GB1586067A - Detergent composition - Google Patents
Detergent composition Download PDFInfo
- Publication number
- GB1586067A GB1586067A GB4486576A GB4486576A GB1586067A GB 1586067 A GB1586067 A GB 1586067A GB 4486576 A GB4486576 A GB 4486576A GB 4486576 A GB4486576 A GB 4486576A GB 1586067 A GB1586067 A GB 1586067A
- Authority
- GB
- United Kingdom
- Prior art keywords
- composition according
- salt
- composition
- bismuth
- alkali metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 95
- 239000003599 detergent Substances 0.000 title claims description 26
- 150000003839 salts Chemical class 0.000 claims description 41
- -1 alkali metal tripolyphosphate Chemical class 0.000 claims description 21
- 239000000460 chlorine Substances 0.000 claims description 20
- 229910052801 chlorine Inorganic materials 0.000 claims description 20
- 238000004851 dishwashing Methods 0.000 claims description 20
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 19
- 239000002736 nonionic surfactant Substances 0.000 claims description 15
- 229910052797 bismuth Inorganic materials 0.000 claims description 14
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 14
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 10
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- 229910052787 antimony Inorganic materials 0.000 claims description 10
- 239000007844 bleaching agent Substances 0.000 claims description 10
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 9
- 229910001388 sodium aluminate Inorganic materials 0.000 claims description 9
- 239000000243 solution Substances 0.000 claims description 8
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 6
- JHXKRIRFYBPWGE-UHFFFAOYSA-K bismuth chloride Chemical group Cl[Bi](Cl)Cl JHXKRIRFYBPWGE-UHFFFAOYSA-K 0.000 claims description 6
- 238000004140 cleaning Methods 0.000 claims description 6
- KKMOSYLWYLMHAL-UHFFFAOYSA-N 2-bromo-6-nitroaniline Chemical group NC1=C(Br)C=CC=C1[N+]([O-])=O KKMOSYLWYLMHAL-UHFFFAOYSA-N 0.000 claims description 5
- 238000005406 washing Methods 0.000 claims description 5
- 229920000388 Polyphosphate Polymers 0.000 claims description 4
- 229910052910 alkali metal silicate Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 239000001205 polyphosphate Substances 0.000 claims description 4
- 235000011176 polyphosphates Nutrition 0.000 claims description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 3
- 230000002035 prolonged effect Effects 0.000 claims description 3
- 229910000318 alkali metal phosphate Inorganic materials 0.000 claims description 2
- 150000004820 halides Chemical group 0.000 claims description 2
- 239000000463 material Substances 0.000 description 11
- 235000019441 ethanol Nutrition 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 8
- 150000004760 silicates Chemical class 0.000 description 8
- 239000004115 Sodium Silicate Substances 0.000 description 7
- 239000000306 component Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 7
- 229910052911 sodium silicate Inorganic materials 0.000 description 7
- 239000004094 surface-active agent Substances 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 150000001621 bismuth Chemical class 0.000 description 5
- 230000002209 hydrophobic effect Effects 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 229910019142 PO4 Inorganic materials 0.000 description 4
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- 229920001296 polysiloxane Polymers 0.000 description 4
- 235000019795 sodium metasilicate Nutrition 0.000 description 4
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical class [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000001462 antimony Chemical class 0.000 description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 3
- 229910052681 coesite Inorganic materials 0.000 description 3
- 229910052906 cristobalite Inorganic materials 0.000 description 3
- 159000000011 group IA salts Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 229910052682 stishovite Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229910052905 tridymite Inorganic materials 0.000 description 3
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 230000002939 deleterious effect Effects 0.000 description 2
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical class O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical class OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 235000002949 phytic acid Nutrition 0.000 description 2
- 229920005646 polycarboxylate Polymers 0.000 description 2
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000006732 (C1-C15) alkyl group Chemical group 0.000 description 1
- KOASOPOYXXEDOS-UHFFFAOYSA-N 1,3-dichloro-5,5-bis(5-methyl-2-propan-2-ylcyclohexyl)imidazolidine-2,4-dione Chemical class CC(C)C1CCC(C)CC1C1(C2C(CCC(C)C2)C(C)C)C(=O)N(Cl)C(=O)N1Cl KOASOPOYXXEDOS-UHFFFAOYSA-N 0.000 description 1
- QYIGOGBGVKONDY-UHFFFAOYSA-N 1-(2-bromo-5-chlorophenyl)-3-methylpyrazole Chemical compound N1=C(C)C=CN1C1=CC(Cl)=CC=C1Br QYIGOGBGVKONDY-UHFFFAOYSA-N 0.000 description 1
- ZHOPFDMJDRLEHT-UHFFFAOYSA-N 1-carbamoyl-1,3-dichlorourea Chemical compound NC(=O)N(Cl)C(=O)NCl ZHOPFDMJDRLEHT-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- KEPNSIARSTUPGS-UHFFFAOYSA-N 2-n,4-n,6-n-trichloro-1,3,5-triazine-2,4,6-triamine Chemical compound ClNC1=NC(NCl)=NC(NCl)=N1 KEPNSIARSTUPGS-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- HWSISDHAHRVNMT-UHFFFAOYSA-N Bismuth subnitrate Chemical compound O[NH+]([O-])O[Bi](O[N+]([O-])=O)O[N+]([O-])=O HWSISDHAHRVNMT-UHFFFAOYSA-N 0.000 description 1
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical class OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical compound OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 239000004435 Oxo alcohol Substances 0.000 description 1
- IMQLKJBTEOYOSI-UHFFFAOYSA-N Phytic acid Natural products OP(O)(=O)OC1C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C1OP(O)(O)=O IMQLKJBTEOYOSI-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- FAPDDOBMIUGHIN-UHFFFAOYSA-K antimony trichloride Chemical compound Cl[Sb](Cl)Cl FAPDDOBMIUGHIN-UHFFFAOYSA-K 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 229940036348 bismuth carbonate Drugs 0.000 description 1
- YUNBLRBSXYCQGF-UHFFFAOYSA-J bismuth sodium tetranitrite Chemical compound N(=O)[O-].[Bi+3].[Na+].N(=O)[O-].N(=O)[O-].N(=O)[O-] YUNBLRBSXYCQGF-UHFFFAOYSA-J 0.000 description 1
- 229960001482 bismuth subnitrate Drugs 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 150000007973 cyanuric acids Chemical class 0.000 description 1
- PGZIKUPSQINGKT-UHFFFAOYSA-N dialuminum;dioxido(oxo)silane Chemical compound [Al+3].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O.[O-][Si]([O-])=O PGZIKUPSQINGKT-UHFFFAOYSA-N 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- GMZOPRQQINFLPQ-UHFFFAOYSA-H dibismuth;tricarbonate Chemical compound [Bi+3].[Bi+3].[O-]C([O-])=O.[O-]C([O-])=O.[O-]C([O-])=O GMZOPRQQINFLPQ-UHFFFAOYSA-H 0.000 description 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical class NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 229940005740 hexametaphosphate Drugs 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Natural products OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 238000010412 laundry washing Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- LWXVCCOAQYNXNX-UHFFFAOYSA-N lithium hypochlorite Chemical compound [Li+].Cl[O-] LWXVCCOAQYNXNX-UHFFFAOYSA-N 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical class OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- UIXTUDLFNOIGRA-UHFFFAOYSA-N n-carbamoyl-2-chloroacetamide Chemical compound NC(=O)NC(=O)CCl UIXTUDLFNOIGRA-UHFFFAOYSA-N 0.000 description 1
- 229910052605 nesosilicate Inorganic materials 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- UHGIMQLJWRAPLT-UHFFFAOYSA-N octadecyl dihydrogen phosphate Chemical compound CCCCCCCCCCCCCCCCCCOP(O)(O)=O UHGIMQLJWRAPLT-UHFFFAOYSA-N 0.000 description 1
- 150000004762 orthosilicates Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229940068041 phytic acid Drugs 0.000 description 1
- 239000000467 phytic acid Substances 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- PNYYBUOBTVHFDN-UHFFFAOYSA-N sodium bismuthate Chemical compound [Na+].[O-][Bi](=O)=O PNYYBUOBTVHFDN-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 235000011008 sodium phosphates Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- RBWFXUOHBJGAMO-UHFFFAOYSA-N sulfanylidenebismuth Chemical compound [Bi]=S RBWFXUOHBJGAMO-UHFFFAOYSA-N 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- JZBRFIUYUGTUGG-UHFFFAOYSA-J tetrapotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical class [K+].[K+].[K+].[K+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O JZBRFIUYUGTUGG-UHFFFAOYSA-J 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical compound OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 1
- KCYJBQNPOFBNHE-UHFFFAOYSA-K trisodium;hydroxy-(1-hydroxy-1-phosphonatoethyl)phosphinate Chemical compound [Na+].[Na+].[Na+].OP(=O)([O-])C(O)(C)P([O-])([O-])=O KCYJBQNPOFBNHE-UHFFFAOYSA-K 0.000 description 1
- 229910009112 xH2O Inorganic materials 0.000 description 1
- 239000002888 zwitterionic surfactant Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/04—Water-soluble compounds
- C11D3/046—Salts
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/20—Organic compounds containing oxygen
- C11D3/2075—Carboxylic acids-salts thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4486576A GB1586067A (en) | 1976-10-28 | 1976-10-28 | Detergent composition |
| DE19772747602 DE2747602A1 (de) | 1976-10-28 | 1977-10-24 | Reinigungsmittel |
| FR7732333A FR2369337A1 (fr) | 1976-10-28 | 1977-10-26 | Composition deter |
| BE182119A BE860180A (nl) | 1976-10-28 | 1977-10-27 | Werkwijze voor het bereinden van een wasmiddel ten gebruike in vaatwasautomaten |
| IT2906377A IT1143765B (it) | 1976-10-28 | 1977-10-27 | Composizione detergente per lavastoviglie contenente un sale di bismuto o antimonio |
| NL7711867A NL7711867A (nl) | 1976-10-28 | 1977-10-28 | Werkwijze voor het bereiden van een wasmiddel ten gebruike in vaatwasautomaten. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4486576A GB1586067A (en) | 1976-10-28 | 1976-10-28 | Detergent composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1586067A true GB1586067A (en) | 1981-03-18 |
Family
ID=10435044
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB4486576A Expired GB1586067A (en) | 1976-10-28 | 1976-10-28 | Detergent composition |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE860180A (enrdf_load_stackoverflow) |
| DE (1) | DE2747602A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2369337A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1586067A (enrdf_load_stackoverflow) |
| IT (1) | IT1143765B (enrdf_load_stackoverflow) |
| NL (1) | NL7711867A (enrdf_load_stackoverflow) |
Cited By (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3300243A1 (de) * | 1982-01-18 | 1983-09-01 | Colgate-Palmolive Co., 10022 New York, N.Y. | Geschirrwaschmittel auf waessriger basis fuer automatische spuelmaschinen |
| US4908148A (en) * | 1989-02-13 | 1990-03-13 | The Procter & Gamble Company | Rinse additive compositions providing glassware protection comprising insoluble zinc compounds |
| US4933101A (en) * | 1989-02-13 | 1990-06-12 | The Procter & Gamble Company | Liquid automatic dishwashing compositions compounds providing glassware protection |
| GB2297096A (en) * | 1995-01-20 | 1996-07-24 | Procter & Gamble | Bleaching composition. |
| US5786314A (en) * | 1993-11-03 | 1998-07-28 | The Procter & Gamble Company | Control of calcium precipitation in automatic dishwashing |
| US5786315A (en) * | 1993-11-03 | 1998-07-28 | The Procter & Gamble Company | Control of calcium carbonate precipitation in automatic dishwashing |
| US5843877A (en) * | 1995-01-20 | 1998-12-01 | The Procter & Gamble Company | Machine dishwashing compositions containing an oxygen bleach and a bismuth salt to reduce silver tarnishing |
| EP0948593A4 (enrdf_load_stackoverflow) * | 1996-01-11 | 1999-10-13 | ||
| WO2001000766A1 (en) * | 1999-06-25 | 2001-01-04 | Unilever Plc | Dish washing process and compositions relating thereto |
| WO2004106476A1 (en) * | 2003-05-28 | 2004-12-09 | Reckitt Benckiser N.V. | Composition for the protection of glassware in a dishwashing process |
| WO2005037975A1 (en) * | 2003-10-17 | 2005-04-28 | Reckitt Benckiser N.V. | Composition for protection of glassware in dishwashers |
| WO2005037724A1 (en) * | 2003-10-17 | 2005-04-28 | Reckitt Benckiser N.V. | Water-soluble glass composition |
| EP1721962A1 (en) * | 2005-05-11 | 2006-11-15 | Unilever N.V. | Dishwashing composition and process for washing dishes |
| CN100408662C (zh) * | 2003-10-17 | 2008-08-06 | 雷克特本克斯尔荷兰有限公司 | 用于保护餐具洗涤机中的玻璃器皿的组合物 |
| EP2768936B1 (de) | 2011-10-19 | 2017-03-01 | Basf Se | Formulierungen, ihre verwendung als oder zur herstellung von geschirrspülmitteln und ihre herstellung |
| EP3623456A1 (de) * | 2018-09-12 | 2020-03-18 | CLARO Products GmbH | Silberschutzmittel |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1143236A (en) * | 1979-05-17 | 1983-03-22 | Andrew C. Coxon | Process for making detergent compositions |
| CA1121245A (en) * | 1979-05-21 | 1982-04-06 | Michael Curtis | Processing of detergent compositions containing nonionic surfactants |
| GB0815022D0 (en) | 2008-08-16 | 2008-09-24 | Reckitt Benckiser Nv | Composition |
| GB201106408D0 (en) | 2011-04-15 | 2011-06-01 | Revolymer Ltd | Novel composite |
| GB201106409D0 (en) | 2011-04-15 | 2011-06-01 | Revolymer Ltd | Novel composite |
| GB201107885D0 (en) | 2011-05-12 | 2011-06-22 | Reckitt Benckiser Nv | Improved composition |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2425907A (en) * | 1947-08-19 | Method of washing glass surfaces | ||
| US2829103A (en) * | 1956-06-28 | 1958-04-01 | Lever Brothers Ltd | Nontarnishing detergent compositions containing salts of antimony or bismuth |
| US3350318A (en) * | 1964-02-18 | 1967-10-31 | Fmc Corp | Method of producing detergent composition |
| US3696041A (en) * | 1970-05-28 | 1972-10-03 | Colgate Palmolive Co | Dishwashing compositions |
| US3701735A (en) * | 1971-04-12 | 1972-10-31 | Colgate Palmolive Co | Automatic dishwashing compositions |
-
1976
- 1976-10-28 GB GB4486576A patent/GB1586067A/en not_active Expired
-
1977
- 1977-10-24 DE DE19772747602 patent/DE2747602A1/de not_active Withdrawn
- 1977-10-26 FR FR7732333A patent/FR2369337A1/fr active Granted
- 1977-10-27 IT IT2906377A patent/IT1143765B/it active
- 1977-10-27 BE BE182119A patent/BE860180A/xx not_active IP Right Cessation
- 1977-10-28 NL NL7711867A patent/NL7711867A/xx not_active Application Discontinuation
Cited By (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3300243A1 (de) * | 1982-01-18 | 1983-09-01 | Colgate-Palmolive Co., 10022 New York, N.Y. | Geschirrwaschmittel auf waessriger basis fuer automatische spuelmaschinen |
| US4908148A (en) * | 1989-02-13 | 1990-03-13 | The Procter & Gamble Company | Rinse additive compositions providing glassware protection comprising insoluble zinc compounds |
| US4933101A (en) * | 1989-02-13 | 1990-06-12 | The Procter & Gamble Company | Liquid automatic dishwashing compositions compounds providing glassware protection |
| US5786315A (en) * | 1993-11-03 | 1998-07-28 | The Procter & Gamble Company | Control of calcium carbonate precipitation in automatic dishwashing |
| US5786314A (en) * | 1993-11-03 | 1998-07-28 | The Procter & Gamble Company | Control of calcium precipitation in automatic dishwashing |
| US5843877A (en) * | 1995-01-20 | 1998-12-01 | The Procter & Gamble Company | Machine dishwashing compositions containing an oxygen bleach and a bismuth salt to reduce silver tarnishing |
| GB2297096A (en) * | 1995-01-20 | 1996-07-24 | Procter & Gamble | Bleaching composition. |
| EP0948593A4 (enrdf_load_stackoverflow) * | 1996-01-11 | 1999-10-13 | ||
| WO2001000766A1 (en) * | 1999-06-25 | 2001-01-04 | Unilever Plc | Dish washing process and compositions relating thereto |
| EP1961803A1 (en) * | 2003-05-28 | 2008-08-27 | Reckitt Benckiser N.V. | Composition for the protection of glassware in a dishwashing process |
| WO2004106476A1 (en) * | 2003-05-28 | 2004-12-09 | Reckitt Benckiser N.V. | Composition for the protection of glassware in a dishwashing process |
| EP2767580A3 (en) * | 2003-05-28 | 2014-11-05 | Reckitt Benckiser N.V. | Composition for the protection of glassware in a dishwashing process |
| EP2194115A3 (en) * | 2003-05-28 | 2013-10-02 | Reckitt Benckiser N.V. | Composition for the protection of glassware in a dishwashing process |
| CN1795261B (zh) * | 2003-05-28 | 2010-07-07 | 雷克特本克斯尔荷兰有限公司 | 用于在餐具洗涤过程中保护玻璃器皿的组合物 |
| WO2005037975A1 (en) * | 2003-10-17 | 2005-04-28 | Reckitt Benckiser N.V. | Composition for protection of glassware in dishwashers |
| US7741236B2 (en) * | 2003-10-17 | 2010-06-22 | Reckitt Benckiser N.V. | Water-soluble glass composition |
| CN100408662C (zh) * | 2003-10-17 | 2008-08-06 | 雷克特本克斯尔荷兰有限公司 | 用于保护餐具洗涤机中的玻璃器皿的组合物 |
| CN1867521B (zh) * | 2003-10-17 | 2011-01-12 | 雷克特本克斯尔荷兰有限公司 | 水溶性玻璃组合物 |
| WO2005037724A1 (en) * | 2003-10-17 | 2005-04-28 | Reckitt Benckiser N.V. | Water-soluble glass composition |
| EP1721962A1 (en) * | 2005-05-11 | 2006-11-15 | Unilever N.V. | Dishwashing composition and process for washing dishes |
| EP2768936B1 (de) | 2011-10-19 | 2017-03-01 | Basf Se | Formulierungen, ihre verwendung als oder zur herstellung von geschirrspülmitteln und ihre herstellung |
| EP3623456A1 (de) * | 2018-09-12 | 2020-03-18 | CLARO Products GmbH | Silberschutzmittel |
| WO2020053316A1 (de) * | 2018-09-12 | 2020-03-19 | Claro Products Gmbh | Silberschutzmittel |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7711867A (nl) | 1978-05-03 |
| BE860180A (nl) | 1978-04-27 |
| FR2369337A1 (fr) | 1978-05-26 |
| DE2747602A1 (de) | 1978-05-03 |
| IT1143765B (it) | 1986-10-22 |
| FR2369337B1 (enrdf_load_stackoverflow) | 1982-06-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1586067A (en) | Detergent composition | |
| US4219436A (en) | High density, high alkalinity dishwashing detergent tablet | |
| US3816320A (en) | Stable dishwashing compositions containing sodium dichloroisocyanurate dihydrate | |
| US4136045A (en) | Detergent compositions containing ethoxylated nonionic surfactants and silicone containing suds suppressing agents | |
| JP5426519B2 (ja) | 器物洗い用組成物 | |
| CA2085985C (en) | Detersive system containing water soluble film article | |
| EP0046342B1 (en) | Detergent compositions and processes of making thereof | |
| CA1174553A (en) | Rinse aid composition | |
| EP0282215A2 (en) | Automatic dishwasher detergent composition | |
| CA1088839A (en) | Process for preparing detergent compositions | |
| CA1304649C (en) | Solid cast warewashing composition | |
| US5205954A (en) | Automatic dishwasher powder detergent composition | |
| EP0423014B1 (en) | Nonaqueous liquid automatic dishwasher detergent composition containing a dual bleach system | |
| US5164106A (en) | Nonaqueous liquid automatic dishwasher detergent composition containing a dual bleach system | |
| US4436642A (en) | Nonionic surfactants for automatic dishwasher detergents | |
| US3817869A (en) | Dishwasher detergent composition | |
| US4259199A (en) | Alkaline dishwasher detergent | |
| CA2015603A1 (en) | Automatic dishwasher detergent composition containing dual bleach system | |
| GB2164950A (en) | Granular automatic dishwasher detergent compositions | |
| EP0010822B1 (en) | Alkaline dishwasher detergent | |
| CA2031289A1 (en) | Automatic dishwasher powder detergent composition | |
| CA1085697A (en) | Detergent compositions | |
| CA1094909A (en) | Low phosphate content dishwashing detergent | |
| EP1409631A1 (en) | Phosphate suspensions | |
| JPH0633399B2 (ja) | 洗浄剤組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed | ||
| PE20 | Patent expired after termination of 20 years |
Effective date: 19971026 |