GB655585A - Improvements in or relating to methods for producing propellent charges for rockets and the like - Google Patents
Improvements in or relating to methods for producing propellent charges for rockets and the likeInfo
- Publication number
- GB655585A GB655585A GB22977/48A GB2297748A GB655585A GB 655585 A GB655585 A GB 655585A GB 22977/48 A GB22977/48 A GB 22977/48A GB 2297748 A GB2297748 A GB 2297748A GB 655585 A GB655585 A GB 655585A
- Authority
- GB
- United Kingdom
- Prior art keywords
- organic material
- rockets
- mixtures
- active component
- relating
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 235000015842 Hesperis Nutrition 0.000 title abstract 2
- 235000012633 Iberis amara Nutrition 0.000 title abstract 2
- 239000000203 mixture Substances 0.000 abstract 3
- 239000011368 organic material Substances 0.000 abstract 3
- 239000010426 asphalt Substances 0.000 abstract 2
- 229920001187 thermosetting polymer Polymers 0.000 abstract 2
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 abstract 1
- SPSSULHKWOKEEL-UHFFFAOYSA-N 2,4,6-trinitrotoluene Chemical group CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O SPSSULHKWOKEEL-UHFFFAOYSA-N 0.000 abstract 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 abstract 1
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 abstract 1
- 239000004793 Polystyrene Substances 0.000 abstract 1
- 229920001807 Urea-formaldehyde Polymers 0.000 abstract 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 abstract 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 abstract 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 abstract 1
- 239000005018 casein Substances 0.000 abstract 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 abstract 1
- 235000021240 caseins Nutrition 0.000 abstract 1
- 229920002678 cellulose Polymers 0.000 abstract 1
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 abstract 1
- 229920001971 elastomer Polymers 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- 125000005395 methacrylic acid group Chemical class 0.000 abstract 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 abstract 1
- 229920001568 phenolic resin Polymers 0.000 abstract 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 abstract 1
- 239000011295 pitch Substances 0.000 abstract 1
- 229920002223 polystyrene Polymers 0.000 abstract 1
- 229920002689 polyvinyl acetate Polymers 0.000 abstract 1
- 239000011118 polyvinyl acetate Substances 0.000 abstract 1
- 229910001487 potassium perchlorate Inorganic materials 0.000 abstract 1
- 229920005989 resin Polymers 0.000 abstract 1
- 239000011347 resin Substances 0.000 abstract 1
- 239000005060 rubber Substances 0.000 abstract 1
- 229920003002 synthetic resin Polymers 0.000 abstract 1
- 239000000057 synthetic resin Substances 0.000 abstract 1
- 229920001169 thermoplastic Polymers 0.000 abstract 1
- 239000004416 thermosoftening plastic Substances 0.000 abstract 1
- 229920002554 vinyl polymer Polymers 0.000 abstract 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B29—WORKING OF PLASTICS; WORKING OF SUBSTANCES IN A PLASTIC STATE IN GENERAL
- B29B—PREPARATION OR PRETREATMENT OF THE MATERIAL TO BE SHAPED; MAKING GRANULES OR PREFORMS; RECOVERY OF PLASTICS OR OTHER CONSTITUENTS OF WASTE MATERIAL CONTAINING PLASTICS
- B29B7/00—Mixing; Kneading
- B29B7/80—Component parts, details or accessories; Auxiliary operations
- B29B7/88—Adding charges, i.e. additives
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B21/00—Apparatus or methods for working-up explosives, e.g. forming, cutting, drying
- C06B21/0033—Shaping the mixture
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B21/00—Apparatus or methods for working-up explosives, e.g. forming, cutting, drying
- C06B21/0033—Shaping the mixture
- C06B21/0041—Shaping the mixture by compression
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B21/00—Apparatus or methods for working-up explosives, e.g. forming, cutting, drying
- C06B21/0033—Shaping the mixture
- C06B21/0075—Shaping the mixture by extrusion
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B45/00—Compositions or products which are defined by structure or arrangement of component of product
- C06B45/04—Compositions or products which are defined by structure or arrangement of component of product comprising solid particles dispersed in solid solution or matrix not used for explosives where the matrix consists essentially of nitrated carbohydrates or a low molecular organic explosive
- C06B45/06—Compositions or products which are defined by structure or arrangement of component of product comprising solid particles dispersed in solid solution or matrix not used for explosives where the matrix consists essentially of nitrated carbohydrates or a low molecular organic explosive the solid solution or matrix containing an organic component
- C06B45/10—Compositions or products which are defined by structure or arrangement of component of product comprising solid particles dispersed in solid solution or matrix not used for explosives where the matrix consists essentially of nitrated carbohydrates or a low molecular organic explosive the solid solution or matrix containing an organic component the organic component containing a resin
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dispersion Chemistry (AREA)
- Molecular Biology (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Casting Or Compression Moulding Of Plastics Or The Like (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE901247A SE134189C1 (forum.php) | 1947-09-29 | 1947-09-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB655585A true GB655585A (en) | 1951-07-25 |
Family
ID=91465556
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB22977/48A Expired GB655585A (en) | 1947-09-29 | 1948-08-31 | Improvements in or relating to methods for producing propellent charges for rockets and the like |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US2622277A (forum.php) |
| BE (1) | BE484962A (forum.php) |
| CH (1) | CH276423A (forum.php) |
| DK (1) | DK76379C (forum.php) |
| FR (1) | FR970950A (forum.php) |
| GB (1) | GB655585A (forum.php) |
| NL (1) | NL70017C (forum.php) |
| SE (1) | SE134189C1 (forum.php) |
Cited By (70)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2926386A (en) * | 1955-03-07 | 1960-03-01 | Phillips Petroleum Co | Manufacture of propellants |
| US2926613A (en) * | 1955-05-23 | 1960-03-01 | Phillips Petroleum Co | Composite rocket-ram jet fuel |
| US2931437A (en) * | 1956-02-23 | 1960-04-05 | Phillips Petroleum Co | Method and apparatus for initiating subterranean combustion |
| US2938780A (en) * | 1955-10-28 | 1960-05-31 | Standard Oil Co | Composition for turbojet starter |
| US2938778A (en) * | 1955-06-21 | 1960-05-31 | Standard Oil Co | Ammonium nitrate gas-generating composition |
| US2939176A (en) * | 1954-12-30 | 1960-06-07 | Phillips Petroleum Co | Molding of propellants |
| US2941352A (en) * | 1960-06-21 | Solid composite propellants with | ||
| US2942963A (en) * | 1955-02-07 | 1960-06-28 | Standard Oil Co | Solid propellant combustion catalyst |
| US2949352A (en) * | 1956-10-01 | 1960-08-16 | North American Aviation Inc | Propellant composition |
| US2952530A (en) * | 1960-09-13 | Method of mixing propellant com- | ||
| DE1092828B (de) * | 1956-10-22 | 1960-11-10 | Hispano Suiza Sa | Verfahren zur Herstellung von komprimierten pyrotechnischen Ladungen |
| US2963356A (en) * | 1956-03-26 | 1960-12-06 | Phillips Petroleum Co | Burning rate catalysts for ammonium nitrate propellants |
| US2965466A (en) * | 1959-04-22 | 1960-12-20 | Hercules Powder Co Ltd | Explosive |
| US2966404A (en) * | 1955-12-12 | 1960-12-27 | Ici Ltd | Mono-propellant charge compositions |
| US2973256A (en) * | 1955-11-08 | 1961-02-28 | Standard Oil Co | Ammonium nitrate solid composite propellant composition |
| DE1101246B (de) * | 1958-09-19 | 1961-03-02 | Boelkow Entwicklungen Kg | Verfahren zur Herstellung von Hochbrisanz-Sprengstoff-Formkoerpern |
| US2982636A (en) * | 1961-05-02 | Rocket fuels containing nitrated | ||
| US2985104A (en) * | 1955-01-03 | 1961-05-23 | Phillips Petroleum Co | Improved cartridge for producing gas |
| US2987388A (en) * | 1961-06-06 | figure | ||
| DE1109578B (de) * | 1960-01-11 | 1961-06-22 | Olin Mathieson | Gaserzeugende und explosionsfaehige Masse |
| US2991166A (en) * | 1955-08-18 | 1961-07-04 | Thiokol Chemical Corp | Propellant and gas producing compositions of elastic gels containing inorganic oxidizing salts |
| US2993769A (en) * | 1958-03-14 | 1961-07-25 | Phillips Petroleum Co | Solid propellant compositions |
| US2994106A (en) * | 1956-05-07 | 1961-08-01 | Phillips Petroleum Co | Molding extrusion process and apparatus |
| US2995430A (en) * | 1961-08-08 | Composite propellant reinforced with | ||
| US2995431A (en) * | 1958-06-20 | 1961-08-08 | Phillips Petroleum Co | Composite ammonium nitrate propellants containing boron |
| US2997375A (en) * | 1953-07-13 | 1961-08-22 | Atlantic Res Corp | Plasticized ammonium perchloratepolyvinyl chloride propellant compositions |
| US3000719A (en) * | 1953-12-08 | 1961-09-19 | Aerojet General Co | Desensitized coated cyclonite and process of preparation |
| US3000713A (en) * | 1953-11-16 | 1961-09-19 | Aerojet General Co | Solid composite propellant containing acrylamide polymers |
| US3000311A (en) * | 1956-11-06 | 1961-09-19 | Standard Oil Co | Igniter for rocket propellant |
| US3000175A (en) * | 1955-05-13 | 1961-09-19 | Aerojet General Co | Burning rate acceleration catalysts for solid propellant compositions |
| US3004840A (en) * | 1957-10-17 | 1961-10-17 | Dow Chemical Co | Solid composite propellants containing polyalkylene oxides |
| US3006744A (en) * | 1956-12-31 | 1961-10-31 | Phillips Petroleum Co | Rubber base solid composite propellant compositions |
| US3009386A (en) * | 1956-10-22 | 1961-11-21 | Hispano Suiza Sa | Methods of preparing compressed explosive charges |
| US3010354A (en) * | 1955-08-15 | 1961-11-28 | Phillips Petroleum Co | Rocket grain and method for restricting same |
| US3012507A (en) * | 1961-12-12 | Shaped- ammonium nitrate propellant | ||
| US3012508A (en) * | 1961-12-12 | Shaped ammonium nitrate propellant grain | ||
| US3012867A (en) * | 1957-09-30 | 1961-12-12 | Standard Oil Co | Solid composite propellant containing ammonia nitrate and glycolic acid polymer |
| US3017260A (en) * | 1958-05-09 | 1962-01-16 | Air Reduction | Solid composite rocket propellants containing poly |
| US3017300A (en) * | 1956-06-21 | 1962-01-16 | Phillips Petroleum Co | Pelleted igniter composition and method of manufacturing same |
| US3018202A (en) * | 1957-08-09 | 1962-01-23 | Phillips Petroleum Co | High impulse propellants |
| US3018203A (en) * | 1958-03-31 | 1962-01-23 | Phillips Petroleum Co | Solid propellant and a process for its preparation |
| US3022149A (en) * | 1957-11-29 | 1962-02-20 | North American Aviation Inc | Process for dispersing solids in polymeric propellent fuel binders |
| US3024143A (en) * | 1958-05-16 | 1962-03-06 | Phillips Petroleum Co | Solid propellant compositions |
| US3024144A (en) * | 1958-12-29 | 1962-03-06 | Phillips Petroleum Co | Solid composite propellants containing diamine dinitrates |
| US3024595A (en) * | 1959-01-07 | 1962-03-13 | Pittsburgh Plate Glass Co | Method of rocket propulsion using liquid ammonia and ammonium perchlorate |
| US3027284A (en) * | 1962-03-27 | Composite propellants containing a | ||
| US3027282A (en) * | 1958-12-29 | 1962-03-27 | Phillips Petroleum Co | Composite propellants containing modifying agents |
| US3031969A (en) * | 1957-10-08 | 1962-05-01 | Phillips Petroleum Co | Adhesive for composite-type propellants |
| US3032449A (en) * | 1954-10-21 | 1962-05-01 | Phillips Petroleum Co | Coated solid rocket propellants with improved ignition characteristics |
| US3044910A (en) * | 1958-06-16 | 1962-07-17 | Phillips Petroleum Co | High burning rate solid propellant |
| US3052577A (en) * | 1958-04-09 | 1962-09-04 | Olin Mathieson | Smoke forming compositions |
| US3056702A (en) * | 1957-08-29 | 1962-10-02 | Standard Oil Co | Ammonium nitrate composition |
| US3072510A (en) * | 1956-07-30 | 1963-01-08 | William M Hutchinson | Pretreatment of solid propellant grains containing ammonium nitrate |
| US3073730A (en) * | 1963-01-15 | Gas-producing compositions | ||
| US3087843A (en) * | 1953-08-10 | 1963-04-30 | Phillips Petroleum Co | Solid propellant compositions |
| US3107186A (en) * | 1953-08-06 | 1963-10-15 | Atlantic Res Corp | Solid polyvinyl chloride propellants containing metal |
| US3109761A (en) * | 1958-04-03 | 1963-11-05 | Phillips Petroleum Co | Easily castable polyurethane propellants containing highly halogenated compounds |
| US3115005A (en) * | 1957-02-28 | 1963-12-24 | John D Clark | Composition for the ignition of rocket monopropellants |
| DE1161506B (de) * | 1960-06-24 | 1964-01-16 | Atlantic Res Corp | Feste Treibmittelmasse |
| US3131100A (en) * | 1957-12-20 | 1964-04-28 | Phillips Petroleum Co | Solid propellants comprising a polyurethane and a copolymer of a conjugated diene |
| US3148096A (en) * | 1958-02-18 | 1964-09-08 | Standard Oil Co | Ammonium nitrate gas generating composition with combustion catalyst |
| US3148229A (en) * | 1953-08-14 | 1964-09-08 | Gen Tire & Rubber Co | Method of making rubber based composite propellant |
| US3151010A (en) * | 1955-02-11 | 1964-09-29 | Phillips Petroleum Co | Method of preparing a solid composite propellant |
| DE1191727B (de) * | 1960-04-20 | 1965-04-22 | Dr Martin Kuehn | Feste Raketentreibstoffe |
| US3246053A (en) * | 1958-01-29 | 1966-04-12 | Exxon Research Engineering Co | Slurry casting process for solid rocket propellants |
| US3249475A (en) * | 1952-07-22 | 1966-05-03 | Joseph S Jorczak | Polybutadiene rocket propellant compositions |
| US3770524A (en) * | 1958-10-22 | 1973-11-06 | Rohm & Haas | Composite propellants containing polymers of trinitratopentaerythrityl acrylate |
| US4099376A (en) * | 1955-06-29 | 1978-07-11 | The B.F. Goodrich Company | Gas generator and solid propellant with a silicon-oxygen compound as a burning rate modifier, and method for making the same |
| US4140562A (en) * | 1952-06-04 | 1979-02-20 | Martin Marietta Corporation | Solid propellant with alginate binder |
| FR2671550A1 (fr) * | 1976-10-06 | 1992-07-17 | Dynamit Nobel Ag | Poudre a charge propulsive exempte de nitrocellulose. |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3069477A (en) * | 1962-12-18 | Preparation of fine hmx | ||
| US3348986A (en) * | 1955-02-04 | 1967-10-24 | Charles W Sauer | Process of preparing plastic coated high explosive particles and articles |
| US3044254A (en) * | 1955-03-14 | 1962-07-17 | Phillips Petroleum Co | Rocket motor |
| US3068641A (en) * | 1955-04-18 | 1962-12-18 | Homer M Fox | Hybrid method of rocket propulsion |
| US3653993A (en) * | 1956-06-12 | 1972-04-04 | Aerojet General Co | Smokeless propellent compositions containing polyester resin |
| US3117044A (en) * | 1957-03-18 | 1964-01-07 | Charles W Sauer | Solid propellant containing organic oxidizers and polymeric fuel |
| US3149009A (en) * | 1957-04-25 | 1964-09-15 | Jr Otho D Ratliff | Solid rocket propellant compositions |
| US3005693A (en) * | 1957-10-29 | 1961-10-24 | Sun Oil Co | Process for preparing rocket fuel containing polymerized olefins and boron |
| GB850336A (en) * | 1957-11-28 | 1960-10-05 | Akira Yamamoto | "propellant compositions" |
| US3282146A (en) * | 1958-03-11 | 1966-11-01 | Walter S Baker | Method of making combustible cartridge cases |
| US2989388A (en) * | 1958-03-17 | 1961-06-20 | Ohio Commw Eng Co | Fuel and propellant composition |
| US2995432A (en) * | 1958-08-04 | 1961-08-08 | Phillips Petroleum Co | Solid composite rubber base propellants containing reinforcing agent of resinous aldehyde condensate |
| US3218206A (en) * | 1958-09-15 | 1965-11-16 | Tenneco Chem | Heat hardened pentaerythritol-acrolein rocket propellant grains and their production |
| US3003310A (en) * | 1958-09-26 | 1961-10-10 | Bar Dal Inc | Combustion process employing irradiated solid polymeric fuels containing oxidizing agents |
| US3513043A (en) * | 1958-11-04 | 1970-05-19 | Phillips Petroleum Co | Composite solid propellants containing a perfluoroethylene resin,metal and a fluoroelastomer |
| US3086895A (en) * | 1958-11-05 | 1963-04-23 | Thiokol Chemical Corp | Solid composite propellant containing acetylenic polyurethane and process of making |
| US3034936A (en) * | 1958-11-14 | 1962-05-15 | American Cyanamid Co | Solid composite propellants containing oxamide dihydrazone |
| US2953446A (en) * | 1958-12-08 | 1960-09-20 | Borne Chemical Company Inc | Solid composite propellants prepared from depolymerized rubber |
| US3027283A (en) * | 1958-12-29 | 1962-03-27 | Phillips Petroleum Co | Solid composite propellant containing halogenated olefin |
| US3062694A (en) * | 1959-05-14 | 1962-11-06 | Phillips Petroleum Co | Propellant extrusion aid |
| US3041216A (en) * | 1959-06-22 | 1962-06-26 | Charles C Bice | Propellant mixing process |
| US3087844A (en) * | 1959-07-24 | 1963-04-30 | Phillips Petroleum Co | Solid composite propellants containing aziridinyl curing agents |
| US3367115A (en) * | 1960-02-08 | 1968-02-06 | Exxon Research Engineering Co | Solid hydrocarbon resin rocket propellants and method of propulsion |
| US3162559A (en) * | 1960-02-19 | 1964-12-22 | Atlantic Res Corp | Polyamide based solid propellants |
| US3419445A (en) * | 1960-07-20 | 1968-12-31 | Susquehanna Corp | Composite propellent compositions containing rounded oxidizer particles of a maximum size of 100 microns |
| US3878003A (en) * | 1960-08-16 | 1975-04-15 | Us Army | Composite double base propellant with HMX oxidizer |
| US3351505A (en) * | 1960-09-01 | 1967-11-07 | Hughes Tool Co | High energy solid propellants containing fluoropolymers and metallic fuels |
| US3092527A (en) * | 1960-10-25 | 1963-06-04 | United Aircraft Corp | Propellant mixing |
| US3106497A (en) * | 1961-01-03 | 1963-10-08 | United Aircraft Corp | Spherical particle oxidizer of lithium perchlorate and ammonium perchlorate and propellant |
| US3171764A (en) * | 1962-03-22 | 1965-03-02 | Gen Precision Inc | Solid propellant |
| US3152027A (en) * | 1962-05-29 | 1964-10-06 | Hercules Powder Co Ltd | Heat-resistant propellants |
| GB1047474A (forum.php) * | 1962-07-02 | |||
| US3380333A (en) * | 1963-10-14 | 1968-04-30 | Intermountain Res And Engineer | System for mixing and pumping slurry explosives |
| US3862865A (en) * | 1971-05-24 | 1975-01-28 | Kilgore Corp | Sparkler composition |
| US4025591A (en) * | 1974-04-15 | 1977-05-24 | Jet Research Center, Inc. | Bonding explosive fillers with anaerobic curing binders |
| CA2389912A1 (en) * | 2001-06-11 | 2002-12-11 | R & D Technology, Inc. | Method and apparatus for introducing colorant or the like to resinous materials |
| US7611550B2 (en) * | 2005-09-15 | 2009-11-03 | The Boeing Company | Slurry fuels and associated methods |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US538618A (en) * | 1895-04-30 | Hudson maxim | ||
| US1765804A (en) * | 1927-05-05 | 1930-06-24 | Frank W Preston | Method of and apparatus for making clay pots |
| US1837770A (en) * | 1928-06-01 | 1931-12-22 | Roessler & Hasslacher Chemical | Process for making electrodes |
| US1894368A (en) * | 1931-04-09 | 1933-01-17 | Henry L Crowley & Company Inc | Method of molding ceramic materials |
| US2371868A (en) * | 1940-09-09 | 1945-03-20 | Berg Herbert | Porous polyvinyl chloride compositions |
| US2383989A (en) * | 1943-08-12 | 1945-09-04 | Du Pont | Apparatus for manufacturing explosives |
| US2417090A (en) * | 1944-01-26 | 1947-03-11 | Olin Ind Inc | Manufacture of propellent explosives |
| US2446062A (en) * | 1945-01-23 | 1948-07-27 | Westinghouse Electric Corp | Manufacture of thorium |
| US2495823A (en) * | 1946-12-02 | 1950-01-31 | Isthmian Metals Inc | Pressing of articles from metal powder |
| US2479727A (en) * | 1947-07-23 | 1949-08-23 | Daniels Farrington | Elimination of fissures with carbon dioxide |
-
1947
- 1947-09-29 SE SE901247A patent/SE134189C1/sv unknown
-
1948
- 1948-08-24 DK DK261048AA patent/DK76379C/da active
- 1948-08-28 US US46706A patent/US2622277A/en not_active Expired - Lifetime
- 1948-08-31 FR FR970950D patent/FR970950A/fr not_active Expired
- 1948-08-31 GB GB22977/48A patent/GB655585A/en not_active Expired
- 1948-09-02 NL NL142150A patent/NL70017C/nl active
- 1948-09-14 CH CH276423D patent/CH276423A/fr unknown
- 1948-09-21 BE BE484962D patent/BE484962A/fr unknown
Cited By (70)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3012508A (en) * | 1961-12-12 | Shaped ammonium nitrate propellant grain | ||
| US2941352A (en) * | 1960-06-21 | Solid composite propellants with | ||
| US2987388A (en) * | 1961-06-06 | figure | ||
| US2982636A (en) * | 1961-05-02 | Rocket fuels containing nitrated | ||
| US2995430A (en) * | 1961-08-08 | Composite propellant reinforced with | ||
| US2952530A (en) * | 1960-09-13 | Method of mixing propellant com- | ||
| US3012507A (en) * | 1961-12-12 | Shaped- ammonium nitrate propellant | ||
| US3027284A (en) * | 1962-03-27 | Composite propellants containing a | ||
| US3073730A (en) * | 1963-01-15 | Gas-producing compositions | ||
| US4140562A (en) * | 1952-06-04 | 1979-02-20 | Martin Marietta Corporation | Solid propellant with alginate binder |
| US3249475A (en) * | 1952-07-22 | 1966-05-03 | Joseph S Jorczak | Polybutadiene rocket propellant compositions |
| US2997375A (en) * | 1953-07-13 | 1961-08-22 | Atlantic Res Corp | Plasticized ammonium perchloratepolyvinyl chloride propellant compositions |
| US3107186A (en) * | 1953-08-06 | 1963-10-15 | Atlantic Res Corp | Solid polyvinyl chloride propellants containing metal |
| US3087843A (en) * | 1953-08-10 | 1963-04-30 | Phillips Petroleum Co | Solid propellant compositions |
| US3148229A (en) * | 1953-08-14 | 1964-09-08 | Gen Tire & Rubber Co | Method of making rubber based composite propellant |
| US3000713A (en) * | 1953-11-16 | 1961-09-19 | Aerojet General Co | Solid composite propellant containing acrylamide polymers |
| US3000719A (en) * | 1953-12-08 | 1961-09-19 | Aerojet General Co | Desensitized coated cyclonite and process of preparation |
| US3032449A (en) * | 1954-10-21 | 1962-05-01 | Phillips Petroleum Co | Coated solid rocket propellants with improved ignition characteristics |
| US2939176A (en) * | 1954-12-30 | 1960-06-07 | Phillips Petroleum Co | Molding of propellants |
| US2985104A (en) * | 1955-01-03 | 1961-05-23 | Phillips Petroleum Co | Improved cartridge for producing gas |
| US2942963A (en) * | 1955-02-07 | 1960-06-28 | Standard Oil Co | Solid propellant combustion catalyst |
| US3151010A (en) * | 1955-02-11 | 1964-09-29 | Phillips Petroleum Co | Method of preparing a solid composite propellant |
| US2926386A (en) * | 1955-03-07 | 1960-03-01 | Phillips Petroleum Co | Manufacture of propellants |
| US3000175A (en) * | 1955-05-13 | 1961-09-19 | Aerojet General Co | Burning rate acceleration catalysts for solid propellant compositions |
| US2926613A (en) * | 1955-05-23 | 1960-03-01 | Phillips Petroleum Co | Composite rocket-ram jet fuel |
| US2938778A (en) * | 1955-06-21 | 1960-05-31 | Standard Oil Co | Ammonium nitrate gas-generating composition |
| US4099376A (en) * | 1955-06-29 | 1978-07-11 | The B.F. Goodrich Company | Gas generator and solid propellant with a silicon-oxygen compound as a burning rate modifier, and method for making the same |
| US3010354A (en) * | 1955-08-15 | 1961-11-28 | Phillips Petroleum Co | Rocket grain and method for restricting same |
| US2991166A (en) * | 1955-08-18 | 1961-07-04 | Thiokol Chemical Corp | Propellant and gas producing compositions of elastic gels containing inorganic oxidizing salts |
| US2938780A (en) * | 1955-10-28 | 1960-05-31 | Standard Oil Co | Composition for turbojet starter |
| US2973256A (en) * | 1955-11-08 | 1961-02-28 | Standard Oil Co | Ammonium nitrate solid composite propellant composition |
| US2966404A (en) * | 1955-12-12 | 1960-12-27 | Ici Ltd | Mono-propellant charge compositions |
| US2931437A (en) * | 1956-02-23 | 1960-04-05 | Phillips Petroleum Co | Method and apparatus for initiating subterranean combustion |
| US2963356A (en) * | 1956-03-26 | 1960-12-06 | Phillips Petroleum Co | Burning rate catalysts for ammonium nitrate propellants |
| US2994106A (en) * | 1956-05-07 | 1961-08-01 | Phillips Petroleum Co | Molding extrusion process and apparatus |
| US3017300A (en) * | 1956-06-21 | 1962-01-16 | Phillips Petroleum Co | Pelleted igniter composition and method of manufacturing same |
| US3072510A (en) * | 1956-07-30 | 1963-01-08 | William M Hutchinson | Pretreatment of solid propellant grains containing ammonium nitrate |
| US2949352A (en) * | 1956-10-01 | 1960-08-16 | North American Aviation Inc | Propellant composition |
| US3009386A (en) * | 1956-10-22 | 1961-11-21 | Hispano Suiza Sa | Methods of preparing compressed explosive charges |
| DE1092828B (de) * | 1956-10-22 | 1960-11-10 | Hispano Suiza Sa | Verfahren zur Herstellung von komprimierten pyrotechnischen Ladungen |
| US3000311A (en) * | 1956-11-06 | 1961-09-19 | Standard Oil Co | Igniter for rocket propellant |
| US3006744A (en) * | 1956-12-31 | 1961-10-31 | Phillips Petroleum Co | Rubber base solid composite propellant compositions |
| US3115005A (en) * | 1957-02-28 | 1963-12-24 | John D Clark | Composition for the ignition of rocket monopropellants |
| US3018202A (en) * | 1957-08-09 | 1962-01-23 | Phillips Petroleum Co | High impulse propellants |
| US3056702A (en) * | 1957-08-29 | 1962-10-02 | Standard Oil Co | Ammonium nitrate composition |
| US3012867A (en) * | 1957-09-30 | 1961-12-12 | Standard Oil Co | Solid composite propellant containing ammonia nitrate and glycolic acid polymer |
| US3031969A (en) * | 1957-10-08 | 1962-05-01 | Phillips Petroleum Co | Adhesive for composite-type propellants |
| US3004840A (en) * | 1957-10-17 | 1961-10-17 | Dow Chemical Co | Solid composite propellants containing polyalkylene oxides |
| US3022149A (en) * | 1957-11-29 | 1962-02-20 | North American Aviation Inc | Process for dispersing solids in polymeric propellent fuel binders |
| US3131100A (en) * | 1957-12-20 | 1964-04-28 | Phillips Petroleum Co | Solid propellants comprising a polyurethane and a copolymer of a conjugated diene |
| US3246053A (en) * | 1958-01-29 | 1966-04-12 | Exxon Research Engineering Co | Slurry casting process for solid rocket propellants |
| US3148096A (en) * | 1958-02-18 | 1964-09-08 | Standard Oil Co | Ammonium nitrate gas generating composition with combustion catalyst |
| US2993769A (en) * | 1958-03-14 | 1961-07-25 | Phillips Petroleum Co | Solid propellant compositions |
| US3018203A (en) * | 1958-03-31 | 1962-01-23 | Phillips Petroleum Co | Solid propellant and a process for its preparation |
| US3109761A (en) * | 1958-04-03 | 1963-11-05 | Phillips Petroleum Co | Easily castable polyurethane propellants containing highly halogenated compounds |
| US3052577A (en) * | 1958-04-09 | 1962-09-04 | Olin Mathieson | Smoke forming compositions |
| US3017260A (en) * | 1958-05-09 | 1962-01-16 | Air Reduction | Solid composite rocket propellants containing poly |
| US3024143A (en) * | 1958-05-16 | 1962-03-06 | Phillips Petroleum Co | Solid propellant compositions |
| US3044910A (en) * | 1958-06-16 | 1962-07-17 | Phillips Petroleum Co | High burning rate solid propellant |
| US2995431A (en) * | 1958-06-20 | 1961-08-08 | Phillips Petroleum Co | Composite ammonium nitrate propellants containing boron |
| DE1101246B (de) * | 1958-09-19 | 1961-03-02 | Boelkow Entwicklungen Kg | Verfahren zur Herstellung von Hochbrisanz-Sprengstoff-Formkoerpern |
| US3770524A (en) * | 1958-10-22 | 1973-11-06 | Rohm & Haas | Composite propellants containing polymers of trinitratopentaerythrityl acrylate |
| US3024144A (en) * | 1958-12-29 | 1962-03-06 | Phillips Petroleum Co | Solid composite propellants containing diamine dinitrates |
| US3027282A (en) * | 1958-12-29 | 1962-03-27 | Phillips Petroleum Co | Composite propellants containing modifying agents |
| US3024595A (en) * | 1959-01-07 | 1962-03-13 | Pittsburgh Plate Glass Co | Method of rocket propulsion using liquid ammonia and ammonium perchlorate |
| US2965466A (en) * | 1959-04-22 | 1960-12-20 | Hercules Powder Co Ltd | Explosive |
| DE1109578B (de) * | 1960-01-11 | 1961-06-22 | Olin Mathieson | Gaserzeugende und explosionsfaehige Masse |
| DE1191727B (de) * | 1960-04-20 | 1965-04-22 | Dr Martin Kuehn | Feste Raketentreibstoffe |
| DE1161506B (de) * | 1960-06-24 | 1964-01-16 | Atlantic Res Corp | Feste Treibmittelmasse |
| FR2671550A1 (fr) * | 1976-10-06 | 1992-07-17 | Dynamit Nobel Ag | Poudre a charge propulsive exempte de nitrocellulose. |
Also Published As
| Publication number | Publication date |
|---|---|
| CH276423A (fr) | 1951-07-15 |
| BE484962A (forum.php) | 1948-10-15 |
| FR970950A (fr) | 1951-01-10 |
| DK76379C (da) | 1953-09-14 |
| NL70017C (nl) | 1952-01-15 |
| US2622277A (en) | 1952-12-23 |
| SE134189C1 (forum.php) | 1952-01-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB655585A (en) | Improvements in or relating to methods for producing propellent charges for rockets and the like | |
| ES389906A1 (es) | Procedimiento de fabricacion de un explosivo compuesto con aglutinante gomoso. | |
| BR7604984A (pt) | Processo para fabricacao de explosivo composito termoestavel explosivo assim obtido,polvora a moldar reticulada,e carregamento explosivo | |
| ES432634A1 (es) | Un metodo de preparacion de una composicion de pintura en polvo. | |
| CA985826A (en) | Process for the production of an elasticized thermoplastic polymer mixture in a pourable powder form | |
| GB602777A (en) | Improvements in or relating to a hand covering and method of making same | |
| NL180220C (nl) | Werkwijze voor het bereiden van een thermohardend harsmengsel alsmede gevormd voortbrengsel bestaande uit een door verhitting van zodanig harsmengsel verkregen gehard produkt. | |
| ATE41434T1 (de) | Verfahren zum herstellen von formteilen durch verpressen von faserigem material unter gleichzeitiger verklebung. | |
| GB1105038A (en) | A continuous process and apparatus for the mixing and gelatinization of nitroglycerine and wet collodion cotton in the manufacture of dynamite | |
| GB1396181A (en) | Bullets | |
| ES266622A1 (es) | Un procedimiento para la preparaciën de superficies de madera y de tableros compuestos de particulas para su acabado | |
| CA851763A (en) | Process for preparing foam materials resistant to pressure and heat from a mixture of bituminous mass with synthetic resins | |
| GB1314769A (en) | Manufacture of bodies from particulate inorganic material | |
| NL159897C (nl) | Werkwijze voor het bekleden van een volledig uitgeharde deklaag van een mengsel van epoxyhars en bitumineus mate- riaal met een bekledingsmengsel van soortgelijke samenstel- ling. | |
| GB1344609A (en) | Pyrotechnic priming compositions | |
| USD189957S (en) | Plastic sheet material | |
| JPS5231419A (en) | Producing method of molding material for automobile having adhesive fi lm of hot-melt type rust-proof | |
| ES345996A1 (es) | Un procedimiento para la preparacion de dihidromircenol y sus esteres. | |
| ES325606A3 (es) | Un metodo para la preparacion de una composicion explosiva de ciclotrimetil-entrinitramina y ciclotetrametil-entetranitramina plastico - ligadas. | |
| CA556533A (en) | Methods of making hollow bodies from fibrous material bonded with heat-hardened resin | |
| JPS5231420A (en) | Producing method of molding material for automobile having adhesive fi lm of hot-melt type rust-proof | |
| CA600761A (en) | Process for the preparation of a moulding material in which a polyamide is mixed with a lubricant | |
| GB1171460A (en) | Sheet Structures of Plastics Material | |
| GB835110A (en) | New and improved apparatus and method for producing gas-generating charges | |
| ES397597A1 (es) | Procedimiento para la fabricacion de hormigon ligero. |