JPS57146773A - Dihydropyrrolo(2,1-alpha)isoquinoline derivative - Google Patents
Dihydropyrrolo(2,1-alpha)isoquinoline derivativeInfo
- Publication number
- JPS57146773A JPS57146773A JP3345181A JP3345181A JPS57146773A JP S57146773 A JPS57146773 A JP S57146773A JP 3345181 A JP3345181 A JP 3345181A JP 3345181 A JP3345181 A JP 3345181A JP S57146773 A JPS57146773 A JP S57146773A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- formula
- dihydropyrrolo
- alpha
- lower alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 125000002183 isoquinolinyl group Chemical class C1(=NC=CC2=CC=CC=C12)* 0.000 title 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 3
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 abstract 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- -1 (substituted) amino Chemical group 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 150000001450 anions Chemical class 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 239000003814 drug Substances 0.000 abstract 1
- 229940079593 drug Drugs 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
Landscapes
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Abstract
NEW MATERIAL:The compound of formulaI[X and Y are H, lower alkoxy or lower alkyl; R1 and R2 are aryl, (substituted) amino, or lower alkylthio].
EXAMPLE: The compound of formula II.
USE: The compound is expected to be a drug having hypotensitve activity.
PROCESS: The compound of formulaIcan be prepared by reacting the cyclopropenium salt of formula III (Zθ is anion; R3 is lower alkyl) with tetrahydroquinoline of formula IV in a solvent such as dimethylformamide at normal temperature for several minutesWseveral hours adding a basic substance such as t-BuOH to the reaction system.
COPYRIGHT: (C)1982,JPO&Japio
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3345181A JPS57146773A (en) | 1981-03-09 | 1981-03-09 | Dihydropyrrolo(2,1-alpha)isoquinoline derivative |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3345181A JPS57146773A (en) | 1981-03-09 | 1981-03-09 | Dihydropyrrolo(2,1-alpha)isoquinoline derivative |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS57146773A true JPS57146773A (en) | 1982-09-10 |
Family
ID=12386895
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP3345181A Pending JPS57146773A (en) | 1981-03-09 | 1981-03-09 | Dihydropyrrolo(2,1-alpha)isoquinoline derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS57146773A (en) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5963140U (en) * | 1982-10-21 | 1984-04-25 | ワイケイケイ株式会社 | Sunroom |
-
1981
- 1981-03-09 JP JP3345181A patent/JPS57146773A/en active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5963140U (en) * | 1982-10-21 | 1984-04-25 | ワイケイケイ株式会社 | Sunroom |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MY109731A (en) | Process for preparing aryl piperazinyl-heterocyclic compounds. | |
| CA2095587A1 (en) | Process for preparing aryl piperazinyl-hetero-cyclic compounds | |
| JPS56131565A (en) | 4-substituted-2-oxoazetidine compound and its preparation | |
| JPS56103168A (en) | Thiazole derivative, its preparation, and antihistaminic agent containing the same | |
| JPS57146773A (en) | Dihydropyrrolo(2,1-alpha)isoquinoline derivative | |
| JPS57183768A (en) | 4-methyl-5-(o-carboxyphenyl)carbamoylthiazole derivative and its preparation | |
| JPS57131771A (en) | Novel pyrimidine derivative | |
| JPS5767589A (en) | Carbamic acid esters | |
| JPS57200392A (en) | Penem-3-carboxylic acid derivative and its preparation | |
| JPS57142966A (en) | (1-alkyl-2-pyrrolyl)glyoxylic acid amide derivative | |
| JPS57167964A (en) | Preparation of (4r)-3-substituted-4-(substituted or unsubstituted carboxymethyl)-2-azetidinone derivative | |
| JPS55136265A (en) | Quinoline derivative having formylstyryl group and its preparation | |
| JPS55160794A (en) | N6-substituted cordycepin and its preparation | |
| JPS5793981A (en) | Carba-2-penem compound and its preparation | |
| JPS57165371A (en) | Preparation of n-acylcarnosine | |
| JPS57134453A (en) | Polyprenylacetone hydrazone derivative and its preparation | |
| JPS56154483A (en) | Preparation or pyrrole derivative | |
| JPS57134469A (en) | Tetrahydroisoquinoline derivative and its preparation | |
| JPS643157A (en) | 2-aminobenzyl alcohol derivative | |
| JPS55164677A (en) | 1-benzylimidazole derivative | |
| JPS57156474A (en) | Novel 3,5-disubstitution product of 1,2,4-dithiazolylium salt | |
| JPS57144254A (en) | 2-substituted-2-oxoazetidine derivative and its preparation | |
| JPS56115792A (en) | Novel phosphorus compound and antitumor agent containing the same | |
| JPS5473797A (en) | Pyride 3.2.1-jk carbazole derivative | |
| JPS54112856A (en) | Preparation of thiophene derivative |