JP2006525022A

JP2006525022A - 反復オリゴヌクレオチド合成を利用する分子検出システム

反復オリゴヌクレオチド合成を利用する分子検出システム Download PDF

Info

Publication number: JP2006525022A
Authority: JP; Japan
Prior art keywords: alkyl; target; oligonucleotide; aminocarbonyl; aryl
Prior art date: 2003-04-29
Legal status : Pending

Application number

JP2006513381A

Other languages

English (en)

Japanese (ja)

Other versions

JP2006525022A5 (https=

Inventor

ハンナ，ミッチェル，エム．

Original Assignee

リボメドバイオテクノロジーズ，インコーポレイテッド

Priority date

2003-04-29

Filing date

2004-04-29

Publication date

2006-11-09

2004-04-29 Application filed by リボメドバイオテクノロジーズ，インコーポレイテッド filed Critical リボメドバイオテクノロジーズ，インコーポレイテッド

2006-11-09 Publication of JP2006525022A publication Critical patent/JP2006525022A/ja

2007-02-15 Publication of JP2006525022A5 publication Critical patent/JP2006525022A5/ja

Status Pending legal-status Critical Current

Links

238000001514 detection method Methods 0.000 title claims abstract description 80
230000003252 repetitive effect Effects 0.000 title claims abstract description 59
238000002515 oligonucleotide synthesis Methods 0.000 title abstract description 9
108091034117 Oligonucleotide Proteins 0.000 claims abstract description 294
238000000034 method Methods 0.000 claims abstract description 279
125000003729 nucleotide group Chemical group 0.000 claims abstract description 262
102000039446 nucleic acids Human genes 0.000 claims abstract description 226
150000007523 nucleic acids Chemical class 0.000 claims abstract description 224
108020004707 nucleic acids Proteins 0.000 claims abstract description 224
102000040430 polynucleotide Human genes 0.000 claims abstract description 198
108091033319 polynucleotide Proteins 0.000 claims abstract description 198
239000002157 polynucleotide Substances 0.000 claims abstract description 198
239000002773 nucleotide Substances 0.000 claims abstract description 196
230000000295 complement effect Effects 0.000 claims abstract description 77
JLCPHMBAVCMARE-UHFFFAOYSA-N [3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl [5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate Polymers Cc1cn(C2CC(OP(O)(=O)OCC3OC(CC3OP(O)(=O)OCC3OC(CC3O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c3nc(N)[nH]c4=O)C(COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3CO)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cc(C)c(=O)[nH]c3=O)n3cc(C)c(=O)[nH]c3=O)n3ccc(N)nc3=O)n3cc(C)c(=O)[nH]c3=O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)O2)c(=O)[nH]c1=O JLCPHMBAVCMARE-UHFFFAOYSA-N 0.000 claims abstract description 60
230000008569 process Effects 0.000 claims abstract description 17
125000000217 alkyl group Chemical group 0.000 claims description 522
125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 174
-1 amino, amino Chemical group 0.000 claims description 171
239000000523 sample Substances 0.000 claims description 171
125000003118 aryl group Chemical group 0.000 claims description 163
239000003999 initiator Substances 0.000 claims description 148
230000035897 transcription Effects 0.000 claims description 119
238000013518 transcription Methods 0.000 claims description 119
108020004414 DNA Proteins 0.000 claims description 108
102000053602 DNA Human genes 0.000 claims description 96
108090000623 proteins and genes Proteins 0.000 claims description 88
125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 86
125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 80
YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 claims description 74
108090000626 DNA-directed RNA polymerases Proteins 0.000 claims description 72
102000004163 DNA-directed RNA polymerases Human genes 0.000 claims description 72
125000001424 substituent group Chemical group 0.000 claims description 71
102000004190 Enzymes Human genes 0.000 claims description 69
108090000790 Enzymes Proteins 0.000 claims description 69
102000004169 proteins and genes Human genes 0.000 claims description 69
230000002194 synthesizing effect Effects 0.000 claims description 68
125000003545 alkoxy group Chemical group 0.000 claims description 65
125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 63
125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 49
238000012360 testing method Methods 0.000 claims description 49
238000009396 hybridization Methods 0.000 claims description 47
IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 42
108091028043 Nucleic acid sequence Proteins 0.000 claims description 39
229960002685 biotin Drugs 0.000 claims description 37
239000011616 biotin Substances 0.000 claims description 37
235000020958 biotin Nutrition 0.000 claims description 37
125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 33
125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 claims description 31
229910052751 metal Inorganic materials 0.000 claims description 31
239000002184 metal Substances 0.000 claims description 31
108010014303 DNA-directed DNA polymerase Proteins 0.000 claims description 30
230000035772 mutation Effects 0.000 claims description 30
108091029430 CpG site Proteins 0.000 claims description 29
102000016928 DNA-directed DNA polymerase Human genes 0.000 claims description 29
125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 claims description 29
108010090804 Streptavidin Proteins 0.000 claims description 28
125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 28
239000000126 substance Substances 0.000 claims description 28
125000004414 alkyl thio group Chemical group 0.000 claims description 27
239000000975 dye Substances 0.000 claims description 27
125000001072 heteroaryl group Chemical group 0.000 claims description 27
229920006395 saturated elastomer Polymers 0.000 claims description 27
OPTASPLRGRRNAP-UHFFFAOYSA-N cytosine Chemical group NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 claims description 26
229910052757 nitrogen Inorganic materials 0.000 claims description 26
125000006413 ring segment Chemical group 0.000 claims description 26
NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 25
ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical group O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 claims description 24
125000001769 aryl amino group Chemical group 0.000 claims description 24
125000000623 heterocyclic group Chemical group 0.000 claims description 24
150000003230 pyrimidines Chemical class 0.000 claims description 24
230000001419 dependent effect Effects 0.000 claims description 23
238000002372 labelling Methods 0.000 claims description 23
244000052769 pathogen Species 0.000 claims description 23
229910052717 sulfur Inorganic materials 0.000 claims description 23
108010001336 Horseradish Peroxidase Proteins 0.000 claims description 22
QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 22
125000004093 cyano group Chemical group *C#N 0.000 claims description 22
229910052760 oxygen Inorganic materials 0.000 claims description 22
239000001301 oxygen Substances 0.000 claims description 22
239000011593 sulfur Substances 0.000 claims description 22
102000002260 Alkaline Phosphatase Human genes 0.000 claims description 20
108020004774 Alkaline Phosphatase Proteins 0.000 claims description 20
239000004971 Cross linker Substances 0.000 claims description 20
125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims description 19
125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 19
125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 claims description 19
125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 19
125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 19
KDCGOANMDULRCW-UHFFFAOYSA-N Purine Natural products N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 claims description 19
125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 18
238000003752 polymerase chain reaction Methods 0.000 claims description 18
230000001717 pathogenic effect Effects 0.000 claims description 16
108020004999 messenger RNA Proteins 0.000 claims description 13
125000005110 aryl thio group Chemical group 0.000 claims description 12
125000004104 aryloxy group Chemical group 0.000 claims description 12
125000002619 bicyclic group Chemical group 0.000 claims description 12
125000002950 monocyclic group Chemical group 0.000 claims description 12
UFBJCMHMOXMLKC-UHFFFAOYSA-N 2,4-dinitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O UFBJCMHMOXMLKC-UHFFFAOYSA-N 0.000 claims description 11
WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 claims description 11
241000588724 Escherichia coli Species 0.000 claims description 11
125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 11
230000001404 mediated effect Effects 0.000 claims description 11
239000003155 DNA primer Substances 0.000 claims description 10
150000002739 metals Chemical class 0.000 claims description 10
238000010839 reverse transcription Methods 0.000 claims description 10
108010008286 DNA nucleotidylexotransferase Proteins 0.000 claims description 9
125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 8
125000000714 pyrimidinyl group Chemical group 0.000 claims description 8
229940035893 uracil Drugs 0.000 claims description 8
108020001019 DNA Primers Proteins 0.000 claims description 7
241000701832 Enterobacteria phage T3 Species 0.000 claims description 7
108020004682 Single-Stranded DNA Proteins 0.000 claims description 7
108700009124 Transcription Initiation Site Proteins 0.000 claims description 7
125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims description 7
238000002493 microarray Methods 0.000 claims description 7
125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 7
108060004795 Methyltransferase Proteins 0.000 claims description 6
238000013519 translation Methods 0.000 claims description 6
230000006820 DNA synthesis Effects 0.000 claims description 5
230000006819 RNA synthesis Effects 0.000 claims description 5
230000014509 gene expression Effects 0.000 claims description 5
229910052739 hydrogen Inorganic materials 0.000 claims description 5
230000003100 immobilizing effect Effects 0.000 claims description 5
108010092681 DNA Primase Proteins 0.000 claims description 3
102000016559 DNA Primase Human genes 0.000 claims description 3
238000000636 Northern blotting Methods 0.000 claims description 3
238000002105 Southern blotting Methods 0.000 claims description 3
241000589500 Thermus aquaticus Species 0.000 claims description 3
241000293869 Salmonella enterica subsp. enterica serovar Typhimurium Species 0.000 claims description 2
241001468001 Salmonella virus SP6 Species 0.000 claims description 2
230000004700 cellular uptake Effects 0.000 claims description 2
238000002156 mixing Methods 0.000 claims description 2
108091032973 (ribonucleotides)n+m Proteins 0.000 claims 5
125000001475 halogen functional group Chemical group 0.000 claims 4
150000003212 purines Chemical class 0.000 claims 2
102100029764 DNA-directed DNA/RNA polymerase mu Human genes 0.000 claims 1
239000002777 nucleoside Substances 0.000 abstract description 16
238000006116 polymerization reaction Methods 0.000 abstract description 11
150000003833 nucleoside derivatives Chemical class 0.000 abstract description 9
230000002255 enzymatic effect Effects 0.000 abstract description 7
239000013615 primer Substances 0.000 description 69
229940088598 enzyme Drugs 0.000 description 64
239000000047 product Substances 0.000 description 61
229920002477 rna polymer Polymers 0.000 description 60
235000018102 proteins Nutrition 0.000 description 45
238000006243 chemical reaction Methods 0.000 description 43
238000003786 synthesis reaction Methods 0.000 description 37
230000027455 binding Effects 0.000 description 35
230000015572 biosynthetic process Effects 0.000 description 34
238000003199 nucleic acid amplification method Methods 0.000 description 28
230000003321 amplification Effects 0.000 description 27
239000002585 base Substances 0.000 description 24
125000005843 halogen group Chemical group 0.000 description 23
BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 22
238000003556 assay Methods 0.000 description 21
PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 20
229910052737 gold Inorganic materials 0.000 description 20
239000010931 gold Substances 0.000 description 20
210000004027 cell Anatomy 0.000 description 19
239000000376 reactant Substances 0.000 description 19
229910052709 silver Inorganic materials 0.000 description 19
239000004332 silver Substances 0.000 description 19
GNBHRKFJIUUOQI-UHFFFAOYSA-N fluorescein Chemical group O1C(=O)C2=CC=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 GNBHRKFJIUUOQI-UHFFFAOYSA-N 0.000 description 18
238000011160 research Methods 0.000 description 18
239000003153 chemical reaction reagent Substances 0.000 description 17
150000001875 compounds Chemical class 0.000 description 17
239000000203 mixture Substances 0.000 description 17
230000010076 replication Effects 0.000 description 17
UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 16
229910052799 carbon Inorganic materials 0.000 description 16
230000000977 initiatory effect Effects 0.000 description 16
125000004178 (C1-C4) alkyl group Chemical group 0.000 description 15
230000004048 modification Effects 0.000 description 15
238000012986 modification Methods 0.000 description 15
ABZLKHKQJHEPAX-UHFFFAOYSA-N tetramethylrhodamine Chemical compound C=12C=CC(N(C)C)=CC2=[O+]C2=CC(N(C)C)=CC=C2C=1C1=CC=CC=C1C([O-])=O ABZLKHKQJHEPAX-UHFFFAOYSA-N 0.000 description 15
238000007792 addition Methods 0.000 description 14
108091028664 Ribonucleotide Proteins 0.000 description 13
125000005647 linker group Chemical group 0.000 description 13
239000002336 ribonucleotide Substances 0.000 description 13
125000002652 ribonucleotide group Chemical group 0.000 description 13
GOLORTLGFDVFDW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one Chemical compound C1=CC=C2NC(C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=NC2=C1 GOLORTLGFDVFDW-UHFFFAOYSA-N 0.000 description 12
239000000872 buffer Substances 0.000 description 12
108020004635 Complementary DNA Proteins 0.000 description 11
229910019142 PO4 Inorganic materials 0.000 description 11
HMFHBZSHGGEWLO-UHFFFAOYSA-N alpha-D-Furanose-Ribose Natural products OCC1OC(O)C(O)C1O HMFHBZSHGGEWLO-UHFFFAOYSA-N 0.000 description 11
125000004429 atom Chemical group 0.000 description 11
239000000227 bioadhesive Substances 0.000 description 11
GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 11
235000021317 phosphate Nutrition 0.000 description 11
239000000758 substrate Substances 0.000 description 11
235000000346 sugar Nutrition 0.000 description 11
125000003396 thiol group Chemical group [H]S* 0.000 description 11
238000011144 upstream manufacturing Methods 0.000 description 11
ZMERMCRYYFRELX-UHFFFAOYSA-N 5-{[2-(iodoacetamido)ethyl]amino}naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1NCCNC(=O)CI ZMERMCRYYFRELX-UHFFFAOYSA-N 0.000 description 10
125000004432 carbon atom Chemical group C* 0.000 description 10
230000000694 effects Effects 0.000 description 10
238000010348 incorporation Methods 0.000 description 10
239000010452 phosphate Substances 0.000 description 10
229920000642 polymer Polymers 0.000 description 10
239000007790 solid phase Substances 0.000 description 10
HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
239000002987 primer (paints) Substances 0.000 description 9
102100033215 DNA nucleotidylexotransferase Human genes 0.000 description 8
PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 8
125000003282 alkyl amino group Chemical group 0.000 description 8
238000010804 cDNA synthesis Methods 0.000 description 8
239000002299 complementary DNA Substances 0.000 description 8
239000011159 matrix material Substances 0.000 description 8
230000011987 methylation Effects 0.000 description 8
238000007069 methylation reaction Methods 0.000 description 8
VWKNUUOGGLNRNZ-UHFFFAOYSA-N methylbimane Chemical compound CC1=C(C)C(=O)N2N1C(C)=C(C)C2=O VWKNUUOGGLNRNZ-UHFFFAOYSA-N 0.000 description 8
238000001668 nucleic acid synthesis Methods 0.000 description 8
239000011541 reaction mixture Substances 0.000 description 8
PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 8
235000021286 stilbenes Nutrition 0.000 description 8
239000001226 triphosphate Substances 0.000 description 8
235000011178 triphosphate Nutrition 0.000 description 8
UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 8
OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
239000005547 deoxyribonucleotide Substances 0.000 description 7
125000002637 deoxyribonucleotide group Chemical group 0.000 description 7
239000000463 material Substances 0.000 description 7
NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 7
239000007787 solid Substances 0.000 description 7
238000005382 thermal cycling Methods 0.000 description 7
125000004169 (C1-C6) alkyl group Chemical group 0.000 description 6
PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
108020005187 Oligonucleotide Probes Proteins 0.000 description 6
108010092799 RNA-directed DNA polymerase Proteins 0.000 description 6
DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 6
239000003795 chemical substances by application Substances 0.000 description 6
238000004925 denaturation Methods 0.000 description 6
230000036425 denaturation Effects 0.000 description 6
239000011521 glass Substances 0.000 description 6
239000011777 magnesium Substances 0.000 description 6
238000010369 molecular cloning Methods 0.000 description 6
239000002751 oligonucleotide probe Substances 0.000 description 6
230000036961 partial effect Effects 0.000 description 6
125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 6
102000004196 processed proteins & peptides Human genes 0.000 description 6
108090000765 processed proteins & peptides Proteins 0.000 description 6
238000011002 quantification Methods 0.000 description 6
230000002285 radioactive effect Effects 0.000 description 6
PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 6
238000006467 substitution reaction Methods 0.000 description 6
108090001008 Avidin Proteins 0.000 description 5
241001465754 Metazoa Species 0.000 description 5
OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 5
238000004458 analytical method Methods 0.000 description 5
ZYGHJZDHTFUPRJ-UHFFFAOYSA-N benzo-alpha-pyrone Natural products C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 5
150000001768 cations Chemical class 0.000 description 5
125000000753 cycloalkyl group Chemical group 0.000 description 5
238000005516 engineering process Methods 0.000 description 5
UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 5
QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 5
239000012071 phase Substances 0.000 description 5
229910052698 phosphorus Inorganic materials 0.000 description 5
239000011574 phosphorus Substances 0.000 description 5
239000002243 precursor Substances 0.000 description 5
MPLHNVLQVRSVEE-UHFFFAOYSA-N texas red Chemical group [O-]S(=O)(=O)C1=CC(S(Cl)(=O)=O)=CC=C1C(C1=CC=2CCCN3CCCC(C=23)=C1O1)=C2C1=C(CCC1)C3=[N+]1CCCC3=C2 MPLHNVLQVRSVEE-UHFFFAOYSA-N 0.000 description 5
125000004765 (C1-C4) haloalkyl group Chemical group 0.000 description 4
125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 description 4
HMFHBZSHGGEWLO-SOOFDHNKSA-N D-ribofuranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H]1O HMFHBZSHGGEWLO-SOOFDHNKSA-N 0.000 description 4
230000004543 DNA replication Effects 0.000 description 4
ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
241000233866 Fungi Species 0.000 description 4
108020004711 Nucleic Acid Probes Proteins 0.000 description 4
PYMYPHUHKUWMLA-LMVFSUKVSA-N Ribose Natural products OC[C@@H](O)[C@@H](O)[C@@H](O)C=O PYMYPHUHKUWMLA-LMVFSUKVSA-N 0.000 description 4
239000002253 acid Substances 0.000 description 4
125000003342 alkenyl group Chemical group 0.000 description 4
239000012620 biological material Substances 0.000 description 4
125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
230000015556 catabolic process Effects 0.000 description 4
229960000956 coumarin Drugs 0.000 description 4
235000001671 coumarin Nutrition 0.000 description 4
HAAZLUGHYHWQIW-KVQBGUIXSA-N dGTP Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@H]1C[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1 HAAZLUGHYHWQIW-KVQBGUIXSA-N 0.000 description 4
238000006731 degradation reaction Methods 0.000 description 4
238000012217 deletion Methods 0.000 description 4
208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
239000012634 fragment Substances 0.000 description 4
239000001257 hydrogen Substances 0.000 description 4
238000011534 incubation Methods 0.000 description 4
230000007246 mechanism Effects 0.000 description 4
239000012528 membrane Substances 0.000 description 4
TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 4
125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
239000002853 nucleic acid probe Substances 0.000 description 4
125000003835 nucleoside group Chemical group 0.000 description 4
229920003023 plastic Polymers 0.000 description 4
239000004033 plastic Substances 0.000 description 4
229920001184 polypeptide Polymers 0.000 description 4
125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
238000004445 quantitative analysis Methods 0.000 description 4
150000003839 salts Chemical class 0.000 description 4
230000035945 sensitivity Effects 0.000 description 4
239000000243 solution Substances 0.000 description 4
RWQNBRDOKXIBIV-UHFFFAOYSA-N thymine Chemical compound CC1=CNC(=O)NC1=O RWQNBRDOKXIBIV-UHFFFAOYSA-N 0.000 description 4
238000012546 transfer Methods 0.000 description 4
230000005945 translocation Effects 0.000 description 4
238000011282 treatment Methods 0.000 description 4
DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 4
AJTVSSFTXWNIRG-UHFFFAOYSA-N 2-[bis(2-hydroxyethyl)amino]ethanesulfonic acid Chemical group OCC[NH+](CCO)CCS([O-])(=O)=O AJTVSSFTXWNIRG-UHFFFAOYSA-N 0.000 description 3
ASJSAQIRZKANQN-CRCLSJGQSA-N 2-deoxy-D-ribose Chemical group OC[C@@H](O)[C@@H](O)CC=O ASJSAQIRZKANQN-CRCLSJGQSA-N 0.000 description 3
QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
239000012099 Alexa Fluor family Substances 0.000 description 3
241000894006 Bacteria Species 0.000 description 3
108020004394 Complementary RNA Proteins 0.000 description 3
NYHBQMYGNKIUIF-UUOKFMHZSA-N Guanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O NYHBQMYGNKIUIF-UUOKFMHZSA-N 0.000 description 3
UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
208000026350 Inborn Genetic disease Diseases 0.000 description 3
108090001090 Lectins Proteins 0.000 description 3
102000004856 Lectins Human genes 0.000 description 3
101710163270 Nuclease Proteins 0.000 description 3
CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
241000700605 Viruses Species 0.000 description 3
125000000304 alkynyl group Chemical group 0.000 description 3
125000003277 amino group Chemical group 0.000 description 3
239000011324 bead Substances 0.000 description 3
239000012472 biological sample Substances 0.000 description 3
125000001246 bromo group Chemical group Br* 0.000 description 3
230000008859 change Effects 0.000 description 3
239000002738 chelating agent Substances 0.000 description 3
239000003638 chemical reducing agent Substances 0.000 description 3
125000001309 chloro group Chemical group Cl* 0.000 description 3
210000000349 chromosome Anatomy 0.000 description 3
239000003184 complementary RNA Substances 0.000 description 3
230000021615 conjugation Effects 0.000 description 3
GLNDAGDHSLMOKX-UHFFFAOYSA-N coumarin 120 Chemical compound C1=C(N)C=CC2=C1OC(=O)C=C2C GLNDAGDHSLMOKX-UHFFFAOYSA-N 0.000 description 3
125000000332 coumarinyl group Chemical group O1C(=O)C(=CC2=CC=CC=C12)* 0.000 description 3
239000003431 cross linking reagent Substances 0.000 description 3
125000004122 cyclic group Chemical group 0.000 description 3
125000000392 cycloalkenyl group Chemical group 0.000 description 3
230000009615 deamination Effects 0.000 description 3
238000006481 deamination reaction Methods 0.000 description 3
230000037430 deletion Effects 0.000 description 3
239000001177 diphosphate Substances 0.000 description 3
XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 3
235000011180 diphosphates Nutrition 0.000 description 3
201000010099 disease Diseases 0.000 description 3
230000007613 environmental effect Effects 0.000 description 3
125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
230000006870 function Effects 0.000 description 3
230000007274 generation of a signal involved in cell-cell signaling Effects 0.000 description 3
208000016361 genetic disease Diseases 0.000 description 3
125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
238000003780 insertion Methods 0.000 description 3
230000037431 insertion Effects 0.000 description 3
230000003993 interaction Effects 0.000 description 3
238000010501 iterative synthesis reaction Methods 0.000 description 3
239000002523 lectin Substances 0.000 description 3
229910052749 magnesium Inorganic materials 0.000 description 3
238000004519 manufacturing process Methods 0.000 description 3
238000002844 melting Methods 0.000 description 3
230000008018 melting Effects 0.000 description 3
150000004712 monophosphates Chemical class 0.000 description 3
230000007935 neutral effect Effects 0.000 description 3
238000006386 neutralization reaction Methods 0.000 description 3
229910052759 nickel Inorganic materials 0.000 description 3
238000007899 nucleic acid hybridization Methods 0.000 description 3
230000003287 optical effect Effects 0.000 description 3
150000002972 pentoses Chemical class 0.000 description 3
102000054765 polymorphisms of proteins Human genes 0.000 description 3
150000003254 radicals Chemical class 0.000 description 3
230000002829 reductive effect Effects 0.000 description 3
241000894007 species Species 0.000 description 3
238000010561 standard procedure Methods 0.000 description 3
150000008163 sugars Chemical class 0.000 description 3
125000001544 thienyl group Chemical group 0.000 description 3
238000005406 washing Methods 0.000 description 3
LTFMZDNNPPEQNG-KVQBGUIXSA-N 2'-deoxyguanosine 5'-monophosphate Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@H]1C[C@H](O)[C@@H](COP(O)(O)=O)O1 LTFMZDNNPPEQNG-KVQBGUIXSA-N 0.000 description 2
RUDINRUXCKIXAJ-UHFFFAOYSA-N 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosafluorotetradecanoic acid Chemical compound OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F RUDINRUXCKIXAJ-UHFFFAOYSA-N 0.000 description 2
PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical compound NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 description 2
OBYNJKLOYWCXEP-UHFFFAOYSA-N 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-4-isothiocyanatobenzoate Chemical compound C=12C=CC(=[N+](C)C)C=C2OC2=CC(N(C)C)=CC=C2C=1C1=CC(N=C=S)=CC=C1C([O-])=O OBYNJKLOYWCXEP-UHFFFAOYSA-N 0.000 description 2
HSHNITRMYYLLCV-UHFFFAOYSA-N 4-methylumbelliferone Chemical compound C1=C(O)C=CC2=C1OC(=O)C=C2C HSHNITRMYYLLCV-UHFFFAOYSA-N 0.000 description 2
JBNOVHJXQSHGRL-UHFFFAOYSA-N 7-amino-4-(trifluoromethyl)coumarin Chemical compound FC(F)(F)C1=CC(=O)OC2=CC(N)=CC=C21 JBNOVHJXQSHGRL-UHFFFAOYSA-N 0.000 description 2
LRFVTYWOQMYALW-UHFFFAOYSA-N 9H-xanthine Chemical compound O=C1NC(=O)NC2=C1NC=N2 LRFVTYWOQMYALW-UHFFFAOYSA-N 0.000 description 2
GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Chemical compound NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 description 2
108091026890 Coding region Proteins 0.000 description 2
206010009944 Colon cancer Diseases 0.000 description 2
SRBFZHDQGSBBOR-IOVATXLUSA-N D-xylopyranose Chemical compound O[C@@H]1COC(O)[C@H](O)[C@H]1O SRBFZHDQGSBBOR-IOVATXLUSA-N 0.000 description 2
XPDXVDYUQZHFPV-UHFFFAOYSA-N Dansyl Chloride Chemical compound C1=CC=C2C(N(C)C)=CC=CC2=C1S(Cl)(=O)=O XPDXVDYUQZHFPV-UHFFFAOYSA-N 0.000 description 2
RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
QTANTQQOYSUMLC-UHFFFAOYSA-O Ethidium cation Chemical compound C12=CC(N)=CC=C2C2=CC=C(N)C=C2[N+](CC)=C1C1=CC=CC=C1 QTANTQQOYSUMLC-UHFFFAOYSA-O 0.000 description 2
LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
241000282414 Homo sapiens Species 0.000 description 2
102100034343 Integrase Human genes 0.000 description 2
102000003960 Ligases Human genes 0.000 description 2
108090000364 Ligases Proteins 0.000 description 2
FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
241001024304 Mino Species 0.000 description 2
102000016943 Muramidase Human genes 0.000 description 2
108010014251 Muramidase Proteins 0.000 description 2
108010062010 N-Acetylmuramoyl-L-alanine Amidase Proteins 0.000 description 2
SEQKRHFRPICQDD-UHFFFAOYSA-N N-tris(hydroxymethyl)methylglycine Chemical compound OCC(CO)(CO)[NH2+]CC([O-])=O SEQKRHFRPICQDD-UHFFFAOYSA-N 0.000 description 2
238000005481 NMR spectroscopy Methods 0.000 description 2
206010028980 Neoplasm Diseases 0.000 description 2
108091005461 Nucleic proteins Proteins 0.000 description 2
108091093037 Peptide nucleic acid Proteins 0.000 description 2
239000004698 Polyethylene Substances 0.000 description 2
229920001213 Polysorbate 20 Polymers 0.000 description 2
239000004793 Polystyrene Substances 0.000 description 2
AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 description 2
108010017842 Telomerase Proteins 0.000 description 2
RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical group OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 2
IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 description 2
XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
DRTQHJPVMGBUCF-XVFCMESISA-N Uridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-XVFCMESISA-N 0.000 description 2
GFOKTJKDALJCDV-XKVFNRALSA-N [[(2r,3s,4r,5r)-5-[4-amino-5-[2-(4-azidophenyl)-2-oxoethyl]sulfanyl-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound NC1=NC(=O)N([C@H]2[C@@H]([C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O2)O)C=C1SCC(=O)C1=CC=C(N=[N+]=[N-])C=C1 GFOKTJKDALJCDV-XKVFNRALSA-N 0.000 description 2
CNPBIGGPYUIVDV-XKVFNRALSA-N [[(2r,3s,4r,5r)-5-[5-[2-(4-azidophenyl)-2-oxoethyl]sulfanyl-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C(=O)NC(=O)C(SCC(=O)C=2C=CC(=CC=2)N=[N+]=[N-])=C1 CNPBIGGPYUIVDV-XKVFNRALSA-N 0.000 description 2
125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 2
OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 2
230000000692 anti-sense effect Effects 0.000 description 2
238000013459 approach Methods 0.000 description 2
239000007864 aqueous solution Substances 0.000 description 2
PYMYPHUHKUWMLA-UHFFFAOYSA-N arabinose Natural products OCC(O)C(O)C(O)C=O PYMYPHUHKUWMLA-UHFFFAOYSA-N 0.000 description 2
125000003710 aryl alkyl group Chemical group 0.000 description 2
125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
SRBFZHDQGSBBOR-UHFFFAOYSA-N beta-D-Pyranose-Lyxose Natural products OC1COC(O)C(O)C1O SRBFZHDQGSBBOR-UHFFFAOYSA-N 0.000 description 2
201000011510 cancer Diseases 0.000 description 2
239000000460 chlorine Substances 0.000 description 2
238000007796 conventional method Methods 0.000 description 2
230000008878 coupling Effects 0.000 description 2
238000010168 coupling process Methods 0.000 description 2
238000005859 coupling reaction Methods 0.000 description 2
229940104302 cytosine Drugs 0.000 description 2
238000011161 development Methods 0.000 description 2
230000018109 developmental process Effects 0.000 description 2
ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
238000010494 dissociation reaction Methods 0.000 description 2
230000005593 dissociations Effects 0.000 description 2
229940079593 drug Drugs 0.000 description 2
239000003814 drug Substances 0.000 description 2
238000006911 enzymatic reaction Methods 0.000 description 2
YQGOJNYOYNNSMM-UHFFFAOYSA-N eosin Chemical compound [Na+].OC(=O)C1=CC=CC=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C(O)=C(Br)C=C21 YQGOJNYOYNNSMM-UHFFFAOYSA-N 0.000 description 2
IINNWAYUJNWZRM-UHFFFAOYSA-L erythrosin B Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=C(I)C(=O)C(I)=C2OC2=C(I)C([O-])=C(I)C=C21 IINNWAYUJNWZRM-UHFFFAOYSA-L 0.000 description 2
239000004174 erythrosine Substances 0.000 description 2
229940011411 erythrosine Drugs 0.000 description 2
235000012732 erythrosine Nutrition 0.000 description 2
VYXSBFYARXAAKO-UHFFFAOYSA-N ethyl 2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoate;hydron;chloride Chemical compound [Cl-].C1=2C=C(C)C(NCC)=CC=2OC2=CC(=[NH+]CC)C(C)=CC2=C1C1=CC=CC=C1C(=O)OCC VYXSBFYARXAAKO-UHFFFAOYSA-N 0.000 description 2
239000012530 fluid Substances 0.000 description 2
238000002866 fluorescence resonance energy transfer Methods 0.000 description 2
125000001153 fluoro group Chemical group F* 0.000 description 2
235000013305 food Nutrition 0.000 description 2
125000000524 functional group Chemical group 0.000 description 2
230000002068 genetic effect Effects 0.000 description 2
RWSXRVCMGQZWBV-WDSKDSINSA-N glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 2
125000005842 heteroatom Chemical group 0.000 description 2
239000005556 hormone Substances 0.000 description 2
229940088597 hormone Drugs 0.000 description 2
FDGQSTZJBFJUBT-UHFFFAOYSA-N hypoxanthine Chemical compound O=C1NC=NC2=C1NC=N2 FDGQSTZJBFJUBT-UHFFFAOYSA-N 0.000 description 2
238000003018 immunoassay Methods 0.000 description 2
238000000338 in vitro Methods 0.000 description 2
230000002452 interceptive effect Effects 0.000 description 2
239000000543 intermediate Substances 0.000 description 2
150000002500 ions Chemical class 0.000 description 2
125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
150000002540 isothiocyanates Chemical class 0.000 description 2
239000003446 ligand Substances 0.000 description 2
238000007834 ligase chain reaction Methods 0.000 description 2
230000000670 limiting effect Effects 0.000 description 2
235000010335 lysozyme Nutrition 0.000 description 2
229960000274 lysozyme Drugs 0.000 description 2
239000004325 lysozyme Substances 0.000 description 2
230000005291 magnetic effect Effects 0.000 description 2
239000002609 medium Substances 0.000 description 2
YACKEPLHDIMKIO-UHFFFAOYSA-N methylphosphonic acid Chemical class CP(O)(O)=O YACKEPLHDIMKIO-UHFFFAOYSA-N 0.000 description 2
238000009629 microbiological culture Methods 0.000 description 2
244000005700 microbiome Species 0.000 description 2
239000003068 molecular probe Substances 0.000 description 2
125000004430 oxygen atom Chemical group O* 0.000 description 2
150000008298 phosphoramidates Chemical group 0.000 description 2
150000008300 phosphoramidites Chemical class 0.000 description 2
229920003229 poly(methyl methacrylate) Polymers 0.000 description 2
229920000573 polyethylene Polymers 0.000 description 2
229920002704 polyhistidine Polymers 0.000 description 2
239000004926 polymethyl methacrylate Substances 0.000 description 2
239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
229920002223 polystyrene Polymers 0.000 description 2
125000006239 protecting group Chemical group 0.000 description 2
ZCCUUQDIBDJBTK-UHFFFAOYSA-N psoralen Chemical compound C1=C2OC(=O)C=CC2=CC2=C1OC=C2 ZCCUUQDIBDJBTK-UHFFFAOYSA-N 0.000 description 2
238000010791 quenching Methods 0.000 description 2
230000000171 quenching effect Effects 0.000 description 2
230000005855 radiation Effects 0.000 description 2
239000012857 radioactive material Substances 0.000 description 2
239000013074 reference sample Substances 0.000 description 2
108091008146 restriction endonucleases Proteins 0.000 description 2
230000000717 retained effect Effects 0.000 description 2
229940043267 rhodamine b Drugs 0.000 description 2
239000002342 ribonucleoside Substances 0.000 description 2
238000000926 separation method Methods 0.000 description 2
238000012163 sequencing technique Methods 0.000 description 2
ATHGHQPFGPMSJY-UHFFFAOYSA-N spermidine Chemical compound NCCCCNCCCN ATHGHQPFGPMSJY-UHFFFAOYSA-N 0.000 description 2
239000004094 surface-active agent Substances 0.000 description 2
229940113082 thymine Drugs 0.000 description 2
125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
239000002699 waste material Substances 0.000 description 2
XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
GIANIJCPTPUNBA-QMMMGPOBSA-N (2s)-3-(4-hydroxyphenyl)-2-nitramidopropanoic acid Chemical compound [O-][N+](=O)N[C@H](C(=O)O)CC1=CC=C(O)C=C1 GIANIJCPTPUNBA-QMMMGPOBSA-N 0.000 description 1
125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
BSSNZUFKXJJCBG-UPHRSURJSA-N (z)-but-2-enediamide Chemical compound NC(=O)\C=C/C(N)=O BSSNZUFKXJJCBG-UPHRSURJSA-N 0.000 description 1
QEYLQOXPVKZINS-UHFFFAOYSA-N 1-(4-aminonaphthalen-1-yl)pyrrole-2,5-dione Chemical compound C12=CC=CC=C2C(N)=CC=C1N1C(=O)C=CC1=O QEYLQOXPVKZINS-UHFFFAOYSA-N 0.000 description 1
UHDGCWIWMRVCDJ-UHFFFAOYSA-N 1-beta-D-Xylofuranosyl-NH-Cytosine Natural products O=C1N=C(N)C=CN1C1C(O)C(O)C(CO)O1 UHDGCWIWMRVCDJ-UHFFFAOYSA-N 0.000 description 1
125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
ZTTARJIAPRWUHH-UHFFFAOYSA-N 1-isothiocyanatoacridine Chemical compound C1=CC=C2C=C3C(N=C=S)=CC=CC3=NC2=C1 ZTTARJIAPRWUHH-UHFFFAOYSA-N 0.000 description 1
KWGZRLZJBLEVFZ-UHFFFAOYSA-N 1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1SSC1=CC=C([N+]([O-])=O)C=C1 KWGZRLZJBLEVFZ-UHFFFAOYSA-N 0.000 description 1
125000006017 1-propenyl group Chemical group 0.000 description 1
125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
ITMNKLCXBVIRGW-UHFFFAOYSA-N 2,4-dioxo-1h-pyrimidine-6-carboxylic acid;pyrimidine Chemical compound C1=CN=CN=C1.OC(=O)C1=CC(=O)NC(=O)N1 ITMNKLCXBVIRGW-UHFFFAOYSA-N 0.000 description 1
JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
IOOMXAQUNPWDLL-UHFFFAOYSA-N 2-[6-(diethylamino)-3-(diethyliminiumyl)-3h-xanthen-9-yl]-5-sulfobenzene-1-sulfonate Chemical compound C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=C(S(O)(=O)=O)C=C1S([O-])(=O)=O IOOMXAQUNPWDLL-UHFFFAOYSA-N 0.000 description 1
LAXVMANLDGWYJP-UHFFFAOYSA-N 2-amino-5-(2-aminoethyl)naphthalene-1-sulfonic acid Chemical compound NC1=CC=C2C(CCN)=CC=CC2=C1S(O)(=O)=O LAXVMANLDGWYJP-UHFFFAOYSA-N 0.000 description 1
125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
125000006197 2-benzoyl ethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(=O)C([H])([H])C([H])([H])* 0.000 description 1
125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 1
125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
CPBJMKMKNCRKQB-UHFFFAOYSA-N 3,3-bis(4-hydroxy-3-methylphenyl)-2-benzofuran-1-one Chemical compound C1=C(O)C(C)=CC(C2(C3=CC=CC=C3C(=O)O2)C=2C=C(C)C(O)=CC=2)=C1 CPBJMKMKNCRKQB-UHFFFAOYSA-N 0.000 description 1
DVLFYONBTKHTER-UHFFFAOYSA-N 3-(N-morpholino)propanesulfonic acid Chemical compound OS(=O)(=O)CCCN1CCOCC1 DVLFYONBTKHTER-UHFFFAOYSA-N 0.000 description 1
125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
VXGRJERITKFWPL-UHFFFAOYSA-N 4',5'-Dihydropsoralen Natural products C1=C2OC(=O)C=CC2=CC2=C1OCC2 VXGRJERITKFWPL-UHFFFAOYSA-N 0.000 description 1
FWBHETKCLVMNFS-UHFFFAOYSA-N 4',6-Diamino-2-phenylindol Chemical compound C1=CC(C(=N)N)=CC=C1C1=CC2=CC=C(C(N)=N)C=C2N1 FWBHETKCLVMNFS-UHFFFAOYSA-N 0.000 description 1
YJCCSLGGODRWKK-NSCUHMNNSA-N 4-Acetamido-4'-isothiocyanostilbene-2,2'-disulphonic acid Chemical compound OS(=O)(=O)C1=CC(NC(=O)C)=CC=C1\C=C\C1=CC=C(N=C=S)C=C1S(O)(=O)=O YJCCSLGGODRWKK-NSCUHMNNSA-N 0.000 description 1
HXVZHTQDVDNJMN-SSZFMOIBSA-N 4-[(z)-inden-1-ylidenemethyl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1\C=C\1C2=CC=CC=C2C=C/1 HXVZHTQDVDNJMN-SSZFMOIBSA-N 0.000 description 1
WCKQPPQRFNHPRJ-UHFFFAOYSA-N 4-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid Chemical compound C1=CC(N(C)C)=CC=C1N=NC1=CC=C(C(O)=O)C=C1 WCKQPPQRFNHPRJ-UHFFFAOYSA-N 0.000 description 1
SJQRQOKXQKVJGJ-UHFFFAOYSA-N 5-(2-aminoethylamino)naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(NCCN)=CC=CC2=C1S(O)(=O)=O SJQRQOKXQKVJGJ-UHFFFAOYSA-N 0.000 description 1
FBZFLXJHAMMUQM-UHFFFAOYSA-N 5-[(2-acetamidoethyl)amino]naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(NCCNC(=O)C)=CC=CC2=C1S(O)(=O)=O FBZFLXJHAMMUQM-UHFFFAOYSA-N 0.000 description 1
NJYVEMPWNAYQQN-UHFFFAOYSA-N 5-carboxyfluorescein Chemical compound C12=CC=C(O)C=C2OC2=CC(O)=CC=C2C21OC(=O)C1=CC(C(=O)O)=CC=C21 NJYVEMPWNAYQQN-UHFFFAOYSA-N 0.000 description 1
ZFRSPPQNAMLUKP-UHFFFAOYSA-N 5-isothiocyanato-2-[2-(4-isothiocyanato-6-sulfocyclohexa-2,4-dien-1-yl)ethenyl]benzenesulfonic acid;5-isothiocyanato-2-[2-(4-isothiocyanato-2-sulfophenyl)ethenyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1C=C(N=C=S)C=CC1C=CC1=CC=C(N=C=S)C=C1S(O)(=O)=O.OS(=O)(=O)C1=CC(N=C=S)=CC=C1C=CC1=CC=C(N=C=S)C=C1S(O)(=O)=O ZFRSPPQNAMLUKP-UHFFFAOYSA-N 0.000 description 1
HWQQCFPHXPNXHC-UHFFFAOYSA-N 6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one Chemical compound C=1C(O)=CC=C2C=1OC1=CC(O)=CC=C1C2(C1=CC=2)OC(=O)C1=CC=2NC1=NC(Cl)=NC(Cl)=N1 HWQQCFPHXPNXHC-UHFFFAOYSA-N 0.000 description 1
WQZIDRAQTRIQDX-UHFFFAOYSA-N 6-carboxy-x-rhodamine Chemical compound OC(=O)C1=CC=C(C([O-])=O)C=C1C(C1=CC=2CCCN3CCCC(C=23)=C1O1)=C2C1=C(CCC1)C3=[N+]1CCCC3=C2 WQZIDRAQTRIQDX-UHFFFAOYSA-N 0.000 description 1
XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 1
YALJZNKPECPZAS-UHFFFAOYSA-N 7-(diethylamino)-3-(4-isothiocyanatophenyl)-4-methylchromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C(C)=C1C1=CC=C(N=C=S)C=C1 YALJZNKPECPZAS-UHFFFAOYSA-N 0.000 description 1
ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
SGAOZXGJGQEBHA-UHFFFAOYSA-N 82344-98-7 Chemical compound C1CCN2CCCC(C=C3C4(OC(C5=CC(=CC=C54)N=C=S)=O)C4=C5)=C2C1=C3OC4=C1CCCN2CCCC5=C12 SGAOZXGJGQEBHA-UHFFFAOYSA-N 0.000 description 1
229930024421 Adenine Natural products 0.000 description 1
108700028369 Alleles Proteins 0.000 description 1
239000004475 Arginine Substances 0.000 description 1
108020000946 Bacterial DNA Proteins 0.000 description 1
DWRXFEITVBNRMK-UHFFFAOYSA-N Beta-D-1-Arabinofuranosylthymine Natural products O=C1NC(=O)C(C)=CN1C1C(O)C(O)C(CO)O1 DWRXFEITVBNRMK-UHFFFAOYSA-N 0.000 description 1
241000212384 Bifora Species 0.000 description 1
ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
108091003079 Bovine Serum Albumin Proteins 0.000 description 1
WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
239000002126 C01EB10 - Adenosine Substances 0.000 description 1
GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
108020004998 Chloroplast DNA Proteins 0.000 description 1
108020004705 Codon Proteins 0.000 description 1
RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
MIKUYHXYGGJMLM-GIMIYPNGSA-N Crotonoside Natural products C1=NC2=C(N)NC(=O)N=C2N1[C@H]1O[C@@H](CO)[C@H](O)[C@@H]1O MIKUYHXYGGJMLM-GIMIYPNGSA-N 0.000 description 1
UHDGCWIWMRVCDJ-PSQAKQOGSA-N Cytidine Natural products O=C1N=C(N)C=CN1[C@@H]1[C@@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-PSQAKQOGSA-N 0.000 description 1
AUNGANRZJHBGPY-UHFFFAOYSA-N D-Lyxoflavin Natural products OCC(O)C(O)C(O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-UHFFFAOYSA-N 0.000 description 1
NYHBQMYGNKIUIF-UHFFFAOYSA-N D-guanosine Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1OC(CO)C(O)C1O NYHBQMYGNKIUIF-UHFFFAOYSA-N 0.000 description 1
108010076525 DNA Repair Enzymes Proteins 0.000 description 1
102100033195 DNA ligase 4 Human genes 0.000 description 1
238000000018 DNA microarray Methods 0.000 description 1
239000003298 DNA probe Substances 0.000 description 1
238000001712 DNA sequencing Methods 0.000 description 1
AHCYMLUZIRLXAA-SHYZEUOFSA-N Deoxyuridine 5'-triphosphate Chemical compound O1[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)C[C@@H]1N1C(=O)NC(=O)C=C1 AHCYMLUZIRLXAA-SHYZEUOFSA-N 0.000 description 1
SHIBSTMRCDJXLN-UHFFFAOYSA-N Digoxigenin Natural products C1CC(C2C(C3(C)CCC(O)CC3CC2)CC2O)(O)C2(C)C1C1=CC(=O)OC1 SHIBSTMRCDJXLN-UHFFFAOYSA-N 0.000 description 1
BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
238000002965 ELISA Methods 0.000 description 1
241000196324 Embryophyta Species 0.000 description 1
241000991587 Enterovirus C Species 0.000 description 1
102000008857 Ferritin Human genes 0.000 description 1
108050000784 Ferritin Proteins 0.000 description 1
238000008416 Ferritin Methods 0.000 description 1
PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
108010010803 Gelatin Proteins 0.000 description 1
208000034826 Genetic Predisposition to Disease Diseases 0.000 description 1
108010024636 Glutathione Proteins 0.000 description 1
102000005720 Glutathione transferase Human genes 0.000 description 1
108010070675 Glutathione transferase Proteins 0.000 description 1
239000007995 HEPES buffer Substances 0.000 description 1
108010078851 HIV Reverse Transcriptase Proteins 0.000 description 1
HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
101000615488 Homo sapiens Methyl-CpG-binding domain protein 2 Proteins 0.000 description 1
UGQMRVRMYYASKQ-UHFFFAOYSA-N Hypoxanthine nucleoside Natural products OC1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 UGQMRVRMYYASKQ-UHFFFAOYSA-N 0.000 description 1
WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
239000007993 MOPS buffer Substances 0.000 description 1
102100021299 Methyl-CpG-binding domain protein 2 Human genes 0.000 description 1
108091092878 Microsatellite Proteins 0.000 description 1
108020005196 Mitochondrial DNA Proteins 0.000 description 1
101100412856 Mus musculus Rhod gene Proteins 0.000 description 1
241000204031 Mycoplasma Species 0.000 description 1
QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 1
239000000020 Nitrocellulose Substances 0.000 description 1
241001195348 Nusa Species 0.000 description 1
108700020796 Oncogene Proteins 0.000 description 1
BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
108010004729 Phycoerythrin Proteins 0.000 description 1
229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
102000015623 Polynucleotide Adenylyltransferase Human genes 0.000 description 1
108010024055 Polynucleotide adenylyltransferase Proteins 0.000 description 1
239000004743 Polypropylene Substances 0.000 description 1
206010036790 Productive cough Diseases 0.000 description 1
102000055027 Protein Methyltransferases Human genes 0.000 description 1
108700040121 Protein Methyltransferases Proteins 0.000 description 1
108010076504 Protein Sorting Signals Proteins 0.000 description 1
108010064250 RNA polymerase beta subunit Proteins 0.000 description 1
240000004808 Saccharomyces cerevisiae Species 0.000 description 1
241000607142 Salmonella Species 0.000 description 1
229920002684 Sepharose Polymers 0.000 description 1
101100192884 Shewanella halifaxensis (strain HAW-EB4) pyrB1 gene Proteins 0.000 description 1
VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
241000191940 Staphylococcus Species 0.000 description 1
UZMAPBJVXOGOFT-UHFFFAOYSA-N Syringetin Natural products COC1=C(O)C(OC)=CC(C2=C(C(=O)C3=C(O)C=C(O)C=C3O2)O)=C1 UZMAPBJVXOGOFT-UHFFFAOYSA-N 0.000 description 1
108010006785 Taq Polymerase Proteins 0.000 description 1
229910052771 Terbium Inorganic materials 0.000 description 1
101100242191 Tetraodon nigroviridis rho gene Proteins 0.000 description 1
102000040945 Transcription factor Human genes 0.000 description 1
108091023040 Transcription factor Proteins 0.000 description 1
239000007997 Tricine buffer Substances 0.000 description 1
PGAVKCOVUIYSFO-XVFCMESISA-N UTP Chemical class O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C(=O)NC(=O)C=C1 PGAVKCOVUIYSFO-XVFCMESISA-N 0.000 description 1
108020005202 Viral DNA Proteins 0.000 description 1
241000726445 Viroids Species 0.000 description 1
238000002441 X-ray diffraction Methods 0.000 description 1
238000001015 X-ray lithography Methods 0.000 description 1
HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
PNDPGZBMCMUPRI-XXSWNUTMSA-N [125I][125I] Chemical compound [125I][125I] PNDPGZBMCMUPRI-XXSWNUTMSA-N 0.000 description 1
230000001594 aberrant effect Effects 0.000 description 1
230000002159 abnormal effect Effects 0.000 description 1
238000010521 absorption reaction Methods 0.000 description 1
DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
125000002015 acyclic group Chemical group 0.000 description 1
229960000643 adenine Drugs 0.000 description 1
229960005305 adenosine Drugs 0.000 description 1
239000003463 adsorbent Substances 0.000 description 1
125000003172 aldehyde group Chemical group 0.000 description 1
125000004457 alkyl amino carbonyl group Chemical group 0.000 description 1
HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
230000004075 alteration Effects 0.000 description 1
229940059260 amidate Drugs 0.000 description 1
150000001408 amides Chemical class 0.000 description 1
235000001014 amino acid Nutrition 0.000 description 1
150000001413 amino acids Chemical class 0.000 description 1
125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
229910052921 ammonium sulfate Inorganic materials 0.000 description 1
235000011130 ammonium sulphate Nutrition 0.000 description 1
210000004102 animal cell Anatomy 0.000 description 1
238000000137 annealing Methods 0.000 description 1
230000001745 anti-biotin effect Effects 0.000 description 1
239000004599 antimicrobial Substances 0.000 description 1
239000012062 aqueous buffer Substances 0.000 description 1
PYMYPHUHKUWMLA-WDCZJNDASA-N arabinose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C=O PYMYPHUHKUWMLA-WDCZJNDASA-N 0.000 description 1
ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
238000003491 array Methods 0.000 description 1
239000003637 basic solution Substances 0.000 description 1
230000008901 benefit Effects 0.000 description 1
125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
125000005605 benzo group Chemical group 0.000 description 1
125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
IQFYYKKMVGJFEH-UHFFFAOYSA-N beta-L-thymidine Natural products O=C1NC(=O)C(C)=CN1C1OC(CO)C(O)C1 IQFYYKKMVGJFEH-UHFFFAOYSA-N 0.000 description 1
DRTQHJPVMGBUCF-PSQAKQOGSA-N beta-L-uridine Natural products O[C@H]1[C@@H](O)[C@H](CO)O[C@@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-PSQAKQOGSA-N 0.000 description 1
239000011230 binding agent Substances 0.000 description 1
230000031018 biological processes and functions Effects 0.000 description 1
229920001222 biopolymer Polymers 0.000 description 1
235000010290 biphenyl Nutrition 0.000 description 1
239000004305 biphenyl Substances 0.000 description 1
229920001400 block copolymer Polymers 0.000 description 1
210000004369 blood Anatomy 0.000 description 1
239000008280 blood Substances 0.000 description 1
229910052796 boron Inorganic materials 0.000 description 1
229940098773 bovine serum albumin Drugs 0.000 description 1
GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
229910052794 bromium Inorganic materials 0.000 description 1
229920005557 bromobutyl Polymers 0.000 description 1
239000006172 buffering agent Substances 0.000 description 1
150000004648 butanoic acid derivatives Chemical class 0.000 description 1
125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
150000004657 carbamic acid derivatives Chemical class 0.000 description 1
239000004202 carbamide Substances 0.000 description 1
125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
125000002837 carbocyclic group Chemical group 0.000 description 1
150000001720 carbohydrates Chemical class 0.000 description 1
235000014633 carbohydrates Nutrition 0.000 description 1
150000001721 carbon Chemical group 0.000 description 1
239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
125000004181 carboxyalkyl group Chemical group 0.000 description 1
150000001732 carboxylic acid derivatives Chemical group 0.000 description 1
125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
239000000969 carrier Substances 0.000 description 1
125000002091 cationic group Chemical group 0.000 description 1
230000001413 cellular effect Effects 0.000 description 1
210000001175 cerebrospinal fluid Anatomy 0.000 description 1
238000012512 characterization method Methods 0.000 description 1
239000013522 chelant Substances 0.000 description 1
238000007385 chemical modification Methods 0.000 description 1
229910052801 chlorine Inorganic materials 0.000 description 1
125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
238000003776 cleavage reaction Methods 0.000 description 1
238000010367 cloning Methods 0.000 description 1
238000002967 competitive immunoassay Methods 0.000 description 1
230000001276 controlling effect Effects 0.000 description 1
229910052802 copper Inorganic materials 0.000 description 1
239000010949 copper Substances 0.000 description 1
239000002537 cosmetic Substances 0.000 description 1
238000004132 cross linking Methods 0.000 description 1
230000001351 cycling effect Effects 0.000 description 1
125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 1
125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
125000004090 cyclononenyl group Chemical group C1(=CCCCCCCC1)* 0.000 description 1
125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
125000001945 cyclooctatrienyl group Chemical group C1(=CC=CC=CCC1)* 0.000 description 1
125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 1
235000018417 cysteine Nutrition 0.000 description 1
UHDGCWIWMRVCDJ-ZAKLUEHWSA-N cytidine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-ZAKLUEHWSA-N 0.000 description 1
CTMZLDSMFCVUNX-VMIOUTBZSA-N cytidylyl-(3'->5')-guanosine Chemical class O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@H](OP(O)(=O)OC[C@@H]2[C@H]([C@@H](O)[C@@H](O2)N2C3=C(C(N=C(N)N3)=O)N=C2)O)[C@@H](CO)O1 CTMZLDSMFCVUNX-VMIOUTBZSA-N 0.000 description 1
235000013365 dairy product Nutrition 0.000 description 1
125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
230000007812 deficiency Effects 0.000 description 1
230000002950 deficient Effects 0.000 description 1
LTFMZDNNPPEQNG-UHFFFAOYSA-N deoxyguanylic acid Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1CC(O)C(COP(O)(O)=O)O1 LTFMZDNNPPEQNG-UHFFFAOYSA-N 0.000 description 1
239000005549 deoxyribonucleoside Substances 0.000 description 1
230000008021 deposition Effects 0.000 description 1
230000001066 destructive effect Effects 0.000 description 1
229960000633 dextran sulfate Drugs 0.000 description 1
238000012631 diagnostic technique Methods 0.000 description 1
125000004663 dialkyl amino group Chemical group 0.000 description 1
125000005265 dialkylamine group Chemical group 0.000 description 1
235000014113 dietary fatty acids Nutrition 0.000 description 1
125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
230000029087 digestion Effects 0.000 description 1
QONQRTHLHBTMGP-UHFFFAOYSA-N digitoxigenin Natural products CC12CCC(C3(CCC(O)CC3CC3)C)C3C11OC1CC2C1=CC(=O)OC1 QONQRTHLHBTMGP-UHFFFAOYSA-N 0.000 description 1
SHIBSTMRCDJXLN-KCZCNTNESA-N digoxigenin Chemical compound C1([C@@H]2[C@@]3([C@@](CC2)(O)[C@H]2[C@@H]([C@@]4(C)CC[C@H](O)C[C@H]4CC2)C[C@H]3O)C)=CC(=O)OC1 SHIBSTMRCDJXLN-KCZCNTNESA-N 0.000 description 1
KCFYHBSOLOXZIF-UHFFFAOYSA-N dihydrochrysin Natural products COC1=C(O)C(OC)=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2)=C1 KCFYHBSOLOXZIF-UHFFFAOYSA-N 0.000 description 1
125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
125000004655 dihydropyridinyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
239000003085 diluting agent Substances 0.000 description 1
NAGJZTKCGNOGPW-UHFFFAOYSA-K dioxido-sulfanylidene-sulfido-$l^{5}-phosphane Chemical compound [O-]P([O-])([S-])=S NAGJZTKCGNOGPW-UHFFFAOYSA-K 0.000 description 1
238000007598 dipping method Methods 0.000 description 1
230000006806 disease prevention Effects 0.000 description 1
235000021186 dishes Nutrition 0.000 description 1
RAGZEDHHTPQLAI-UHFFFAOYSA-L disodium;2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate Chemical compound [Na+].[Na+].O1C(=O)C2=CC=CC=C2C21C1=CC(I)=C([O-])C(I)=C1OC1=C(I)C([O-])=C(I)C=C21 RAGZEDHHTPQLAI-UHFFFAOYSA-L 0.000 description 1
208000035475 disorder Diseases 0.000 description 1
238000006073 displacement reaction Methods 0.000 description 1
150000002019 disulfides Chemical class 0.000 description 1
229920001971 elastomer Polymers 0.000 description 1
230000005611 electricity Effects 0.000 description 1
238000010894 electron beam technology Methods 0.000 description 1
238000000609 electron-beam lithography Methods 0.000 description 1
238000005370 electroosmosis Methods 0.000 description 1
239000005447 environmental material Substances 0.000 description 1
XHXYXYGSUXANME-UHFFFAOYSA-N eosin 5-isothiocyanate Chemical compound O1C(=O)C2=CC(N=C=S)=CC=C2C21C1=CC(Br)=C(O)C(Br)=C1OC1=C(Br)C(O)=C(Br)C=C21 XHXYXYGSUXANME-UHFFFAOYSA-N 0.000 description 1
230000008995 epigenetic change Effects 0.000 description 1
150000002148 esters Chemical class 0.000 description 1
125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 description 1
DEFVIWRASFVYLL-UHFFFAOYSA-N ethylene glycol bis(2-aminoethyl)tetraacetic acid Chemical compound OC(=O)CN(CC(O)=O)CCOCCOCCN(CC(O)=O)CC(O)=O DEFVIWRASFVYLL-UHFFFAOYSA-N 0.000 description 1
125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
NPUKDXXFDDZOKR-LLVKDONJSA-N etomidate Chemical compound CCOC(=O)C1=CN=CN1[C@H](C)C1=CC=CC=C1 NPUKDXXFDDZOKR-LLVKDONJSA-N 0.000 description 1
229930195729 fatty acid Natural products 0.000 description 1
239000000194 fatty acid Substances 0.000 description 1
150000004665 fatty acids Chemical class 0.000 description 1
210000003608 fece Anatomy 0.000 description 1
ZFKJVJIDPQDDFY-UHFFFAOYSA-N fluorescamine Chemical compound C12=CC=CC=C2C(=O)OC1(C1=O)OC=C1C1=CC=CC=C1 ZFKJVJIDPQDDFY-UHFFFAOYSA-N 0.000 description 1
MHMNJMPURVTYEJ-UHFFFAOYSA-N fluorescein-5-isothiocyanate Chemical compound O1C(=O)C2=CC(N=C=S)=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 MHMNJMPURVTYEJ-UHFFFAOYSA-N 0.000 description 1
238000002189 fluorescence spectrum Methods 0.000 description 1
239000007850 fluorescent dye Substances 0.000 description 1
229910052731 fluorine Inorganic materials 0.000 description 1
239000011737 fluorine Substances 0.000 description 1
125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
125000005816 fluoropropyl group Chemical group [H]C([H])(F)C([H])([H])C([H])([H])* 0.000 description 1
230000005714 functional activity Effects 0.000 description 1
150000002243 furanoses Chemical class 0.000 description 1
125000002541 furyl group Chemical group 0.000 description 1
239000000499 gel Substances 0.000 description 1
238000001502 gel electrophoresis Methods 0.000 description 1
239000008273 gelatin Substances 0.000 description 1
229920000159 gelatin Polymers 0.000 description 1
229940014259 gelatin Drugs 0.000 description 1
235000019322 gelatine Nutrition 0.000 description 1
235000011852 gelatine desserts Nutrition 0.000 description 1
238000012239 gene modification Methods 0.000 description 1
230000005017 genetic modification Effects 0.000 description 1
235000013617 genetically modified food Nutrition 0.000 description 1
229930195712 glutamate Natural products 0.000 description 1
229960003180 glutathione Drugs 0.000 description 1
125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 1
238000000892 gravimetry Methods 0.000 description 1
230000012010 growth Effects 0.000 description 1
229960000789 guanidine hydrochloride Drugs 0.000 description 1
PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 1
229940029575 guanosine Drugs 0.000 description 1
125000001188 haloalkyl group Chemical group 0.000 description 1
229910052736 halogen Inorganic materials 0.000 description 1
150000002367 halogens Chemical class 0.000 description 1
230000036541 health Effects 0.000 description 1
238000003505 heat denaturation Methods 0.000 description 1
229960002897 heparin Drugs 0.000 description 1
229920000669 heparin Polymers 0.000 description 1
125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
125000004475 heteroaralkyl group Chemical group 0.000 description 1
125000004446 heteroarylalkyl group Chemical group 0.000 description 1
125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
150000002431 hydrogen Chemical class 0.000 description 1
WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
125000002768 hydroxyalkyl group Chemical group 0.000 description 1
125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
238000003384 imaging method Methods 0.000 description 1
125000002632 imidazolidinyl group Chemical group 0.000 description 1
125000002636 imidazolinyl group Chemical group 0.000 description 1
125000002883 imidazolyl group Chemical group 0.000 description 1
125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
125000001041 indolyl group Chemical group 0.000 description 1
239000004615 ingredient Substances 0.000 description 1
230000002401 inhibitory effect Effects 0.000 description 1
239000013067 intermediate product Substances 0.000 description 1
229910052740 iodine Inorganic materials 0.000 description 1
239000011630 iodine Substances 0.000 description 1
PGLTVOMIXTUURA-UHFFFAOYSA-N iodoacetamide Chemical compound NC(=O)CI PGLTVOMIXTUURA-UHFFFAOYSA-N 0.000 description 1
125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
238000002955 isolation Methods 0.000 description 1
125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
125000005956 isoquinolyl group Chemical group 0.000 description 1
238000011901 isothermal amplification Methods 0.000 description 1
125000001786 isothiazolyl group Chemical group 0.000 description 1
125000000842 isoxazolyl group Chemical group 0.000 description 1
229910052747 lanthanoid Inorganic materials 0.000 description 1
150000002602 lanthanoids Chemical class 0.000 description 1
150000002632 lipids Chemical class 0.000 description 1
239000007788 liquid Substances 0.000 description 1
235000021056 liquid food Nutrition 0.000 description 1
210000002751 lymph Anatomy 0.000 description 1
230000005389 magnetism Effects 0.000 description 1
229940107698 malachite green Drugs 0.000 description 1
WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
239000003550 marker Substances 0.000 description 1
238000005259 measurement Methods 0.000 description 1
229910044991 metal oxide Inorganic materials 0.000 description 1
150000004706 metal oxides Chemical class 0.000 description 1
125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 description 1
230000000813 microbial effect Effects 0.000 description 1
239000011859 microparticle Substances 0.000 description 1
108091064355 mitochondrial RNA Proteins 0.000 description 1
125000002757 morpholinyl group Chemical group 0.000 description 1
210000003097 mucus Anatomy 0.000 description 1
125000006606 n-butoxy group Chemical group 0.000 description 1
125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
125000002004 n-butylamino group Chemical group [H]N(*)C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
125000004708 n-butylthio group Chemical group C(CCC)S* 0.000 description 1
125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
LKKPNUDVOYAOBB-UHFFFAOYSA-N naphthalocyanine Chemical compound N1C(N=C2C3=CC4=CC=CC=C4C=C3C(N=C3C4=CC5=CC=CC=C5C=C4C(=N4)N3)=N2)=C(C=C2C(C=CC=C2)=C2)C2=C1N=C1C2=CC3=CC=CC=C3C=C2C4=N1 LKKPNUDVOYAOBB-UHFFFAOYSA-N 0.000 description 1
125000001624 naphthyl group Chemical group 0.000 description 1
125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
239000013642 negative control Substances 0.000 description 1
230000003472 neutralizing effect Effects 0.000 description 1
108010087904 neutravidin Proteins 0.000 description 1
229920001220 nitrocellulos Polymers 0.000 description 1
125000004433 nitrogen atom Chemical group N* 0.000 description 1
125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
230000005257 nucleotidylation Effects 0.000 description 1
229940066429 octoxynol Drugs 0.000 description 1
229920002113 octoxynol Polymers 0.000 description 1
125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
238000005457 optimization Methods 0.000 description 1
238000004806 packaging method and process Methods 0.000 description 1
230000005298 paramagnetic effect Effects 0.000 description 1
230000005408 paramagnetism Effects 0.000 description 1
AFAIELJLZYUNPW-UHFFFAOYSA-N pararosaniline free base Chemical compound C1=CC(N)=CC=C1C(C=1C=CC(N)=CC=1)=C1C=CC(=N)C=C1 AFAIELJLZYUNPW-UHFFFAOYSA-N 0.000 description 1
229960003330 pentetic acid Drugs 0.000 description 1
125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
125000005327 perimidinyl group Chemical group N1C(=NC2=CC=CC3=CC=CC1=C23)* 0.000 description 1
230000000737 periodic effect Effects 0.000 description 1
125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
229960003531 phenolsulfonphthalein Drugs 0.000 description 1
125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
PTMHPRAIXMAOOB-UHFFFAOYSA-L phosphoramidate Chemical compound NP([O-])([O-])=O PTMHPRAIXMAOOB-UHFFFAOYSA-L 0.000 description 1
150000003013 phosphoric acid derivatives Chemical group 0.000 description 1
ZWLUXSQADUDCSB-UHFFFAOYSA-N phthalaldehyde Chemical compound O=CC1=CC=CC=C1C=O ZWLUXSQADUDCSB-UHFFFAOYSA-N 0.000 description 1
125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
125000004193 piperazinyl group Chemical group 0.000 description 1
125000005936 piperidyl group Chemical group 0.000 description 1
239000013612 plasmid Substances 0.000 description 1
210000004910 pleural fluid Anatomy 0.000 description 1
229920000729 poly(L-lysine) polymer Polymers 0.000 description 1
239000004417 polycarbonate Substances 0.000 description 1
229920000515 polycarbonate Polymers 0.000 description 1
230000000379 polymerizing effect Effects 0.000 description 1
229920001155 polypropylene Polymers 0.000 description 1
229940068977 polysorbate 20 Drugs 0.000 description 1
239000013641 positive control Substances 0.000 description 1
101150113223 pppA gene Proteins 0.000 description 1
238000002360 preparation method Methods 0.000 description 1
150000003141 primary amines Chemical group 0.000 description 1
238000012545 processing Methods 0.000 description 1
230000000750 progressive effect Effects 0.000 description 1
125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
230000009145 protein modification Effects 0.000 description 1
125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
150000003214 pyranose derivatives Chemical class 0.000 description 1
125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
125000003373 pyrazinyl group Chemical group 0.000 description 1
125000003072 pyrazolidinyl group Chemical group 0.000 description 1
125000002755 pyrazolinyl group Chemical group 0.000 description 1
125000003226 pyrazolyl group Chemical group 0.000 description 1
AJMSJNPWXJCWOK-UHFFFAOYSA-N pyren-1-yl butanoate Chemical compound C1=C2C(OC(=O)CCC)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 AJMSJNPWXJCWOK-UHFFFAOYSA-N 0.000 description 1
125000002098 pyridazinyl group Chemical group 0.000 description 1
125000004076 pyridyl group Chemical group 0.000 description 1
125000000719 pyrrolidinyl group Chemical group 0.000 description 1
125000001422 pyrrolinyl group Chemical group 0.000 description 1
125000000168 pyrrolyl group Chemical group 0.000 description 1
238000004451 qualitative analysis Methods 0.000 description 1
125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
125000005493 quinolyl group Chemical group 0.000 description 1
125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
230000005258 radioactive decay Effects 0.000 description 1
238000003608 radiolysis reaction Methods 0.000 description 1
239000012429 reaction media Substances 0.000 description 1
238000010188 recombinant method Methods 0.000 description 1
230000007115 recruitment Effects 0.000 description 1
230000009467 reduction Effects 0.000 description 1
230000008439 repair process Effects 0.000 description 1
230000003362 replicative effect Effects 0.000 description 1
230000027756 respiratory electron transport chain Effects 0.000 description 1
230000004044 response Effects 0.000 description 1
230000002441 reversible effect Effects 0.000 description 1
MYFATKRONKHHQL-UHFFFAOYSA-N rhodamine 123 Chemical compound [Cl-].COC(=O)C1=CC=CC=C1C1=C2C=CC(=[NH2+])C=C2OC2=CC(N)=CC=C21 MYFATKRONKHHQL-UHFFFAOYSA-N 0.000 description 1
235000019192 riboflavin Nutrition 0.000 description 1
239000002151 riboflavin Substances 0.000 description 1
229960002477 riboflavin Drugs 0.000 description 1
210000003296 saliva Anatomy 0.000 description 1
230000007017 scission Effects 0.000 description 1
238000012216 screening Methods 0.000 description 1
210000000582 semen Anatomy 0.000 description 1
210000002966 serum Anatomy 0.000 description 1
150000003384 small molecules Chemical class 0.000 description 1
239000011734 sodium Substances 0.000 description 1
239000001632 sodium acetate Substances 0.000 description 1
235000017281 sodium acetate Nutrition 0.000 description 1
239000007974 sodium acetate buffer Substances 0.000 description 1
235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
239000002689 soil Substances 0.000 description 1
235000021055 solid food Nutrition 0.000 description 1
239000002904 solvent Substances 0.000 description 1
229940035044 sorbitan monolaurate Drugs 0.000 description 1
230000009870 specific binding Effects 0.000 description 1
229940063673 spermidine Drugs 0.000 description 1
238000005507 spraying Methods 0.000 description 1
210000003802 sputum Anatomy 0.000 description 1
208000024794 sputum Diseases 0.000 description 1
150000003431 steroids Chemical class 0.000 description 1
238000003860 storage Methods 0.000 description 1
150000003457 sulfones Chemical class 0.000 description 1
125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
COIVODZMVVUETJ-UHFFFAOYSA-N sulforhodamine 101 Chemical compound OS(=O)(=O)C1=CC(S([O-])(=O)=O)=CC=C1C1=C(C=C2C3=C4CCCN3CCC2)C4=[O+]C2=C1C=C1CCCN3CCCC2=C13 COIVODZMVVUETJ-UHFFFAOYSA-N 0.000 description 1
125000004434 sulfur atom Chemical group 0.000 description 1
208000024891 symptom Diseases 0.000 description 1
GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 description 1
125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
125000004853 tetrahydropyridinyl group Chemical group N1(CCCC=C1)* 0.000 description 1
125000003831 tetrazolyl group Chemical group 0.000 description 1
230000001225 therapeutic effect Effects 0.000 description 1
ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 1
RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 1
229940104230 thymidine Drugs 0.000 description 1
210000001519 tissue Anatomy 0.000 description 1
239000003053 toxin Substances 0.000 description 1
231100000765 toxin Toxicity 0.000 description 1
108700012359 toxins Proteins 0.000 description 1
230000005026 transcription initiation Effects 0.000 description 1
230000005030 transcription termination Effects 0.000 description 1
230000002103 transcriptional effect Effects 0.000 description 1
230000032258 transport Effects 0.000 description 1
125000006000 trichloroethyl group Chemical group 0.000 description 1
125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
JLEXUIVKURIPFI-UHFFFAOYSA-N tris phosphate Chemical compound OP(O)(O)=O.OCC(N)(CO)CO JLEXUIVKURIPFI-UHFFFAOYSA-N 0.000 description 1
241001515965 unidentified phage Species 0.000 description 1
DRTQHJPVMGBUCF-UHFFFAOYSA-N uracil arabinoside Natural products OC1C(O)C(CO)OC1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-UHFFFAOYSA-N 0.000 description 1
229940045145 uridine Drugs 0.000 description 1
210000002700 urine Anatomy 0.000 description 1
238000007740 vapor deposition Methods 0.000 description 1
108700026220 vif Genes Proteins 0.000 description 1
229920002554 vinyl polymer Polymers 0.000 description 1
230000003612 virological effect Effects 0.000 description 1
125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
229940075420 xanthine Drugs 0.000 description 1
229910052725 zinc Inorganic materials 0.000 description 1
239000011701 zinc Substances 0.000 description 1
125000004933 β-carbolinyl group Chemical group C1(=NC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1