DEF0015533MA - - Google Patents
Info
- Publication number
- DEF0015533MA DEF0015533MA DEF0015533MA DE F0015533M A DEF0015533M A DE F0015533MA DE F0015533M A DEF0015533M A DE F0015533MA
- Authority
- DE
- Germany
- Prior art keywords
- compound
- weight
- parts
- cyanogen chloride
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims description 28
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 12
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 1
- 150000003464 sulfur compounds Chemical class 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 15
- 239000007788 liquid Substances 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 8
- 238000004821 distillation Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 238000009835 boiling Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000006414 CCl Chemical group ClC* 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1353890B1 (de) | Gewinnung von anthracen und carbazol durch schmelzkristallisation | |
| DE69717846T2 (de) | Behandlungsverfahren von laktamen | |
| DEF0015533MA (cs) | ||
| DE2503536B2 (de) | Verfahren zur Gewinnung eines sauren Ammoniumsalzes der 11-Cyanundecansäure | |
| DE944009C (de) | Verfahren zur Herstellung einer Stickstoff enthaltenden, chlorierten Schwefelverbindung der Formel C O N S Cl | |
| DE2057956A1 (de) | Verfahren zur Herstellung von aliphatischen Carbonsaeurechloriden | |
| DE1245967B (de) | Verfahren zur Herstellung von S.S-Diamino-o-chlor-pyrazincarbonsäurealkylestern | |
| DE2558399C3 (de) | Verfahren zur Herstellung von 3,6-Dichlorpicolinsäure | |
| EP0468303A1 (de) | Verfahren zur Gewinnung von Carbonsäuren aus ihren wässrigen Lösungen | |
| CH383398A (de) | Verfahren zur Herstellung von hochgereinigtem Hexamethylendiamin | |
| DE2708388A1 (de) | Verfahren zur herstellung von 4,4'- dihydroxydiphenylsulfon | |
| DE866647C (de) | Verfahren zur Herstellung von sekundaeren 1, 3-Alkendiaminen | |
| DE69117137T2 (de) | 2-Chlorpropionaldehyd-Trimer und Verfahren zur Herstellung davon | |
| AT237582B (de) | Verfahren zur Herstellung von Allylchloriden | |
| DE1914496C3 (de) | Verfahren zur Herstellung von 1,2,5 -Thiadiazolderivaten | |
| DE2141765A1 (de) | 4-chlor-4-thiazolin-2-one und verfahren zu deren herstellung | |
| DE898737C (de) | Verfahren zur Herstellung von Chlormethylmethylaether | |
| AT292660B (de) | Verfahren zur Herstellung von reinem Malonsäuredinitril | |
| DE763930C (de) | Verfahren zur Herstellung von ª‰-Chlorpropionaldehyd | |
| DE1964964C (cs) | ||
| DE1165582B (de) | Verfahren zur Herstellung von endstaendigen ª‡, ª‰-ungesaettigten Acetylenverbindungen | |
| DE2635401C3 (de) | Verfahren zur Herstellung von reinem 4-Aminoindan | |
| DE1290551B (de) | Verfahren zur Herstellung von 3, 4-Dichlorthiacyclopenten-2, 5-dion | |
| DE2451634A1 (de) | Trichloraethyliden-bis(isocyaniddichlorid) | |
| DE2345835A1 (de) | Verfahren zur herstellung von n-acetyl-dl-penicillamin |