IL84105A0 - 1-tertiary-alkyl-substituted naphthyridine-and quinoline-carboxylic acids and salts thereof and pharmaceutical compositions containing them - Google Patents
1-tertiary-alkyl-substituted naphthyridine-and quinoline-carboxylic acids and salts thereof and pharmaceutical compositions containing themInfo
- Publication number
- IL84105A0 IL84105A0 IL84105A IL8410587A IL84105A0 IL 84105 A0 IL84105 A0 IL 84105A0 IL 84105 A IL84105 A IL 84105A IL 8410587 A IL8410587 A IL 8410587A IL 84105 A0 IL84105 A0 IL 84105A0
- Authority
- IL
- Israel
- Prior art keywords
- quinoline
- tertiary
- salts
- alkyl
- pharmaceutical compositions
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical class C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/08—Bridged systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IL102173A IL102173A0 (en) | 1986-10-08 | 1992-06-11 | Heterocyclic amines |
| IL102174A IL102174A0 (en) | 1986-10-08 | 1992-06-11 | 4-oxo-naphthyridine-and 4-oxo-quinoline-3-carboxylic acid derivatives |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US91675286A | 1986-10-08 | 1986-10-08 | |
| US9923187A | 1987-09-25 | 1987-09-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL84105A0 true IL84105A0 (en) | 1988-03-31 |
Family
ID=26795810
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL84105A IL84105A0 (en) | 1986-10-08 | 1987-10-06 | 1-tertiary-alkyl-substituted naphthyridine-and quinoline-carboxylic acids and salts thereof and pharmaceutical compositions containing them |
Country Status (10)
| Country | Link |
|---|---|
| EP (1) | EP0266576A3 (cs) |
| CN (1) | CN87106925A (cs) |
| CS (1) | CS270597B2 (cs) |
| IE (1) | IE872696L (cs) |
| IL (1) | IL84105A0 (cs) |
| NZ (1) | NZ222047A (cs) |
| OA (1) | OA08688A (cs) |
| PL (2) | PL156484B1 (cs) |
| PT (1) | PT85886B (cs) |
| YU (2) | YU46079B (cs) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5173484A (en) * | 1988-02-05 | 1992-12-22 | Bayer Aktiengesellschaft | Quinolone- and naphthyridone carboxylic acid derivatives, process for their production, antibacterial compositions and feed additives containing them |
| US4859776A (en) * | 1988-03-11 | 1989-08-22 | Abbott Laboratories | (S)-7-(3-aminopyrrolidin-1-yl)-1-(ortho, para-difluorophenyl)-1,4-dihydro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid and method for its preparation |
| EP0997466A1 (en) * | 1988-10-24 | 2000-05-03 | PROCTER & GAMBLE PHARMACEUTICALS, INC. | Novel antimicrobial lactam-quinolones |
| CA2001203C (en) * | 1988-10-24 | 2001-02-13 | Thomas P. Demuth, Jr. | Novel antimicrobial dithiocarbamoyl quinolones |
| FI901201A7 (fi) * | 1989-03-13 | 1990-09-14 | Bristol Myers Squibb Co | Antibakteeriset 5-substituoidut 1,4-dihydro-4-oksonaftyridiini-3-karboksylaattijohdannaiset ja niiden valmistus |
| DE3910920A1 (de) * | 1989-04-05 | 1990-10-11 | Bayer Ag | Enantiomerenreine 7-(3-amino-1-pyrrolidinyl)-chinolon- und -naphthyridoncarbonsaeuren |
| WO1991016327A1 (en) | 1990-04-18 | 1991-10-31 | Norwich Eaton Pharmaceuticals, Inc. | Antimicrobial quinolonyl lactams |
| JPH06509792A (ja) * | 1991-01-14 | 1994-11-02 | ハンミ藥品工業株式會社 | 新規なキノロン化合物及びその製造方法 |
| AU1161492A (en) * | 1991-01-14 | 1992-08-17 | Hanmi Pharmaceutical Co., Ltd. | Novel quinolone compounds and processes for preparation thereof |
| KR940014395A (ko) * | 1992-12-09 | 1994-07-18 | 강박광 | 신규한 퀴놀론 유도체 및 그의 제조방법 |
| KR0148277B1 (ko) * | 1993-01-18 | 1998-11-02 | 채영복 | 신규한 플루오르퀴놀론계 유도체 및 그의 제조방법 |
| WO1994025464A1 (en) * | 1993-04-24 | 1994-11-10 | Korea Research Institute Of Chemical Technology | Novel quinolone carboxylic acid derivatives and process for preparing the same |
| DK0688772T3 (da) * | 1994-06-16 | 1999-11-01 | Lg Chemical Ltd | Quinolincarboxylsyrederivater med 7-(4-aminomethyl-3-oxim)-pyrrolidinsubstituenter og fremgangsmåde til deres fremstilling |
| US20020032216A1 (en) | 1997-03-21 | 2002-03-14 | Lg Chemical Ltd. | Salt of naphthyridine carboxylic acid derivative |
| MA24500A1 (fr) | 1997-03-21 | 1998-10-01 | Lg Life Sciences Ltd | Derive du sel d'acide carboxylique de naphthyridine . |
| US6316488B1 (en) * | 1999-06-17 | 2001-11-13 | Merck & Co., Inc. | Antibiotic compound |
| GB9920917D0 (en) | 1999-09-03 | 1999-11-10 | Sb Pharmco Inc | Novel process |
| GB9920919D0 (en) | 1999-09-03 | 1999-11-10 | Sb Pharmco Inc | Novel compound |
| SE0003795D0 (sv) | 2000-10-20 | 2000-10-20 | Astrazeneca Ab | Pharmaceutically useful compounds |
| WO2003031443A1 (en) | 2001-10-04 | 2003-04-17 | Morphochem Aktiengesellschaft für kombinatorische Chemie | Dual actions antibiotics comprising a oxazoldinone and a quinolone or naphthyridinone moiety |
| WO2003031441A1 (en) * | 2001-10-04 | 2003-04-17 | Morphochen Aktiengesellschaft Für Kombinatorische Chemie | Multiple action compounds |
| KR100517638B1 (ko) | 2002-04-08 | 2005-09-28 | 주식회사 엘지생명과학 | 게미플록사신 산염의 새로운 제조방법 |
| EP1620098B1 (en) | 2003-04-30 | 2008-06-11 | Morphochem Aktiengesellschaft Für Kombinatorische Chemie | Use of oxazolidinone-quinoline hybrid antibiotics for the treatment of anthrax and other infections |
| DE10340485B4 (de) | 2003-09-03 | 2015-05-13 | Morphochem AG Aktiengesellschaft für kombinatorische Chemie | Verfahren zur Herstellung von Oxazolidinon-Chinolon Hybriden |
| DE602004015158D1 (de) | 2003-12-18 | 2008-08-28 | Morphochem Ag Komb Chemie | Oxazolidinon-chinolon hybrid antibiotika |
| US8158797B2 (en) | 2003-12-18 | 2012-04-17 | Morphochem Aktiengesellschaft Fur Kombinatorische Chemie | Oxazolidinone-quinolone hybrid antibiotics |
| US7563805B2 (en) * | 2005-05-19 | 2009-07-21 | Daiichi Pharmaceutical Co., Ltd. | Tri-, tetra-substituted-3-aminopyrrolidine derivative |
| RU2420524C2 (ru) * | 2005-05-19 | 2011-06-10 | Дайити Санкио Компани, Лимитед | Производные три- или тетра-замещенного-3-аминопирролидина |
| US7935725B2 (en) | 2007-10-31 | 2011-05-03 | Janssen Pharmaceutica Nv | Aryl-substituted bridged or fused diamines as modulators of leukotriene A4 hydrolase |
| RS53081B (sr) | 2008-04-11 | 2014-06-30 | Janssen Pharmaceutica N.V. | Thiazolopiridin-2-iloksi-fenil i amini thiazolopiridin-2-iloksi fenila kao modulatori leukotrien a4 hidrolaze |
| EP2430019B1 (en) | 2009-05-14 | 2013-09-18 | Janssen Pharmaceutica, N.V. | Compounds with two fused bicyclic heteroaryl moieties as modulators of leukotriene a4 hydrolase |
| ES2383857B1 (es) * | 2010-11-23 | 2013-05-13 | Consejo Superior De Investigaciones Científicas (Csic) | Haptenos e inmunoreactivos y su uso en la obtención de anticuerpos de familia e inmunoensayos para quinolonas |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH408036A (de) * | 1960-02-17 | 1966-02-28 | Lepetit Spa | Verfahren zur Herstellung von 3,8-Diazabicyclo-(3,2,1)-octan-2,4-dionen |
| DE2808070A1 (de) * | 1978-02-24 | 1979-08-30 | Bayer Ag | Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten |
| GB2093018B (en) * | 1979-08-22 | 1984-09-12 | Kyorin Seiyaku Kk | 6,8-difluoro-quinoline carboxylic acid derivatives |
| US4665079A (en) * | 1984-02-17 | 1987-05-12 | Warner-Lambert Company | Antibacterial agents |
| US4571396A (en) * | 1984-04-16 | 1986-02-18 | Warner-Lambert Company | Antibacterial agents |
| DE3509546A1 (de) * | 1985-03-16 | 1986-09-25 | Bayer Ag, 5090 Leverkusen | 7-amino-1-(subst.cyclopropyl)-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| US4578473A (en) * | 1985-04-15 | 1986-03-25 | Warner-Lambert Company | Process for quinoline-3-carboxylic acid antibacterial agents |
-
1987
- 1987-10-05 NZ NZ222047A patent/NZ222047A/xx unknown
- 1987-10-06 IL IL84105A patent/IL84105A0/xx unknown
- 1987-10-07 PL PL1987287459A patent/PL156484B1/pl unknown
- 1987-10-07 PL PL1987268098A patent/PL154473B1/pl unknown
- 1987-10-08 EP EP87114686A patent/EP0266576A3/en not_active Withdrawn
- 1987-10-08 CN CN198787106925A patent/CN87106925A/zh active Pending
- 1987-10-08 YU YU186887A patent/YU46079B/sh unknown
- 1987-10-08 PT PT85886A patent/PT85886B/pt not_active IP Right Cessation
- 1987-10-08 OA OA59206A patent/OA08688A/xx unknown
- 1987-10-08 IE IE872696A patent/IE872696L/xx unknown
- 1987-10-08 CS CS877295A patent/CS270597B2/cs unknown
-
1988
- 1988-07-05 YU YU131088A patent/YU46112B/sh unknown
Also Published As
| Publication number | Publication date |
|---|---|
| YU46079B (sh) | 1992-12-21 |
| PT85886A (en) | 1987-11-01 |
| PL268098A1 (en) | 1988-09-01 |
| YU46112B (sh) | 1992-12-21 |
| PT85886B (pt) | 1990-07-31 |
| CS270597B2 (en) | 1990-07-12 |
| OA08688A (fr) | 1989-03-31 |
| CN87106925A (zh) | 1988-09-14 |
| PL156484B1 (en) | 1992-03-31 |
| NZ222047A (en) | 1991-01-29 |
| YU186887A (en) | 1988-12-31 |
| EP0266576A2 (en) | 1988-05-11 |
| EP0266576A3 (en) | 1989-03-22 |
| PL154473B1 (en) | 1991-08-30 |
| YU131088A (en) | 1988-12-31 |
| IE872696L (en) | 1988-04-08 |
| CS729587A2 (en) | 1989-11-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL84105A0 (en) | 1-tertiary-alkyl-substituted naphthyridine-and quinoline-carboxylic acids and salts thereof and pharmaceutical compositions containing them | |
| IL74882A (en) | Naphthyridine-and quinoline-carboxylic acids and derivatives thereof,their manufacture and pharmaceutical compositions containing them | |
| NZ220345A (en) | Imidazoquinolinylether derivatives and pharmaceutical compositions containing them | |
| NZ222980A (en) | 3-aryloxy-3-substituted propanamines and pharmaceutical compositions | |
| NZ223096A (en) | Peptidylaminodiols and pharmaceutical compositions | |
| IL82221A0 (en) | Phenyl-piperazines and pharmaceutical compositions containing them | |
| NZ216678A (en) | Heterocyclic substituted-phenoxyalkyl-isoxazoles and -furans and pharmaceutical compositions | |
| IL83032A (en) | Pharmaceutical compositions containing calcium salts and their preparation | |
| IL78528A (en) | Difluoro-naphthyridine-and trifluoro-quinoline-carboxylic acids and esters and salts thereof and pharmaceutical compositions containing them | |
| NZ226450A (en) | Crystalline-1-carbacephalosporin and pharmaceutical compositions | |
| NZ227036A (en) | Quinoline derivatives and pharmaceutical compositions containing such | |
| IL84268A (en) | Amino-cyclohexyl-hydroxyalkanoic acid peptide derivatives and pharmaceutical compositions containing them | |
| IL87800A0 (en) | Dioxolane-2-carboxylic acids and pharmaceutical compositions comprising them | |
| IL79376A (en) | Substituted di-t-butylphenols and pharmaceutical compositions containing them | |
| IL85969A0 (en) | Ribofuranuronic acid derivatives and pharmaceutical compositions containing them | |
| IL82205A0 (en) | Substituted alkanesulfonamidophenyl derivatives and pharmaceutical compositions containing them | |
| NZ220336A (en) | Isoquinoline derivatives and pharmaceutical compositions containing such | |
| NZ214821A (en) | Spiro-dioxolanes, -dithiolanes and -oxothiolanes and pharmaceutical compositions | |
| NZ218428A (en) | Heterocyclically-substituted quinoline derivatives and pharmaceutical compositions | |
| IL79181A0 (en) | 3-(substituted)propenylaminothiazolylcephalosporanic acids and esters thereof,their preparation and pharmaceutical compositions containing them | |
| NZ218837A (en) | Melphalan derivatives and pharmaceutical compositions | |
| NZ215070A (en) | Imidazole-indoles and pharmaceutical compositions | |
| NZ224923A (en) | 2-methoxymethyl-penem-3-carboxylic acid derivatives and pharmaceutical compositions | |
| IL84724A0 (en) | Substituted aminomethyl-5,6,7,8-tetrahydronaphthyloxyacetic acids and esters and amides thereof,their preparation and pharmaceutical compositions containing them | |
| NZ215174A (en) | Barbituric acid derivatives and pharmaceutical compositions |