JPS57102892A - Thiopyranopyridobenzoxazol-7-one derivative - Google Patents
Thiopyranopyridobenzoxazol-7-one derivativeInfo
- Publication number
- JPS57102892A JPS57102892A JP17994880A JP17994880A JPS57102892A JP S57102892 A JPS57102892 A JP S57102892A JP 17994880 A JP17994880 A JP 17994880A JP 17994880 A JP17994880 A JP 17994880A JP S57102892 A JPS57102892 A JP S57102892A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- formula
- formulai
- molar amount
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 abstract 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 abstract 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 abstract 2
- -1 Methyl 1,2,4a,5,6,13a-hexahydro-4H,7H-thiopyrano[4',3':2,3]pyrido[2, 1-b]benzoxazol-7-on-4a-yl-carboxylate Chemical compound 0.000 abstract 1
- 208000007536 Thrombosis Diseases 0.000 abstract 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 229940121363 anti-inflammatory agent Drugs 0.000 abstract 1
- 239000002260 anti-inflammatory agent Substances 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 238000000034 method Methods 0.000 abstract 1
- 238000007363 ring formation reaction Methods 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
Landscapes
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Abstract
NEW MATERIAL:A compound of formulaI(R<1> is H, halogen or lower alkyl; R<2> is H, carboxyl or lower alkoxycarbonyl; X is O or S; n is 0, 1 or 2) and a salt thereof. EXAMPLE:Methyl 1,2,4a,5,6,13a-hexahydro-4H,7H-thiopyrano[4',3':2,3]pyrido[2, 1-b]benzoxazol-7-on-4a-yl-carboxylate. USE:An anti-inflammatory agent and a preventing agent or a remedy for thrombosis. PROCESS:A compound of formula II is subjected to the ring closing reaction with a compound of formula III in an equimolar amount - excess molar amount in a solvent, e.g. chloroform, at room temperature - 200 deg.C to give the compound of formulaI, The presence of p-toluenesulfonic acid, etc. in a molar amount of 0.5 - excess based on the compound of formula II permits the reaction to advance suitably.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP17994880A JPS6056159B2 (en) | 1980-12-18 | 1980-12-18 | Thiopyranopyridobenzoxazol-7-one derivative |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP17994880A JPS6056159B2 (en) | 1980-12-18 | 1980-12-18 | Thiopyranopyridobenzoxazol-7-one derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57102892A true JPS57102892A (en) | 1982-06-26 |
| JPS6056159B2 JPS6056159B2 (en) | 1985-12-09 |
Family
ID=16074739
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP17994880A Expired JPS6056159B2 (en) | 1980-12-18 | 1980-12-18 | Thiopyranopyridobenzoxazol-7-one derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS6056159B2 (en) |
-
1980
- 1980-12-18 JP JP17994880A patent/JPS6056159B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6056159B2 (en) | 1985-12-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS559058A (en) | 1-(3-mercapto-2-methylpropanoyl)prolyl amino acid derivative | |
| JPS56131565A (en) | 4-substituted-2-oxoazetidine compound and its preparation | |
| JPS57102892A (en) | Thiopyranopyridobenzoxazol-7-one derivative | |
| JPS55133366A (en) | Thiazole derivative | |
| JPS6425786A (en) | Imidazothiadiazine derivative and production thereof | |
| JPS5639085A (en) | Chromone derivative and its preparation | |
| JPS6419084A (en) | Thiazolopyridine compound | |
| JPS5515457A (en) | Dithiocarbamic acid derivative | |
| JPS5564592A (en) | Thiazolo 3, 2-a pyrimidine derivative, its preparation, and drug comprising it | |
| JPS5754177A (en) | Substituted thiazole derivative | |
| JPS5492956A (en) | 2-oxobenzothiazoline fatty acid amide and its preparation | |
| JPS5566592A (en) | 7-alkoxythiazolo 3,2-a pyrimidine derivative, its preparation, and drug containing the same | |
| JPS5759856A (en) | Benzene derivative | |
| JPS5564591A (en) | Thiazolo 3, 2-a pyrimidine derivative, its preparation, and drug comprising it | |
| JPS57197258A (en) | Sulfonic ester derivative and its preparation | |
| JPS5721321A (en) | Antihyperlipemic agent | |
| JPS5540645A (en) | Benzopyrone derivative | |
| JPS57109791A (en) | Thiopyranopyridine derivative | |
| JPS5549386A (en) | Heterocyclic compound and its acid addition salt | |
| JPS5473797A (en) | Pyride 3.2.1-jk carbazole derivative | |
| JPS56115780A (en) | Phenoxyalkaneacid derivative substituted by heterocyclic ring containing nitrogen and sulfur, and its preparation | |
| JPS5618955A (en) | Beta-lactam-based antibiotic | |
| JPS54100384A (en) | Novel penicillamine derivative | |
| JPS55104266A (en) | Novel pyridone derivative | |
| JPS5581882A (en) | Preparation of hexahydronaphtho(1,2':4,5)imidazo(2,1-b)thiazole derivative |