- Natural Medicines & Medicinal Plants (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Microbiology (AREA)
- Biotechnology (AREA)
- Engineering & Computer Science (AREA)
- Botany (AREA)
- Mycology (AREA)
- Epidemiology (AREA)
- Pharmacology & Pharmacy (AREA)
- Medical Informatics (AREA)
- Alternative & Traditional Medicine (AREA)
- Medicinal Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Dermatology (AREA)
- Neurosurgery (AREA)
- Birds (AREA)
- Cosmetics (AREA)
Abstract
본 발명은 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물, 피부보습, 여드름, 아토피 피부염 또는 피부 각질 개선 효과가 있는 화장료 조성물에 관한 것이다. 상기 생약 혼합물의 추출물과 편백 오일이 혼합된 조성물은 여드름과 아토피의 원인균인 프로피오니박테리움 아크네스(Propionibacterium acnes)와 스태필로코쿠스 아우레우스(Staphylococcus aureus)의 생육저지에 대한 상승효과가 우수하여 다양한 형태의 약학적 조성물, 피부외용제, 화장료 제품으로 용이하게 이용할 수 있다.
Description
본 발명은 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물에 관한 것이다.
인체에 있어서 피부는 외부환경으로부터 생체를 보호하는 보호막의 기능을 하는 기관으로서, 인체 내의 생체성분 즉, 물이나 전해질 등의 손실을 방지하는 동시에 외부로부터 유해물질이 인체 내로 침입하지 못하도록 하는 역할을 한다. 이러한 피부는 크게 표피층, 진피층 및 피하지방층으로 구분된다. 표피층은 각질세포와 멜라닌세포로 구성되는데, 피부 최외곽의 각질세포층은 외부환경과 직접 접촉하기 때문에 물리적, 화학적 혹은 물질의 투과에 대한 강한 저항성이 요구되며, 인체로부터 외부로 수분이 손실되는 것을 막아줌과 동시에 자체로도 적당한 수분을 보유함으로써 유연성을 유지하여야 한다.
일반적으로 피부의 수분량은 진피층에서는 70% 정도이나 표피층으로 갈수록 감소하여 각질세포층에서는 약 10 내지 30%가 된다. 진피층에서 공급된 물은 주로 수동적 확산에 의해 각질층 상부로 이동하며 최종적으로는 외부로 배출된다. 이를 경피수분손실(Trans Epidermal Water Loss : TEWL)이라 하며, 이러한 경피수분손실을 적절한 수준으로 유지시켜주는 것이 각질세포층의 지질막 성분인 피지성분과 표피지질이라고 알려져 있다. 그리고 각질세포층에는 천연보습 인자(Natural Moisturizing Factor : NMF)라고 하는 친수성의 수분 보유능을 가진 물질이 존재하여 피부의 보습에 중요한 역할을 담당하는 것으로 알려져 있다. 정상적인 각질세포층의 수분이 10 내지 30% 정도가 유지되면 피부는 매끄럽고 부드러우며, 신체 보호기능을 정상적으로 발휘하게 된다.
그러나 각질세포층의 수분함량이 10% 이하가 되면 피부는 거칠어지고 신체의 보호기능을 잃게 되어 노화현상이 일어난다. 예를 들어, 건성피부의 경우에는 각질세포의 결집력이 약화되어 피부표면으로부터 비늘조각과 같이 각질세포가 허옇게 벗겨져 나오는 스케일링(Scaling) 현상이 나타나는 바, 이와 같이 피부가 건성화되는 것은 각질세포층의 수분함량이 정상피부에 비해 적기 때문이다. 이 밖에, 건강한 피부라 할지라도 혹독한 외부환경 즉, 바람, 추운 날씨, 햇빛, 세안, 면도 등에 의해 수분 부족현상이 일어나 피부상태가 나빠지기도 한다.
따라서 피부의 각질세포층의 수분함량을 적절히 유지하는 것은 매우 중요하다. 이를 위하여 화장품에는 피지와 유사한 성분이나 NMF 성분, 또는 폴리올과 같은 보습제 등이 첨가되어 사용되었다. 예를 들어, 수용성 폴리올로서 수산기(OH기)가 3개 이상인 글리세린, 솔리톨 등은 뛰어난 보습력을 나타내나 끈적임이 심하여 사용할 때 불쾌감을 느끼게 하며, 수산기가 2개인 프로필렌글리콜, 1,3-부틸렌글리콜 등은 피부의 부작용이 발생하기도 한다. 또한, 다른 천연보습인자인 피롤리돈 카르복실산 나트륨(PCA-Na), 젖산나트륨(Sodium lactate), 요소 등은 전해성이 강해 화장료의 유화안정성을 해치는 문제점이 있으며, 아미노산, 콜라겐, 엘라스틴 등도 보습능력이 있다고 하나 그 보습능력에 한계가 있다. 각질층의 수분을 보유할 수 있는 능력은 피지성분과 아미노산, 젖산, 요소 및 무기염 등으로 이루어진 천연보습인자(NMF)에 의해 조절되며 피부 외용제에서 천연보습인자와 같이 안전하면서도 사용성이 우수하고 보습효과가 높은 물질의 개발이 필요한 실정이다.
한편, 각질 등으로 손상된 피부는 아토피나 여드름의 원인과도 관련이 있다. 여드름(acne)의 발병 원인은 아직도 명확히 규정되어 있지 않으며, 다만 유전적인 요인과 환경적인 요인을 배제한다면 세 가지 중요한 원인이 여드름 발병에 직접적으로 관여한다는 것이 지금까지의 연구 보고를 통하여 정설로서 인정되고 있다. 그 세 가지 중요한 원인을 여드름 발병 기전을 통하여 간단히 설명하면 다음과 같다. 첫 번째 원인은 과잉으로 분비된 피지 때문이라고 할 수 있다. 피지의 형성은 남성 호르몬(androgenic hormone)의 작용에 의하여 이루어지며, 이 남성 호르몬의 비정상적인 증가 또는 이와 관련된 여러 기전을 통하여 피지선은 기능이 항진되고 그 결과 과잉의 피지를 생성하게 된다. 두번째는 모낭의 과각화(hyperkeratinization)로 인한 모공의 폐쇄 때문으로 설명된다. 생성된 피지는 피부 밖으로 원활하게 배출되어야 하지만 모낭의 과각화로 인하여 모공이 막혀 피지의 원활한 배출이 억제되고 그 결과 모낭 내에 피지가 정체되어 미세면포를 형성하게 된다. 피지분비와 관련되어, 피부 내에는 비활성 스테로이드 전구물질을 활성 안드로젠으로 전환시키는 데에 필요한 모든 효소가 존재하는데, 5α-리덕타아제는 그 중의 하나이다. 남성 호르몬 중의 하나인 테스토스테론은 피지선(sebaceous gland)에 진입한 후 세포(sebocyte)에 존재하는 5α-리덕타아제에 의하여 디하이드로테스토스테론으로 전환되며, 이것을 신호로 하여 유전자가 발현되는 등의 다단계 경로를 수행하게 되어 그 결과 피지를 생성하게 된다. 세번째의 원인은 여드름을 일으키는 스태피로코커스 에피더미스(Staphylococcus epidermis), 스태피로코커스 아우레우스(Staphylococcus aureus), 프로피오니박테리움 아크네스(Propionibacterium acnes) 등의 피부상재균 때문으로 이것은 여드름 병변 악화의 중요한 원인으로 설명된다. 모낭 내에 상주하는 여드름 균은 모공벽 자극 물질을 형성한다. 미세면포는 피지의 과잉 분비가 계속되면서 크기가 점차 증가하여 면포로 발전되며 이로 인하여 모낭벽은 얇아지게 되고 여드름 균에 의하여 생성된 자극성 물질은 이 얇아진 모낭벽을 자극하여 면포를 점차 염증성 병변으로 악화(구진→농포→결절→반흔)시킨다. 이와 같은 여드름의 원인에 따라 피지 억제, 피부상재균에 대한 항균효과 등에 초점을 맞춰 여드름 치료 또는 개선을 위한 방법들에 관한 다양한 연구가 수행되고 있다.
아토피 피부염의 병인기전은 아직 완전하게 밝혀지지 않았지만 환경 내에서 흔한 물질(알레르겐)에 대한 과민한 면역반응(알레르기반응)으로 인하여 피부에 만성적인 염증반응을 유발하여 아토피 피부염이 발생한 것으로 알려져 왔다. 또한, 아토피 피부염(atopic dermatitis)은 천식과 알레르기성 질환의 발달 전에 발생하는 만성적인 염증질환으로, 케모카인의 농도, 양적변화나 활성 정도에 따라 그 증상에 차이가 있으며(Curr. Allergy Asthma Rep., 2005, 5, 284~290), Th2 타입의 림프구가 병변부(lesional skin)로 침입하는 현상을 말하기도 한다.
현재 세계 인구의 0.5~1%, 특히, 어린이의 경우 5~10%가 아토피 피부염으로 고생하는 것으로 알려져 있으며, 그 발증과 악화에는 환경인자가 크게 관여하고 있는 것으로 알려져 있다. 그 예로서, 아토피 피부염의 발병 빈도는 집먼지 진드기에 노출된 양과 상관성을 보이며 아토피 피부염의 중증도와도 유의한 상관관계를 보인다고 알려져 있다. 또한 환경 내에서 집먼지 진드기에 대한 노출을 줄임으로써 아토피 피부염의 중증도를 감소시킬 수 있다고 알려져 있다. 그 외에 아토피 피부염은 건조한 피부, 정상인에 비해 쉽게 피부 가려움증을 느끼는 특성, 세균/바이러스/곰팡이 등에 의한 감염, 정서적 요인, 환경적 요인 등이 서로 복합적으로 작용하여 일어나는 것으로 보인다. 최근 수십 년 동안 아토피 피부염의 발병률이 상승하고 있으며, 우리나라 또한 그 환자 수가 크게 늘고 있는 현실이다.
아토피 피부염을 일으키는 사이토카인 중의 하나인 IL-8(interleukin-8)은 기도 상피세포에서 분비되는 중요한 염증성 케모카인(chemokine)으로서 염증 초기에 주로 발현되며, IL-8에 의해 기관지 과민성이 유발되고 알레르기 비염이나 기관지 천식에서도 증가되는 것으로 알려져 있다. 이에 대한 예로서, 아토피 피부염을 유발하는 집 먼드기 추출물을 THP-1 세포나 EoL-1 세포에 처리하면 아토피 피부염을 유발하는 사이토카인(cytokine)인 IL-8의 양이 증가하게 된다.
아토피 피부염을 일으키는 다른 종류의 사이토카인으로는 MCP-1(monocyte chemoattractant protein-1)이 있는데, 상기 MCP-1은 CCR2(chemokine receptor)에 결합하며 MCP-1 유전자가 제거된 생쥐는 단핵구(monocytes)에 대한 화학주성이 손상을 받고, 특정 균의 감염에 저항성이 약화되는 것이 관찰되었으며, 이러한 현상은 CCR2 유전자가 제거된 동물에서 관찰되는 증상과 유사하다고 보고된 바 있다. 이 밖에도 MCP-1은 시험관에서 Th0 세포를 Th2 사이토카인을 분비하는 세포로 전환시키며, MCP-1을 정맥주사 하였을 때 IL-12의 생성이 감소되고 IL-4의 생성이 증가하는 것이 보고된 바 있다. 이 외에도 스태피로코커스 아우레우스(Staphylococcus aureus)로 인한 피부의 손상 또한 아토피의 유발원이라는 연구보고도 있어왔다.
기존에 아토피 피부염의 치료제로 가장 널리 이용되어 왔던 것은 주로 스테로이드제, 항히스타민제, 항생제 등과 같은 치료제이다. 이 중, 스테로이드제는 기관지천식 등의 염증성 질환에서 가장 널리 사용되는 치료제이기는 하지만, 아직까지도 스테로이드제가 체내에서 반응하는 기전이 다 알려져 있지는 않는 실정이다. 기관지 천식이나 류마티스 관절염 등의 환자들 중 일부는 스테로이드제에 반응하지 않는 스테로이드 저항성을 보인다. 또한, 아토피 피부염은 스테로이드 계통의 약제를 통해 완전히 치료가 되기보다 만성화되면서 조직의 변성 및 섬유화가 일어나는 부작용이 종종 발생한다. 스테로이드제에 대한 저항성이 커지면, 만성 염증성 반응에서 다양한 세포를 통해 섬유화에 관련된 TGF-β(tumor growth factor-β), IL-4, IL-13 등의 다양한 사이토카인이 분비되고, 이를 통해 섬유모세포(fibroblast)를 활성화시키는 IL-6의 분비가 증가되어 많은 섬유모세포의 분화증식이 초래되며, 세포외 기질(extra cellular matrix)이 과생산되어 세포 및 조직의 변형과 섬유화가 야기될 수도 있다.
따라서, 스테로이드제와 같은 아토피 피부염의 치료제들은 상기와 같은 여러 가지 부작용으로 인해 그 사용을 점차 제한하고 있는 추세이며, 아토피 피부염에 효과가 있으면서도 부작용이 없는 새로운 개념의 아토피 피부염의 치료용 조성물이 요구되고 있다.
생약으로 사용되는 황금(Scutellaria baicalensis)의 뿌리(Scutellariae Radix)는 한방에서는 해열, 이뇨, 지사, 담 및 소염제로 이용한다.
황련으로는 Plagiorhegma dubium Maxim., Coptis chinensis Franch., Coptis japonica Makino, Coptis teeta, Coptis sinensis 등의 식물이 사용되며 그 외에도 외국에서는 Coptis 속의 다양한 식물을 황련으로 이용한다. 황련은 열을 내리고 습을 없애며 해독하는 기능이 있고, 백색칸디다와 일련의 피부사상균에 대한 억균 작용을 나타낸다고 보고된 바 있다. 가슴이 답답하고 잠을 자지 못하는 데, 습열설사, 이질, 위열로 토하는 데, 간화로 눈이 충혈되면서 붓고 아픈 데, 옹종, 구내염, 혈열로 피를 토하는 데, 코피 등에 사용되었다.
황백은 황경피나무(황벽나무, Phellodendron amurense Rupr.)의 껍질을 말린 것으로서, 열을 내리고 습을 없애며 해독하는 기능이 있고, 혈압강하 작용, 혈액응고 촉진 작용, 이담 작용, 자궁수축 작용, 결핵균을 비롯한 일련의 병원성 미생물에 대한 항균 작용, 소염 작용을 나타낸다는 것이 밝혀졌다. 습열설사, 이질, 황달, 오로, 임증, 폐결핵, 유정, 음부 가려움증, 헌데, 습진 등에 쓰며, 세균성 적리, 장결핵, 방광 및 요도의 염증, 골관절 결핵 등에도 쓰고 고혈압증과 입맛이 없는데도 쓴다.
치자는 꼭두서니과 식물인 치자나무(Gardenia jasminoides Ellis)의 익은 열매를 말린 것이다. 치자나무는 우리나라의 중부 이남에서 심으며 북부에서는 온실에 심는다. 가을에 익은 열매를 따서 햇볕에 말린다. 맛은 쓰고 성질은 차다. 심경, 폐경, 위경, 간경, 삼초경에 작용한다. 열을 내리고 가슴이 답답한 것을 낫게 하며 습열사를 없애고 소변이 잘 나오게 한다. 또한 출혈을 멈추게 하고 부기를 가라앉히며 해독한다.
피톤치드는 나무가 해충과 병균으로부터 자신을 보호하기 위해 내뿜는 자연 항균 물질로서, 스트레스 해소, 심폐기능 강화, 살균작용의 효과가 있으며 아토피를 유발하는 집먼지 진드기의 번식을 억제하는 효과가 있는데, 편백나무(Chamaecyparis obtusa)에 특히 이 피톤치드가 많이 포함되어 있어 각종 건축자재, 침구, 주방용품에 편백나무의 사용이 많다. 편백나무로부터 추출된 정유인 편백 오일(hinoki oil)에도 이러한 피톤치드가 다량 함유되어 있어, 항균, 항염, 아토피 개선 등의 용도로서 다양하게 사용되는 추세이다. 편백 오일은 편백나무에 함유된 정유(精油)를 증기증류로 분리한 것을 말한다.
본 발명자들은 황금, 황련, 황백, 치자, 편백 등의 생약이 갖는 생리활성에 관해 연구하던 중, 이들 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일이 포함된 조성물이 여드름균에 대한 항균효과가 우수하고 아토피 피부염의 억제효과, 보습 등으로 인한 피부각질 개선 효과가 있음을 확인하여, 본 발명을 완성할 수 있었다.
본 발명의 목적은 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물을 제공하는데 있다.
본 발명은 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물에 관한 것이다.
상기 생약 혼합물에는 황금 100 중량부를 기준으로, 황련 50~200 중량부, 황백 50~200 중량부 및 치자 50~200 중량부가 포함될 수 있다.
상기 생약 혼합물의 추출물은, 생약 혼합물을 1,3-부틸렌글리콜 수용액을 용매로 하여 추출할 수 있다.
상기 조성물에 생약 혼합물의 추출물과 편백 오일이 10:0.1~5의 중량비로 함유될 수 있다.
상기 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일은 프로피오니박테리움 아크네스(Propionibacterium acnes) 및 스태필로코쿠스 아우레우스(Staphylococcus aureus) 중 선택되는 1종 이상의 균주에 항균 효과가 있는 것을 특징으로 한다.
본 발명은 또한 상기 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일을 함유하는 화장료 조성물에 관한 것이다. 상기 화장료 조성물은 피부 보습, 여드름, 아토피 피부염 또는 피부 각질 개선 효과가 있는 것을 특징으로 한다.
이에 본 발명은 상기 화장료 조성물을 원료 또는 유효성분으로 함유하는 화장료를 제공할 수 있다.
이하 본 발명을 더 자세하게 설명한다.
본 발명은 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물에 관한 것이다.
상기 생약 혼합물의 추출물은, 생약 혼합물을 1,3-부틸렌글리콜 수용액을 용매로 하여 추출할 수 있으며, 상기 1,3-부틸렌글리콜 수용액은 바람직하게는 20~50%(v/v)의 1,3-부틸렌글리콜 수용액인 것이 좋으며, 가장 바람직하게는 30~40%(v/v)의 1,3-부틸렌글리콜 수용액일 수 있다. 이러한 조건의 용매를 이용하여 추출된 생약 혼합물의 추출물은, C1~C4 알코올 또는 이들의 혼합용액 등으로 추출된 용매 추출물보다 항산화 활성이 보다 우수하다. 상기 C1~C4 알코올은 메탄올, 에탄올, 프로판올, 이소프로판올, 부탄올 및 이소부탄올로 이루어진 군에서 선택될 수 있다.
상기 생약 혼합물의 추출물 제조시 사용되는 1,3-부틸렌글리콜 수용액은 생약 혼합물의 사용 중량 기준 1~40배 부피(1kg 기준 1~40ℓ)를 사용할 수 있으며, 바람직하게는 5~40배 부피를 사용할 수 있다. 상기 생약 혼합물의 추출조건은 20~50℃에서 1분~48시간일 수 있다. 상기 과정은 1~4번까지 반복할 수 있다.
상기 생약 혼합물의 추출물과 편백 오일이 10:0.1~5의 중량비로 함유될 수 있는데, 이러한 비로 혼합되지 않는 조성물의 경우, 여드름 개선 효과가 좋지 않거나 여드름이 오히려 더 악화될 수도 있다.
본 발명의 추출과정에서 사용되는 추출용 기기로는 통상의 추출기기, 초음파분쇄추출기를 이용할 수 있다. 이렇게 제조된 생약 혼합물의 추출물은 열풍건조, 감압건조 또는 동결건조하여 용매를 제거할 수 있다.
상기 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일은 프로피오니박테리움 아크네스(Propionibacterium acnes)에 항균 효과가 있어 여드름의 예방, 개선 또는 치료에 유용하게 사용될 수 있다.
본 발명은 상기 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일 및 약제학적 부형제를 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 약학 조성물 또는 피부 외용제를 제공할 수 있다. 이 때, 상기 약학 조성물이나 피부 외용제는 쥐, 가축, 인간 등의 포유동물에 다양한 경로로 투여될 수 있다. 상기 약학 조성물은 경구투여, 혈관투여 등도 가능하지만, 바람직하게는 피부에 뿌리거나 바르거나 붙이는 스프레이제, 액상제제, 로션, 수포제, 테이프제, 연무제, 외용산제, 겔, 크림, 졸, 연고제, 패치제, 마스크팩 등으로 제조될 수 있다. 상기 약학 조성물 또는 피부외용제에 생약 혼합물의 추출물과 편백 오일은 0.001~99.9%가 함유될 수 있다. 본 발명의 약학 조성물 또는 피부외용제의 활성성분 이외의 다른 성분들은 일반적으로 피부에 적용되는 외용제에 사용되는 어떠한 성분이 사용될 수 있다. 예를 들어, 백색와셀린(와셀린), 황색와셀린, 라놀린, 정제 밀랍, 세타놀, 스테아릴 알콜, 스테아르산, 수소첨가유, 탄화수소겔, 폴리에틸렌글리콜, 액체 파라핀 및 스쿠알란과 같은 기제; 올레산, 이소프로필 미리스테이트, 글리세롤 트리이소옥타노에이트, 크로타미톤, 디에틸 세바케이트, 디이소프로필 세바케이트, 디이소프로필아디페이트, 헥실라울레이트, 지방산, 지방산 에스테르, 식물성유, 지방산 알콜 및 알콜과 같은 용매 또는 안정화제; 토코페롤 유도체, L-아스코르브산, 디부틸히드록시톨루엔 및 부틸히드록시아니졸과 같은 항산화제; p-히드록시벤조에 이트와 같은 방부제; 글리세린, 플로필렌 글리콜 및 소듐히라우로네이트와 같은 연석제; 폴리옥시에틸렌 유도체, 글리세롤 지방산 에스테르, 슈크로스 지방산 에스테르, 소르비탄 지방산 에스테르, 프로필렌 글리콜 지방산 에스테르 및 레시틴과 같은 계면 활성제; 카르복시비닐 폴리머, 크산검, 카르복시메틸 셀룰로스 및 소듐 카르복시메틸 셀룰로스, 히드록시프로필 셀룰로스 및 히드록시프로필메틸 셀룰로스와 같은 증점제; 안정화제; 보존제; 흡착 촉진제; 및 기타 적당한 충진제들이 첨가될 수 있다. 본 발명의 약학 조성물 또는 피부외용제는 외용제를 제조하는데 잘 알려진 방법에 따라, 필요에 따라 적당한 기제와 함께, 각 성분을 잘 혼합하여 제조될 수 있으며 이와 같이 제조된 제제는 필요에 따라 병변에 적용된다.
본 발명의 약학 조성물 또는 피부외용제의 투여량은 치료받을 대상의 연령, 성별, 체중과, 또는 병리 상태, 질환 또는 병리 상태의 심각도, 투여경로 및 처방자의 판단에 따라 달라질 것이다. 이러한 인자에 기초한 투여량 결정은 당업자의 수준 내에 있으며, 일반적으로 투여량은 0.01㎎/㎏/일 내지 대략 2000㎎/㎏/일의 범위이다. 더 바람직한 투여량은 1㎎/㎏/일 내지 500㎎/㎏/일이다. 투여는 하루에 한번 투여할 수도 있고, 수회 나누어 투여할 수도 있다. 상기 투여량은 어떠한 면으로든 본 발명의 범위를 한정하는 것은 아니다.
본 발명은 또한 상기 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일을 함유하는 화장료 조성물에 관한 것이다. 상기 화장료 조성물은 피부 보습, 여드름, 아토피 피부염 또는 피부 각질 개선 효과가 있는 것을 특징으로 한다. 이에 본 발명은 상기 화장료 조성물을 원료 또는 유효성분으로 함유하는 화장료를 제공할 수 있다. 상기 화장료의 제형은 당업계에서 통상적으로 제조되는 어떠한 화장료 제형으로도 제조될 수 있으며, 피부외용연고, 에센스, 미백크림, 로션, 에멀젼, 팩, 일반화장수, 스킨밀크, 스킨, 크림, 세럼, 미용비누, 유연화장수, 약용화장수, 전신세정제, 클렌징 오일, 클렌징 크림, 클렌징 티슈 및 클렌징 워터에서 선택될 수 있다.
본 발명의 화장료 제형에는 담체 성분으로서 동물성유, 식물성유, 왁스, 파라핀, 전분, 트라칸트, 셀룰로오스 유도체, 폴리에틸렌 글리콜, 실리콘, 벤토나이트, 실리카, 탈크, 산화아연, 락토스, 실리카, 알루미늄 히드록시드, 칼슘 실리케이트, 폴리아미드 파우더, 클로로플루오로히드로카본, 프로판/부탄 또는 디메틸 에테르, 물, 에탄올, 이소프로판올, 에틸 카보네이트, 에틸 아세테이트, 벤질 알코올, 벤질 벤조에이트, 프로필렌글리콜, 1,3-부틸글리콜오일, 글리세롤 지방족 에스테르, 폴리에틸렌 글리콜 또는 소르비탄의 지방산 에스테르, 에톡실화이소스테아릴 알코올, 폴리옥시에틸렌 소르비톨 에스테르 및 폴리옥시에틸렌 소르비탄 에스테르와 같은 현탁제, 미소결정성 셀룰로오스, 알루미늄 메타히드록시드, 벤토나이트, 아가 또는 트라칸트, 지방족 알코올 설페이트, 지방족 알코올 에테르 설페이트, 설포숙신산 모노에스테르, 이세티오네이트, 이미다졸리늄 유도체, 메틸타우레이트, 사르코시네이트, 지방산 아미드 에테르 설페이트, 알킬아미도베타인, 지방산 글리세리드, 지방산 디에탄올아미드, 라놀린 유도체 또는 에톡실화 글리세롤 지방산 에스테르 등이 이용될 수 있다.
본 발명은 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물, 피부보습, 여드름, 아토피 피부염 또는 피부 각질 개선 효과가 있는 화장료 조성물에 관한 것이다. 상기 생약 혼합물의 추출물과 편백 오일이 혼합된 조성물은 여드름과 아토피의 원인균인 프로피오니박테리움 아크네스(Propionibacterium acnes)와 스태필로코쿠스 아우레우스(Staphylococcus aureus)의 생육저지에 대한 상승효과가 우수하여 다양한 형태의 약학적 조성물, 피부외용제, 화장료 제품으로 용이하게 이용할 수 있다. 대한민국 공개특허 제10-2009-0038648호, 대한민국 공개특허 제10-2014-0070946호, 대한민국 등록특허 제10-1081914호 등에 본 발명의 생약 혼합물의 추출물의 원료 생약, 편백 오일 등이 포함된 화장료에 관한 기술이 되어 있지만, 생약 혼합물의 추출물과 편백 오일의 상승효과를 이용하여 제조된 화장료 또는 피부외용제 등의 조성물은 전혀 개시된 바 없다.
도 1은 본 발명의 화장료 제조예 1-1의 비누를 1개월 간 사용한 사람의 피부 상태를 나타낸다.
이하 본 발명의 바람직한 실시예를 상세히 설명하기로 한다. 그러나, 본 발명은 여기서 설명되는 실시예에 한정되지 않고 다른 형태로 구체화될 수도 있다. 오히려, 여기서 소개되는 내용이 철저하고 완전해지도록, 당업자에게 본 발명의 사상을 충분히 전달하기 위해 제공하는 것이다.
<실시예 1. 생약 혼합물의 추출물 제조>
황금, 황련, 황백 및 치자가 표 1에 개시된 함량으로 혼합된 생약 혼합물에 30%(v/v) 1,3-부틸렌글리콜(1,3-Butylene Glycol) 수용액 2ℓ를 가하여 실온에서 2시간 동안 추출하였으며, 이 후 생약 건더기를 걸러내고 남은 액상을 감압농축하여 생약 혼합물의 추출물을 얻었다.
| 조건 | 황금(g) | 황련(g) | 황백(g) | 치자(g) |
| 실시예 1-1 | 100 | 100 | 100 | 100 |
| 실시예 1-2 | 100 | 150 | 50 | 100 |
| 실시예 1-3 | 100 | 200 | 50 | 50 |
| 실시예 1-4 | 100 | 50 | 200 | 50 |
| 실시예 1-5 | 100 | 50 | 50 | 200 |
<
실시예
2. 생약 혼합물과 편백 오일의 혼합>
실시예 1에서 제조한 생약 혼합물의 추출물과 편백 오일을 하기의 표 2에 개시된 중량비로 혼합하였다.
| 조건 | 실시예 1-1의 추출물 (g) | 실시예 1-2의 추출물 (g) | 실시예 1-3의 추출물 (g) | 실시예 1-4의 추출물 (g) | 실시예 1-5의 추출물 (g) | 편백 오일 (g) |
| 실시예 2-1 | 10 | 0 | 0 | 0 | 0 | 1 |
| 실시예 2-2 | 10 | 0 | 0 | 0 | 0 | 5 |
| 실시예 2-3 | 0 | 10 | 0 | 0 | 0 | 1 |
| 실시예 2-4 | 0 | 0 | 10 | 0 | 0 | 1 |
| 실시예 2-5 | 0 | 0 | 0 | 10 | 0 | 1 |
| 실시예 2-6 | 0 | 0 | 0 | 0 | 10 | 1 |
<비교예 1. 비교대상 생약 혼합물의 추출물 제조>
비교예 1-1 내지 1-8. 부틸렌글리콜 수용액 추출
실시예 1과 동일한 방법으로 생약 혼합물의 추출물을 제조하되 각 생약의 혼합비는 하기의 표 3을 참고하였다.
| 조건 | 황금(g) | 황련(g) | 황백(g) | 치자(g) |
| 비교예 1-1 | 100 | 10 | 280 | 10 |
| 비교예 1-2 | 0 | 130 | 130 | 140 |
| 비교예 1-3 | 200 | 0 | 100 | 100 |
| 비교예 1-4 | 0 | 200 | 0 | 200 |
| 비교예 1-5 | 400 | 0 | 0 | 0 |
| 비교예 1-6 | 0 | 400 | 0 | 0 |
| 비교예 1-7 | 0 | 0 | 400 | 0 |
| 비교예 1-8 | 0 | 0 | 0 | 400 |
비교예 1-9. 에탄올 추출
실시예 1-1과 동일한 방법으로 생약 혼합물의 추출물을 제조하되 용매는 에탄올을 사용하였다.
비교예 1-10. 에탄올 수용액 추출
실시예 1-1과 동일한 방법으로 생약 혼합물의 추출물을 제조하되 용매는 70%(v/v) 에탄올 수용액을 사용하였다.
비교예 1-11. 물 추출
실시예 1-1과 동일한 방법으로 생약 혼합물의 추출물을 제조하되 용매는 물을 사용하고 추출온도는 90℃를 유지하였고, 감압농축 대신 동결건조하였다.
<비교예 2. 비교대상 생약 혼합물과 편백 오일의 혼합>
실시예 2와 동일한 방법으로 생약 혼합물과 편백 오일을 혼합하되, 각 조건에서의 혼합비는 하기의 표 4를 참고하였다.
| 조건 | 실시예 1-1의 추출물 | 비교예 1-1의 추출물 (g) |
비교예 1-2의 추출물 (g) |
비교예 1-3의 추출물 (g) |
비교예 1-4의 추출물 (g) |
비교예 1-5의 추출물 (g) |
비교예 1-6의 추출물 (g) |
비교예 1-7의 추출물 (g) |
비교예 1-8의 추출물 (g) |
비교예 1-9의 추출물 (g) |
비교예 1-10의 추출물 (g) |
비교예 1-11의 추출물 (g) |
편백 오일 (g) |
| 비교예 2-1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 |
| 비교예 2-2 | 5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 |
| 비교예 2-3 | 0 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
| 비교예 2-4 | 0 | 0 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
| 비교예 2-5 | 0 | 0 | 0 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
| 비교예 2-6 | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
| 비교예 2-7 | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
| 비교예 2-8 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 0 | 0 | 0 | 1 |
| 비교예 2-9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 0 | 0 | 1 |
| 비교예 2-10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 0 | 1 |
| 비교예 2-11 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 0 | 1 |
| 비교예 2-12 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 0 | 1 |
| 비교예 2-13 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | 1 |
<화장료 제조예 1. 비누 제조>
올리브오일 2 중량%, 팜 오일 5 중량%, 소르비톨 20 중량%, 카르보머 0.2 중량%, 수소첨가 피마자 오일 0.5 중량%, 디프로필렌 글리콜 10 중량%, 페녹시에탄올 0.15 중량%, 트리소듐 에틸렌 디아민 테트라 아세트산 0.02 중량%, 물 69.13 중량%, 실시예 2의 각각의 조성물 1 중량%, 트리에탄올 아민 0.2 중량%를 포함하는 에멀전을 제조하고, 상기 에멀전 10g과 시중에서 판매하는 천연비누 베이스 90g을 혼합하여 표 5의 여드름 개선용 비누를 제조하였다.
| 비누 조건 | 비누에 포함된 조성물 |
| 화장료 제조예 1-1 | 실시예 2-1 |
| 화장료 제조예 1-2 | 실시예 2-2 |
| 화장료 제조예 1-3 | 실시예 2-3 |
| 화장료 제조예 1-4 | 실시예 2-4 |
| 화장료 제조예 1-5 | 실시예 2-5 |
| 화장료 제조예 1-6 | 실시예 2-6 |
<화장료 제조예 2. 스킨 제조>
실시예 2-1의 조성물 5.0 중량%, 프로필렌글리콜 5.2 중량%, 올레일알코올 1.5 중량%, 에탄올 3.2 중량%, 폴리솔베이트 20 3.2 중량%, 벤조페논-9 2.0 중량%, 카르복실비닐폴리머 1.0 중량%, 글리세린 3.5 중량% 향 미량, 방부제 미량, 정제수 잔량의 함량으로 하여 통상적인 방법을 사용하여 스킨을 제조하였다.
<화장료 제조예 3. 로션 제조>
실시예 2-1의 조성물 5.0 중량%, 세토스테아릴 알코올 1.0 중량%, 글리세릴모노스테아레이트 0.8 중량%, 소르비탄모노스테아레이트 0.3 중량%, 폴리솔베이트 60 1.0 중량%, 미네랄오일 5.0 중량%, 사이크로메치콘 3.0 중량%, 디메치콘 0.5 중량%, 알란토인 0.1 중량%, 글리세린 5.0 중량%, 알코올 2 중량%, 프로필렌글리콜 3.0 중량%, 향 미량, 방부제 미량, 정제수 잔량의 함량으로 통상적인 방법을 사용하여 로션을 제조하였다.
<화장료 제조예 4. 에센스 제조>
실시예 2-1의 조성물 5.0 중량%, 프로필렌글리콜 4.0 중량%, 글리세린 3.0 중량%, 알란토인 0.5 중량%, EDTA-2Na 0.01 중량%, 에탄올 5.0 중량%, 트리에탄올아민 1.5 중량%, 스쿠알란 2.0 중량%, 밀랍 2.5 중량%, 폴리솔베이트60 중량%, 카르복실비닐폴리머 1.0 중량%, 솔비탄세스퀴올레이트 2.5 중량%, 향 미량, 방부제 미량, 정제수 잔량의 함량으로 통상적인 방법을 사용하여 에센스를 제조하였다.
<화장료 제조예 5. 크림 제조>
실시예 2-1의 조성물 10.0%, 폴리옥시에틸렌소르비탄모노스테아레이트 0.7%, 솔비탄세스퀴올레이트 0.5%, 세틸알코올 0.6%, 스테아린산 0.75%, 글리세릴모노스테아레이트 0.6%, 유동파라핀 15.0%, 카르복시비닐폴리머 10.0%, 트리에탄올아민 0.2%, 향 미량, 방부제 미량, 정제수 잔량의 함량으로 통상적인 방법을 사용하여 크림을 제조하였다.
<화장료 비교제조예 1. 비누 제조>
화장료 제조예 1과 동일하게 비누를 제조하되, 에멀전에 포함되는 실시예 2의 조성물 대신 실시예 1, 비교예 1 및 비교예 2의 조성물을 포함시켜 표 6의 비누를 제조하였다.
| 비누 조건 | 비누에 포함된 조성물 |
| 화장료 비교제조예 1-1 | 실시예 1-1 |
| 화장료 비교제조예 1-2 | 실시예 1-2 |
| 화장료 비교제조예 1-3 | 실시예 1-3 |
| 화장료 비교제조예 1-4 | 실시예 1-4 |
| 화장료 비교제조예 1-5 | 실시예 1-5 |
| 화장료 비교제조예 1-6 | 비교예 1-1 |
| 화장료 비교제조예 1-7 | 비교예 1-2 |
| 화장료 비교제조예 1-8 | 비교예 1-3 |
| 화장료 비교제조예 1-9 | 비교예 1-4 |
| 화장료 비교제조예 1-10 | 비교예 1-5 |
| 화장료 비교제조예 1-11 | 비교예 1-6 |
| 화장료 비교제조예 1-12 | 비교예 1-7 |
| 화장료 비교제조예 1-13 | 비교예 1-8 |
| 화장료 비교제조예 1-14 | 비교예 2-1 |
| 화장료 비교제조예 1-15 | 비교예 2-2 |
| 화장료 비교제조예 1-16 | 비교예 2-3 |
| 화장료 비교제조예 1-17 | 비교예 2-4 |
| 화장료 비교제조예 1-18 | 비교예 2-5 |
| 화장료 비교제조예 1-19 | 비교예 2-6 |
| 화장료 비교제조예 1-20 | 비교예 2-7 |
| 화장료 비교제조예 1-21 | 비교예 2-8 |
| 화장료 비교제조예 1-22 | 비교예 2-9 |
| 화장료 비교제조예 1-23 | 비교예 2-10 |
| 화장료 비교제조예 1-24 | 비교예 2-11 |
| 화장료 비교제조예 1-25 | 비교예 2-12 |
| 화장료 비교제조예 1-26 | 비교예 2-13 |
| 화장료 비교제조예 1-27 | 물 |
<화장료 비교제조예 2. 크림 제조>
화장료 제조예 5와 동일하게 크림을 제조하되, 실시예 2-1의 조성물 대신 비교예 2-1의 조성물을 사용하였다.
<약학적 조성물 제조예 1. 피부 외용제 제조>
실시예 2-1의 조성물이 1.0 중량%가 되도록 백색 바셀린에 혼합하여 여드름 개선용 피부 외용제 조성물을 제조하였다.
<실험예 1. 여드름균에 대한 항균 효과 확인>
실시예 1, 2 및 비교예 1, 2의 조성물의 항균효과를 확인하기 위해, 각 조성물을 여드름의 원인이 되는 프로피오니박테리움 아크네스(Propionibacterium acnes), 아토피의 원인이 되는 스태필로코쿠스 아우레우스(Staphylococcus aureus) 와 각각 대치배양하여 항균 활성을 확인하였다.
이를 위해, 프로피오니박테리움 아크네스는 RCB(reinforced clostridial broth)에 37℃에서 72시간 배양하여 RCA(reinforced clostridial agar) 평판배지에 1 × 106 CFU/ml이 포함 되도록 현탁시킨 액체배지를 멸균한 면봉으로 균일하게 도말하고 스태필로코쿠스 아우레우스는 TSB(tryptic soybean broth)에 37℃에서 24시간 배양하여 TSA(tryptic soybean agar)평판배지에 동일하게 현탁시킨 액체배지를 멸균한 면봉으로 균일하게 도말하였다. 다음으로 각 조성물을 동일 배수로 DMSO(dimethyl sulfoxide)에 희석하여 상기 희석액 35㎕를 페이퍼디스크(직경 8㎜)에 묻힌 후 프로피오니박테리움 아크네스와 스태필로코쿠스 아우레우스가 도말된 평판배지 위에 올려놓고 프로피오니박테리울 아크네스는 Gaspak system에 anaerogen을 넣은 후 , 밀봉하여 37℃에서 72시간 배양, 스태필로코쿠스 아우레우스는 37℃에서 24시간 배양하였다.
이 후, 각 시료의 희석액이 프로피오니박테리움 아크네스와 스태필로코쿠스 아우레우스에 미치는 영향을 저지원의 직경으로 조사하고, 이를 표 7에 나타냈다.
| 조성물 조건 | 프로피오니박테리움 아크네스의 항균효과(㎜) | 스태필로코쿠스 아우레우스의 항균효과(㎜) |
| 실시예 1-1 | 15 | 13 |
| 실시예 1-2 | 14 | 12 |
| 실시예 1-3 | 13 | 13 |
| 실시예 1-4 | 14 | 13 |
| 실시예 1-5 | 15 | 12 |
| 실시예 2-1 | 25 | 27 |
| 실시예 2-2 | 27 | 29 |
| 실시예 2-3 | 25 | 24 |
| 실시예 2-4 | 26 | 23 |
| 실시예 2-5 | 26 | 27 |
| 실시예 2-6 | 24 | 23 |
| 비교예 1-1 | 11 | 12 |
| 비교예 1-2 | 11 | 11 |
| 비교예 1-3 | 10 | 12 |
| 비교예 1-4 | 10 | 10 |
| 비교예 1-5 | 10 | 9 |
| 비교예 1-6 | 10 | 10 |
| 비교예 1-7 | 12 | 11 |
| 비교예 1-8 | 10 | 11 |
| 비교예 2-1 | 16 | 13 |
| 비교예 2-2 | 15 | 14 |
| 비교예 2-3 | 13 | 13 |
| 비교예 2-4 | 10 | 9 |
| 비교예 2-5 | 12 | 11 |
| 비교예 2-6 | 13 | 12 |
| 비교예 2-7 | 12 | 13 |
| 비교예 2-8 | 13 | 12 |
| 비교예 2-9 | 12 | 13 |
| 비교예 2-10 | 12 | 13 |
| 비교예 2-11 | 12 | 11 |
| 비교예 2-12 | 13 | 12 |
| 비교예 2-13 | 12 | 11 |
표 7을 참고하면, 실시예 2의 조성물이 갖는 항균 효과가 다른 조성물이 갖는 효과에 비해 가장 우수함을 확인할 수 있다.
<실험예 2. 아토피 치료 효과 확인>
사람의 단핵구(monocyte)인 THP-1 세포(human acute monocytic leukemia cell)를 항생제(penicillinm 104U/㎖, streptomycin 10㎎/㎖, amphotericin B 25㎍/㎖)와 FBS(fetal bovine serum)가 10%(v/v) 포함된 RPMI 1640 배지를 이용하여, 37℃, 5% CO2 조건에서 3일간 배양하였다. 이 후, MCP-1, IL-6, IL-8의 활성을 측정하기 위해 상기 THP-1 세포를 트립신-EDTA를 이용하여 2.0×106/㎖의 농도로 24웰 플레이트에 분주한 후 FBS가 0.5%(v/v) 포함된 RPMI에서 37℃, 5% CO2 조건에서 16시간 동안 배양하였다. 다음으로, 진드기 추출물(1㎍/㎖)을 각 웰에 아토피 유발원으로 처리하고, 동시에 DMSO(dimethyl sulfoxide)로 희석된 실시예 2 및 비교예 2의 시료(200㎍/㎖), 덱사메타손(dexamethasone, 50㎍/㎖)을 14시간 동안 처리한 후(대조군에는 DMSO를 세포배양액에 처리된 용매와 동일 부피로 처리) ELISA(enzyme-linked immunospecific assay ; Cytokine. 2008, 42(3), 365~371)를 이용하여 상층액에서 MCP-1, IL-6, IL-8의 양을 측정하여 표 8에 나타내었다. 이 때 각 사이토카인의 양은 진드기 추출물만을 처리한 세포에서의 값을 1.00으로 하여 대비한 fold 값을 나타내었다.
| 조건 | MCP-1 (fold) | IL-6 (fold) | IL-8 (fold) |
| 대조군 | 0.12 | 0.13 | 0.15 |
| 진드기 추출물 | 1.00 | 1.00 | 1.00 |
| 실시예 2-1 | 0.25 | 0.38 | 0.24 |
| 실시예 2-2 | 0.24 | 0.24 | 0.36 |
| 실시예 2-3 | 0.33 | 0.25 | 0.15 |
| 실시예 2-4 | 0.26 | 0.33 | 0.24 |
| 실시예 2-5 | 0.25 | 0.34 | 0.27 |
| 실시예 2-6 | 0.24 | 0.22 | 0.28 |
| 비교예 2-1 | 0.83 | 0.87 | 0.76 |
| 비교예 2-2 | 0.87 | 0.84 | 0.85 |
| 비교예 2-3 | 0.93 | 0.85 | 0.84 |
| 비교예 2-4 | 0.85 | 0.96 | 0.83 |
| 비교예 2-5 | 0.82 | 0.98 | 0.92 |
| 비교예 2-6 | 0.93 | 0.79 | 0.77 |
| 비교예 2-7 | 0.91 | 0.83 | 0.83 |
| 비교예 2-8 | 0.85 | 0.84 | 0.85 |
| 비교예 2-9 | 0.87 | 0.85 | 0.74 |
| 비교예 2-10 | 0.83 | 0.79 | 0.79 |
| 비교예 2-11 | 0.79 | 0.88 | 0.94 |
| 비교예 2-12 | 0.88 | 0.85 | 0.78 |
| 비교예 2-13 | 0.90 | 0.78 | 0.97 |
| 덱사메타손 | 0.13 | 0.17 | 0.17 |
상기 표 8에 개시된 바와 같이 THP-1 세포에 아토피를 유발한다고 알려진 진드기 추출물을 처리하면 MCP-1, IL-6 및 IL-8의 분비가 증가됨을 알 수 있다. 양성대조군으로 사용한 덱사메타손은 MCP-1의 분비를 거의 대조군(정상수준)으로 떨어뜨리는 것으로 확인되며, 본 발명의 생약 혼합물의 추출물과 편백 오일이 함유된 실시예 2의 조성물을 처리한 세포에서는 MCP-1, IL-6 및 IL-8의 분비가 현저하게 감소되는 것으로 확인되어, 상기 조성물이 아토피 피부염의 치료 효과가 우수함을 알 수 있다.
<실험예 3. 피부보습 효과 확인>
본 발명의 화장료 제조예 5의 크림과 화장료 비교제조예 2의 크림을 이용하여 피부 보습효과를 평가하였다. 각 군당 20~40대 여성 실험자 20명을 대상으로 오른쪽과 왼쪽 얼굴에 각 크림 시료를 바르고 눈가에서 3cm 우측으로 1cm 아래로 떨어진 부위를 바르기 전과 바른 후 90분의 보습 능력을 Cornoemeter(CM810, Courage and Khazaka Electronic Co., Germany)로 △Hydration(보습증가량)을 평가하였고 그 결과를 하기의 표 9에 나타내었다.
| 크림 | 크림에 함유된 조성물 | Corneometer (△Hydration, g/m2/h |
| 화장료 제조예 5 | 실시예 2-1 | 20.5 |
| 화장료 비교제조예 2 | 비교예 2-1 | 9.3 |
상기 표 9를 참고하면, 본 발명의 생약 혼합 추출물과 편백 오일이 포함된 화장료 제조예 5 크림의 피부보습 효과가 비교군 시료가 포함된 화장료 비교제조예 2 크림에 비해서도 보습 효과가 우수한 것으로 확인된다.
<실험예 4. 비누의 여드름 개선 효과 확인>
여드름 피부를 갖는 만 20~25세의 성인을 대상으로 화장료 제조예 1과 화장료 비교제조예 1의 비누를 1개월간 사용하고, 여드름 개선 효과를 확인하여 하기의 표 7에 나타내었다(각 비누 그룹의 사용자는 5명이었다).
여드름을 확인하는 방법으로는, 자세하게는 2004년 전문가 패널에 의해 개발된 한국인 여드름 중증도 시스템(Korean Acne Grading System, KAGS)은 통일된 규격으로 촬영된 피험자의 얼굴 사진을 사용하여 여드름의 염증성 병변을 대표하는 구진(papules)과 결절(nodules), 진행성 반흔(ongoing scar),누(sinus tract)의 수를 세어 grade 1~6의 여섯 등급으로 나눈 평가 시스템으로 구진이 10개 이하면 grade1, 구진이 11-30개이면 grade2, 구진이 31개 이상이고 결절이 10개 이하이면 grade3, 결절이 11-20개 and/or 결한 진행성 반흔이 있으면 grade4, 결절이 21-30개 and/or 중등도의 진행성 반흔이 있으면 grade5, 결절이 31개 이상 and/or 중한 진행성 반흔 and/or 누가 있으면 grade6이다. 매 방문 시 KAGS grad를 기록하였고 각 결과는 하기 표 10에 나타내었다.
| 비누 조건 | 비누에 포함된 조성물 | 여드름 개선 효과 (grade) | |||
| 사용 직전 | 3일 사용 후 | 1주 사용 후 | 4주 사용 후 | ||
| 화장료 제조예 1-1 | 실시예 2-1 | 3 | 2 | 2 | 1 |
| 화장료 제조예 1-2 | 실시예 2-2 | 3 | 3 | 3 | 1 |
| 화장료 제조예 1-3 | 실시예 2-3 | 3 | 3 | 3 | 1 |
| 화장료 제조예 1-4 | 실시예 2-4 | 4 | 3 | 3 | 1 |
| 화장료 제조예 1-5 | 실시예 2-5 | 5 | 4 | 3 | 2 |
| 화장료 제조예 1-6 | 실시예 2-6 | 5 | 4 | 3 | 1 |
| 화장료 비교제조예 1-1 | 실시예 1-1 | 4 | 4 | 4 | 3 |
| 화장료 비교제조예 1-2 | 실시예 1-2 | 4 | 4 | 4 | 3 |
| 화장료 비교제조예 1-3 | 실시예 1-3 | 4 | 4 | 4 | 3 |
| 화장료 비교제조예 1-4 | 실시예 1-4 | 4 | 4 | 4 | 3 |
| 화장료 비교제조예 1-5 | 실시예 1-5 | 4 | 4 | 4 | 3 |
| 화장료 비교제조예 1-6 | 비교예 1-1 | 5 | 5 | 5 | 5 |
| 화장료 비교제조예 1-7 | 비교예 1-2 | 4 | 4 | 4 | 4 |
| 화장료 비교제조예 1-8 | 비교예 1-3 | 4 | 4 | 4 | 3 |
| 화장료 비교제조예 1-9 | 비교예 1-4 | 5 | 5 | 5 | 4 |
| 화장료 비교제조예 1-10 | 비교예 1-5 | 4 | 4 | 4 | 4 |
| 화장료 비교제조예 1-11 | 비교예 1-6 | 3 | 3 | 3 | 3 |
| 화장료 비교제조예 1-12 | 비교예 1-7 | 4 | 4 | 4 | 4 |
| 화장료 비교제조예 1-13 | 비교예 1-8 | 5 | 5 | 5 | 4 |
| 화장료 비교제조예 1-14 | 비교예 2-1 | 4 | 4 | 4 | 4 |
| 화장료 비교제조예 1-15 | 비교예 2-2 | 5 | 5 | 5 | 4 |
| 화장료 비교제조예 1-16 | 비교예 2-3 | 6 | 6 | 6 | 5 |
| 화장료 비교제조예 1-17 | 비교예 2-4 | 4 | 4 | 4 | 3 |
| 화장료 비교제조예 1-18 | 비교예 2-5 | 5 | 5 | 5 | 4 |
| 화장료 비교제조예 1-19 | 비교예 2-6 | 5 | 5 | 5 | 4 |
| 화장료 비교제조예 1-20 | 비교예 2-7 | 4 | 4 | 4 | 4 |
| 화장료 비교제조예 1-21 | 비교예 2-8 | 4 | 4 | 4 | 3 |
| 화장료 비교제조예 1-22 | 비교예 2-9 | 4 | 4 | 4 | 3 |
| 화장료 비교제조예 1-23 | 비교예 2-10 | 5 | 5 | 5 | 4 |
| 화장료 비교제조예 1-24 | 비교예 2-11 | 4 | 4 | 4 | 4 |
| 화장료 비교제조예 1-25 | 비교예 2-12 | 4 | 4 | 4 | 3 |
| 화장료 비교제조예 1-26 | 비교예 2-13 | 4 | 4 | 4 | 3 |
| 화장료 비교제조예 1-27 | 물 | 4 | 4 | 4 | 4 |
상기 표 10의 결과를 통해 화장료 제조예 1 비누(실시예 2의 조성물이 포함된 비누)가 다른 조건의 조성물이 포함된 비누에 비해 여드름 개선 효과가 뛰어나거나, 이러한 여드름 개선 시기를 보다 앞당기는 것으로 확인된다. 이 때 화장료 제조예 1-1 비누(실시예 2-1의 조성물이 포함된 비누)를 사용하여 여드름 치료 효과가 나타난 사례를 도 1에 나타내었다.
<실험예 5. 비누의 피부 보호 효과 확인>
실험예 5에서 여드름 개선 실험에 참여한 이들 중, 화장료 제조예 1-1의 비누와 화장료 비교제조예 1-14, 1-15 및 1-27의 비누를 사용한 이들의 4주 후의 각질개선 효과와 피부보습 효과는 하기 표 11의 기준에 따라 표 12에 나타내었다.
| 각질/보습 개선 효과 |
평가기준 |
| 5 | 아주 좋음 |
| 4 | 좋음 |
| 3 | 보통 |
| 2 | 나쁨 |
| 1 | 아주 나쁨 |
| 비누 조건 | 비누에 포함된 조성물 | 각질 제거 효과 | 피부 보습 효과 |
| 화장료 제조예 1-1 | 실시예 2-1 | 4.2 | 4.3 |
| 화장료 비교제조예 1-14 | 비교예 2-1 | 3.2 | 3.5 |
| 화장료 비교제조예 1-15 | 비교예 2-2 | 3.0 | 3.2 |
| 화장료 비교제조예 1-27 | 물 | 2.8 | 2.5 |
상기 표 12의 결과를 통해 본 발명에서 제조한 비누의 여드름 개선 효과와 각질 제거 효과 및 피부 보습 효과가 매우 탁월함이 확인된다.
<실험예 6. 비누의 아토피 개선 효과 확인>
아토피 피부를 갖는 만 20~25세의 성인에게 각 그룹 5명 기준으로 실험예 4의 조건과 동일하게 매일 2회씩(아침 및 저녁) 4주간 세안을 하게 하였다. 4주 후의 비누 사용에 따른 아토피 개선, 각질개선 효과와 피부보습 효과를 확인하여 하기 표 13의 기준에 따라 표 14에 나타내었다.
| 아토피, 각질, 보습 개선 효과 | 평가기준 |
| 5 | 아주 좋음 |
| 4 | 좋음 |
| 3 | 보통 |
| 2 | 나쁨 |
| 1 | 아주 나쁨 |
| 비누 조건 | 비누에 포함된 조성물 |
아토피 개선 효과 |
각질 제거 효과 |
피부 보습 효과 |
| 화장료 제조예 1-1 | 실시예 2-1 | 4.3 | 4.5 | 4.1 |
| 화장료 비교제조예 1-14 | 비교예 2-1 | 3.1 | 3.0 | 3.2 |
| 화장료 비교제조예 1-15 | 비교예 2-2 | 3.3 | 3.2 | 2.9 |
| 화장료 비교제조예 1-27 | 물 | 2.7 | 2.7 | 2.3 |
상기 표 14의 결과를 통해 본 발명에서 제조한 비누가 아토피 환자들에게서도 아토피 개선 효과와 각질 제거 효과 및 피부 보습 효과가 우수함을 확인할 수 있다.
Claims (10)
- 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일을 함유하는 것을 특징으로 하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물.
- 제1항에 있어서,
상기 생약 혼합물에는 황금 100 중량부를 기준으로, 황련 50~200 중량부, 황백 50~200 중량부 및 치자 50~200 중량부가 포함되는 것을 특징으로 하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물. - 제1항에 있어서,
상기 생약 혼합물의 추출물은, 생약 혼합물을 1,3-부틸렌글리콜 수용액을 용매로 하여 추출하는 것을 특징으로 하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물. - 제1항에 있어서,
상기 생약 혼합물의 추출물과 편백 오일이 10:0.1~5의 중량비로 함유되는 것을 특징으로 하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물. - 제1항에 있어서,
상기 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일은 프로피오니박테리움 아크네스(Propionibacterium acnes) 및 스태필로코쿠스 아우레우스(Staphylococcus aureus) 중 선택되는 1종 이상의 균주에 항균 효과가 있는 것을 특징으로 하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물. - 황금, 황련, 황백 및 치자를 포함하는 생약 혼합물의 추출물과 편백 오일을 함유하는 것을 특징으로 하는 화장료 조성물.
- 제6항에 있어서,
상기 화장료 조성물은 피부 보습, 여드름, 아토피 피부염 또는 피부 각질 개선 효과가 있는 것을 특징으로 하는 화장료 조성물. - 제6항에 있어서,
상기 생약 혼합물에는 황금 100 중량부를 기준으로, 황련 50~200 중량부, 황백 50~200 중량부 및 치자 50~200 중량부가 포함되는 것을 특징으로 하는 화장료 조성물. - 제6항에 있어서,
상기 생약 혼합물의 추출물과 편백 오일이 10:0.1~5의 중량비로 함유되는 것을 특징으로 하는 여드름의 예방 또는 개선용 화장료 조성물. - 제6항 내지 제9항 중의 어느 한 항의 화장료 조성물을 원료 또는 유효성분으로 함유하는 것을 특징으로 하는 화장료.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020160136458A KR101878069B1 (ko) | 2016-10-20 | 2016-10-20 | 생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020160136458A KR101878069B1 (ko) | 2016-10-20 | 2016-10-20 | 생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| KR20180043580A true KR20180043580A (ko) | 2018-04-30 |
| KR101878069B1 KR101878069B1 (ko) | 2018-07-12 |
Family
ID=62081152
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020160136458A Active KR101878069B1 (ko) | 2016-10-20 | 2016-10-20 | 생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물 |
Country Status (1)
| Country | Link |
|---|---|
| KR (1) | KR101878069B1 (ko) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN109528506A (zh) * | 2018-12-14 | 2019-03-29 | 安徽大学 | 一种多效祛痘凝胶 |
| KR20200049008A (ko) * | 2018-10-31 | 2020-05-08 | 주식회사 리앤투네이쳐 | 항산화 및 열감소 효능을 갖는 화장품 조성물 |
| KR20200049007A (ko) * | 2018-10-31 | 2020-05-08 | 주식회사 리앤투네이쳐 | 피부노화 방지용 화장품 조성물 |
| KR102282642B1 (ko) | 2021-01-19 | 2021-07-28 | (주)더마랩 | 5가지 방향성 식물과 5가지 생약소재의 복합추출물을 함유하는 화장료 조성물 |
| WO2024123081A3 (ko) * | 2022-12-09 | 2024-11-07 | 최하도 | 아토피 개선 기능성 화장품 조성물 |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR102068521B1 (ko) | 2018-10-29 | 2020-01-21 | 대한민국(농촌진흥청장) | 테레오그릴루신 2 펩타이드를 함유하는 여드름 또는 아토피 피부염의 예방 또는 개선용 화장료 조성물 |
| KR102194920B1 (ko) | 2019-02-15 | 2020-12-24 | 대구가톨릭대학교산학협력단 | 여드름 개선용 복합생약추출물, 이를 포함하는 화장료 조성물 및 이를 함유하는 마스크팩 |
| KR102096743B1 (ko) | 2019-06-18 | 2020-04-02 | 원경아 | 피부 보습용 화장료 조성물 |
| KR20210130543A (ko) | 2020-04-22 | 2021-11-01 | 한국콜마주식회사 | 항바이러스 효과를 갖는 향료 조성물 및 이를 포함하는 화장료 조성물 |
| KR20230070839A (ko) | 2021-11-15 | 2023-05-23 | 전북대학교산학협력단 | ｍｉＲ126과 편백오일의 나노에멀전를 유효성분으로 포함하는 아토피성 피부염의 예방, 개선 또는 치료용 조성물 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR20090038648A (ko) * | 2007-10-16 | 2009-04-21 | (주)지앤지 | 편백 오일를 함유한 여드름 피부용 화장료 조성물 |
| KR101086736B1 (ko) * | 2008-10-06 | 2011-11-25 | 재단법인대구경북한방산업진흥원 | 복합 생약 추출물을 유효성분으로 함유하는 피부 노화방지 및 주름개선용 조성물 |
| KR101106216B1 (ko) * | 2008-10-22 | 2012-01-19 | 이병수 | 피부염 예방 화장품 조성물 및 이를 이용한 화장품 |
| KR20110040024A (ko) * | 2009-10-13 | 2011-04-20 | 박상헌 | 천연 식물의 혼합 추출물(Ｈ５―Ｓ．ａｕｒｅｕｓ ＣＯＭＰＬＥＸ™) 및 이를 함유하는 아토피 개선 화장료 조성물 |
| KR101467675B1 (ko) * | 2013-04-11 | 2014-12-04 | 경상대학교산학협력단 | 전처리된 차나무 추출물 및 편백 정유 추출물을 유효성분으로 함유하는 아토피성 피부염 개선용 조성물 |
| KR101538743B1 (ko) * | 2013-10-04 | 2015-07-22 | 호서대학교 산학협력단 | 목향 및 측백나무 추출물을 유효성분으로 포함하는 Ｔｈ1-매개 면역 질환 또는 Ｔｈ2-매개 면역 질환의 예방, 개선 또는 치료용 조성물 |
| KR20150140104A (ko) * | 2014-06-05 | 2015-12-15 | 정해윤 | 피부개선용 화장품 제조방법 및 이를 이용한 화장품 |
-
2016
- 2016-10-20 KR KR1020160136458A patent/KR101878069B1/ko active Active
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR20200049008A (ko) * | 2018-10-31 | 2020-05-08 | 주식회사 리앤투네이쳐 | 항산화 및 열감소 효능을 갖는 화장품 조성물 |
| KR20200049007A (ko) * | 2018-10-31 | 2020-05-08 | 주식회사 리앤투네이쳐 | 피부노화 방지용 화장품 조성물 |
| CN109528506A (zh) * | 2018-12-14 | 2019-03-29 | 安徽大学 | 一种多效祛痘凝胶 |
| KR102282642B1 (ko) | 2021-01-19 | 2021-07-28 | (주)더마랩 | 5가지 방향성 식물과 5가지 생약소재의 복합추출물을 함유하는 화장료 조성물 |
| WO2024123081A3 (ko) * | 2022-12-09 | 2024-11-07 | 최하도 | 아토피 개선 기능성 화장품 조성물 |
Also Published As
| Publication number | Publication date |
|---|---|
| KR101878069B1 (ko) | 2018-07-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR101878069B1 (ko) | 생약 혼합물의 추출물과 편백 오일을 함유하는 여드름 또는 아토피 피부염의 예방 또는 치료용 조성물 | |
| KR101860496B1 (ko) | 파리지옥풀 추출물을 함유하는 미용 치료용 조성물 | |
| KR102171133B1 (ko) | 병풀 추출물 및 개양귀비 추출물을 포함하는 피부 외용제 조성물 | |
| KR101135172B1 (ko) | 황백, 어성초, 선학초, 작약 및 감초의 혼합추출물을 유효성분으로 함유하는 여드름 예방, 개선 또는 치료용 조성물 | |
| KR101064904B1 (ko) | 천연 추출물을 포함하는 여드름 개선용 화장료 조성물 | |
| KR20200138142A (ko) | 구근추출물을 포함하는 피부 개선용 조성물 | |
| KR101100678B1 (ko) | 식물 추출물을 함유하는 화장료 조성물 | |
| KR102189330B1 (ko) | 구근추출물을 포함하는 피부 개선용 조성물 | |
| KR100772575B1 (ko) | 생약성분 추출물을 함유하는 피부 외용제 조성물 | |
| KR101827771B1 (ko) | 닥나무 추출물을 함유하는 여드름 개선용 화장료 조성물 | |
| KR101917645B1 (ko) | 사카로미세스 효모발효여과물, 아스파라거스줄기 추출물 및 관동꽃 추출물을 포함하는 화장료 조성물 | |
| KR102214985B1 (ko) | 식물추출물 또는 이의 분획물을 유효성분으로 함유하는 피부 상태 개선용 조성물 | |
| KR20210130595A (ko) | 도깨비바늘속 식물 추출물을 유효성분으로 포함하는 민감성 피부용 조성물 | |
| KR102300581B1 (ko) | 식물추출물 또는 이의 분획물을 유효성분으로 함유하는 피부 상태 개선용 조성물 | |
| KR101419588B1 (ko) | 홍삼 오일을 유효성분으로 함유하는 피부 보습용 조성물 | |
| KR102416652B1 (ko) | 미세먼지로 인한 피부자극 완화 및 피부 개선용 화장료 조성물 | |
| KR102169463B1 (ko) | 피부트러블 개선용 화장료 조성물 | |
| KR102257448B1 (ko) | 흑다시마를 유효성분으로 포함하는 화장료 조성물 | |
| KR102686879B1 (ko) | 레티놀과 콜라겐 유효성분을 포함하는 주름 및 모공 개선 조성물 및 이의 제조법 | |
| KR20220001161A (ko) | 천연물 유래 추출물을 포함하는 피부 보호용 조성물 | |
| KR20110104625A (ko) | 아토피 피부염 예방 및 개선효과를 나타내는 황금 가수분해 추출물의 제조방법 및 이를 이용하여 제조된 화장품 | |
| KR101852510B1 (ko) | 닥나무 추출물을 함유하는 피부의 지질 생성 억제 및 피지 분비 감소용 화장료 조성물 | |
| KR20210090870A (ko) | 마이크로바이옴을 이용한 피부 장벽 개선 효과가 우수한 화장료 조성물 | |
| KR102801893B1 (ko) | 나노화된 벌화분 추출물을 유효성분으로 포함하는 여드름 치료용 조성물 | |
| KR102262791B1 (ko) | 한방 발효물을 포함하는 피부 개선을 위한 조성물 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A201 | Request for examination | ||
| PA0109 | Patent application |
Patent event code: PA01091R01D Comment text: Patent Application Patent event date: 20161020 |
|
| PA0201 | Request for examination | ||
| E902 | Notification of reason for refusal | ||
| PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20180110 Patent event code: PE09021S01D |
|
| PG1501 | Laying open of application | ||
| E701 | Decision to grant or registration of patent right | ||
| PE0701 | Decision of registration |
Patent event code: PE07011S01D Comment text: Decision to Grant Registration Patent event date: 20180602 |
|
| PR0701 | Registration of establishment |
Comment text: Registration of Establishment Patent event date: 20180706 Patent event code: PR07011E01D |
|
| PR1002 | Payment of registration fee |
Payment date: 20180706 End annual number: 3 Start annual number: 1 |
|
| PG1601 | Publication of registration | ||
| PR1001 | Payment of annual fee |
Payment date: 20210604 Start annual number: 4 End annual number: 4 |
|
| PR1001 | Payment of annual fee |
Payment date: 20220715 Start annual number: 5 End annual number: 5 |
|
| PR1001 | Payment of annual fee |
Payment date: 20230719 Start annual number: 6 End annual number: 6 |
|
| PR1001 | Payment of annual fee |
Payment date: 20240708 Start annual number: 7 End annual number: 7 |