DK138420B - Analogifremgangsmåde til fremstilling af caroverin-fumarat. - Google Patents
Analogifremgangsmåde til fremstilling af caroverin-fumarat.Info
- Publication number
- DK138420B DK138420B DK220675AA DK220675A DK138420B DK 138420 B DK138420 B DK 138420B DK 220675A A DK220675A A DK 220675AA DK 220675 A DK220675 A DK 220675A DK 138420 B DK138420 B DK 138420B
- Authority
- DK
- Denmark
- Prior art keywords
- caroverin
- fumarate
- preparation
- analogous process
- analogous
- Prior art date
Links
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 title 1
- MSPRUJDUTKRMLM-UHFFFAOYSA-N caroverine Chemical compound O=C1N(CCN(CC)CC)C2=CC=CC=C2N=C1CC1=CC=C(OC)C=C1 MSPRUJDUTKRMLM-UHFFFAOYSA-N 0.000 title 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/44—Benzopyrazines with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH695774A CH592637A5 (enEXAMPLES) | 1974-05-21 | 1974-05-21 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK220675A DK220675A (enEXAMPLES) | 1975-11-22 |
| DK138420B true DK138420B (da) | 1978-09-04 |
| DK138420C DK138420C (enEXAMPLES) | 1978-09-04 |
Family
ID=4317694
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK220675AA DK138420B (da) | 1974-05-21 | 1975-05-20 | Analogifremgangsmåde til fremstilling af caroverin-fumarat. |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS5642599B2 (enEXAMPLES) |
| AT (1) | AT342059B (enEXAMPLES) |
| AU (1) | AU8114475A (enEXAMPLES) |
| BE (1) | BE829085A (enEXAMPLES) |
| CA (1) | CA1037477A (enEXAMPLES) |
| CH (1) | CH592637A5 (enEXAMPLES) |
| DE (1) | DE2521905C2 (enEXAMPLES) |
| DK (1) | DK138420B (enEXAMPLES) |
| ES (1) | ES437774A1 (enEXAMPLES) |
| FR (1) | FR2272087B1 (enEXAMPLES) |
| GB (1) | GB1461558A (enEXAMPLES) |
| NL (1) | NL7505715A (enEXAMPLES) |
| SE (1) | SE414634B (enEXAMPLES) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0032564A1 (de) * | 1979-12-28 | 1981-07-29 | Medichemie Ag | Pharmazeutische Verwendung von Caroverin und/oder Caroverinsalzen sowie Caroverinsalze mit Xanthinderivat-Säureresten und Nicotinsäurerest |
| JPS6115033U (ja) * | 1984-07-04 | 1986-01-28 | 石川島播磨重工業株式会社 | 圧力容器内のガス抜き装置 |
| AT408837B (de) * | 1998-06-19 | 2002-03-25 | Phafag Ag | Verwendung von caroverin und/oder caroverin. hydrochlorid zur herstellung von als antioxidantien wirkenden zusammensetzungen und/oder von neuroregenerativen zusammensetzungen |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1189552B (de) * | 1959-07-03 | 1965-03-25 | Donau Pharmazie Ges M B H | Verfahren zur Herstellung von 2-Oxo-1, 2-dihydrochinoxalinen und von deren Salzen und quaternaeren Ammoniumverbindungen |
| CH513884A (de) * | 1967-10-23 | 1971-10-15 | Donau Pharmazie Gmbh | Verfahren zur Herstellung von Tetrahydro-Chinoxalin-2-onen |
-
1974
- 1974-05-21 CH CH695774A patent/CH592637A5/xx not_active IP Right Cessation
-
1975
- 1975-05-06 GB GB1887475A patent/GB1461558A/en not_active Expired
- 1975-05-13 FR FR7514844A patent/FR2272087B1/fr not_active Expired
- 1975-05-14 SE SE7505555A patent/SE414634B/xx unknown
- 1975-05-14 AU AU81144/75A patent/AU8114475A/en not_active Expired
- 1975-05-14 AT AT368375A patent/AT342059B/de not_active IP Right Cessation
- 1975-05-14 BE BE156363A patent/BE829085A/xx not_active IP Right Cessation
- 1975-05-14 CA CA226,964A patent/CA1037477A/en not_active Expired
- 1975-05-15 NL NL7505715A patent/NL7505715A/xx not_active Application Discontinuation
- 1975-05-16 DE DE2521905A patent/DE2521905C2/de not_active Expired
- 1975-05-19 ES ES437774A patent/ES437774A1/es not_active Expired
- 1975-05-20 DK DK220675AA patent/DK138420B/da not_active IP Right Cessation
- 1975-05-20 JP JP6009775A patent/JPS5642599B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT342059B (de) | 1978-03-10 |
| CA1037477A (en) | 1978-08-29 |
| AU8114475A (en) | 1976-11-18 |
| ATA368375A (de) | 1977-07-15 |
| SE414634B (sv) | 1980-08-11 |
| DE2521905C2 (de) | 1986-06-26 |
| SE7505555L (sv) | 1975-11-24 |
| FR2272087B1 (enEXAMPLES) | 1979-06-22 |
| JPS50160417A (enEXAMPLES) | 1975-12-25 |
| NL7505715A (nl) | 1975-11-25 |
| ES437774A1 (es) | 1977-01-16 |
| DK220675A (enEXAMPLES) | 1975-11-22 |
| JPS5642599B2 (enEXAMPLES) | 1981-10-06 |
| DE2521905A1 (de) | 1975-12-04 |
| DK138420C (enEXAMPLES) | 1978-09-04 |
| FR2272087A1 (enEXAMPLES) | 1975-12-19 |
| GB1461558A (en) | 1977-01-13 |
| BE829085A (fr) | 1975-09-01 |
| CH592637A5 (enEXAMPLES) | 1977-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK138655B (da) | Fremgangsmåde til fremstilling af N-phosphonomethyl-glycin. | |
| DK138800B (da) | Analogifremgangsmåde til fremstilling af 4-aminoquinazolinderivater. | |
| DK135716B (da) | Analogifremgangsmåde til fremstilling af methyl-5-propylthio-2-benzimidazolcarbamat. | |
| DK136075B (da) | Analogifremgangsmåde til fremstilling af 11beta-hydroxy-16-methyl-3-oxo-17alfa-acyloxyandrosta-1,4,15-trien-17beta-carboxylater. | |
| DK136655B (da) | Analogifremgangsmåde til fremstilling af piperazinyliminorifamyciner. | |
| DK135711B (da) | Analogifremgangsmåde til fremstilling af hidtil ukendte, hjerteaktive substituerede fenoxyisopropanolaminer. | |
| DK179675A (da) | Fremgangsmade til fremstilling af 6-amino-5-r3-2,4-diaminopyrimidin-3-oxider | |
| DK137835B (da) | Analogifremgangsmåde til fremstilling af thienothiazinderivater. | |
| DK135796B (da) | Fremgangsmåde til fremstilling af alkyl-tert-alkylethere. | |
| DK139846B (da) | Analogifremgangsmåde til fremstilling af 3-alkoxypyrazin-2-carboxamider. | |
| DK139969B (da) | Analogifremgangsmåde til fremstilling af 1-alkylcarbamoyl-5-fluoruraciler. | |
| DK140012B (da) | Fremgangsmåde til fremstilling af substituerede indoleniner. | |
| DK136656B (da) | Analogifremgangsmåde til fremstilling af substituerede piperazinyliminorifamyciner. | |
| DK390975A (da) | Fremgangsmade til fremstilling af omega-nor-cycloalkyl-13,14-dehydroprostaglandiner | |
| DK135538B (da) | Fremgangsmåde til fremstilling af 17alfa-ethynyl-(5alfa)-2-androsten-17-beta-ol. | |
| DK138227B (da) | Analogifremgangsmåde til fremstilling af substituerede xanthon-2-carboxylsyreforbindelser. | |
| DK140557B (da) | Analogifremgangsmåde til fremstilling af sultiner af 17-hydroxy-3-oxo-17alfa-pregn-4-en-21-sulfinsyrer. | |
| DK136313B (da) | Analogifremgangsmåde til fremstilling af N-substituerede m-trifluormethylbenzylaminer. | |
| DK139682B (da) | Analogifremgangsmåde til fremstilling af eburnameninderivater. | |
| DK138694B (da) | Fremgangsmåde til fremstilling af phenylphosphonothiodichlorid. | |
| DK137646B (da) | Fremgangsmåde til fremstilling af 6-chlor-2-chlormethyl-4-phenylquinazolin-3-oxid. | |
| DK139140B (da) | Fremgangsmåde til fremstilling af dilactonforbindelser. | |
| DK140670B (da) | Analogifremgangsmåde til fremstilling af ergopeptinderivater. | |
| DK137449B (da) | Fremgangsmåde til fremstilling af N,N-diallyldichloracetamid. | |
| DK138420B (da) | Analogifremgangsmåde til fremstilling af caroverin-fumarat. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |