JPS5379858A - Sulfamoylbenzoate - Google Patents
SulfamoylbenzoateInfo
- Publication number
- JPS5379858A JPS5379858A JP15510677A JP15510677A JPS5379858A JP S5379858 A JPS5379858 A JP S5379858A JP 15510677 A JP15510677 A JP 15510677A JP 15510677 A JP15510677 A JP 15510677A JP S5379858 A JPS5379858 A JP S5379858A
- Authority
- JP
- Japan
- Prior art keywords
- sulfamoylbenzoate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- JOMQIRBLMOXBAZ-UHFFFAOYSA-N sulfamoyl benzoate Chemical compound NS(=O)(=O)OC(=O)C1=CC=CC=C1 JOMQIRBLMOXBAZ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/325—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
- C07D207/327—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrrole Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1630976A CH628622A5 (de) | 1976-12-24 | 1976-12-24 | Verfahren zur herstellung von neuen in 4-stellung substituierten 3-sulfamoylbenzoesaeuren. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS5379858A true JPS5379858A (en) | 1978-07-14 |
Family
ID=4416194
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP15510677A Pending JPS5379858A (en) | 1976-12-24 | 1977-12-24 | Sulfamoylbenzoate |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4176190A (enEXAMPLES) |
| JP (1) | JPS5379858A (enEXAMPLES) |
| AT (1) | AT362350B (enEXAMPLES) |
| AU (1) | AU515286B2 (enEXAMPLES) |
| BE (1) | BE862275A (enEXAMPLES) |
| CA (1) | CA1083160A (enEXAMPLES) |
| CH (4) | CH628622A5 (enEXAMPLES) |
| DD (1) | DD134641A5 (enEXAMPLES) |
| DE (1) | DE2756783A1 (enEXAMPLES) |
| DK (1) | DK575177A (enEXAMPLES) |
| ES (1) | ES465390A1 (enEXAMPLES) |
| FI (1) | FI773846A7 (enEXAMPLES) |
| FR (1) | FR2375211A1 (enEXAMPLES) |
| GB (1) | GB1592295A (enEXAMPLES) |
| HU (1) | HU177298B (enEXAMPLES) |
| IE (1) | IE46279B1 (enEXAMPLES) |
| IT (1) | IT1092247B (enEXAMPLES) |
| NL (1) | NL7713916A (enEXAMPLES) |
| NO (1) | NO774451L (enEXAMPLES) |
| NZ (1) | NZ186059A (enEXAMPLES) |
| PL (3) | PL112696B1 (enEXAMPLES) |
| SE (1) | SE7714656L (enEXAMPLES) |
| ZA (1) | ZA777629B (enEXAMPLES) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7714062A (nl) * | 1976-12-24 | 1978-06-27 | Hoechst Ag | Werkwijze voor de bereiding van pyrrolo-benzoe- zuur-derivaten. |
| DE2737195A1 (de) * | 1977-08-18 | 1979-03-01 | Hoechst Ag | Benzolsulfonamidderivate und verfahren zu ihrer herstellung |
| ES482591A1 (es) * | 1978-07-20 | 1980-04-01 | Basf Ag | Procedimiento para la obtencion de n-arilsulfonilpirroles. |
| DE2917997A1 (de) * | 1979-05-04 | 1980-11-20 | Hoechst Ag | Substituierte pyrrolidinyl-benzoesaeure- derivate und verfahren zu ihrer herstellung |
| CA1341128C (en) * | 1989-06-27 | 2000-10-24 | Borden Chemical, Inc. | Optical fiber array |
| US5908858A (en) | 1996-04-05 | 1999-06-01 | Sankyo Company, Limited | 1,2-diphenylpyrrole derivatives, their preparation and their therapeutic uses |
| AU2008274941A1 (en) | 2007-07-12 | 2009-01-15 | Tragara Pharmaceuticals, Inc. | Methods and compositions for the treatment of cancer, tumors, and tumor-related disorders |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3565920A (en) * | 1966-12-29 | 1971-02-23 | Ciba Geigy Corp | 5-sulfamyl-anthranilic acids |
| US3534027A (en) * | 1968-04-25 | 1970-10-13 | Hoffmann La Roche | Pyrrolyl ethylamino sulfamoyl benzoic acids,esters and salts thereof |
| US3939267A (en) * | 1972-10-13 | 1976-02-17 | Ciba-Geigy Corporation | 4-Ethers of 3-amino-5-sulfamoylbenzoic acids |
| US4093735A (en) * | 1974-04-25 | 1978-06-06 | Hoechst Aktiengesellschaft | 5-Sulfamoylbenzoic acid derivatives carrying a heterocyclic substituent |
| DE2419970C3 (de) * | 1974-04-25 | 1980-06-12 | Hoechst Ag, 6000 Frankfurt | 3-<l-Pyrrolidinyl)-4-phenoxy-5sulfamoylbenzoesäure und Verfahren zu ihrer Herstellung |
| GB1523631A (en) * | 1975-07-08 | 1978-09-06 | Leo Pharm Prod Ltd | Sulphonamide derivatives |
-
1976
- 1976-12-24 CH CH1630976A patent/CH628622A5/de not_active IP Right Cessation
-
1977
- 1977-12-14 US US05/860,533 patent/US4176190A/en not_active Expired - Lifetime
- 1977-12-15 NL NL7713916A patent/NL7713916A/xx not_active Application Discontinuation
- 1977-12-15 GB GB52249/77A patent/GB1592295A/en not_active Expired
- 1977-12-19 FI FI773846A patent/FI773846A7/fi not_active Application Discontinuation
- 1977-12-20 DE DE19772756783 patent/DE2756783A1/de not_active Withdrawn
- 1977-12-21 NZ NZ186059A patent/NZ186059A/xx unknown
- 1977-12-22 HU HU77CI1789A patent/HU177298B/hu unknown
- 1977-12-22 PL PL1977211757A patent/PL112696B1/pl unknown
- 1977-12-22 FR FR7738857A patent/FR2375211A1/fr active Granted
- 1977-12-22 DK DK575177A patent/DK575177A/da unknown
- 1977-12-22 IT IT52333/77A patent/IT1092247B/it active
- 1977-12-22 ZA ZA00777629A patent/ZA777629B/xx unknown
- 1977-12-22 CA CA293,789A patent/CA1083160A/en not_active Expired
- 1977-12-22 IE IE2608/77A patent/IE46279B1/en unknown
- 1977-12-22 AU AU31864/77A patent/AU515286B2/en not_active Expired
- 1977-12-22 PL PL1977203248A patent/PL110872B1/pl unknown
- 1977-12-22 PL PL1977211756A patent/PL110887B1/pl unknown
- 1977-12-22 SE SE7714656A patent/SE7714656L/xx not_active Application Discontinuation
- 1977-12-22 DD DD77202894A patent/DD134641A5/xx unknown
- 1977-12-23 ES ES465390A patent/ES465390A1/es not_active Expired
- 1977-12-23 AT AT928177A patent/AT362350B/de not_active IP Right Cessation
- 1977-12-23 NO NO774451A patent/NO774451L/no unknown
- 1977-12-23 BE BE183803A patent/BE862275A/xx unknown
- 1977-12-24 JP JP15510677A patent/JPS5379858A/ja active Pending
-
1980
- 1980-11-27 CH CH880480A patent/CH625215A5/de not_active IP Right Cessation
- 1980-11-27 CH CH880580A patent/CH625216A5/de not_active IP Right Cessation
- 1980-11-27 CH CH880680A patent/CH625217A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DK575177A (da) | 1978-06-25 |
| PL110872B1 (en) | 1980-08-30 |
| FR2375211B1 (enEXAMPLES) | 1981-07-17 |
| IE46279L (en) | 1978-06-24 |
| PL112696B1 (en) | 1980-10-31 |
| FI773846A7 (fi) | 1978-06-25 |
| CH625216A5 (enEXAMPLES) | 1981-09-15 |
| IT1092247B (it) | 1985-07-06 |
| DE2756783A1 (de) | 1978-06-29 |
| HU177298B (en) | 1981-09-28 |
| BE862275A (fr) | 1978-06-23 |
| GB1592295A (en) | 1981-07-01 |
| NO774451L (no) | 1978-06-27 |
| DD134641A5 (de) | 1979-03-14 |
| AU515286B2 (en) | 1981-03-26 |
| ES465390A1 (es) | 1978-09-16 |
| AT362350B (de) | 1981-05-11 |
| FR2375211A1 (fr) | 1978-07-21 |
| CH625217A5 (enEXAMPLES) | 1981-09-15 |
| CH625215A5 (enEXAMPLES) | 1981-09-15 |
| US4176190A (en) | 1979-11-27 |
| PL110887B1 (en) | 1980-08-30 |
| ATA928177A (de) | 1980-10-15 |
| AU3186477A (en) | 1979-06-28 |
| SE7714656L (sv) | 1978-06-25 |
| CH628622A5 (de) | 1982-03-15 |
| ZA777629B (en) | 1978-10-25 |
| PL203248A1 (pl) | 1978-12-04 |
| NZ186059A (en) | 1979-11-01 |
| IE46279B1 (en) | 1983-04-20 |
| CA1083160A (en) | 1980-08-05 |
| NL7713916A (nl) | 1978-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU517514B2 (en) | 3-de-0-methylfortimicins | |
| AU2542577A (en) | 4-amino-4-arylcyclohexanones | |
| AU2384277A (en) | Triazolo-pyrimidines | |
| GB1542539A (en) | Bicycle-trailer | |
| CS164777A2 (en) | Zpusob ziskavani krystalickeho xylitolu farmaceuricke jakosti | |
| GB1522457A (en) | Benzocycloheptafurans | |
| CS474677A2 (en) | Obrazovy zesilovac | |
| AU3191677A (en) | Cyclopentan-1-amine | |
| AU2726877A (en) | Benzofuranyl-benzimidazoles | |
| AU507260B2 (en) | N-2-imidazolidinylidene-benzeneamine | |
| AU2451277A (en) | Isothiazolopyridines | |
| AU2714177A (en) | Phenoxy-hydroxypropylamines | |
| JPS5379858A (en) | Sulfamoylbenzoate | |
| GB1538366A (en) | Pyridobenzodiazepines | |
| ZA775985B (en) | Thiaprostaglandins | |
| AU2893177A (en) | Perhydroindolinols | |
| GB1520699A (en) | Benzoxazolenes | |
| AU508067B2 (en) | Electroradiography | |
| GB1537670A (en) | De-tinning | |
| AU2378777A (en) | Amino - alkoxyalkanes | |
| CY1158A (en) | Arylmalonamido-1-oxadethiacephalosporins | |
| AU2493077A (en) | 2-amino-substituted-isothioureido bewzenes | |
| GB1540313A (en) | Low-loader-waggons | |
| AU3192177A (en) | 2-methoxybenzamides | |
| AU2710877A (en) | Benzodioxepins |