DET0000013MA - - Google Patents
Info
- Publication number
- DET0000013MA DET0000013MA DET0000013MA DE T0000013M A DET0000013M A DE T0000013MA DE T0000013M A DET0000013M A DE T0000013MA
- Authority
- DE
- Germany
- Prior art keywords
- net
- der
- iat
- pinniaasc
- 3pal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 241001122767 Theaceae Species 0.000 description 2
- BHMLFPOTZYRDKA-IRXDYDNUSA-N (2s)-2-[(s)-(2-iodophenoxy)-phenylmethyl]morpholine Chemical compound IC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 BHMLFPOTZYRDKA-IRXDYDNUSA-N 0.000 description 1
- WFKSADNZWSKCRZ-UHFFFAOYSA-N Diethatyl-ethyl Chemical compound CCOC(=O)CN(C(=O)CCl)C1=C(CC)C=CC=C1CC WFKSADNZWSKCRZ-UHFFFAOYSA-N 0.000 description 1
- 101001126084 Homo sapiens Piwi-like protein 2 Proteins 0.000 description 1
- 208000030514 Leukocyte adhesion deficiency type II Diseases 0.000 description 1
- 102100029365 Piwi-like protein 2 Human genes 0.000 description 1
- GYMWQLRSSDFGEQ-ADRAWKNSSA-N [(3e,8r,9s,10r,13s,14s,17r)-13-ethyl-17-ethynyl-3-hydroxyimino-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate;(8r,9s,13s,14s,17r)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthrene-3,17-diol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1.O/N=C/1CC[C@@H]2[C@H]3CC[C@](CC)([C@](CC4)(OC(C)=O)C#C)[C@@H]4[C@@H]3CCC2=C\1 GYMWQLRSSDFGEQ-ADRAWKNSSA-N 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 210000001061 forehead Anatomy 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69006076T2 (de) | Vorrichtung zur Belüftung von Eisenbahnantriebsmotoren und zum Filtern von Zuführluft. | |
| EP3485958A1 (de) | Filterelement | |
| EP0516879A1 (de) | Brennkraftmaschine mit einer Ansaugleitung zur Frischluftansaugung | |
| DET0000013MA (enrdf_load_stackoverflow) | ||
| DE19511158A1 (de) | Ventilatoreinheit für Reinräume | |
| EP0498072A1 (de) | Laborgaswäscher | |
| DE102005024155B4 (de) | Kondensationsanlage | |
| DE2328055A1 (de) | Luefteranordnung fuer den kondensator einer klimaanlage mit kondensatzerstaeubung | |
| DE69303447T2 (de) | Vakuumpumpgerät | |
| EP1005615B1 (de) | Mehrstufige seitenkanalpumpe | |
| DE19916172C2 (de) | Kolben-Nachverdichter | |
| EP1139038B1 (de) | Kälteanlage | |
| DE2557762A1 (de) | Dachluefter fuer waagerechten ausblas | |
| EP0269810A2 (de) | Selbstreinigendes Filter für gasförmige Medien, Verfahren und Ausfuehrung dazu | |
| DE3212313A1 (de) | Oelkasten fuer rotationsvakuumpumpen | |
| DE3910203C2 (enrdf_load_stackoverflow) | ||
| DE1406075U (enrdf_load_stackoverflow) | ||
| EP2878353B1 (de) | Tropfenabscheider | |
| AT47815B (de) | Eisenbahnwagenventilator. | |
| DE1509103A1 (de) | Dachdeckung | |
| DE102006001419A1 (de) | Kühlventilator | |
| DE2347352B2 (de) | Tropfenabscheider | |
| DE267321C (enrdf_load_stackoverflow) | ||
| DE64595C (de) | Entluftungshaube | |
| DE803877C (de) | Selbstentlueftender Heberkopf |