GB1562806A - 2-aroly-3-phenylindenes and 2-aroyl-1-phenyl naphthalenes methods for their preparation and their use - Google Patents
2-aroly-3-phenylindenes and 2-aroyl-1-phenyl naphthalenes methods for their preparation and their use Download PDFInfo
- Publication number
- GB1562806A GB1562806A GB44176/76A GB4417676A GB1562806A GB 1562806 A GB1562806 A GB 1562806A GB 44176/76 A GB44176/76 A GB 44176/76A GB 4417676 A GB4417676 A GB 4417676A GB 1562806 A GB1562806 A GB 1562806A
- Authority
- GB
- United Kingdom
- Prior art keywords
- compound
- phenyl
- formula
- hydrogen
- methoxybenzoyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title description 14
- 150000001875 compounds Chemical class 0.000 claims description 91
- -1 bromo, hydroxyl Chemical group 0.000 claims description 65
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 23
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 16
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 10
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 claims description 10
- 241001465754 Metazoa Species 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 6
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 5
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 claims description 4
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 231100000252 nontoxic Toxicity 0.000 claims description 4
- 230000003000 nontoxic effect Effects 0.000 claims description 4
- JFPAZHMKWHOGKS-UHFFFAOYSA-N (4-methoxyphenyl)-(6-methoxy-1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C(CCC1=CC(OC)=CC=C11)=C1C1=CC=CC=C1 JFPAZHMKWHOGKS-UHFFFAOYSA-N 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 239000003153 chemical reaction reagent Substances 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 3
- QJDUDPQVDAASMV-UHFFFAOYSA-M sodium;ethanethiolate Chemical compound [Na+].CC[S-] QJDUDPQVDAASMV-UHFFFAOYSA-M 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- VBKXLXCGRUVRQO-UHFFFAOYSA-N (4-hydroxyphenyl)-(6-hydroxy-1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound C1=CC(O)=CC=C1C(=O)C(CCC1=CC(O)=CC=C11)=C1C1=CC=CC=C1 VBKXLXCGRUVRQO-UHFFFAOYSA-N 0.000 claims description 2
- RJQTVZQAFBFYGW-UHFFFAOYSA-N (4-hydroxyphenyl)-(6-hydroxy-3-phenyl-1h-inden-2-yl)methanone Chemical compound C1=CC(O)=CC=C1C(=O)C1=C(C=2C=CC=CC=2)C2=CC=C(O)C=C2C1 RJQTVZQAFBFYGW-UHFFFAOYSA-N 0.000 claims description 2
- VFBVZFWBELVADP-UHFFFAOYSA-N (4-methoxyphenyl)-(3-phenyl-1h-inden-2-yl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=C(C=2C=CC=CC=2)C2=CC=CC=C2C1 VFBVZFWBELVADP-UHFFFAOYSA-N 0.000 claims description 2
- HKFKOVAPQJBBPD-UHFFFAOYSA-N (4-methoxyphenyl)-(6-methoxy-1-phenylnaphthalen-2-yl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=C(C=C(OC)C=C2)C2=C1C1=CC=CC=C1 HKFKOVAPQJBBPD-UHFFFAOYSA-N 0.000 claims description 2
- 229910015900 BF3 Inorganic materials 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- DGQOCLATAPFASR-UHFFFAOYSA-N tetrahydroxy-1,4-benzoquinone Chemical compound OC1=C(O)C(=O)C(O)=C(O)C1=O DGQOCLATAPFASR-UHFFFAOYSA-N 0.000 claims 1
- 239000002023 wood Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 40
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 16
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- 239000000047 product Substances 0.000 description 13
- KEIFWROAQVVDBN-UHFFFAOYSA-N 1,2-dihydronaphthalene Chemical group C1=CC=C2C=CCCC2=C1 KEIFWROAQVVDBN-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 238000004458 analytical method Methods 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- 230000003509 anti-fertility effect Effects 0.000 description 9
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- 239000003433 contraceptive agent Substances 0.000 description 7
- 125000000586 2-(4-morpholinyl)ethoxy group Chemical group [H]C([H])(O*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 230000035935 pregnancy Effects 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 241000282421 Canidae Species 0.000 description 5
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000003981 vehicle Substances 0.000 description 5
- 125000000872 2-diethylaminoethoxy group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 4
- 125000003635 2-dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 4
- 241000271566 Aves Species 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- CVFWKMJYJPBDPV-UHFFFAOYSA-N (4-methoxyphenyl)-(6-methoxy-3-phenyl-1h-inden-2-yl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=C(C=2C=CC=CC=2)C2=CC=C(OC)C=C2C1 CVFWKMJYJPBDPV-UHFFFAOYSA-N 0.000 description 2
- XHLHPRDBBAGVEG-UHFFFAOYSA-N 1-tetralone Chemical compound C1=CC=C2C(=O)CCCC2=C1 XHLHPRDBBAGVEG-UHFFFAOYSA-N 0.000 description 2
- FRIGLBWVTJAEHM-UHFFFAOYSA-N 3,4-diphenyl-1,2-dihydronaphthalene Chemical class C1CC2=CC=CC=C2C(C=2C=CC=CC=2)=C1C1=CC=CC=C1 FRIGLBWVTJAEHM-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000011449 brick Substances 0.000 description 2
- 238000013375 chromatographic separation Methods 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- BNZYBNYNPXKWCM-UHFFFAOYSA-N phenyl 4-methoxybenzoate Chemical compound C1=CC(OC)=CC=C1C(=O)OC1=CC=CC=C1 BNZYBNYNPXKWCM-UHFFFAOYSA-N 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- RURCGKORRUHWEE-UHFFFAOYSA-N (1-phenyl-3,4-dihydronaphthalen-2-yl)-(4-propan-2-yloxyphenyl)methanone Chemical compound C1=CC(OC(C)C)=CC=C1C(=O)C(CCC1=CC=CC=C11)=C1C1=CC=CC=C1 RURCGKORRUHWEE-UHFFFAOYSA-N 0.000 description 1
- WIHHIHONJKPWLR-UHFFFAOYSA-N (1-phenylnaphthalen-2-yl)-(4-propan-2-yloxyphenyl)methanone Chemical compound C1=CC(OC(C)C)=CC=C1C(=O)C1=CC=C(C=CC=C2)C2=C1C1=CC=CC=C1 WIHHIHONJKPWLR-UHFFFAOYSA-N 0.000 description 1
- POTITPNUWZJACJ-UHFFFAOYSA-N (2-bromophenyl)-(1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound BrC1=CC=CC=C1C(=O)C(CCC1=CC=CC=C11)=C1C1=CC=CC=C1 POTITPNUWZJACJ-UHFFFAOYSA-N 0.000 description 1
- VBRBFYFVOWZDJH-UHFFFAOYSA-N (2-bromophenyl)-(1-phenylnaphthalen-2-yl)methanone Chemical compound BrC1=CC=CC=C1C(=O)C1=CC=C(C=CC=C2)C2=C1C1=CC=CC=C1 VBRBFYFVOWZDJH-UHFFFAOYSA-N 0.000 description 1
- STPHKTYBCUYYHA-UHFFFAOYSA-N (2-bromophenyl)-(3-phenyl-1h-inden-2-yl)methanone Chemical compound BrC1=CC=CC=C1C(=O)C1=C(C=2C=CC=CC=2)C2=CC=CC=C2C1 STPHKTYBCUYYHA-UHFFFAOYSA-N 0.000 description 1
- JYXXVRUCJQKVAP-UHFFFAOYSA-N (2-hydroxyphenyl)-naphthalen-1-ylmethanone Chemical compound OC1=CC=CC=C1C(=O)C1=CC=CC2=CC=CC=C12 JYXXVRUCJQKVAP-UHFFFAOYSA-N 0.000 description 1
- SNHTULUCLCJKDC-UHFFFAOYSA-N (2-methoxyphenyl)-(1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound COC1=CC=CC=C1C(=O)C(CCC1=CC=CC=C11)=C1C1=CC=CC=C1 SNHTULUCLCJKDC-UHFFFAOYSA-N 0.000 description 1
- OLWWVXSVAHNATM-UHFFFAOYSA-N (2-methoxyphenyl)-(1-phenylnaphthalen-2-yl)methanone Chemical compound COC1=CC=CC=C1C(=O)C1=CC=C(C=CC=C2)C2=C1C1=CC=CC=C1 OLWWVXSVAHNATM-UHFFFAOYSA-N 0.000 description 1
- FHYTXIMJVHAGEX-UHFFFAOYSA-N (2-methoxyphenyl)-(3-phenyl-1h-inden-2-yl)methanone Chemical compound COC1=CC=CC=C1C(=O)C1=C(C=2C=CC=CC=2)C2=CC=CC=C2C1 FHYTXIMJVHAGEX-UHFFFAOYSA-N 0.000 description 1
- CVHRTWITDLPMRK-UHFFFAOYSA-N (3-bromophenyl)-naphthalen-1-ylmethanone Chemical compound BrC1=CC=CC(C(=O)C=2C3=CC=CC=C3C=CC=2)=C1 CVHRTWITDLPMRK-UHFFFAOYSA-N 0.000 description 1
- KHEHTUZNXFLNTP-UHFFFAOYSA-N (3-chlorophenyl)-(3-phenyl-1h-inden-2-yl)methanone Chemical compound ClC1=CC=CC(C(=O)C=2CC3=CC=CC=C3C=2C=2C=CC=CC=2)=C1 KHEHTUZNXFLNTP-UHFFFAOYSA-N 0.000 description 1
- TWQQPAFBUZPBJN-UHFFFAOYSA-N (3-cyclopentyloxyphenyl)-(1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound C=1C=CC(OC2CCCC2)=CC=1C(=O)C(CCC1=CC=CC=C11)=C1C1=CC=CC=C1 TWQQPAFBUZPBJN-UHFFFAOYSA-N 0.000 description 1
- COOKUVVOGQBSKT-UHFFFAOYSA-N (3-cyclopentyloxyphenyl)-(1-phenylnaphthalen-2-yl)methanone Chemical compound C=1C=C2C=CC=CC2=C(C=2C=CC=CC=2)C=1C(=O)C(C=1)=CC=CC=1OC1CCCC1 COOKUVVOGQBSKT-UHFFFAOYSA-N 0.000 description 1
- REOPUHOCQYANCA-UHFFFAOYSA-N (3-cyclopentyloxyphenyl)-(3-phenyl-1h-inden-2-yl)methanone Chemical compound C=1C=CC(OC2CCCC2)=CC=1C(=O)C(CC1=CC=CC=C11)=C1C1=CC=CC=C1 REOPUHOCQYANCA-UHFFFAOYSA-N 0.000 description 1
- DWKNVFUUDWGHIA-UHFFFAOYSA-N (3-cyclopentyloxyphenyl)-(6-hydroxy-3-phenyl-1h-inden-2-yl)methanone Chemical compound C1C2=CC(O)=CC=C2C(C=2C=CC=CC=2)=C1C(=O)C(C=1)=CC=CC=1OC1CCCC1 DWKNVFUUDWGHIA-UHFFFAOYSA-N 0.000 description 1
- AOUSMRZUWAUQJI-UHFFFAOYSA-N (3-cyclopentyloxyphenyl)-(7-hydroxy-1-phenylnaphthalen-2-yl)methanone Chemical compound C=1C=CC=CC=1C=1C2=CC(O)=CC=C2C=CC=1C(=O)C(C=1)=CC=CC=1OC1CCCC1 AOUSMRZUWAUQJI-UHFFFAOYSA-N 0.000 description 1
- XSZZMVUWLLSFOJ-UHFFFAOYSA-N (3-ethoxyphenyl)-(1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound CCOC1=CC=CC(C(=O)C=2CCC3=CC=CC=C3C=2C=2C=CC=CC=2)=C1 XSZZMVUWLLSFOJ-UHFFFAOYSA-N 0.000 description 1
- YBTWSFJLDVXDJH-UHFFFAOYSA-N (3-ethoxyphenyl)-(3-phenyl-1h-inden-2-yl)methanone Chemical compound CCOC1=CC=CC(C(=O)C=2CC3=CC=CC=C3C=2C=2C=CC=CC=2)=C1 YBTWSFJLDVXDJH-UHFFFAOYSA-N 0.000 description 1
- RITLIYJHAUOYNX-UHFFFAOYSA-N (3-hydroxyphenyl)-(1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound OC1=CC=CC(C(=O)C=2CCC3=CC=CC=C3C=2C=2C=CC=CC=2)=C1 RITLIYJHAUOYNX-UHFFFAOYSA-N 0.000 description 1
- ZTIZJSNCARSUAH-UHFFFAOYSA-N (3-hydroxyphenyl)-(1-phenylnaphthalen-2-yl)methanone Chemical compound OC1=CC=CC(C(=O)C=2C(=C3C=CC=CC3=CC=2)C=2C=CC=CC=2)=C1 ZTIZJSNCARSUAH-UHFFFAOYSA-N 0.000 description 1
- AHKIAFDCGVTACB-UHFFFAOYSA-N (3-hydroxyphenyl)-(3-phenyl-1h-inden-2-yl)methanone Chemical compound OC1=CC=CC(C(=O)C=2CC3=CC=CC=C3C=2C=2C=CC=CC=2)=C1 AHKIAFDCGVTACB-UHFFFAOYSA-N 0.000 description 1
- PJJMZIDNKIRXFK-UHFFFAOYSA-N (3-methoxyphenyl)-naphthalen-1-ylmethanone Chemical compound COC1=CC=CC(C(=O)C=2C3=CC=CC=C3C=CC=2)=C1 PJJMZIDNKIRXFK-UHFFFAOYSA-N 0.000 description 1
- FODJGTKUNGRYAH-UHFFFAOYSA-N (3-phenyl-1h-inden-2-yl)-(4-propan-2-yloxyphenyl)methanone Chemical compound C1=CC(OC(C)C)=CC=C1C(=O)C1=C(C=2C=CC=CC=2)C2=CC=CC=C2C1 FODJGTKUNGRYAH-UHFFFAOYSA-N 0.000 description 1
- KQRRMBRGOXAVFA-UHFFFAOYSA-N (4-chlorophenyl)-(1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound C1=CC(Cl)=CC=C1C(=O)C(CCC1=CC=CC=C11)=C1C1=CC=CC=C1 KQRRMBRGOXAVFA-UHFFFAOYSA-N 0.000 description 1
- GLZZJTOLZAZCGX-UHFFFAOYSA-N (4-chlorophenyl)-(1-phenylnaphthalen-2-yl)methanone Chemical compound C1=CC(Cl)=CC=C1C(=O)C1=CC=C(C=CC=C2)C2=C1C1=CC=CC=C1 GLZZJTOLZAZCGX-UHFFFAOYSA-N 0.000 description 1
- XZUMSVDKXOELLE-UHFFFAOYSA-N (4-chlorophenyl)-naphthalen-1-ylmethanone Chemical compound C1=CC(Cl)=CC=C1C(=O)C1=CC=CC2=CC=CC=C12 XZUMSVDKXOELLE-UHFFFAOYSA-N 0.000 description 1
- WYJJCYGHOQCWRK-UHFFFAOYSA-N (4-cyclohexyloxyphenyl)-(1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound C=1C=C(OC2CCCCC2)C=CC=1C(=O)C(CCC1=CC=CC=C11)=C1C1=CC=CC=C1 WYJJCYGHOQCWRK-UHFFFAOYSA-N 0.000 description 1
- SLRFJKITKWTLMQ-UHFFFAOYSA-N (4-cyclohexyloxyphenyl)-(1-phenylnaphthalen-2-yl)methanone Chemical compound C=1C=C2C=CC=CC2=C(C=2C=CC=CC=2)C=1C(=O)C(C=C1)=CC=C1OC1CCCCC1 SLRFJKITKWTLMQ-UHFFFAOYSA-N 0.000 description 1
- MCZJVMJFZYWMLN-UHFFFAOYSA-N (4-cyclohexyloxyphenyl)-(3-phenyl-1h-inden-2-yl)methanone Chemical compound C=1C=C(OC2CCCCC2)C=CC=1C(=O)C(CC1=CC=CC=C11)=C1C1=CC=CC=C1 MCZJVMJFZYWMLN-UHFFFAOYSA-N 0.000 description 1
- GNQGBAJIABBHSI-UHFFFAOYSA-N (4-cyclohexyloxyphenyl)-(5-ethoxy-3-phenyl-1h-inden-2-yl)methanone Chemical compound C=1C=CC=CC=1C=1C2=CC(OCC)=CC=C2CC=1C(=O)C(C=C1)=CC=C1OC1CCCCC1 GNQGBAJIABBHSI-UHFFFAOYSA-N 0.000 description 1
- QSFSTMVKGQMSTJ-UHFFFAOYSA-N (4-cyclohexyloxyphenyl)-(6-ethoxy-1-phenylnaphthalen-2-yl)methanone Chemical compound C=1C=C(OC2CCCCC2)C=CC=1C(=O)C=1C=CC2=CC(OCC)=CC=C2C=1C1=CC=CC=C1 QSFSTMVKGQMSTJ-UHFFFAOYSA-N 0.000 description 1
- SDHUBLJKKGJWOM-UHFFFAOYSA-N (4-hydroxyphenyl)-(5-hydroxy-3-phenyl-1h-inden-2-yl)methanone Chemical compound C1=CC(O)=CC=C1C(=O)C1=C(C=2C=CC=CC=2)C2=CC(O)=CC=C2C1 SDHUBLJKKGJWOM-UHFFFAOYSA-N 0.000 description 1
- CLPOERWSGYHPPI-UHFFFAOYSA-N (4-hydroxyphenyl)-(6-hydroxy-1-phenylnaphthalen-2-yl)methanone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=C(C=C(O)C=C2)C2=C1C1=CC=CC=C1 CLPOERWSGYHPPI-UHFFFAOYSA-N 0.000 description 1
- VPURGMWFNZFHNK-UHFFFAOYSA-N (4-hydroxyphenyl)-naphthalen-1-ylmethanone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=CC2=CC=CC=C12 VPURGMWFNZFHNK-UHFFFAOYSA-N 0.000 description 1
- JPKIXBSUNVOPMB-UHFFFAOYSA-N (4-methoxyphenyl)-(7-methoxy-1-phenylnaphthalen-2-yl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=C(C=CC(OC)=C2)C2=C1C1=CC=CC=C1 JPKIXBSUNVOPMB-UHFFFAOYSA-N 0.000 description 1
- NNXQMTKVUIFOIV-UHFFFAOYSA-N (4-methoxyphenyl)-naphthalen-2-ylmethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=C(C=CC=C2)C2=C1 NNXQMTKVUIFOIV-UHFFFAOYSA-N 0.000 description 1
- ZVMPKCGQHUMHSB-UHFFFAOYSA-N (4-pentoxyphenyl)-(1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound C1=CC(OCCCCC)=CC=C1C(=O)C(CCC1=CC=CC=C11)=C1C1=CC=CC=C1 ZVMPKCGQHUMHSB-UHFFFAOYSA-N 0.000 description 1
- RLWYEULVDILHNX-UHFFFAOYSA-N (4-pentoxyphenyl)-(1-phenylnaphthalen-2-yl)methanone Chemical compound C1=CC(OCCCCC)=CC=C1C(=O)C1=CC=C(C=CC=C2)C2=C1C1=CC=CC=C1 RLWYEULVDILHNX-UHFFFAOYSA-N 0.000 description 1
- PMLGJZYJWQYIMX-UHFFFAOYSA-N (4-pentoxyphenyl)-(3-phenyl-1h-inden-2-yl)methanone Chemical compound C1=CC(OCCCCC)=CC=C1C(=O)C1=C(C=2C=CC=CC=2)C2=CC=CC=C2C1 PMLGJZYJWQYIMX-UHFFFAOYSA-N 0.000 description 1
- BFLQMGQSWHDRDU-UHFFFAOYSA-N (5-cyclopentyloxy-3-phenyl-1h-inden-2-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C(CC1=CC=2)=C(C=3C=CC=CC=3)C1=CC=2OC1CCCC1 BFLQMGQSWHDRDU-UHFFFAOYSA-N 0.000 description 1
- GNZVGAGNXFVQPU-UHFFFAOYSA-N (5-ethoxy-3-phenyl-1h-inden-2-yl)-(4-propan-2-yloxyphenyl)methanone Chemical compound C=1C=CC=CC=1C=1C2=CC(OCC)=CC=C2CC=1C(=O)C1=CC=C(OC(C)C)C=C1 GNZVGAGNXFVQPU-UHFFFAOYSA-N 0.000 description 1
- CIGJLTLGASCTOY-UHFFFAOYSA-N (5-ethoxy-3-phenyl-1h-inden-2-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C=1C2=CC(OCC)=CC=C2CC=1C(=O)C1=CC=CC=C1 CIGJLTLGASCTOY-UHFFFAOYSA-N 0.000 description 1
- FBTSWYFFLNHIRZ-UHFFFAOYSA-N (5-hydroxy-3-phenyl-1h-inden-2-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C=1C2=CC(O)=CC=C2CC=1C(=O)C1=CC=CC=C1 FBTSWYFFLNHIRZ-UHFFFAOYSA-N 0.000 description 1
- KSJBPNPTNZZBSU-UHFFFAOYSA-N (6-cyclohexyloxy-3-phenyl-1h-inden-2-yl)-(4-pentoxyphenyl)methanone Chemical compound C1=CC(OCCCCC)=CC=C1C(=O)C(CC1=C2)=C(C=3C=CC=CC=3)C1=CC=C2OC1CCCCC1 KSJBPNPTNZZBSU-UHFFFAOYSA-N 0.000 description 1
- IJKHNHAAYYHIFI-UHFFFAOYSA-N (6-cyclopentyloxy-1-phenylnaphthalen-2-yl)-phenylmethanone Chemical compound C=1C=C2C=C(OC3CCCC3)C=CC2=C(C=2C=CC=CC=2)C=1C(=O)C1=CC=CC=C1 IJKHNHAAYYHIFI-UHFFFAOYSA-N 0.000 description 1
- XTZLKBJJTZMSIG-UHFFFAOYSA-N (6-ethoxy-1-phenylnaphthalen-2-yl)-(4-propan-2-yloxyphenyl)methanone Chemical compound C=1C=C(OC(C)C)C=CC=1C(=O)C=1C=CC2=CC(OCC)=CC=C2C=1C1=CC=CC=C1 XTZLKBJJTZMSIG-UHFFFAOYSA-N 0.000 description 1
- YXAOGJDFBPUECR-UHFFFAOYSA-N (6-ethoxy-1-phenylnaphthalen-2-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C=1C=CC2=CC(OCC)=CC=C2C=1C1=CC=CC=C1 YXAOGJDFBPUECR-UHFFFAOYSA-N 0.000 description 1
- CPWOROVLSVXSKA-UHFFFAOYSA-N (6-hydroxy-1-phenylnaphthalen-2-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C=1C=CC2=CC(O)=CC=C2C=1C1=CC=CC=C1 CPWOROVLSVXSKA-UHFFFAOYSA-N 0.000 description 1
- CCHGMNUKXBEJRL-UHFFFAOYSA-N (6-hydroxy-3-phenyl-1h-inden-2-yl)-phenylmethanone Chemical compound C1C2=CC(O)=CC=C2C(C=2C=CC=CC=2)=C1C(=O)C1=CC=CC=C1 CCHGMNUKXBEJRL-UHFFFAOYSA-N 0.000 description 1
- UJQXQIWLLAHTFL-UHFFFAOYSA-N (6-hydroxy-4-phenyl-1,2-dihydronaphthalen-1-yl)-phenylmethanone Chemical compound C(C1=CC=CC=C1)(=O)C1CC=C(C2=CC(=CC=C12)O)C1=CC=CC=C1 UJQXQIWLLAHTFL-UHFFFAOYSA-N 0.000 description 1
- MIUCFGHHWPEKKI-UHFFFAOYSA-N (6-methoxy-3-phenyl-1h-inden-2-yl)-phenylmethanone Chemical compound C1C2=CC(OC)=CC=C2C(C=2C=CC=CC=2)=C1C(=O)C1=CC=CC=C1 MIUCFGHHWPEKKI-UHFFFAOYSA-N 0.000 description 1
- KCYISNRBBKQKTG-UHFFFAOYSA-N (6-pentoxy-3-phenyl-1h-inden-2-yl)-phenylmethanone Chemical compound C1C2=CC(OCCCCC)=CC=C2C(C=2C=CC=CC=2)=C1C(=O)C1=CC=CC=C1 KCYISNRBBKQKTG-UHFFFAOYSA-N 0.000 description 1
- GISQMVFRZGFERP-UHFFFAOYSA-N (7-cyclohexyloxy-1-phenylnaphthalen-2-yl)-(4-pentoxyphenyl)methanone Chemical compound C1=CC(OCCCCC)=CC=C1C(=O)C1=CC=C(C=CC(OC2CCCCC2)=C2)C2=C1C1=CC=CC=C1 GISQMVFRZGFERP-UHFFFAOYSA-N 0.000 description 1
- UHCVSAHAKFDJPG-UHFFFAOYSA-N (7-ethoxynaphthalen-1-yl)-phenylmethanone Chemical compound C12=CC(OCC)=CC=C2C=CC=C1C(=O)C1=CC=CC=C1 UHCVSAHAKFDJPG-UHFFFAOYSA-N 0.000 description 1
- WLYHLGACLGEQMW-UHFFFAOYSA-N (7-hydroxy-1-phenylnaphthalen-2-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C=1C2=CC(O)=CC=C2C=CC=1C(=O)C1=CC=CC=C1 WLYHLGACLGEQMW-UHFFFAOYSA-N 0.000 description 1
- DJNHHABSXXSVRG-UHFFFAOYSA-N (7-methoxy-1-phenylnaphthalen-2-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C=1C2=CC(OC)=CC=C2C=CC=1C(=O)C1=CC=CC=C1 DJNHHABSXXSVRG-UHFFFAOYSA-N 0.000 description 1
- ZLIUVNDIYUMHSX-UHFFFAOYSA-N (7-methoxynaphthalen-1-yl)-phenylmethanone Chemical compound C12=CC(OC)=CC=C2C=CC=C1C(=O)C1=CC=CC=C1 ZLIUVNDIYUMHSX-UHFFFAOYSA-N 0.000 description 1
- BKEGLTXVXNPMMV-UHFFFAOYSA-N (7-pentoxy-1-phenylnaphthalen-2-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C=1C2=CC(OCCCCC)=CC=C2C=CC=1C(=O)C1=CC=CC=C1 BKEGLTXVXNPMMV-UHFFFAOYSA-N 0.000 description 1
- TVZQDMRKJSXJPZ-UHFFFAOYSA-N 1,2-dihydronaphthalen-1-ol Chemical compound C1=CC=C2C(O)CC=CC2=C1 TVZQDMRKJSXJPZ-UHFFFAOYSA-N 0.000 description 1
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical class C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 1
- JOGFTFKRKDIQEK-UHFFFAOYSA-N 1-propoxynaphthalene Chemical compound C1=CC=C2C(OCCC)=CC=CC2=C1 JOGFTFKRKDIQEK-UHFFFAOYSA-N 0.000 description 1
- PANZFQYXPMCHFD-UHFFFAOYSA-N 2,3-diphenyl-1h-indene Chemical class C12=CC=CC=C2CC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 PANZFQYXPMCHFD-UHFFFAOYSA-N 0.000 description 1
- BJJQJLOZWBZEGA-UHFFFAOYSA-N 3-Methoxybenzenepropanoic acid Chemical compound COC1=CC=CC(CCC(O)=O)=C1 BJJQJLOZWBZEGA-UHFFFAOYSA-N 0.000 description 1
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- QOPRWBRNMPANKN-UHFFFAOYSA-N 5-methoxy-2,3-dihydroinden-1-one Chemical compound COC1=CC=C2C(=O)CCC2=C1 QOPRWBRNMPANKN-UHFFFAOYSA-N 0.000 description 1
- BYFKVUHAZRQWRW-UHFFFAOYSA-N 5-methoxy-2-(4-methoxybenzoyl)-2,3-dihydroinden-1-one Chemical compound C1=CC(OC)=CC=C1C(=O)C1C(=O)C2=CC=C(OC)C=C2C1 BYFKVUHAZRQWRW-UHFFFAOYSA-N 0.000 description 1
- MNALUTYMBUBKNX-UHFFFAOYSA-N 6-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(OC)=CC=C21 MNALUTYMBUBKNX-UHFFFAOYSA-N 0.000 description 1
- QTUANRNBNIECOH-UHFFFAOYSA-N 7,8-dihydronaphthalen-2-ol Chemical class C1=CCCC2=CC(O)=CC=C21 QTUANRNBNIECOH-UHFFFAOYSA-N 0.000 description 1
- OAWCMXCTQPOKQN-UHFFFAOYSA-N 7-methoxy-1,2-dihydronaphthalene Chemical compound C1=CCCC2=CC(OC)=CC=C21 OAWCMXCTQPOKQN-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000272161 Charadriiformes Species 0.000 description 1
- 241000272201 Columbiformes Species 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000287182 Sturnidae Species 0.000 description 1
- 241000962283 Turdus iliacus Species 0.000 description 1
- 241000287436 Turdus merula Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- JOEPJYXRFABAMU-UHFFFAOYSA-N [1-[4-[2-(azepan-1-yl)ethoxy]phenyl]-6-butoxynaphthalen-2-yl]-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C=1C=CC2=CC(OCCCC)=CC=C2C=1C(C=C1)=CC=C1OCCN1CCCCCC1 JOEPJYXRFABAMU-UHFFFAOYSA-N 0.000 description 1
- DDYABCWKCWPBCN-UHFFFAOYSA-N [1-[4-[2-(azepan-1-yl)ethoxy]phenyl]-7-methoxynaphthalen-2-yl]-phenylmethanone Chemical compound C=1C=C(OCCN2CCCCCC2)C=CC=1C=1C2=CC(OC)=CC=C2C=CC=1C(=O)C1=CC=CC=C1 DDYABCWKCWPBCN-UHFFFAOYSA-N 0.000 description 1
- DVRMWVFUZRYTEC-UHFFFAOYSA-N [1-[4-[2-(azepan-1-yl)ethoxy]phenyl]naphthalen-2-yl]-(2-hydroxyphenyl)methanone Chemical compound OC1=CC=CC=C1C(=O)C1=CC=C(C=CC=C2)C2=C1C(C=C1)=CC=C1OCCN1CCCCCC1 DVRMWVFUZRYTEC-UHFFFAOYSA-N 0.000 description 1
- UMAOUICYVPXBMZ-UHFFFAOYSA-N [3-[(2-methylpropan-2-yl)oxy]phenyl]-(1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound CC(C)(C)OC1=CC=CC(C(=O)C=2CCC3=CC=CC=C3C=2C=2C=CC=CC=2)=C1 UMAOUICYVPXBMZ-UHFFFAOYSA-N 0.000 description 1
- KMYRQKRMYZWBSA-UHFFFAOYSA-N [3-[(2-methylpropan-2-yl)oxy]phenyl]-(3-phenyl-1h-inden-2-yl)methanone Chemical compound CC(C)(C)OC1=CC=CC(C(=O)C=2CC3=CC=CC=C3C=2C=2C=CC=CC=2)=C1 KMYRQKRMYZWBSA-UHFFFAOYSA-N 0.000 description 1
- OHOPXAUVAFAKGY-UHFFFAOYSA-N [3-[(2-methylpropan-2-yl)oxy]phenyl]-(3-phenyl-6-propoxy-1h-inden-2-yl)methanone Chemical compound C1C2=CC(OCCC)=CC=C2C(C=2C=CC=CC=2)=C1C(=O)C1=CC=CC(OC(C)(C)C)=C1 OHOPXAUVAFAKGY-UHFFFAOYSA-N 0.000 description 1
- MMDYWADRRWPFAV-UHFFFAOYSA-N [3-[4-[2-(azepan-1-yl)ethoxy]phenyl]-1h-inden-2-yl]-(2-hydroxyphenyl)methanone Chemical compound OC1=CC=CC=C1C(=O)C1=C(C=2C=CC(OCCN3CCCCCC3)=CC=2)C2=CC=CC=C2C1 MMDYWADRRWPFAV-UHFFFAOYSA-N 0.000 description 1
- CFAKGIZRWFSMFQ-UHFFFAOYSA-N [3-[4-[2-(azepan-1-yl)ethoxy]phenyl]-5-butoxy-1h-inden-2-yl]-phenylmethanone Chemical compound C=1C=C(OCCN2CCCCCC2)C=CC=1C=1C2=CC(OCCCC)=CC=C2CC=1C(=O)C1=CC=CC=C1 CFAKGIZRWFSMFQ-UHFFFAOYSA-N 0.000 description 1
- XYTLFFJGJGZQDO-UHFFFAOYSA-N [3-[4-[2-(azepan-1-yl)ethoxy]phenyl]-6-methoxy-1h-inden-2-yl]-phenylmethanone Chemical compound C1C2=CC(OC)=CC=C2C(C=2C=CC(OCCN3CCCCCC3)=CC=2)=C1C(=O)C1=CC=CC=C1 XYTLFFJGJGZQDO-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000005667 attractant Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 229940124558 contraceptive agent Drugs 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000005594 diketone group Chemical group 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- DNJIEGIFACGWOD-UHFFFAOYSA-M ethanethiolate Chemical compound CC[S-] DNJIEGIFACGWOD-UHFFFAOYSA-M 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 210000003754 fetus Anatomy 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002469 indenes Chemical class 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- RBWRWAUAVRMBAC-UHFFFAOYSA-M magnesium;methoxybenzene;bromide Chemical compound [Mg+2].[Br-].COC1=CC=[C-]C=C1 RBWRWAUAVRMBAC-UHFFFAOYSA-M 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- FQLMLKAKODCRNI-UHFFFAOYSA-N phenyl-(1-phenyl-7-propan-2-yloxynaphthalen-2-yl)methanone Chemical compound C=1C=CC=CC=1C=1C2=CC(OC(C)C)=CC=C2C=CC=1C(=O)C1=CC=CC=C1 FQLMLKAKODCRNI-UHFFFAOYSA-N 0.000 description 1
- GWWKBLFPPUSKRQ-UHFFFAOYSA-N phenyl-(3-phenyl-6-propan-2-yloxy-1h-inden-2-yl)methanone Chemical compound C1C2=CC(OC(C)C)=CC=C2C(C=2C=CC=CC=2)=C1C(=O)C1=CC=CC=C1 GWWKBLFPPUSKRQ-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- FRNOGLGSGLTDKL-UHFFFAOYSA-N thulium atom Chemical compound [Tm] FRNOGLGSGLTDKL-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/65—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by splitting-off hydrogen atoms or functional groups; by hydrogenolysis of functional groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/673—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/625,992 US4017546A (en) | 1975-10-28 | 1975-10-28 | Novel antifertility agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1562806A true GB1562806A (en) | 1980-03-19 |
Family
ID=24508497
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB44176/76A Expired GB1562806A (en) | 1975-10-28 | 1976-10-25 | 2-aroly-3-phenylindenes and 2-aroyl-1-phenyl naphthalenes methods for their preparation and their use |
Country Status (31)
| Country | Link |
|---|---|
| US (2) | US4017546A (https=) |
| JP (1) | JPS5253844A (https=) |
| AR (1) | AR221031A1 (https=) |
| AT (1) | AT347443B (https=) |
| AU (1) | AU503883B2 (https=) |
| BE (1) | BE847717A (https=) |
| BG (1) | BG27556A3 (https=) |
| CA (1) | CA1064926A (https=) |
| CH (1) | CH624375A5 (https=) |
| CS (1) | CS234003B2 (https=) |
| DD (1) | DD127462A5 (https=) |
| DE (1) | DE2647906C2 (https=) |
| DK (1) | DK484676A (https=) |
| ES (1) | ES452736A1 (https=) |
| FR (1) | FR2329265A1 (https=) |
| GB (1) | GB1562806A (https=) |
| GR (1) | GR61239B (https=) |
| HU (1) | HU176092B (https=) |
| IE (1) | IE43642B1 (https=) |
| IL (1) | IL50414A (https=) |
| MX (1) | MX4320E (https=) |
| NL (1) | NL7611973A (https=) |
| NZ (1) | NZ182426A (https=) |
| PH (2) | PH13486A (https=) |
| PL (1) | PL106987B1 (https=) |
| PT (1) | PT65754B (https=) |
| RO (1) | RO70754A (https=) |
| SE (1) | SE431086B (https=) |
| SU (1) | SU654164A3 (https=) |
| YU (1) | YU262176A (https=) |
| ZA (1) | ZA766441B (https=) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4400543A (en) * | 1975-10-28 | 1983-08-23 | Eli Lilly And Company | 3-Phenyl-4-benzoyl-1,2-dihydronaphthalenes |
| US4230862A (en) * | 1975-10-28 | 1980-10-28 | Eli Lilly And Company | Antifertility compounds |
| US4323707A (en) * | 1975-10-28 | 1982-04-06 | Eli Lilly And Company | Antifertility compounds |
| US4017546A (en) * | 1975-10-28 | 1977-04-12 | Eli Lilly And Company | Novel antifertility agents |
| US5552401A (en) * | 1995-02-28 | 1996-09-03 | Eli Lilly And Company | 2-benzyl-3-arylbenzothiophenes |
| US6107346A (en) * | 1997-08-11 | 2000-08-22 | Eli Lilly And Company | Methods for treating hyperlipidemia |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2551316A (en) * | 1948-02-20 | 1951-05-01 | Searle & Co | 9-aminoalkyl 9-alkanoyl 9, 10 dihydroanthracenes |
| US3274213A (en) * | 1961-09-05 | 1966-09-20 | Upjohn Co | Alkoxy-substituted 2-phenyl-1-(tertiary-aminoalkoxy)phenyl-3, 4-dihydronaphthalenes |
| US3396169A (en) * | 1966-10-26 | 1968-08-06 | Upjohn Co | Substituted 2-phenyl-1-(tertiary-aminoalkoxy) phenyl-3, 4-dihydronaphthalenes |
| US3862232A (en) * | 1963-07-03 | 1975-01-21 | Upjohn Co | 1-(p-hydroxyphenyl)-2-phenyl-6-(2-diethylaminoethoxy)-3,4-dihydronaphthalene and the salts thereof |
| US3293263A (en) * | 1963-12-09 | 1966-12-20 | Upjohn Co | Diphenylbenzocycloalkenes |
| US3519675A (en) * | 1964-06-01 | 1970-07-07 | Upjohn Co | 1,2-diphenyl-3,4-dihydronaphthalenes and 2,3-diphenylindenes |
| US3320271A (en) * | 1964-06-01 | 1967-05-16 | Upjohn Co | 1, 2-diphenyl-3, 4-dihydronaphthalenes and 2, 3-diphenylindenes |
| US3483293A (en) * | 1967-12-15 | 1969-12-09 | Upjohn Co | Method for controlling birds and rodents |
| US4017546A (en) * | 1975-10-28 | 1977-04-12 | Eli Lilly And Company | Novel antifertility agents |
-
1975
- 1975-10-28 US US05/625,992 patent/US4017546A/en not_active Expired - Lifetime
-
1976
- 1976-09-02 AU AU17407/76A patent/AU503883B2/en not_active Expired
- 1976-09-05 IL IL50414A patent/IL50414A/xx unknown
- 1976-10-20 JP JP51126786A patent/JPS5253844A/ja active Granted
- 1976-10-20 MX MX764987U patent/MX4320E/es unknown
- 1976-10-21 CA CA263,843A patent/CA1064926A/en not_active Expired
- 1976-10-21 NZ NZ182426A patent/NZ182426A/xx unknown
- 1976-10-22 PH PH19041A patent/PH13486A/en unknown
- 1976-10-22 HU HU76EI712A patent/HU176092B/hu unknown
- 1976-10-22 DE DE2647906A patent/DE2647906C2/de not_active Expired
- 1976-10-25 GR GR52002A patent/GR61239B/el unknown
- 1976-10-25 PT PT65754A patent/PT65754B/pt unknown
- 1976-10-25 GB GB44176/76A patent/GB1562806A/en not_active Expired
- 1976-10-26 SU SU762414100A patent/SU654164A3/ru active
- 1976-10-26 RO RO7688225A patent/RO70754A/ro unknown
- 1976-10-26 ES ES452736A patent/ES452736A1/es not_active Expired
- 1976-10-27 IE IE2373/76A patent/IE43642B1/en unknown
- 1976-10-27 ZA ZA00766441A patent/ZA766441B/xx unknown
- 1976-10-27 DK DK484676A patent/DK484676A/da not_active Application Discontinuation
- 1976-10-27 SE SE7611952A patent/SE431086B/xx not_active IP Right Cessation
- 1976-10-27 CH CH1355276A patent/CH624375A5/de not_active IP Right Cessation
- 1976-10-27 YU YU02621/76A patent/YU262176A/xx unknown
- 1976-10-28 BG BG034553A patent/BG27556A3/xx unknown
- 1976-10-28 NL NL7611973A patent/NL7611973A/xx not_active Application Discontinuation
- 1976-10-28 DD DD195509A patent/DD127462A5/xx unknown
- 1976-10-28 FR FR7632512A patent/FR2329265A1/fr active Granted
- 1976-10-28 PL PL1976193327A patent/PL106987B1/pl unknown
- 1976-10-28 CS CS766972A patent/CS234003B2/cs unknown
- 1976-10-28 AR AR265275A patent/AR221031A1/es active
- 1976-10-28 AT AT800676A patent/AT347443B/de not_active IP Right Cessation
- 1976-10-28 BE BE1007723A patent/BE847717A/xx not_active IP Right Cessation
- 1976-11-24 US US05/744,488 patent/US4075223A/en not_active Expired - Lifetime
-
1979
- 1979-09-17 PH PH23040A patent/PH14545A/en unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1090795A (en) | 2-phenyl-3-aroylbenzothiophenes and their 1-oxides | |
| US4230862A (en) | Antifertility compounds | |
| US4075227A (en) | Antifertility compounds | |
| AU8021198A (en) | Non-steroidal (hetero) cyclically substituted acylanilides with mixed gestagen and androgen activity | |
| GB2097788A (en) | Benzothiophene compounds and process for preparing them | |
| US4323707A (en) | Antifertility compounds | |
| GB2047697A (en) | 4-oxo-4h-pyrans | |
| GB1562806A (en) | 2-aroly-3-phenylindenes and 2-aroyl-1-phenyl naphthalenes methods for their preparation and their use | |
| US4400543A (en) | 3-Phenyl-4-benzoyl-1,2-dihydronaphthalenes | |
| CA1078834A (en) | Antifertility compounds | |
| US4219657A (en) | Dibenzothiophenes | |
| US3843664A (en) | Substituted naphtho pyrazoles | |
| KR800000145B1 (ko) | 새로운 항 수정제의 제조방법 | |
| KR800001035B1 (ko) | 새로운 항수정제의 제조방법 | |
| EP0032821B1 (en) | Substituted benzopyranotriazoles | |
| KR800000942B1 (ko) | 아로일-페닐나프탈렌 유도체의 제조방법 | |
| US4179443A (en) | 6-Chloro-1,2,3,4-tetrahydrocarbazole-2-one | |
| US4283404A (en) | Aroylethenylpiperidinobutyrophenone antipsychotic agents | |
| KR800000943B1 (ko) | 아로일-페닐나프탈렌 유도체의 제조방법 | |
| GB2142024A (en) | Terphenyl derivatives | |
| US4234487A (en) | Process of making a carbazole acetic acid | |
| KR800001036B1 (ko) | 새로운 항수정제의 제조방법 | |
| IL23284A (en) | Derivatives of 1,2-diphenyl-3,4-dihydronaphthalenes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |