JPS56145250A - Polymerizable quaternary ammonium compound - Google Patents
Polymerizable quaternary ammonium compoundInfo
- Publication number
- JPS56145250A JPS56145250A JP4765280A JP4765280A JPS56145250A JP S56145250 A JPS56145250 A JP S56145250A JP 4765280 A JP4765280 A JP 4765280A JP 4765280 A JP4765280 A JP 4765280A JP S56145250 A JPS56145250 A JP S56145250A
- Authority
- JP
- Japan
- Prior art keywords
- compound shown
- formula
- polymerizable
- properties
- quaternary ammonium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000003856 quaternary ammonium compounds Chemical class 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 4
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 239000000178 monomer Substances 0.000 abstract 2
- 239000000126 substance Substances 0.000 abstract 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 abstract 1
- OYNZJZVQLMGGLB-UHFFFAOYSA-N C[N+](C)(CC([O-])=O)C(C=C)C1=CC=CC=C1 Chemical compound C[N+](C)(CC([O-])=O)C(C=C)C1=CC=CC=C1 OYNZJZVQLMGGLB-UHFFFAOYSA-N 0.000 abstract 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 abstract 1
- 230000002378 acidificating effect Effects 0.000 abstract 1
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 229960003237 betaine Drugs 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000005842 heteroatom Chemical group 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 239000003960 organic solvent Substances 0.000 abstract 1
- 150000003839 salts Chemical group 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4765280A JPS56145250A (en) | 1980-04-10 | 1980-04-10 | Polymerizable quaternary ammonium compound |
| GB8111045A GB2075970B (en) | 1980-04-10 | 1981-04-08 | Polymerisable amino acid compounds and their production |
| CA000375135A CA1161436A (en) | 1980-04-10 | 1981-04-09 | Polymerizable amino acid compounds and their production |
| DE19813114360 DE3114360A1 (de) | 1980-04-10 | 1981-04-09 | Polymerisierbare aminosaeureverbindungen und ihre herstellung |
| US06/372,729 US4452746A (en) | 1980-04-10 | 1982-04-28 | Polymerizable amino acid compounds and their production |
| US06/594,826 US4543216A (en) | 1980-04-10 | 1984-03-29 | Polymerizable amino acid compounds and their production |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4765280A JPS56145250A (en) | 1980-04-10 | 1980-04-10 | Polymerizable quaternary ammonium compound |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS56145250A true JPS56145250A (en) | 1981-11-11 |
| JPS6353182B2 JPS6353182B2 (enrdf_load_stackoverflow) | 1988-10-21 |
Family
ID=12781176
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP4765280A Granted JPS56145250A (en) | 1980-04-10 | 1980-04-10 | Polymerizable quaternary ammonium compound |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS56145250A (enrdf_load_stackoverflow) |
-
1980
- 1980-04-10 JP JP4765280A patent/JPS56145250A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6353182B2 (enrdf_load_stackoverflow) | 1988-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2090967A1 (en) | Water soluble camptothecin analogues, processes and methods | |
| JPS5690031A (en) | Preparation of aromatic aldehyde | |
| JPS57136567A (en) | N-2-hydroxy-3-substituted piperidine compound | |
| JPS568365A (en) | Nitrogen-containing heterocyclic compounds bearing acetal groups and its production | |
| JPS56145250A (en) | Polymerizable quaternary ammonium compound | |
| JPS57179146A (en) | Amidine compound | |
| JPS5695142A (en) | Preparation of aliphatic aldehyde | |
| JPS5583791A (en) | 7-methoxycephalosporin derivative and its preparation | |
| JPS56115751A (en) | Preparation of novel 3-acylamino-4-hydroxy-alpha- aralkylaminomethyl benzyl alcohol | |
| JPS5585551A (en) | New tricycloundecane amino acid amide | |
| JPS57200331A (en) | Preparation of dicyclopentenyloxyalkyl carboxylate | |
| JPS5714579A (en) | Novel hydroxybenzylidenehydrazinophthalazine derivative | |
| JPS572297A (en) | Moranoline derivative and its preparation | |
| JPS56145249A (en) | Polymerizable amino acid compound | |
| JPS57159788A (en) | Unsaturated compound having bicyclo-orthoester group | |
| JPS57108079A (en) | Delta2-1,2,4-triazolin-5-one deriviative, its preparation and use | |
| JPS5524126A (en) | Formylstilbazolium salt and its preparation | |
| JPS57192360A (en) | Isoprenylamine derivative | |
| JPS5762258A (en) | Preparation of 5-alkanoyl-1,4-dihydropyridine-3-carboxylic acid aminoalkyl ester derivative | |
| JPS56152442A (en) | Novel basic monomer | |
| JPS57144233A (en) | Cyclopentene derivative | |
| JPS56127378A (en) | 2-alkoxyindolizine derivative and its preparation | |
| JPS5687542A (en) | Preparation of amino acid ester | |
| JPS57139053A (en) | Preparation of benzanilide compound | |
| JPS5714593A (en) | Nitro-beta-trialkylsilystyrene oxide and its preparation |