KR100359996B1 - 감태 추출물을 함유하는 미백 화장료 - Google Patents
감태 추출물을 함유하는 미백 화장료 Download PDFInfo
- Publication number
- KR100359996B1 KR100359996B1 KR1020000048933A KR20000048933A KR100359996B1 KR 100359996 B1 KR100359996 B1 KR 100359996B1 KR 1020000048933 A KR1020000048933 A KR 1020000048933A KR 20000048933 A KR20000048933 A KR 20000048933A KR 100359996 B1 KR100359996 B1 KR 100359996B1
- Authority
- KR
- South Korea
- Prior art keywords
- ecklonia cava
- extract
- cava extract
- whitening
- cosmetics containing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000002537 cosmetic Substances 0.000 title claims abstract description 38
- 230000002087 whitening effect Effects 0.000 title claims abstract description 38
- 241001512722 Ecklonia cava Species 0.000 title claims description 12
- 239000000284 extract Substances 0.000 title abstract description 20
- 229940018973 ecklonia cava extract Drugs 0.000 claims abstract description 51
- 238000000605 extraction Methods 0.000 claims abstract description 12
- 239000002904 solvent Substances 0.000 claims abstract description 11
- 238000004821 distillation Methods 0.000 claims abstract description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 claims description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 8
- 229940058015 1,3-butylene glycol Drugs 0.000 claims description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 6
- 235000019437 butane-1,3-diol Nutrition 0.000 claims description 6
- 238000003756 stirring Methods 0.000 claims description 2
- 102000003425 Tyrosinase Human genes 0.000 abstract description 15
- 108060008724 Tyrosinase Proteins 0.000 abstract description 15
- 230000000694 effects Effects 0.000 abstract description 15
- 230000002401 inhibitory effect Effects 0.000 abstract description 14
- 241001512723 Ecklonia Species 0.000 abstract description 3
- 238000007598 dipping method Methods 0.000 abstract description 2
- 230000000052 comparative effect Effects 0.000 description 13
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 12
- XUMBMVFBXHLACL-UHFFFAOYSA-N Melanin Chemical compound O=C1C(=O)C(C2=CNC3=C(C(C(=O)C4=C32)=O)C)=C2C4=CNC2=C1C XUMBMVFBXHLACL-UHFFFAOYSA-N 0.000 description 12
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 8
- 210000004027 cell Anatomy 0.000 description 8
- BJRNKVDFDLYUGJ-RMPHRYRLSA-N hydroquinone O-beta-D-glucopyranoside Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=CC=C(O)C=C1 BJRNKVDFDLYUGJ-RMPHRYRLSA-N 0.000 description 8
- 239000004615 ingredient Substances 0.000 description 7
- 239000008213 purified water Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 6
- 235000011187 glycerol Nutrition 0.000 description 6
- 210000003491 skin Anatomy 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 239000006071 cream Substances 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- BEJNERDRQOWKJM-UHFFFAOYSA-N kojic acid Chemical compound OCC1=CC(=O)C(O)=CO1 BEJNERDRQOWKJM-UHFFFAOYSA-N 0.000 description 5
- 229960004705 kojic acid Drugs 0.000 description 5
- WZNJWVWKTVETCG-UHFFFAOYSA-N kojic acid Natural products OC(=O)C(N)CN1C=CC(=O)C(O)=C1 WZNJWVWKTVETCG-UHFFFAOYSA-N 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 230000008099 melanin synthesis Effects 0.000 description 5
- PRAKJMSDJKAYCZ-UHFFFAOYSA-N squalane Chemical compound CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C PRAKJMSDJKAYCZ-UHFFFAOYSA-N 0.000 description 5
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 4
- POJWUDADGALRAB-UHFFFAOYSA-N allantoin Chemical compound NC(=O)NC1NC(=O)NC1=O POJWUDADGALRAB-UHFFFAOYSA-N 0.000 description 4
- 229960000271 arbutin Drugs 0.000 description 4
- 229960005070 ascorbic acid Drugs 0.000 description 4
- 235000010323 ascorbic acid Nutrition 0.000 description 4
- 239000011668 ascorbic acid Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- BJRNKVDFDLYUGJ-UHFFFAOYSA-N p-hydroxyphenyl beta-D-alloside Natural products OC1C(O)C(O)C(CO)OC1OC1=CC=C(O)C=C1 BJRNKVDFDLYUGJ-UHFFFAOYSA-N 0.000 description 4
- 239000000419 plant extract Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 229960004418 trolamine Drugs 0.000 description 4
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 4
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 3
- AHMIDUVKSGCHAU-UHFFFAOYSA-N Dopaquinone Natural products OC(=O)C(N)CC1=CC(=O)C(=O)C=C1 AHMIDUVKSGCHAU-UHFFFAOYSA-N 0.000 description 3
- AHMIDUVKSGCHAU-LURJTMIESA-N L-dopaquinone Chemical compound [O-]C(=O)[C@@H]([NH3+])CC1=CC(=O)C(=O)C=C1 AHMIDUVKSGCHAU-LURJTMIESA-N 0.000 description 3
- 240000008415 Lactuca sativa Species 0.000 description 3
- 235000003228 Lactuca sativa Nutrition 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000021355 Stearic acid Nutrition 0.000 description 3
- 230000002421 anti-septic effect Effects 0.000 description 3
- 229940082500 cetostearyl alcohol Drugs 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 239000003205 fragrance Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 230000002335 preservative effect Effects 0.000 description 3
- 239000012488 sample solution Substances 0.000 description 3
- 239000008117 stearic acid Substances 0.000 description 3
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontyl alcohol Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 3
- POJWUDADGALRAB-PVQJCKRUSA-N Allantoin Natural products NC(=O)N[C@@H]1NC(=O)NC1=O POJWUDADGALRAB-PVQJCKRUSA-N 0.000 description 2
- ZAKOWWREFLAJOT-CEFNRUSXSA-N D-alpha-tocopherylacetate Chemical compound CC(=O)OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C ZAKOWWREFLAJOT-CEFNRUSXSA-N 0.000 description 2
- SNPLKNRPJHDVJA-ZETCQYMHSA-N D-panthenol Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCCO SNPLKNRPJHDVJA-ZETCQYMHSA-N 0.000 description 2
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 2
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 2
- 229920002385 Sodium hyaluronate Polymers 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 229960000458 allantoin Drugs 0.000 description 2
- 229940079894 benzophenone-9 Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000000287 crude extract Substances 0.000 description 2
- ZAKOWWREFLAJOT-UHFFFAOYSA-N d-alpha-Tocopheryl acetate Natural products CC(=O)OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C ZAKOWWREFLAJOT-UHFFFAOYSA-N 0.000 description 2
- QDCHWIWENYCPIL-UHFFFAOYSA-L disodium;4-hydroxy-5-(2-hydroxy-4-methoxy-5-sulfonatobenzoyl)-2-methoxybenzenesulfonate Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C(OC)=CC(O)=C1C(=O)C1=CC(S([O-])(=O)=O)=C(OC)C=C1O QDCHWIWENYCPIL-UHFFFAOYSA-L 0.000 description 2
- 238000006911 enzymatic reaction Methods 0.000 description 2
- 239000000686 essence Substances 0.000 description 2
- FOYKKGHVWRFIBD-UHFFFAOYSA-N gamma-tocopherol acetate Natural products CC(=O)OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1 FOYKKGHVWRFIBD-UHFFFAOYSA-N 0.000 description 2
- 229940075529 glyceryl stearate Drugs 0.000 description 2
- 229940071826 hydroxyethyl cellulose Drugs 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- JXTPJDDICSTXJX-UHFFFAOYSA-N n-Triacontane Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCC JXTPJDDICSTXJX-UHFFFAOYSA-N 0.000 description 2
- 229940101267 panthenol Drugs 0.000 description 2
- 235000020957 pantothenol Nutrition 0.000 description 2
- 239000011619 pantothenol Substances 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 239000008055 phosphate buffer solution Substances 0.000 description 2
- 229940010747 sodium hyaluronate Drugs 0.000 description 2
- 239000012064 sodium phosphate buffer Substances 0.000 description 2
- YWIVKILSMZOHHF-QJZPQSOGSA-N sodium;(2s,3s,4s,5r,6r)-6-[(2s,3r,4r,5s,6r)-3-acetamido-2-[(2s,3s,4r,5r,6r)-6-[(2r,3r,4r,5s,6r)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2- Chemical compound [Na+].CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 YWIVKILSMZOHHF-QJZPQSOGSA-N 0.000 description 2
- 229940032094 squalane Drugs 0.000 description 2
- 229940066528 trichloroacetate Drugs 0.000 description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 2
- YEFOAORQXAOVJQ-UHFFFAOYSA-N wuweizischun A Natural products C1C(C)C(C)(O)CC2=CC(OC)=C(OC)C(OC)=C2C2=C1C=C(OC)C(OC)=C2OC YEFOAORQXAOVJQ-UHFFFAOYSA-N 0.000 description 2
- YYGNTYWPHWGJRM-UHFFFAOYSA-N (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene Chemical compound CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C YYGNTYWPHWGJRM-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- ABEXEQSGABRUHS-UHFFFAOYSA-N 16-methylheptadecyl 16-methylheptadecanoate Chemical compound CC(C)CCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCCCC(C)C ABEXEQSGABRUHS-UHFFFAOYSA-N 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 208000001382 Experimental Melanoma Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000202807 Glycyrrhiza Species 0.000 description 1
- 235000001453 Glycyrrhiza echinata Nutrition 0.000 description 1
- 235000006200 Glycyrrhiza glabra Nutrition 0.000 description 1
- 235000017382 Glycyrrhiza lepidota Nutrition 0.000 description 1
- 235000018330 Macadamia integrifolia Nutrition 0.000 description 1
- 240000000912 Macadamia tetraphylla Species 0.000 description 1
- 235000003800 Macadamia tetraphylla Nutrition 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- BHEOSNUKNHRBNM-UHFFFAOYSA-N Tetramethylsqualene Natural products CC(=C)C(C)CCC(=C)C(C)CCC(C)=CCCC=C(C)CCC(C)C(=C)CCC(C)C(C)=C BHEOSNUKNHRBNM-UHFFFAOYSA-N 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 230000009920 chelation Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229910001431 copper ion Inorganic materials 0.000 description 1
- 238000012258 culturing Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229940008099 dimethicone Drugs 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 239000003676 hair preparation Substances 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 229940060384 isostearyl isostearate Drugs 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229940010454 licorice Drugs 0.000 description 1
- 229940069445 licorice extract Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 210000002752 melanocyte Anatomy 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 210000003097 mucus Anatomy 0.000 description 1
- 239000010466 nut oil Substances 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 239000001818 polyoxyethylene sorbitan monostearate Substances 0.000 description 1
- 235000010989 polyoxyethylene sorbitan monostearate Nutrition 0.000 description 1
- 229940113124 polysorbate 60 Drugs 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000002453 shampoo Substances 0.000 description 1
- 210000004927 skin cell Anatomy 0.000 description 1
- 229950011392 sorbitan stearate Drugs 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 229940031439 squalene Drugs 0.000 description 1
- TUHBEKDERLKLEC-UHFFFAOYSA-N squalene Natural products CC(=CCCC(=CCCC(=CCCC=C(/C)CCC=C(/C)CC=C(C)C)C)C)C TUHBEKDERLKLEC-UHFFFAOYSA-N 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 229940099259 vaseline Drugs 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 230000037303 wrinkles Effects 0.000 description 1
- 239000000230 xanthan gum Substances 0.000 description 1
- 229920001285 xanthan gum Polymers 0.000 description 1
- 235000010493 xanthan gum Nutrition 0.000 description 1
- 229940082509 xanthan gum Drugs 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/96—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution
- A61K8/97—Cosmetics or similar toiletry preparations characterised by the composition containing materials, or derivatives thereof of undetermined constitution from algae, fungi, lichens or plants; from derivatives thereof
- A61K8/9706—Algae
- A61K8/9711—Phaeophycota or Phaeophyta [brown algae], e.g. Fucus
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q19/00—Preparations for care of the skin
- A61Q19/02—Preparations for care of the skin for chemically bleaching or whitening the skin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2800/00—Properties of cosmetic compositions or active ingredients thereof or formulation aids used therein and process related aspects
- A61K2800/74—Biological properties of particular ingredients
- A61K2800/78—Enzyme modulators, e.g. Enzyme agonists
- A61K2800/782—Enzyme inhibitors; Enzyme antagonists
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2800/00—Properties of cosmetic compositions or active ingredients thereof or formulation aids used therein and process related aspects
- A61K2800/80—Process related aspects concerning the preparation of the cosmetic composition or the storage or application thereof
- A61K2800/805—Corresponding aspects not provided for by any of codes A61K2800/81 - A61K2800/95
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Biotechnology (AREA)
- Engineering & Computer Science (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Dermatology (AREA)
- Botany (AREA)
- Microbiology (AREA)
- Mycology (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Cosmetics (AREA)
Abstract
Description
| 구분 | 용 매 | 건조중량(g) |
| 실시예 1 | 물 | 387 |
| 실시예 2 | 10% 에탄올 | 362 |
| 실시예 3 | 20% 에탄올 | 325 |
| 실시예 4 | 30% 에탄올 | 350 |
| 실시예 5 | 40% 에탄올 | 337 |
| 실시예 6 | 50% 에탄올 | 350 |
| 실시예 7 | 60% 에탄올 | 312 |
| 실시예 8 | 70% 에탄올 | 300 |
| 실시예 9 | 80% 에탄올 | 238 |
| 실시예 10 | 90% 에탄올 | 263 |
| 실시예 11 | 100% 에탄올 | 51 |
| 실시예 12 | 100% 메탄올 | 178 |
| 실시예 13 | 아세톤 | 14 |
| 실시예 14 | 에틸아세테이트 | 10 |
| 실시예 15 | 부탄올 | 15 |
| 사용 추출물 | 저해효과(%) | |||
| 10 (㎍/㎖) | 20 (㎍/㎖) | 50 (㎍/㎖) | 100 (㎍/㎖) | |
| 실시예 1 | 12.34 | 14.56 | 15.82 | 39.56 |
| 실시예 2 | 11.39 | 16.46 | 26.27 | 35.13 |
| 실시예 3 | 16.60 | 31.58 | 47.37 | 61.94 |
| 실시예 4 | 27.12 | 35.88 | 56.21 | 72.32 |
| 실시예 5 | 30.06 | 45.57 | 61.39 | 74.37 |
| 실시예 6 | 35.44 | 50.32 | 70.25 | 82.00 |
| 실시예 7 | 18.04 | 36.71 | 58.86 | 72.47 |
| 실시예 8 | 39.23 | 48.34 | 67.96 | 82.04 |
| 실시예 9 | 40.88 | 50.28 | 66.30 | 78.45 |
| 실시예 10 | 43.65 | 56.637 | 73.76 | 82.87 |
| 실시예 11 | 38.67 | 58.56 | 77.07 | 88.12 |
| 실시예 12 | 29.79 | 47.61 | 64.63 | 81.38 |
| 실시예 13 | 53.72 | 63.30 | 78.99 | 87.50 |
| 실시예 14 | 31.91 | 48.94 | 54.52 | 66.49 |
| 실시예 15 | 23.94 | 47.61 | 58.24 | 72.87 |
| 사용한 미백물질 | IC50(㎍/㎖) |
| 감태 추출물(실시예10) | 14.89 |
| 상백피 추출물(비교예1) | 17.87 |
| 감초 추출물(비교예2) | 52.28 |
| 오미자 추출물(비교예3) | 29.04 |
| 알부틴(비교예4) | 68.32 |
| 코직산(비교예5) | 6.21 |
| 아스코르빅산(비교예6) | 70.65 |
| 감태추출물 사용농도(㎍/㎖) | 멜라닌 생성 저해율(%) |
| 50 | 74.8 |
| 100 | 87.9 |
| 150 | 92.6 |
| 200 | 94.3 |
| 성 분 | 함량 (중량%) |
| 감태 추출물 | 0.1 |
| 1,3-부틸렌 글리콜 | 6.0 |
| 소듐 히아루로네이트 | 2.0 |
| 글리세린 | 4.0 |
| 피이지 4000 | 1.0 |
| 폴리 솔베이트 20 | 0.5 |
| 에탄올 | 10.0 |
| 방부제 | 적량 |
| 벤조페논-9 | 0.05 |
| 향 | 적량 |
| 정제수 | 적량 |
| 합 계 | 100 |
| 성 분 | 함량(중량%) |
| 감태 추출물 | 0.1 |
| 스테아린산 | 0.4 |
| 1,3-부틸렌 글리콜 | 6.0 |
| 세토스테아릴 알콜 | 1.2 |
| 글리세린 | 4.0 |
| 글리세릴 스테아레이트 | 1.0 |
| 트리에탄올아민 | 0.25 |
| 토코페릴 아세테이트 | 3.0 |
| 유동 파라핀 | 5.0 |
| 스쿠알란 | 3.0 |
| 마카다미아 너트 오일 | 2.0 |
| 폴리 솔베이트 60 | 1.5 |
| 솔비탄 세스퀴올레이트 | 0.6 |
| 카르복시비닐 폴리머 | 0.15 |
| 방부제 | 적량 |
| 향 | 적량 |
| 정제수 | 잔량 |
| 합 계 | 100 |
| 성 분 | 함량(중량 %) |
| 감태 추출물 | 0.1 |
| 바셀린 | 7.0 |
| 세토스테아릴 알콜 | 2.5 |
| 글리세릴 스테아레이트 | 2.0 |
| 스테아린산 | 1.5 |
| 유동 파라핀 | 10.0 |
| 밀납 | 2.0 |
| 폴리 솔베이트 60 | 1.5 |
| 솔비탄 세스퀴올레이트 | 0.8 |
| 스쿠알란 | 3.0 |
| 1,3-부틸렌 글리콜 | 6.0 |
| 글리세린 | 4.0 |
| 트리에탄올아민 | 0.5 |
| 토코페릴 아세테이트 | 0.1 |
| 방부제 | 적량 |
| 향 | 적량 |
| 정제수 | 잔량 |
| 합 계 | 100 |
| 성 분 | 함량 (중량%) |
| 감태 추출물 | 0.1 |
| 글리세린 | 10.0 |
| 피이지 1500 | 2.0 |
| 알란토인 | 0.1 |
| 판테놀 | 0.3 |
| 이.디.티이.에이(EDTA) | 0.02 |
| 벤조페논-9 | 0.04 |
| 히드록시 에틸 셀룰로오스, | 0.1 |
| 소듐 히아루로네이트 | 8.0 |
| 카르복시비닐 폴리머 | 0.2 |
| 트리에탄올아민 | 0.18 |
| 옥틸도데세스-25 | 0.6 |
| 에탄올 | 6.0 |
| 방부제, 향, 색소 | 미량 |
| 정제수 | 잔량 |
| 합 계 | 100 |
| 성 분 | 함량 (중량%) |
| 감태 추출물 | 0.1 |
| 글리세릴 스테아레이트 | 2.0 |
| 세토스테아릴 알콜 | 2.5 |
| 스테아린산 | 1.0 |
| 폴리솔베이트 60 | 1.5 |
| 솔비탄 스테아레이트 | 0.6 |
| 이소스테아릴 이소스테아레이트 | 5.0 |
| 스쿠알렌 | 5.0 |
| 광물유 | 35.0 |
| 디메치콘 | 1.0 |
| 산탄검 | 0.1 |
| 히드록시에틸 셀룰로오스 | 0.12 |
| 글리세린 | 6.0 |
| 트리에탄올 아민 | 0.5 |
| 방부제, 향, 색소 | 적량 |
| 정제수 | 잔량 |
| 합 계 | 100 |
| 성 분 | 함량 (중량%) |
| 감태 추출물 | 0.1 |
| 폴리비닐 알콜 | 15.0 |
| 셀룰로오스 검 | 0.15 |
| 글리세린 | 3.0 |
| 피이지 1500 | 2.0 |
| 판테놀 | 0.4 |
| 알란토인 | 0.1 |
| 에탄올 | 6.0 |
| 피이지 40 경화 피마자유 | 0.3 |
| 방부제, 향, 색소 | 미량 |
| 정제수 | 잔량 |
| 합 계 | 100 |
| 시험물질 | ΔL |
| 감태 추출물 함유 화장료 | 3.6 |
| 감태 추출물이 함유되지 않은 화장료 | 0.8 |
Claims (5)
- 감태(Ecklonia cava) 추출물을 함유하는 미백 화장료.
- 제1항에 있어서, 상기 감태 추출물은 건조 및 분쇄된 감태에 상기 감태 건조중량에 대해 1∼15배의 물 및/또는 유기 추출용매를 첨가하고, 10∼50℃에서 1시간∼15일간 침적 또는 교반하여 추출용액을 얻은 다음, 감압 증류하여 얻어지는 것을 특징으로 하는 감태 추출물을 함유하는 미백 화장료.
- 제1항에 있어서, 상기 추출용매는 물, 메탄올, 에탄올, 부탄올, 에틸 아세테이트, 아세토니트릴, 아세톤, 1,3-부틸렌 글리콜, 및 물과 이들의 혼합물로 이루어진 군으로 부터 하나 또는 그 이상을 선택하여 사용하는 것을 특징으로 하는 감태 추출물을 함유하는 미백 화장료.
- 제1항에 있어서, 상기 감태 추출물은 화장료의 건조중량에 대하여 0.001∼5중량%로 함유되는 것을 특징으로 하는 감태 추출물을 함유하는 미백 화장료.
- 제4항에 있어서, 상기 감태 추출물은 화장료의 건조중량에 대하여 0.001∼1 중량%로 함유되는 것을 특징으로 하는 감태 추출물을 함유하는 미백 화장료.
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020000048933A KR100359996B1 (ko) | 2000-08-23 | 2000-08-23 | 감태 추출물을 함유하는 미백 화장료 |
| JP2001087086A JP2002080339A (ja) | 2000-08-23 | 2001-03-26 | カジメ抽出物を含有する美白化粧料 |
| US09/895,516 US20020044915A1 (en) | 2000-08-23 | 2001-06-28 | Whitening cosmetics containing extracts from Ecklonia cava |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020000048933A KR100359996B1 (ko) | 2000-08-23 | 2000-08-23 | 감태 추출물을 함유하는 미백 화장료 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| KR20020015816A KR20020015816A (ko) | 2002-03-02 |
| KR100359996B1 true KR100359996B1 (ko) | 2002-11-07 |
Family
ID=19684687
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020000048933A Expired - Lifetime KR100359996B1 (ko) | 2000-08-23 | 2000-08-23 | 감태 추출물을 함유하는 미백 화장료 |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US20020044915A1 (ko) |
| JP (1) | JP2002080339A (ko) |
| KR (1) | KR100359996B1 (ko) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2010098533A3 (ko) * | 2009-02-26 | 2010-10-21 | 부경대학교 산학협력단 | 피부 미백활성을 갖는 감태 추출물 |
| KR101217472B1 (ko) * | 2006-07-06 | 2013-01-02 | 코스맥스 주식회사 | 초임계 이산화탄소를 이용하여 제조한 높은 항산화 활성을갖는 감태추출물 및 이의 제조방법 |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR100904759B1 (ko) * | 2008-11-12 | 2009-06-29 | 아쿠아그린텍(주) | 감태 추출물을 포함하는 미백 화장용 조성물 |
| US20110262505A1 (en) | 2010-04-22 | 2011-10-27 | Gina Athwal | Seaweed-derived cosmetic compositions |
| WO2012086853A1 (en) * | 2010-12-20 | 2012-06-28 | Korea Food Research Institute | Composition for positively allosterically modulating gabaa-benzodiazepine receptor and composition for producing sedative-hypnotic effects containing ecklonia cava extract and ecklonia kurome extract |
| KR101313724B1 (ko) * | 2011-10-07 | 2013-10-02 | 부경대학교 산학협력단 | 감태 추출물을 주성분으로 하는 발모제 및 이를 함유하는 화장료 조성물 |
| KR101541289B1 (ko) | 2015-04-13 | 2015-08-03 | 주식회사 코스메카코리아 | 해마, 감태 및 우뭇가사리 추출물을 함유하는 항노화 화장료 조성물 |
| JP7104956B2 (ja) * | 2017-06-28 | 2022-07-22 | 日本メナード化粧品株式会社 | メラノサイト分化誘導抑制剤及びその使用方法 |
| KR102220581B1 (ko) * | 2018-09-21 | 2021-02-25 | 대한민국 | 감태 열수추출물의 추출방법 및 추출된 감태 열수추출물을 이용한 어묵의 제조방법 |
| CN113116778B (zh) * | 2021-04-16 | 2022-03-08 | 广州中草世家化妆品有限公司 | 一种人参提取液及其制备方法及其应用 |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62286907A (ja) * | 1986-06-05 | 1987-12-12 | Daiichi Seimo Kk | 化粧料又は浴剤の製法 |
| JPH0495016A (ja) * | 1990-08-08 | 1992-03-27 | Mikimoto Pharmaceut Co Ltd | 美白化粧料 |
| KR970002049A (ko) * | 1995-06-12 | 1997-01-24 | 스팀 및 연료 오일을 조절하고 배출하는 밸브에 사용하거나 그 밸브와 결합하여 사용하는 밀봉 장치 및, 그 밀봉 장치용 밸브 시트 | |
| KR0155426B1 (ko) * | 1995-12-11 | 1998-11-16 | 곽성학 | 다시마 분말이 첨가된 화장비누 |
| JP2000109407A (ja) * | 1998-10-05 | 2000-04-18 | Kao Corp | 海藻抽出物の精製方法 |
-
2000
- 2000-08-23 KR KR1020000048933A patent/KR100359996B1/ko not_active Expired - Lifetime
-
2001
- 2001-03-26 JP JP2001087086A patent/JP2002080339A/ja active Pending
- 2001-06-28 US US09/895,516 patent/US20020044915A1/en not_active Abandoned
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62286907A (ja) * | 1986-06-05 | 1987-12-12 | Daiichi Seimo Kk | 化粧料又は浴剤の製法 |
| JPH0495016A (ja) * | 1990-08-08 | 1992-03-27 | Mikimoto Pharmaceut Co Ltd | 美白化粧料 |
| KR970002049A (ko) * | 1995-06-12 | 1997-01-24 | 스팀 및 연료 오일을 조절하고 배출하는 밸브에 사용하거나 그 밸브와 결합하여 사용하는 밀봉 장치 및, 그 밀봉 장치용 밸브 시트 | |
| KR0155426B1 (ko) * | 1995-12-11 | 1998-11-16 | 곽성학 | 다시마 분말이 첨가된 화장비누 |
| JP2000109407A (ja) * | 1998-10-05 | 2000-04-18 | Kao Corp | 海藻抽出物の精製方法 |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR101217472B1 (ko) * | 2006-07-06 | 2013-01-02 | 코스맥스 주식회사 | 초임계 이산화탄소를 이용하여 제조한 높은 항산화 활성을갖는 감태추출물 및 이의 제조방법 |
| WO2010098533A3 (ko) * | 2009-02-26 | 2010-10-21 | 부경대학교 산학협력단 | 피부 미백활성을 갖는 감태 추출물 |
| KR101016761B1 (ko) * | 2009-02-26 | 2011-02-25 | 부경대학교 산학협력단 | 피부 미백활성을 갖는 감태 추출물 |
Also Published As
| Publication number | Publication date |
|---|---|
| JP2002080339A (ja) | 2002-03-19 |
| US20020044915A1 (en) | 2002-04-18 |
| KR20020015816A (ko) | 2002-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5872254A (en) | Whitening cosmetics containing ramulus mori extracts | |
| EP2146688B1 (en) | Use of an extract of magnolia sieboldii for skin whitening | |
| KR100504408B1 (ko) | 생큐노라이드 a를 포함하는 피부 미백용 화장료 조성물 | |
| KR100359996B1 (ko) | 감태 추출물을 함유하는 미백 화장료 | |
| KR102111648B1 (ko) | 왕벚나무 잎 생물전환추출물의 제조방법 및 이를 함유하는 피부미백용 화장료 조성물 | |
| KR20080098925A (ko) | 목단피 추출물을 함유하는 화장료 조성물 | |
| KR100260510B1 (ko) | 상지추출물의 분배추출물을 함유하는 미백 화장료 | |
| KR102289957B1 (ko) | 백향과 추출물의 분획물을 포함하는 피부 미백용 화장료 조성물 | |
| KR100530669B1 (ko) | 락테이트 및 감초 추출물을 포함하는 피부 미백용 화장료조성물 | |
| KR100495454B1 (ko) | 피토라이트를 포함하는 미백 화장료 조성물 | |
| KR20040087644A (ko) | 배나무 추출물을 함유하는 미백 화장료 조성물 | |
| KR101061722B1 (ko) | 연호색 추출물을 유효성분으로 함유하는 피부미백용 화장료조성물 | |
| KR102325393B1 (ko) | 소계 추출물의 생물전환물을 유효성분으로 함유하는 피부 미백용 화장료 조성물 | |
| KR102168533B1 (ko) | 한약재 추출물을 포함하는 미백 또는 안색 개선용 화장료 조성물 | |
| KR102336538B1 (ko) | 피부 미백 효과를 갖는 천연 복합 추출물을 함유하는 피부 미백용 조성물 | |
| KR100416400B1 (ko) | 천화분 추출물의 제조방법 및 이를 함유하는 피부 미백용외용제 조성물 | |
| KR102202554B1 (ko) | 삼백초잎 추출물, 포도씨 추출물, 마치현 추출물 및 고두밥 발효물을 포함하는 피부 미백용 화장료 조성물 | |
| KR102855855B1 (ko) | 인삼꽃 추출물의 분획물을 포함하는 피부 미백용 화장료 조성물 | |
| KR100681700B1 (ko) | 생큐노라이드 a 및 글루콘산을 유효성분으로 함유하는피부 미백용 화장료 조성물 | |
| KR20030087236A (ko) | 천궁 추출물을 포함하는 피부 미백용 화장료 조성물 | |
| KR100449345B1 (ko) | 엠블리카 추출물 및 상지 추출물을 포함하는 피부 미백용화장료 조성물 | |
| KR20030015536A (ko) | 넓패 추출물을 함유하는 미백 화장료 | |
| KR102393811B1 (ko) | 미생물 발효액을 포함하고 피부 미백활성이 개선된 피부 미백용 조성물 | |
| US8268295B2 (en) | Cosmetic composition for skin whitening comprising the extract of Magnolia sieboldii as active ingredient | |
| KR102308715B1 (ko) | 가는 갯능쟁이 추출물을 포함하는 화장료 조성물 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A201 | Request for examination | ||
| PA0109 | Patent application |
Patent event code: PA01091R01D Comment text: Patent Application Patent event date: 20000823 |
|
| PA0201 | Request for examination | ||
| PG1501 | Laying open of application | ||
| E701 | Decision to grant or registration of patent right | ||
| PE0701 | Decision of registration |
Patent event code: PE07011S01D Comment text: Decision to Grant Registration Patent event date: 20020926 |
|
| GRNT | Written decision to grant | ||
| PR0701 | Registration of establishment |
Comment text: Registration of Establishment Patent event date: 20021024 Patent event code: PR07011E01D |
|
| PR1002 | Payment of registration fee |
Payment date: 20021025 End annual number: 3 Start annual number: 1 |
|
| PG1601 | Publication of registration | ||
| PR1001 | Payment of annual fee |
Payment date: 20051025 Start annual number: 4 End annual number: 6 |
|
| PR1001 | Payment of annual fee |
Payment date: 20081024 Start annual number: 7 End annual number: 7 |
|
| PR1001 | Payment of annual fee |
Payment date: 20091023 Start annual number: 8 End annual number: 8 |
|
| PR1001 | Payment of annual fee |
Payment date: 20101013 Start annual number: 9 End annual number: 9 |
|
| PR1001 | Payment of annual fee |
Payment date: 20111021 Start annual number: 10 End annual number: 10 |
|
| FPAY | Annual fee payment |
Payment date: 20121023 Year of fee payment: 11 |
|
| PR1001 | Payment of annual fee |
Payment date: 20121023 Start annual number: 11 End annual number: 11 |
|
| FPAY | Annual fee payment |
Payment date: 20131024 Year of fee payment: 12 |
|
| PR1001 | Payment of annual fee |
Payment date: 20131024 Start annual number: 12 End annual number: 12 |
|
| FPAY | Annual fee payment |
Payment date: 20141021 Year of fee payment: 13 |
|
| PR1001 | Payment of annual fee |
Payment date: 20141021 Start annual number: 13 End annual number: 13 |
|
| FPAY | Annual fee payment |
Payment date: 20151021 Year of fee payment: 14 |
|
| PR1001 | Payment of annual fee |
Payment date: 20151021 Start annual number: 14 End annual number: 14 |
|
| FPAY | Annual fee payment |
Payment date: 20161024 Year of fee payment: 15 |
|
| PR1001 | Payment of annual fee |
Payment date: 20161024 Start annual number: 15 End annual number: 15 |
|
| FPAY | Annual fee payment |
Payment date: 20171024 Year of fee payment: 16 |
|
| PR1001 | Payment of annual fee |
Payment date: 20171024 Start annual number: 16 End annual number: 16 |
|
| FPAY | Annual fee payment |
Payment date: 20180928 Year of fee payment: 17 |
|
| PR1001 | Payment of annual fee |
Payment date: 20180928 Start annual number: 17 End annual number: 17 |
|
| FPAY | Annual fee payment |
Payment date: 20191021 Year of fee payment: 18 |
|
| PR1001 | Payment of annual fee |
Payment date: 20191021 Start annual number: 18 End annual number: 18 |
|
| PC1801 | Expiration of term |
Termination date: 20210223 Termination category: Expiration of duration |