IE42653B1 - Benzyl thioamides and their use as pesticides - Google Patents
Benzyl thioamides and their use as pesticidesInfo
- Publication number
- IE42653B1 IE42653B1 IE486/76A IE48676A IE42653B1 IE 42653 B1 IE42653 B1 IE 42653B1 IE 486/76 A IE486/76 A IE 486/76A IE 48676 A IE48676 A IE 48676A IE 42653 B1 IE42653 B1 IE 42653B1
- Authority
- IE
- Ireland
- Prior art keywords
- group
- thioamides
- carbon atoms
- represent
- general formula
- Prior art date
Links
- 239000000575 pesticide Substances 0.000 title description 2
- BCELSKZIQVOBEH-UHFFFAOYSA-N s-benzylthiohydroxylamine Chemical class NSCC1=CC=CC=C1 BCELSKZIQVOBEH-UHFFFAOYSA-N 0.000 title 1
- 150000003556 thioamides Chemical class 0.000 claims abstract description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 15
- 150000003839 salts Chemical class 0.000 claims abstract description 11
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000000460 chlorine Substances 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 4
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 3
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims abstract description 3
- 125000000262 haloalkenyl group Chemical group 0.000 claims abstract description 3
- 125000005843 halogen group Chemical group 0.000 claims abstract 4
- 239000000203 mixture Substances 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 9
- -1 isobutenyl group Chemical group 0.000 claims description 6
- 239000004094 surface-active agent Substances 0.000 claims description 6
- 241000238876 Acari Species 0.000 claims description 5
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 241000238631 Hexapoda Species 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 239000000010 aprotic solvent Substances 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- 239000004480 active ingredient Substances 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 abstract description 2
- 150000001875 compounds Chemical class 0.000 description 16
- 239000000243 solution Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 238000005507 spraying Methods 0.000 description 6
- 231100000167 toxic agent Toxicity 0.000 description 6
- 239000003440 toxic substance Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 241000255925 Diptera Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 240000006677 Vicia faba Species 0.000 description 3
- 230000000895 acaricidal effect Effects 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 230000000749 insecticidal effect Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000000361 pesticidal effect Effects 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- 235000011293 Brassica napus Nutrition 0.000 description 2
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- 241000171293 Megoura viciae Species 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 241000256250 Spodoptera littoralis Species 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- YMGUBTXCNDTFJI-UHFFFAOYSA-M cyclopropanecarboxylate Chemical compound [O-]C(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-M 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000004546 suspension concentrate Substances 0.000 description 2
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- QLVKECUOHNDWOI-UHFFFAOYSA-N 2-oxo-1,3,2$l^{5}-diazaphosphonan-2-amine Chemical compound NP1(=O)NCCCCCCN1 QLVKECUOHNDWOI-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 108010053481 Antifreeze Proteins Proteins 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- 244000215747 Pachyrhizus erosus Species 0.000 description 1
- 241001608568 Phaedon Species 0.000 description 1
- 241001608567 Phaedon cochleariae Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 241000238680 Rhipicephalus microplus Species 0.000 description 1
- 241001261167 Tegenaria domestica Species 0.000 description 1
- 241001454293 Tetranychus urticae Species 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 230000002528 anti-freeze Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- XQUXKZZNEFRCAW-UHFFFAOYSA-N fenpropathrin Chemical compound CC1(C)C(C)(C)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 XQUXKZZNEFRCAW-UHFFFAOYSA-N 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 235000021552 granulated sugar Nutrition 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000008268 mayonnaise Substances 0.000 description 1
- 235000010746 mayonnaise Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229920002113 octoxynol Polymers 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 239000013008 thixotropic agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/36—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids
- A01N37/38—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids having at least one oxygen or sulfur atom attached to an aromatic ring system
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB10070/75A GB1533854A (en) | 1975-03-11 | 1975-03-11 | Benzyl thioamides and their use as pesticides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE42653L IE42653L (en) | 1976-09-11 |
| IE42653B1 true IE42653B1 (en) | 1980-09-24 |
Family
ID=9960894
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE486/76A IE42653B1 (en) | 1975-03-11 | 1976-03-09 | Benzyl thioamides and their use as pesticides |
Country Status (23)
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ184242A (en) * | 1976-06-16 | 1979-12-11 | Ici Ltd | Carboxamido esters |
| GB1597487A (en) * | 1977-03-31 | 1981-09-09 | Shell Int Research | Pesticidal cyclopropane carboxylates |
| GB2035301B (en) * | 1978-10-13 | 1982-12-08 | Shell Int Research | 2-bromobenzyl esters of alkenyl cyclopropane carboxylic acids and their use as pesticides |
| US4335118A (en) * | 1979-10-17 | 1982-06-15 | Ciba-Geigy Corporation | Insecticidal α-cyano-3-phenoxy-benzyl-2-(4-azidophenyl)-3-methylbutyrates |
| US4503073A (en) * | 1981-01-07 | 1985-03-05 | A. H. Robins Company, Incorporated | 2-Amino-3-(alkylthiobenzoyl)-phenylacetic acids |
| FR2491466A1 (fr) * | 1981-03-04 | 1982-04-09 | Roussel Uclaf | Alcools comportant un groupement thioamido et un procede de preparation |
-
1975
- 1975-03-11 GB GB10070/75A patent/GB1533854A/en not_active Expired
-
1976
- 1976-02-23 CA CA246,365A patent/CA1078404A/en not_active Expired
- 1976-03-03 ES ES445906A patent/ES445906A1/es not_active Expired
- 1976-03-08 IT IT20972/76A patent/IT1062441B/it active
- 1976-03-09 BR BR7601401A patent/BR7601401A/pt unknown
- 1976-03-09 DE DE19762609704 patent/DE2609704A1/de not_active Withdrawn
- 1976-03-09 FR FR7606671A patent/FR2303796A1/fr active Granted
- 1976-03-09 IL IL49182A patent/IL49182A/xx unknown
- 1976-03-09 CH CH290476A patent/CH616311A5/de not_active IP Right Cessation
- 1976-03-09 BE BE164990A patent/BE839360A/xx not_active IP Right Cessation
- 1976-03-09 HU HU76SE1823A patent/HU176427B/hu unknown
- 1976-03-09 AR AR262489A patent/AR216897A1/es active
- 1976-03-09 TR TR19034A patent/TR19034A/xx unknown
- 1976-03-09 ZA ZA761466A patent/ZA761466B/xx unknown
- 1976-03-09 US US05/665,220 patent/US4045575A/en not_active Expired - Lifetime
- 1976-03-09 DK DK100076A patent/DK144333C/da not_active IP Right Cessation
- 1976-03-09 LU LU74510A patent/LU74510A1/xx unknown
- 1976-03-09 OA OA55758A patent/OA05264A/xx unknown
- 1976-03-09 SU SU762331674A patent/SU700041A3/ru active
- 1976-03-09 EG EG76142A patent/EG12378A/xx active
- 1976-03-09 IE IE486/76A patent/IE42653B1/en unknown
- 1976-03-09 JP JP51024719A patent/JPS51115442A/ja active Pending
- 1976-03-10 NL NL7602487A patent/NL7602487A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| SU700041A3 (ru) | 1979-11-25 |
| DK144333C (da) | 1982-07-19 |
| US4045575A (en) | 1977-08-30 |
| IE42653L (en) | 1976-09-11 |
| EG12378A (en) | 1978-12-31 |
| TR19034A (tr) | 1978-03-16 |
| CH616311A5 (US20110009641A1-20110113-C00160.png) | 1980-03-31 |
| DK144333B (da) | 1982-02-22 |
| CA1078404A (en) | 1980-05-27 |
| IL49182A0 (en) | 1976-05-31 |
| FR2303796B1 (US20110009641A1-20110113-C00160.png) | 1978-05-19 |
| ES445906A1 (es) | 1977-10-01 |
| FR2303796A1 (fr) | 1976-10-08 |
| JPS51115442A (en) | 1976-10-12 |
| IL49182A (en) | 1978-10-31 |
| BE839360A (fr) | 1976-09-09 |
| IT1062441B (it) | 1984-10-10 |
| HU176427B (en) | 1981-02-28 |
| DK100076A (da) | 1976-09-12 |
| BR7601401A (pt) | 1976-09-14 |
| AR216897A1 (es) | 1980-02-15 |
| GB1533854A (en) | 1978-11-29 |
| NL7602487A (nl) | 1976-09-14 |
| ZA761466B (en) | 1977-03-30 |
| DE2609704A1 (de) | 1976-09-23 |
| LU74510A1 (US20110009641A1-20110113-C00160.png) | 1977-01-10 |
| OA05264A (fr) | 1981-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1087208A (en) | Substituted benzyl ethers and thioethers | |
| US4042710A (en) | Alpha-cyano-phenoxybenzyl-isovalerates | |
| EP0335519A1 (en) | Insecticides | |
| US2786009A (en) | Insecticidal compositions comprising carbonyl bisdithiophosphate compounds and method of applying the same | |
| IE42653B1 (en) | Benzyl thioamides and their use as pesticides | |
| US3950535A (en) | Cyanobenzyl cyclopropane carboxylates | |
| US4297496A (en) | Nitrimine derivatives | |
| EP0034823B1 (en) | Pesticidal amines, preparation and use | |
| EP0117577B1 (en) | Pesticidal nitromethylene derivative | |
| GB2073172A (en) | Pesticidal Pyrazole Derivatives | |
| HU184822B (en) | Insecticide and nematocide compositions containing asymmetric thiophosphonates | |
| EP0019294B1 (en) | N,n'diacyl-ethane-1,2 diamines, their preparation and their pesticidal formulations | |
| US4096275A (en) | Thioamide pesticides | |
| US3973035A (en) | Cyanobenzyl cyclopropane carboxylate pesticides | |
| US3993774A (en) | Pesticidal cyclopropane derivatives | |
| US4188400A (en) | Furylmethyloxime ethers | |
| EP0373775A2 (en) | Insecticides | |
| US4100363A (en) | 2-Substituted isovaleric acid ester pesticides | |
| US4175134A (en) | Phenoxybenzyl ester pesticides | |
| US3784554A (en) | Pesticidal phosphorylated thiazole derivatives | |
| US4529726A (en) | Pesticidal nitromethylene derivatives | |
| US7399757B1 (en) | Pesticidal diazene oxide carboxylates | |
| US4016278A (en) | Pesticidal carbamates | |
| CA1219864A (en) | Pesticidal nitromethane derivatives | |
| US4021466A (en) | Cyclopropane carboxylates |